Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1 | // Copyright (c) 2013-2017, Matt Godbolt |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 2 | // All rights reserved. |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 3 | // |
| 4 | // Redistribution and use in source and binary forms, with or without |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 5 | // modification, are permitted provided that the following conditions are met: |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 6 | // |
| 7 | // Redistributions of source code must retain the above copyright notice, this |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 8 | // list of conditions and the following disclaimer. |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 9 | // |
| 10 | // Redistributions in binary form must reproduce the above copyright notice, |
| 11 | // this list of conditions and the following disclaimer in the documentation |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 12 | // and/or other materials provided with the distribution. |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 13 | // |
| 14 | // THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" |
| 15 | // AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE |
| 16 | // IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE |
| 17 | // ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE |
| 18 | // LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR |
| 19 | // CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF |
| 20 | // SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS |
| 21 | // INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN |
| 22 | // CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) |
| 23 | // ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 24 | // POSSIBILITY OF SUCH DAMAGE. |
| 25 | |
| 26 | #include "internal/Config.h" |
| 27 | #include "internal/Embedded.h" |
| 28 | #include "internal/HeaderMap.h" |
| 29 | #include "internal/HybiAccept.h" |
| 30 | #include "internal/HybiPacketDecoder.h" |
| 31 | #include "internal/LogStream.h" |
| 32 | #include "internal/PageRequest.h" |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 33 | #include "internal/RaiiFd.h" |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 34 | |
| 35 | #include "md5/md5.h" |
| 36 | |
| 37 | #include "seasocks/Connection.h" |
| 38 | #include "seasocks/Credentials.h" |
| 39 | #include "seasocks/Logger.h" |
| 40 | #include "seasocks/PageHandler.h" |
| 41 | #include "seasocks/Server.h" |
| 42 | #include "seasocks/StringUtil.h" |
| 43 | #include "seasocks/ToString.h" |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 44 | #include "seasocks/ResponseWriter.h" |
| 45 | #include "seasocks/ZlibContext.h" |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 46 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 47 | #include <sys/socket.h> |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 48 | #include <sys/stat.h> |
| 49 | #include <sys/types.h> |
| 50 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 51 | #include <algorithm> |
| 52 | #include <cassert> |
| 53 | #include <cctype> |
| 54 | #include <cerrno> |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 55 | #include <fcntl.h> |
| 56 | #include <fstream> |
| 57 | #include <iostream> |
| 58 | #include <limits> |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 59 | #include <memory> |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 60 | #include <sstream> |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 61 | #include <cstdio> |
| 62 | #include <cstring> |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 63 | #include <unistd.h> |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 64 | #include <byteswap.h> |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 65 | #include <unordered_map> |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 66 | #include <memory> |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 67 | |
| 68 | namespace { |
| 69 | |
| 70 | uint32_t parseWebSocketKey(const std::string& key) { |
| 71 | uint32_t keyNumber = 0; |
| 72 | uint32_t numSpaces = 0; |
| 73 | for (auto c : key) { |
| 74 | if (c >= '0' && c <= '9') { |
| 75 | keyNumber = keyNumber * 10 + c - '0'; |
| 76 | } else if (c == ' ') { |
| 77 | ++numSpaces; |
| 78 | } |
| 79 | } |
| 80 | return numSpaces > 0 ? keyNumber / numSpaces : 0; |
| 81 | } |
| 82 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 83 | char* extractLine(uint8_t*& first, uint8_t* last, char** colon = nullptr) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 84 | for (uint8_t* ptr = first; ptr < last - 1; ++ptr) { |
| 85 | if (ptr[0] == '\r' && ptr[1] == '\n') { |
| 86 | ptr[0] = 0; |
| 87 | uint8_t* result = first; |
| 88 | first = ptr + 2; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 89 | return reinterpret_cast<char*>(result); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 90 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 91 | if (colon && ptr[0] == ':' && *colon == nullptr) { |
| 92 | *colon = reinterpret_cast<char*>(ptr); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 93 | } |
| 94 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 95 | return nullptr; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 96 | } |
| 97 | |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 98 | const std::unordered_map<std::string, std::string> contentTypes = { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 99 | {"txt", "text/plain"}, |
| 100 | {"css", "text/css"}, |
| 101 | {"csv", "text/csv"}, |
| 102 | {"htm", "text/html"}, |
| 103 | {"html", "text/html"}, |
| 104 | {"xml", "text/xml"}, |
| 105 | {"js", "text/javascript"}, // Technically it should be application/javascript (RFC 4329), but IE8 struggles with that |
| 106 | {"xhtml", "application/xhtml+xml"}, |
| 107 | {"json", "application/json"}, |
| 108 | {"pdf", "application/pdf"}, |
| 109 | {"zip", "application/zip"}, |
| 110 | {"tar", "application/x-tar"}, |
| 111 | {"gif", "image/gif"}, |
| 112 | {"jpeg", "image/jpeg"}, |
| 113 | {"jpg", "image/jpeg"}, |
| 114 | {"tiff", "image/tiff"}, |
| 115 | {"tif", "image/tiff"}, |
| 116 | {"png", "image/png"}, |
| 117 | {"svg", "image/svg+xml"}, |
| 118 | {"ico", "image/x-icon"}, |
| 119 | {"swf", "application/x-shockwave-flash"}, |
| 120 | {"mp3", "audio/mpeg"}, |
| 121 | {"wav", "audio/x-wav"}, |
| 122 | {"ttf", "font/ttf"}, |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 123 | }; |
| 124 | |
| 125 | std::string getExt(const std::string& path) { |
| 126 | auto lastDot = path.find_last_of('.'); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 127 | if (lastDot != std::string::npos) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 128 | return path.substr(lastDot + 1); |
| 129 | } |
| 130 | return ""; |
| 131 | } |
| 132 | |
| 133 | const std::string& getContentType(const std::string& path) { |
| 134 | auto it = contentTypes.find(getExt(path)); |
| 135 | if (it != contentTypes.end()) { |
| 136 | return it->second; |
| 137 | } |
| 138 | static const std::string defaultType("text/html"); |
| 139 | return defaultType; |
| 140 | } |
| 141 | |
| 142 | // Cacheability is only set for resources that *REQUIRE* caching for browser support reasons. |
| 143 | // It's off for everything else to save on browser reload headaches during development, at |
| 144 | // least until we support ETags or If-Modified-Since: type checking, which we may never do. |
| 145 | bool isCacheable(const std::string& path) { |
| 146 | std::string extension = getExt(path); |
| 147 | if (extension == "mp3" || extension == "wav") { |
| 148 | return true; |
| 149 | } |
| 150 | return false; |
| 151 | } |
| 152 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 153 | constexpr size_t ReadWriteBufferSize = 16 * 1024; |
| 154 | constexpr size_t MaxWebsocketMessageSize = 16384; |
| 155 | constexpr size_t MaxHeadersSize = 64 * 1024; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 156 | |
| 157 | class PrefixWrapper : public seasocks::Logger { |
| 158 | std::string _prefix; |
| 159 | std::shared_ptr<Logger> _logger; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 160 | |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 161 | public: |
| 162 | PrefixWrapper(const std::string& prefix, std::shared_ptr<Logger> logger) |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 163 | : _prefix(prefix), _logger(logger) { |
| 164 | } |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 165 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 166 | virtual void log(Level level, const char* message) override { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 167 | _logger->log(level, (_prefix + message).c_str()); |
| 168 | } |
| 169 | }; |
| 170 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 171 | bool hasConnectionType(const std::string& connection, const std::string& type) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 172 | for (auto conType : seasocks::split(connection, ',')) { |
| 173 | while (!conType.empty() && isspace(conType[0])) |
| 174 | conType = conType.substr(1); |
| 175 | if (seasocks::caseInsensitiveSame(conType, type)) |
| 176 | return true; |
| 177 | } |
| 178 | return false; |
| 179 | } |
| 180 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 181 | } // namespace |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 182 | |
| 183 | namespace seasocks { |
| 184 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 185 | struct Connection::Writer : ResponseWriter { |
| 186 | Connection* _connection; |
| 187 | explicit Writer(Connection& connection) |
| 188 | : _connection(&connection) { |
| 189 | } |
| 190 | |
| 191 | void detach() { |
| 192 | _connection = nullptr; |
| 193 | } |
| 194 | |
| 195 | void begin(ResponseCode responseCode, TransferEncoding encoding) override { |
| 196 | if (_connection) |
| 197 | _connection->begin(responseCode, encoding); |
| 198 | } |
| 199 | void header(const std::string& header, const std::string& value) override { |
| 200 | if (_connection) |
| 201 | _connection->header(header, value); |
| 202 | } |
| 203 | void payload(const void* data, size_t size, bool flush) override { |
| 204 | if (_connection) |
| 205 | _connection->payload(data, size, flush); |
| 206 | } |
| 207 | void finish(bool keepConnectionOpen) override { |
| 208 | if (_connection) |
| 209 | _connection->finish(keepConnectionOpen); |
| 210 | } |
| 211 | void error(ResponseCode responseCode, const std::string& payload) override { |
| 212 | if (_connection) |
| 213 | _connection->error(responseCode, payload); |
| 214 | } |
| 215 | |
| 216 | bool isActive() const override { |
| 217 | return _connection; |
| 218 | } |
| 219 | }; |
| 220 | |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 221 | Connection::Connection( |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 222 | std::shared_ptr<Logger> logger, |
| 223 | ServerImpl& server, |
| 224 | int fd, |
| 225 | const sockaddr_in& address) |
| 226 | : _logger(std::make_shared<PrefixWrapper>(formatAddress(address) + " : ", logger)), |
| 227 | _server(server), |
| 228 | _fd(fd), |
| 229 | _shutdown(false), |
| 230 | _hadSendError(false), |
| 231 | _closeOnEmpty(false), |
| 232 | _registeredForWriteEvents(false), |
| 233 | _address(address), |
| 234 | _bytesSent(0), |
| 235 | _bytesReceived(0), |
| 236 | _shutdownByUser(false), |
| 237 | _transferEncoding(TransferEncoding::Raw), |
| 238 | _chunk(0u), |
| 239 | _writer(std::make_shared<Writer>(*this)), |
| 240 | _state(State::READING_HEADERS) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 241 | } |
| 242 | |
| 243 | Connection::~Connection() { |
| 244 | _server.checkThread(); |
| 245 | finalise(); |
| 246 | } |
| 247 | |
| 248 | void Connection::close() { |
| 249 | // This is the user-side close requests ONLY! You should Call closeInternal |
| 250 | _shutdownByUser = true; |
| 251 | closeInternal(); |
| 252 | } |
| 253 | |
| 254 | void Connection::closeWhenEmpty() { |
| 255 | if (_outBuf.empty()) { |
| 256 | closeInternal(); |
| 257 | } else { |
| 258 | _closeOnEmpty = true; |
| 259 | } |
| 260 | } |
| 261 | |
| 262 | void Connection::closeInternal() { |
| 263 | // It only actually only calls shutdown on the socket, |
| 264 | // leaving the close of the FD and the cleanup until the destructor runs. |
| 265 | _server.checkThread(); |
| 266 | if (_fd != -1 && !_shutdown && ::shutdown(_fd, SHUT_RDWR) == -1) { |
| 267 | LS_WARNING(_logger, "Unable to shutdown socket : " << getLastError()); |
| 268 | } |
| 269 | _shutdown = true; |
| 270 | } |
| 271 | |
| 272 | |
| 273 | void Connection::finalise() { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 274 | if (_response) { |
| 275 | _response->cancel(); |
| 276 | _response.reset(); |
| 277 | _writer->detach(); |
| 278 | _writer.reset(); |
| 279 | } |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 280 | if (_webSocketHandler) { |
| 281 | _webSocketHandler->onDisconnect(this); |
| 282 | _webSocketHandler.reset(); |
| 283 | } |
| 284 | if (_fd != -1) { |
| 285 | _server.remove(this); |
| 286 | LS_DEBUG(_logger, "Closing socket"); |
| 287 | ::close(_fd); |
| 288 | } |
| 289 | _fd = -1; |
| 290 | } |
| 291 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 292 | ssize_t Connection::safeSend(const void* data, size_t size) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 293 | if (_fd == -1 || _hadSendError || _shutdown) { |
| 294 | // Ignore further writes to the socket, it's already closed or has been shutdown |
| 295 | return -1; |
| 296 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 297 | auto sendResult = ::send(_fd, data, size, MSG_NOSIGNAL); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 298 | if (sendResult == -1) { |
| 299 | if (errno == EAGAIN || errno == EWOULDBLOCK) { |
| 300 | // Treat this as if zero bytes were written. |
| 301 | return 0; |
| 302 | } |
| 303 | LS_WARNING(_logger, "Unable to write to socket : " << getLastError() << " - disabling further writes"); |
| 304 | closeInternal(); |
| 305 | } else { |
| 306 | _bytesSent += sendResult; |
| 307 | } |
| 308 | return sendResult; |
| 309 | } |
| 310 | |
| 311 | bool Connection::write(const void* data, size_t size, bool flushIt) { |
| 312 | if (closed() || _closeOnEmpty) { |
| 313 | return false; |
| 314 | } |
| 315 | if (size) { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 316 | ssize_t bytesSent = 0; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 317 | if (_outBuf.empty() && flushIt) { |
| 318 | // Attempt fast path, send directly. |
| 319 | bytesSent = safeSend(data, size); |
| 320 | if (bytesSent == static_cast<int>(size)) { |
| 321 | // We sent directly. |
| 322 | return true; |
| 323 | } |
| 324 | if (bytesSent == -1) { |
| 325 | return false; |
| 326 | } |
| 327 | } |
| 328 | size_t bytesToBuffer = size - bytesSent; |
| 329 | size_t endOfBuffer = _outBuf.size(); |
| 330 | size_t newBufferSize = endOfBuffer + bytesToBuffer; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 331 | if (newBufferSize >= _server.clientBufferSize()) { |
| 332 | LS_WARNING(_logger, "Closing connection: buffer size too large (" |
| 333 | << newBufferSize << " >= " << _server.clientBufferSize() << ")"); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 334 | closeInternal(); |
| 335 | return false; |
| 336 | } |
| 337 | _outBuf.resize(newBufferSize); |
| 338 | memcpy(&_outBuf[endOfBuffer], reinterpret_cast<const uint8_t*>(data) + bytesSent, bytesToBuffer); |
| 339 | } |
| 340 | if (flushIt) { |
| 341 | return flush(); |
| 342 | } |
| 343 | return true; |
| 344 | } |
| 345 | |
| 346 | bool Connection::bufferLine(const char* line) { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 347 | static const char crlf[] = {'\r', '\n'}; |
| 348 | if (!write(line, strlen(line), false)) |
| 349 | return false; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 350 | return write(crlf, 2, false); |
| 351 | } |
| 352 | |
| 353 | bool Connection::bufferLine(const std::string& line) { |
| 354 | std::string lineAndCrlf = line + "\r\n"; |
| 355 | return write(lineAndCrlf.c_str(), lineAndCrlf.length(), false); |
| 356 | } |
| 357 | |
| 358 | void Connection::handleDataReadyForRead() { |
| 359 | if (closed()) { |
| 360 | return; |
| 361 | } |
| 362 | size_t curSize = _inBuf.size(); |
| 363 | _inBuf.resize(curSize + ReadWriteBufferSize); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 364 | auto result = ::read(_fd, &_inBuf[curSize], ReadWriteBufferSize); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 365 | if (result == -1) { |
| 366 | LS_WARNING(_logger, "Unable to read from socket : " << getLastError()); |
| 367 | return; |
| 368 | } |
| 369 | if (result == 0) { |
| 370 | LS_DEBUG(_logger, "Remote end closed connection"); |
| 371 | closeInternal(); |
| 372 | return; |
| 373 | } |
| 374 | _bytesReceived += result; |
| 375 | _inBuf.resize(curSize + result); |
| 376 | handleNewData(); |
| 377 | } |
| 378 | |
| 379 | void Connection::handleDataReadyForWrite() { |
| 380 | if (closed()) { |
| 381 | return; |
| 382 | } |
| 383 | flush(); |
| 384 | } |
| 385 | |
| 386 | bool Connection::flush() { |
| 387 | if (_outBuf.empty()) { |
| 388 | return true; |
| 389 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 390 | auto numSent = safeSend(&_outBuf[0], _outBuf.size()); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 391 | if (numSent == -1) { |
| 392 | return false; |
| 393 | } |
| 394 | _outBuf.erase(_outBuf.begin(), _outBuf.begin() + numSent); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 395 | if (!_outBuf.empty() && !_registeredForWriteEvents) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 396 | if (!_server.subscribeToWriteEvents(this)) { |
| 397 | return false; |
| 398 | } |
| 399 | _registeredForWriteEvents = true; |
| 400 | } else if (_outBuf.empty() && _registeredForWriteEvents) { |
| 401 | if (!_server.unsubscribeFromWriteEvents(this)) { |
| 402 | return false; |
| 403 | } |
| 404 | _registeredForWriteEvents = false; |
| 405 | } |
| 406 | if (_outBuf.empty() && !closed() && _closeOnEmpty) { |
| 407 | LS_DEBUG(_logger, "Ready for close, now empty"); |
| 408 | closeInternal(); |
| 409 | } |
| 410 | return true; |
| 411 | } |
| 412 | |
| 413 | bool Connection::closed() const { |
| 414 | return _fd == -1 || _shutdown; |
| 415 | } |
| 416 | |
| 417 | void Connection::handleNewData() { |
| 418 | switch (_state) { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 419 | case State::READING_HEADERS: |
| 420 | handleHeaders(); |
| 421 | break; |
| 422 | case State::READING_WEBSOCKET_KEY3: |
| 423 | handleWebSocketKey3(); |
| 424 | break; |
| 425 | case State::HANDLING_HIXIE_WEBSOCKET: |
| 426 | handleHixieWebSocket(); |
| 427 | break; |
| 428 | case State::HANDLING_HYBI_WEBSOCKET: |
| 429 | handleHybiWebSocket(); |
| 430 | break; |
| 431 | case State::BUFFERING_POST_DATA: |
| 432 | handleBufferingPostData(); |
| 433 | break; |
| 434 | case State::AWAITING_RESPONSE_BEGIN: |
| 435 | case State::SENDING_RESPONSE_BODY: |
| 436 | case State::SENDING_RESPONSE_HEADERS: |
| 437 | break; |
| 438 | default: |
| 439 | assert(false); |
| 440 | break; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 441 | } |
| 442 | } |
| 443 | |
| 444 | void Connection::handleHeaders() { |
| 445 | if (_inBuf.size() < 4) { |
| 446 | return; |
| 447 | } |
| 448 | for (size_t i = 0; i <= _inBuf.size() - 4; ++i) { |
| 449 | if (_inBuf[i] == '\r' && |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 450 | _inBuf[i + 1] == '\n' && |
| 451 | _inBuf[i + 2] == '\r' && |
| 452 | _inBuf[i + 3] == '\n') { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 453 | if (!processHeaders(&_inBuf[0], &_inBuf[i + 2])) { |
| 454 | closeInternal(); |
| 455 | return; |
| 456 | } |
| 457 | _inBuf.erase(_inBuf.begin(), _inBuf.begin() + i + 4); |
| 458 | handleNewData(); |
| 459 | return; |
| 460 | } |
| 461 | } |
| 462 | if (_inBuf.size() > MaxHeadersSize) { |
| 463 | sendUnsupportedError("Headers too big"); |
| 464 | } |
| 465 | } |
| 466 | |
| 467 | void Connection::handleWebSocketKey3() { |
| 468 | constexpr auto WebSocketKeyLen = 8u; |
| 469 | if (_inBuf.size() < WebSocketKeyLen) { |
| 470 | return; |
| 471 | } |
| 472 | |
| 473 | struct { |
| 474 | uint32_t key1; |
| 475 | uint32_t key2; |
| 476 | char key3[WebSocketKeyLen]; |
| 477 | } md5Source; |
| 478 | |
| 479 | auto key1 = parseWebSocketKey(_request->getHeader("Sec-WebSocket-Key1")); |
| 480 | auto key2 = parseWebSocketKey(_request->getHeader("Sec-WebSocket-Key2")); |
| 481 | |
| 482 | LS_DEBUG(_logger, "Got a hixie websocket with key1=0x" << std::hex << key1 << ", key2=0x" << key2); |
| 483 | |
| 484 | md5Source.key1 = htonl(key1); |
| 485 | md5Source.key2 = htonl(key2); |
| 486 | memcpy(&md5Source.key3, &_inBuf[0], WebSocketKeyLen); |
| 487 | |
| 488 | uint8_t digest[16]; |
| 489 | md5_state_t md5state; |
| 490 | md5_init(&md5state); |
| 491 | md5_append(&md5state, reinterpret_cast<const uint8_t*>(&md5Source), sizeof(md5Source)); |
| 492 | md5_finish(&md5state, digest); |
| 493 | |
| 494 | LS_DEBUG(_logger, "Attempting websocket upgrade"); |
| 495 | |
| 496 | bufferResponseAndCommonHeaders(ResponseCode::WebSocketProtocolHandshake); |
| 497 | bufferLine("Upgrade: websocket"); |
| 498 | bufferLine("Connection: Upgrade"); |
| 499 | bool allowCrossOrigin = _server.isCrossOriginAllowed(_request->getRequestUri()); |
| 500 | if (_request->hasHeader("Origin") && allowCrossOrigin) { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 501 | bufferLine("Sec-WebSocket-Origin: " + _request->getHeader("Origin")); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 502 | } |
| 503 | if (_request->hasHeader("Host")) { |
| 504 | auto host = _request->getHeader("Host"); |
| 505 | if (!allowCrossOrigin) { |
| 506 | bufferLine("Sec-WebSocket-Origin: http://" + host); |
| 507 | } |
| 508 | bufferLine("Sec-WebSocket-Location: ws://" + host + _request->getRequestUri()); |
| 509 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 510 | pickProtocol(); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 511 | bufferLine(""); |
| 512 | |
| 513 | write(&digest, 16, true); |
| 514 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 515 | _state = State::HANDLING_HIXIE_WEBSOCKET; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 516 | _inBuf.erase(_inBuf.begin(), _inBuf.begin() + 8); |
| 517 | if (_webSocketHandler) { |
| 518 | _webSocketHandler->onConnect(this); |
| 519 | } |
| 520 | } |
| 521 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 522 | void Connection::pickProtocol() { |
| 523 | static std::string protocolHeader = "Sec-WebSocket-Protocol"; |
| 524 | if (!_request->hasHeader(protocolHeader) || !_webSocketHandler) |
| 525 | return; |
| 526 | // Ideally we need o support this header being set multiple times...but the headers don't support that. |
| 527 | auto protocols = split(_request->getHeader(protocolHeader), ','); |
| 528 | LS_DEBUG(_logger, "Requested protocols:"); |
| 529 | std::transform(protocols.begin(), protocols.end(), protocols.begin(), trimWhitespace); |
| 530 | for (auto&& p : protocols) { |
| 531 | LS_DEBUG(_logger, " " + p); |
| 532 | } |
| 533 | auto choice = _webSocketHandler->chooseProtocol(protocols); |
| 534 | if (choice >= 0 && choice < static_cast<ssize_t>(protocols.size())) { |
| 535 | LS_DEBUG(_logger, "Chose protocol " + protocols[choice]); |
| 536 | bufferLine(protocolHeader + ": " + protocols[choice]); |
| 537 | } |
| 538 | } |
| 539 | |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 540 | void Connection::handleBufferingPostData() { |
| 541 | if (_request->consumeContent(_inBuf)) { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 542 | _state = State::READING_HEADERS; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 543 | if (!handlePageRequest()) { |
| 544 | closeInternal(); |
| 545 | } |
| 546 | } |
| 547 | } |
| 548 | |
| 549 | void Connection::send(const char* webSocketResponse) { |
| 550 | _server.checkThread(); |
| 551 | if (_shutdown) { |
| 552 | if (_shutdownByUser) { |
| 553 | LS_ERROR(_logger, "Server wrote to connection after closing it"); |
| 554 | } |
| 555 | return; |
| 556 | } |
| 557 | auto messageLength = strlen(webSocketResponse); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 558 | if (_state == State::HANDLING_HIXIE_WEBSOCKET) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 559 | uint8_t zero = 0; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 560 | if (!write(&zero, 1, false)) |
| 561 | return; |
| 562 | if (!write(webSocketResponse, messageLength, false)) |
| 563 | return; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 564 | uint8_t effeff = 0xff; |
| 565 | write(&effeff, 1, true); |
| 566 | return; |
| 567 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 568 | sendHybi(static_cast<uint8_t>(HybiPacketDecoder::Opcode::Text), |
| 569 | reinterpret_cast<const uint8_t*>(webSocketResponse), messageLength); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 570 | } |
| 571 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 572 | void Connection::send(const uint8_t* webSocketResponse, size_t length) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 573 | _server.checkThread(); |
| 574 | if (_shutdown) { |
| 575 | if (_shutdownByUser) { |
| 576 | LS_ERROR(_logger, "Client wrote to connection after closing it"); |
| 577 | } |
| 578 | return; |
| 579 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 580 | if (_state == State::HANDLING_HIXIE_WEBSOCKET) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 581 | LS_ERROR(_logger, "Hixie does not support binary"); |
| 582 | return; |
| 583 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 584 | sendHybi(static_cast<uint8_t>(HybiPacketDecoder::Opcode::Binary), webSocketResponse, length); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 585 | } |
| 586 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 587 | void Connection::sendHybi(uint8_t opcode, const uint8_t* webSocketResponse, size_t messageLength) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 588 | uint8_t firstByte = 0x80 | opcode; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 589 | if (_perMessageDeflate) |
| 590 | firstByte |= 0x40; |
| 591 | if (!write(&firstByte, 1, false)) |
| 592 | return; |
| 593 | |
| 594 | if (_perMessageDeflate) { |
| 595 | std::vector<uint8_t> compressed; |
| 596 | |
| 597 | zlibContext.deflate(webSocketResponse, messageLength, compressed); |
| 598 | |
| 599 | LS_DEBUG(_logger, "Compression result: " << messageLength << " bytes -> " << compressed.size() << " bytes"); |
| 600 | sendHybiData(compressed.data(), compressed.size()); |
| 601 | } else { |
| 602 | sendHybiData(webSocketResponse, messageLength); |
| 603 | } |
| 604 | } |
| 605 | |
| 606 | void Connection::sendHybiData(const uint8_t* webSocketResponse, size_t messageLength) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 607 | if (messageLength < 126) { |
| 608 | uint8_t nextByte = messageLength; // No MASK bit set. |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 609 | if (!write(&nextByte, 1, false)) |
| 610 | return; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 611 | } else if (messageLength < 65536) { |
| 612 | uint8_t nextByte = 126; // No MASK bit set. |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 613 | if (!write(&nextByte, 1, false)) |
| 614 | return; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 615 | auto lengthBytes = htons(messageLength); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 616 | if (!write(&lengthBytes, 2, false)) |
| 617 | return; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 618 | } else { |
| 619 | uint8_t nextByte = 127; // No MASK bit set. |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 620 | if (!write(&nextByte, 1, false)) |
| 621 | return; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 622 | uint64_t lengthBytes = __bswap_64(messageLength); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 623 | if (!write(&lengthBytes, 8, false)) |
| 624 | return; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 625 | } |
| 626 | write(webSocketResponse, messageLength, true); |
| 627 | } |
| 628 | |
| 629 | std::shared_ptr<Credentials> Connection::credentials() const { |
| 630 | _server.checkThread(); |
| 631 | return _request ? _request->credentials() : std::shared_ptr<Credentials>(); |
| 632 | } |
| 633 | |
| 634 | void Connection::handleHixieWebSocket() { |
| 635 | if (_inBuf.empty()) { |
| 636 | return; |
| 637 | } |
| 638 | size_t messageStart = 0; |
| 639 | while (messageStart < _inBuf.size()) { |
| 640 | if (_inBuf[messageStart] != 0) { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 641 | LS_WARNING(_logger, "Error in WebSocket input stream (got " << (int) _inBuf[messageStart] << ")"); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 642 | closeInternal(); |
| 643 | return; |
| 644 | } |
| 645 | // TODO: UTF-8 |
| 646 | size_t endOfMessage = 0; |
| 647 | for (size_t i = messageStart + 1; i < _inBuf.size(); ++i) { |
| 648 | if (_inBuf[i] == 0xff) { |
| 649 | endOfMessage = i; |
| 650 | break; |
| 651 | } |
| 652 | } |
| 653 | if (endOfMessage != 0) { |
| 654 | _inBuf[endOfMessage] = 0; |
| 655 | handleWebSocketTextMessage(reinterpret_cast<const char*>(&_inBuf[messageStart + 1])); |
| 656 | messageStart = endOfMessage + 1; |
| 657 | } else { |
| 658 | break; |
| 659 | } |
| 660 | } |
| 661 | if (messageStart != 0) { |
| 662 | _inBuf.erase(_inBuf.begin(), _inBuf.begin() + messageStart); |
| 663 | } |
| 664 | if (_inBuf.size() > MaxWebsocketMessageSize) { |
| 665 | LS_WARNING(_logger, "WebSocket message too long"); |
| 666 | closeInternal(); |
| 667 | } |
| 668 | } |
| 669 | |
| 670 | void Connection::handleHybiWebSocket() { |
| 671 | if (_inBuf.empty()) { |
| 672 | return; |
| 673 | } |
| 674 | HybiPacketDecoder decoder(*_logger, _inBuf); |
| 675 | bool done = false; |
| 676 | while (!done) { |
| 677 | std::vector<uint8_t> decodedMessage; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 678 | bool deflateNeeded = false; |
| 679 | |
| 680 | auto messageState = decoder.decodeNextMessage(decodedMessage, deflateNeeded); |
| 681 | |
| 682 | if (deflateNeeded) { |
| 683 | if (!_perMessageDeflate) { |
| 684 | LS_WARNING(_logger, "Received deflated hybi frame but deflate wasn't negotiated"); |
| 685 | closeInternal(); |
| 686 | return; |
| 687 | } |
| 688 | |
| 689 | size_t compressed_size = decodedMessage.size(); |
| 690 | |
| 691 | std::vector<uint8_t> decompressed; |
| 692 | int zlibError; |
| 693 | |
| 694 | // Note: inflate() alters decodedMessage |
| 695 | bool success = zlibContext.inflate(decodedMessage, decompressed, zlibError); |
| 696 | |
| 697 | if (!success) { |
| 698 | LS_WARNING(_logger, "Decompression error from zlib: " << zlibError); |
| 699 | closeInternal(); |
| 700 | return; |
| 701 | } |
| 702 | |
| 703 | LS_DEBUG(_logger, "Decompression result: " << compressed_size << " bytes -> " << decodedMessage.size() << " bytes"); |
| 704 | |
| 705 | decodedMessage.swap(decompressed); |
| 706 | } |
| 707 | |
| 708 | |
| 709 | switch (messageState) { |
| 710 | default: |
| 711 | closeInternal(); |
| 712 | LS_WARNING(_logger, "Unknown HybiPacketDecoder state"); |
| 713 | return; |
| 714 | case HybiPacketDecoder::MessageState::Error: |
| 715 | closeInternal(); |
| 716 | return; |
| 717 | case HybiPacketDecoder::MessageState::TextMessage: |
| 718 | decodedMessage.push_back(0); // avoids a copy |
| 719 | handleWebSocketTextMessage(reinterpret_cast<const char*>(&decodedMessage[0])); |
| 720 | break; |
| 721 | case HybiPacketDecoder::MessageState::BinaryMessage: |
| 722 | handleWebSocketBinaryMessage(decodedMessage); |
| 723 | break; |
| 724 | case HybiPacketDecoder::MessageState::Ping: |
| 725 | sendHybi(static_cast<uint8_t>(HybiPacketDecoder::Opcode::Pong), |
| 726 | &decodedMessage[0], decodedMessage.size()); |
| 727 | break; |
| 728 | case HybiPacketDecoder::MessageState::Pong: |
| 729 | // Pongs can be sent unsolicited (MSIE and Edge do this) |
| 730 | // The spec says to ignore them. |
| 731 | break; |
| 732 | case HybiPacketDecoder::MessageState::NoMessage: |
| 733 | done = true; |
| 734 | break; |
| 735 | case HybiPacketDecoder::MessageState::Close: |
| 736 | LS_DEBUG(_logger, "Received WebSocket close"); |
| 737 | closeInternal(); |
| 738 | return; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 739 | } |
| 740 | } |
| 741 | if (decoder.numBytesDecoded() != 0) { |
| 742 | _inBuf.erase(_inBuf.begin(), _inBuf.begin() + decoder.numBytesDecoded()); |
| 743 | } |
| 744 | if (_inBuf.size() > MaxWebsocketMessageSize) { |
| 745 | LS_WARNING(_logger, "WebSocket message too long"); |
| 746 | closeInternal(); |
| 747 | } |
| 748 | } |
| 749 | |
| 750 | void Connection::handleWebSocketTextMessage(const char* message) { |
| 751 | LS_DEBUG(_logger, "Got text web socket message: '" << message << "'"); |
| 752 | if (_webSocketHandler) { |
| 753 | _webSocketHandler->onData(this, message); |
| 754 | } |
| 755 | } |
| 756 | |
| 757 | void Connection::handleWebSocketBinaryMessage(const std::vector<uint8_t>& message) { |
| 758 | LS_DEBUG(_logger, "Got binary web socket message (size: " << message.size() << ")"); |
| 759 | if (_webSocketHandler) { |
| 760 | _webSocketHandler->onData(this, &message[0], message.size()); |
| 761 | } |
| 762 | } |
| 763 | |
| 764 | bool Connection::sendError(ResponseCode errorCode, const std::string& body) { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 765 | assert(_state != State::HANDLING_HIXIE_WEBSOCKET); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 766 | auto errorNumber = static_cast<int>(errorCode); |
| 767 | auto message = ::name(errorCode); |
| 768 | bufferResponseAndCommonHeaders(errorCode); |
| 769 | auto errorContent = findEmbeddedContent("/_error.html"); |
| 770 | std::string document; |
| 771 | if (errorContent) { |
| 772 | document.assign(errorContent->data, errorContent->data + errorContent->length); |
| 773 | replace(document, "%%ERRORCODE%%", toString(errorNumber)); |
| 774 | replace(document, "%%MESSAGE%%", message); |
| 775 | replace(document, "%%BODY%%", body); |
| 776 | } else { |
| 777 | std::stringstream documentStr; |
| 778 | documentStr << "<html><head><title>" << errorNumber << " - " << message << "</title></head>" |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 779 | << "<body><h1>" << errorNumber << " - " << message << "</h1>" |
| 780 | << "<div>" << body << "</div><hr/><div><i>Powered by " |
| 781 | "<a href=\"https://github.com/mattgodbolt/seasocks\">Seasocks</a></i></div></body></html>"; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 782 | document = documentStr.str(); |
| 783 | } |
| 784 | bufferLine("Content-Length: " + toString(document.length())); |
| 785 | bufferLine("Connection: close"); |
| 786 | bufferLine(""); |
| 787 | bufferLine(document); |
| 788 | if (!flush()) { |
| 789 | return false; |
| 790 | } |
| 791 | closeWhenEmpty(); |
| 792 | return true; |
| 793 | } |
| 794 | |
| 795 | bool Connection::sendUnsupportedError(const std::string& reason) { |
| 796 | return sendError(ResponseCode::NotImplemented, reason); |
| 797 | } |
| 798 | |
| 799 | bool Connection::send404() { |
| 800 | auto path = getRequestUri(); |
| 801 | auto embedded = findEmbeddedContent(path); |
| 802 | if (embedded) { |
| 803 | return sendData(getContentType(path), embedded->data, embedded->length); |
| 804 | } else if (strcmp(path.c_str(), "/_livestats.js") == 0) { |
| 805 | auto stats = _server.getStatsDocument(); |
| 806 | return sendData("text/javascript", stats.c_str(), stats.length()); |
| 807 | } else { |
| 808 | return sendError(ResponseCode::NotFound, "Unable to find resource for: " + path); |
| 809 | } |
| 810 | } |
| 811 | |
| 812 | bool Connection::sendBadRequest(const std::string& reason) { |
| 813 | return sendError(ResponseCode::BadRequest, reason); |
| 814 | } |
| 815 | |
| 816 | bool Connection::sendISE(const std::string& error) { |
| 817 | return sendError(ResponseCode::InternalServerError, error); |
| 818 | } |
| 819 | |
| 820 | bool Connection::processHeaders(uint8_t* first, uint8_t* last) { |
| 821 | // Ideally we'd copy off [first, last] now into a header structure here. |
| 822 | // Be careful about lifetimes though and multiple requests coming in, should |
| 823 | // we ever support HTTP pipelining and/or long-lived requests. |
| 824 | char* requestLine = extractLine(first, last); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 825 | assert(requestLine != nullptr); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 826 | |
| 827 | LS_ACCESS(_logger, "Request: " << requestLine); |
| 828 | |
| 829 | const char* verbText = shift(requestLine); |
| 830 | if (!verbText) { |
| 831 | return sendBadRequest("Malformed request line"); |
| 832 | } |
| 833 | auto verb = Request::verb(verbText); |
| 834 | if (verb == Request::Verb::Invalid) { |
| 835 | return sendBadRequest("Malformed request line"); |
| 836 | } |
| 837 | const char* requestUri = shift(requestLine); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 838 | if (requestUri == nullptr) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 839 | return sendBadRequest("Malformed request line"); |
| 840 | } |
| 841 | |
| 842 | const char* httpVersion = shift(requestLine); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 843 | if (httpVersion == nullptr) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 844 | return sendBadRequest("Malformed request line"); |
| 845 | } |
| 846 | if (strcmp(httpVersion, "HTTP/1.1") != 0) { |
| 847 | return sendUnsupportedError("Unsupported HTTP version"); |
| 848 | } |
| 849 | if (*requestLine != 0) { |
| 850 | return sendBadRequest("Trailing crap after http version"); |
| 851 | } |
| 852 | |
| 853 | HeaderMap headers(31); |
| 854 | while (first < last) { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 855 | char* colonPos = nullptr; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 856 | char* headerLine = extractLine(first, last, &colonPos); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 857 | assert(headerLine != nullptr); |
| 858 | if (colonPos == nullptr) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 859 | return sendBadRequest("Malformed header"); |
| 860 | } |
| 861 | *colonPos = 0; |
| 862 | const char* key = headerLine; |
| 863 | const char* value = skipWhitespace(colonPos + 1); |
| 864 | LS_DEBUG(_logger, "Key: " << key << " || " << value); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 865 | headers.emplace(key, value); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 866 | } |
| 867 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 868 | if (headers.count("Connection") && headers.count("Upgrade") && hasConnectionType(headers["Connection"], "Upgrade") && caseInsensitiveSame(headers["Upgrade"], "websocket")) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 869 | LS_INFO(_logger, "Websocket request for " << requestUri << "'"); |
| 870 | if (verb != Request::Verb::Get) { |
| 871 | return sendBadRequest("Non-GET WebSocket request"); |
| 872 | } |
| 873 | _webSocketHandler = _server.getWebSocketHandler(requestUri); |
| 874 | if (!_webSocketHandler) { |
| 875 | LS_WARNING(_logger, "Couldn't find WebSocket end point for '" << requestUri << "'"); |
| 876 | return send404(); |
| 877 | } |
| 878 | verb = Request::Verb::WebSocket; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 879 | |
| 880 | if (_server.server().getPerMessageDeflateEnabled() && headers.count("Sec-WebSocket-Extensions")) { |
| 881 | parsePerMessageDeflateHeader(headers["Sec-WebSocket-Extensions"]); |
| 882 | } |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 883 | } |
| 884 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 885 | _request = std::make_unique<PageRequest>(_address, requestUri, _server.server(), |
| 886 | verb, std::move(headers)); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 887 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 888 | const EmbeddedContent* embedded = findEmbeddedContent(requestUri); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 889 | if (verb == Request::Verb::Get && embedded) { |
| 890 | // MRG: one day, this could be a request handler. |
| 891 | return sendData(getContentType(requestUri), embedded->data, embedded->length); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 892 | } else if (verb == Request::Verb::Head && embedded) { |
| 893 | return sendHeader(getContentType(requestUri), embedded->length); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 894 | } |
| 895 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 896 | if (_request->contentLength() > _server.clientBufferSize()) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 897 | return sendBadRequest("Content length too long"); |
| 898 | } |
| 899 | if (_request->contentLength() == 0) { |
| 900 | return handlePageRequest(); |
| 901 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 902 | _state = State::BUFFERING_POST_DATA; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 903 | return true; |
| 904 | } |
| 905 | |
| 906 | bool Connection::handlePageRequest() { |
| 907 | std::shared_ptr<Response> response; |
| 908 | try { |
| 909 | response = _server.handle(*_request); |
| 910 | } catch (const std::exception& e) { |
| 911 | LS_ERROR(_logger, "page error: " << e.what()); |
| 912 | return sendISE(e.what()); |
| 913 | } catch (...) { |
| 914 | LS_ERROR(_logger, "page error: (unknown)"); |
| 915 | return sendISE("(unknown)"); |
| 916 | } |
| 917 | auto uri = _request->getRequestUri(); |
| 918 | if (!response && _request->verb() == Request::Verb::WebSocket) { |
| 919 | _webSocketHandler = _server.getWebSocketHandler(uri.c_str()); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 920 | const auto webSocketVersion = std::stoi(_request->getHeader("Sec-WebSocket-Version")); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 921 | if (!_webSocketHandler) { |
| 922 | LS_WARNING(_logger, "Couldn't find WebSocket end point for '" << uri << "'"); |
| 923 | return send404(); |
| 924 | } |
| 925 | if (webSocketVersion == 0) { |
| 926 | // Hixie |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 927 | _state = State::READING_WEBSOCKET_KEY3; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 928 | return true; |
| 929 | } |
| 930 | auto hybiKey = _request->getHeader("Sec-WebSocket-Key"); |
| 931 | return handleHybiHandshake(webSocketVersion, hybiKey); |
| 932 | } |
| 933 | return sendResponse(response); |
| 934 | } |
| 935 | |
| 936 | bool Connection::sendResponse(std::shared_ptr<Response> response) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 937 | if (response == Response::unhandled()) { |
| 938 | return sendStaticData(); |
| 939 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 940 | assert(_response.get() == nullptr); |
| 941 | _state = State::AWAITING_RESPONSE_BEGIN; |
| 942 | _transferEncoding = TransferEncoding::Raw; |
| 943 | _chunk = 0; |
| 944 | _response = response; |
| 945 | _response->handle(_writer); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 946 | return true; |
| 947 | } |
| 948 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 949 | void Connection::error(ResponseCode responseCode, const std::string& payload) { |
| 950 | _server.checkThread(); |
| 951 | if (_state != State::AWAITING_RESPONSE_BEGIN) { |
| 952 | LS_ERROR(_logger, "error() called when in wrong state"); |
| 953 | return; |
| 954 | } |
| 955 | if (isOk(responseCode)) { |
| 956 | LS_ERROR(_logger, "error() called with a non-error code"); |
| 957 | } |
| 958 | if (responseCode == ResponseCode::NotFound) { |
| 959 | // TODO: better here; we use this purely to serve our own embedded content. |
| 960 | send404(); |
| 961 | } else { |
| 962 | sendError(responseCode, payload); |
| 963 | } |
| 964 | } |
| 965 | |
| 966 | void Connection::begin(ResponseCode responseCode, TransferEncoding encoding) { |
| 967 | _server.checkThread(); |
| 968 | if (_state != State::AWAITING_RESPONSE_BEGIN) { |
| 969 | LS_ERROR(_logger, "begin() called when in wrong state"); |
| 970 | return; |
| 971 | } |
| 972 | _state = State::SENDING_RESPONSE_HEADERS; |
| 973 | bufferResponseAndCommonHeaders(responseCode); |
| 974 | _transferEncoding = encoding; |
| 975 | if (_transferEncoding == TransferEncoding::Chunked) { |
| 976 | bufferLine("Transfer-encoding: chunked"); |
| 977 | } |
| 978 | } |
| 979 | |
| 980 | void Connection::header(const std::string& header, const std::string& value) { |
| 981 | _server.checkThread(); |
| 982 | if (_state != State::SENDING_RESPONSE_HEADERS) { |
| 983 | LS_ERROR(_logger, "header() called when in wrong state"); |
| 984 | return; |
| 985 | } |
| 986 | bufferLine(header + ": " + value); |
| 987 | } |
| 988 | void Connection::payload(const void* data, size_t size, bool flush) { |
| 989 | _server.checkThread(); |
| 990 | if (_state == State::SENDING_RESPONSE_HEADERS) { |
| 991 | bufferLine(""); |
| 992 | _state = State::SENDING_RESPONSE_BODY; |
| 993 | } else if (_state != State::SENDING_RESPONSE_BODY) { |
| 994 | LS_ERROR(_logger, "payload() called when in wrong state"); |
| 995 | return; |
| 996 | } |
| 997 | if (size && _transferEncoding == TransferEncoding::Chunked) { |
| 998 | writeChunkHeader(size); |
| 999 | } |
| 1000 | write(data, size, flush); |
| 1001 | } |
| 1002 | |
| 1003 | void Connection::writeChunkHeader(size_t size) { |
| 1004 | std::ostringstream lengthStr; |
| 1005 | if (_chunk) |
| 1006 | lengthStr << "\r\n"; |
| 1007 | lengthStr << std::hex << size << "\r\n"; |
| 1008 | auto length = lengthStr.str(); |
| 1009 | _chunk++; |
| 1010 | write(length.c_str(), length.size(), false); |
| 1011 | } |
| 1012 | |
| 1013 | void Connection::finish(bool keepConnectionOpen) { |
| 1014 | _server.checkThread(); |
| 1015 | if (_state == State::SENDING_RESPONSE_HEADERS) { |
| 1016 | bufferLine(""); |
| 1017 | } else if (_state != State::SENDING_RESPONSE_BODY) { |
| 1018 | LS_ERROR(_logger, "finish() called when in wrong state"); |
| 1019 | return; |
| 1020 | } |
| 1021 | if (_transferEncoding == TransferEncoding::Chunked) { |
| 1022 | writeChunkHeader(0); |
| 1023 | write("\r\n", 2, false); |
| 1024 | } |
| 1025 | |
| 1026 | flush(); |
| 1027 | |
| 1028 | if (!keepConnectionOpen) { |
| 1029 | closeWhenEmpty(); |
| 1030 | } |
| 1031 | |
| 1032 | _state = State::READING_HEADERS; |
| 1033 | _response.reset(); |
| 1034 | } |
| 1035 | |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1036 | bool Connection::handleHybiHandshake( |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1037 | int webSocketVersion, |
| 1038 | const std::string& webSocketKey) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1039 | if (webSocketVersion != 8 && webSocketVersion != 13) { |
| 1040 | return sendBadRequest("Invalid websocket version"); |
| 1041 | } |
| 1042 | LS_DEBUG(_logger, "Got a hybi-8 websocket with key=" << webSocketKey); |
| 1043 | |
| 1044 | LS_DEBUG(_logger, "Attempting websocket upgrade"); |
| 1045 | |
| 1046 | bufferResponseAndCommonHeaders(ResponseCode::WebSocketProtocolHandshake); |
| 1047 | bufferLine("Upgrade: websocket"); |
| 1048 | bufferLine("Connection: Upgrade"); |
| 1049 | bufferLine("Sec-WebSocket-Accept: " + getAcceptKey(webSocketKey)); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1050 | if (_perMessageDeflate) |
| 1051 | bufferLine("Sec-WebSocket-Extensions: permessage-deflate"); |
| 1052 | pickProtocol(); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1053 | bufferLine(""); |
| 1054 | flush(); |
| 1055 | |
| 1056 | if (_webSocketHandler) { |
| 1057 | _webSocketHandler->onConnect(this); |
| 1058 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1059 | _state = State::HANDLING_HYBI_WEBSOCKET; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1060 | return true; |
| 1061 | } |
| 1062 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1063 | void Connection::parsePerMessageDeflateHeader(const std::string& header) { |
| 1064 | for (auto& extField : seasocks::split(header, ';')) { |
| 1065 | while (!extField.empty() && isspace(extField[0])) { |
| 1066 | extField = extField.substr(1); |
| 1067 | } |
| 1068 | |
| 1069 | if (seasocks::caseInsensitiveSame(extField, "permessage-deflate")) { |
| 1070 | LS_INFO(_logger, "Enabling per-message deflate"); |
| 1071 | _perMessageDeflate = true; |
| 1072 | zlibContext.initialise(); |
| 1073 | } |
| 1074 | } |
| 1075 | } |
| 1076 | |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1077 | bool Connection::parseRange(const std::string& rangeStr, Range& range) const { |
| 1078 | size_t minusPos = rangeStr.find('-'); |
| 1079 | if (minusPos == std::string::npos) { |
| 1080 | LS_WARNING(_logger, "Bad range: '" << rangeStr << "'"); |
| 1081 | return false; |
| 1082 | } |
| 1083 | if (minusPos == 0) { |
| 1084 | // A range like "-500" means 500 bytes from end of file to end. |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1085 | range.start = std::stoi(rangeStr); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1086 | range.end = std::numeric_limits<long>::max(); |
| 1087 | return true; |
| 1088 | } else { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1089 | range.start = std::stoi(rangeStr.substr(0, minusPos)); |
| 1090 | if (minusPos == rangeStr.size() - 1) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1091 | range.end = std::numeric_limits<long>::max(); |
| 1092 | } else { |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1093 | range.end = std::stoi(rangeStr.substr(minusPos + 1)); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1094 | } |
| 1095 | return true; |
| 1096 | } |
| 1097 | return false; |
| 1098 | } |
| 1099 | |
| 1100 | bool Connection::parseRanges(const std::string& range, std::list<Range>& ranges) const { |
| 1101 | static const std::string expectedPrefix = "bytes="; |
| 1102 | if (range.length() < expectedPrefix.length() || range.substr(0, expectedPrefix.length()) != expectedPrefix) { |
| 1103 | LS_WARNING(_logger, "Bad range request prefix: '" << range << "'"); |
| 1104 | return false; |
| 1105 | } |
| 1106 | auto rangesText = split(range.substr(expectedPrefix.length()), ','); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1107 | for (auto& it : rangesText) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1108 | Range r; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1109 | if (!parseRange(it, r)) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1110 | return false; |
| 1111 | } |
| 1112 | ranges.push_back(r); |
| 1113 | } |
| 1114 | return !ranges.empty(); |
| 1115 | } |
| 1116 | |
| 1117 | // Sends HTTP 200 or 206, content-length, and range info as needed. Returns the actual file ranges |
| 1118 | // needing sending. |
| 1119 | std::list<Connection::Range> Connection::processRangesForStaticData(const std::list<Range>& origRanges, long fileSize) { |
| 1120 | if (origRanges.empty()) { |
| 1121 | // Easy case: a non-range request. |
| 1122 | bufferResponseAndCommonHeaders(ResponseCode::Ok); |
| 1123 | bufferLine("Content-Length: " + toString(fileSize)); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1124 | return {Range{0, fileSize - 1}}; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1125 | } |
| 1126 | |
| 1127 | // Partial content request. |
| 1128 | bufferResponseAndCommonHeaders(ResponseCode::PartialContent); |
| 1129 | int contentLength = 0; |
| 1130 | std::ostringstream rangeLine; |
| 1131 | rangeLine << "Content-Range: bytes "; |
| 1132 | std::list<Range> sendRanges; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1133 | for (auto actualRange : origRanges) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1134 | if (actualRange.start < 0) { |
| 1135 | actualRange.start += fileSize; |
| 1136 | } |
| 1137 | if (actualRange.start >= fileSize) { |
| 1138 | actualRange.start = fileSize - 1; |
| 1139 | } |
| 1140 | if (actualRange.end >= fileSize) { |
| 1141 | actualRange.end = fileSize - 1; |
| 1142 | } |
| 1143 | contentLength += actualRange.length(); |
| 1144 | sendRanges.push_back(actualRange); |
| 1145 | rangeLine << actualRange.start << "-" << actualRange.end; |
| 1146 | } |
| 1147 | rangeLine << "/" << fileSize; |
| 1148 | bufferLine(rangeLine.str()); |
| 1149 | bufferLine("Content-Length: " + toString(contentLength)); |
| 1150 | return sendRanges; |
| 1151 | } |
| 1152 | |
| 1153 | bool Connection::sendStaticData() { |
| 1154 | // TODO: fold this into the handler way of doing things. |
| 1155 | std::string path = _server.getStaticPath() + getRequestUri(); |
| 1156 | auto rangeHeader = getHeader("Range"); |
| 1157 | // Trim any trailing queries. |
| 1158 | size_t queryPos = path.find('?'); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1159 | if (queryPos != std::string::npos) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1160 | path.resize(queryPos); |
| 1161 | } |
| 1162 | if (*path.rbegin() == '/') { |
| 1163 | path += "index.html"; |
| 1164 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1165 | |
| 1166 | RaiiFd input{::open(path.c_str(), O_RDONLY)}; |
| 1167 | struct stat fileStat; |
| 1168 | if (!input.ok() || ::fstat(input, &fileStat) == -1) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1169 | return send404(); |
| 1170 | } |
| 1171 | std::list<Range> ranges; |
| 1172 | if (!rangeHeader.empty() && !parseRanges(rangeHeader, ranges)) { |
| 1173 | return sendBadRequest("Bad range header"); |
| 1174 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1175 | ranges = processRangesForStaticData(ranges, fileStat.st_size); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1176 | bufferLine("Content-Type: " + getContentType(path)); |
| 1177 | bufferLine("Connection: keep-alive"); |
| 1178 | bufferLine("Accept-Ranges: bytes"); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1179 | bufferLine("Last-Modified: " + webtime(fileStat.st_mtime)); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1180 | if (!isCacheable(path)) { |
| 1181 | bufferLine("Cache-Control: no-store"); |
| 1182 | bufferLine("Pragma: no-cache"); |
| 1183 | bufferLine("Expires: " + now()); |
| 1184 | } |
| 1185 | bufferLine(""); |
| 1186 | if (!flush()) { |
| 1187 | return false; |
| 1188 | } |
| 1189 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1190 | for (auto range : ranges) { |
| 1191 | if (::lseek(input, range.start, SEEK_SET) == -1) { |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1192 | // We've (probably) already sent data. |
| 1193 | return false; |
| 1194 | } |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1195 | auto bytesLeft = range.length(); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1196 | while (bytesLeft) { |
| 1197 | char buf[ReadWriteBufferSize]; |
| 1198 | auto bytesRead = ::read(input, buf, std::min(sizeof(buf), bytesLeft)); |
| 1199 | if (bytesRead <= 0) { |
| 1200 | const static std::string unexpectedEof("Unexpected EOF"); |
| 1201 | LS_ERROR(_logger, "Error reading file: " << (bytesRead == 0 ? unexpectedEof : getLastError())); |
| 1202 | // We can't send an error document as we've sent the header. |
| 1203 | return false; |
| 1204 | } |
| 1205 | bytesLeft -= bytesRead; |
| 1206 | if (!write(buf, bytesRead, true)) { |
| 1207 | return false; |
| 1208 | } |
| 1209 | } |
| 1210 | } |
| 1211 | return true; |
| 1212 | } |
| 1213 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1214 | bool Connection::sendHeader(const std::string& type, size_t size) { |
| 1215 | bufferResponseAndCommonHeaders(ResponseCode::Ok); |
| 1216 | bufferLine("Content-Type: " + type); |
| 1217 | bufferLine("Content-Length: " + toString(size)); |
| 1218 | bufferLine("Connection: keep-alive"); |
| 1219 | return bufferLine(""); |
| 1220 | } |
| 1221 | |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1222 | bool Connection::sendData(const std::string& type, const char* start, size_t size) { |
| 1223 | bufferResponseAndCommonHeaders(ResponseCode::Ok); |
| 1224 | bufferLine("Content-Type: " + type); |
| 1225 | bufferLine("Content-Length: " + toString(size)); |
| 1226 | bufferLine("Connection: keep-alive"); |
| 1227 | bufferLine(""); |
| 1228 | bool result = write(start, size, true); |
| 1229 | return result; |
| 1230 | } |
| 1231 | |
| 1232 | void Connection::bufferResponseAndCommonHeaders(ResponseCode code) { |
| 1233 | auto responseCodeInt = static_cast<int>(code); |
| 1234 | auto responseCodeName = ::name(code); |
| 1235 | auto response = std::string("HTTP/1.1 " + toString(responseCodeInt) + " " + responseCodeName); |
| 1236 | LS_ACCESS(_logger, "Response: " << response); |
| 1237 | bufferLine(response); |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1238 | bufferLine("Server: " + std::string(Config::version)); |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1239 | bufferLine("Date: " + now()); |
| 1240 | bufferLine("Access-Control-Allow-Origin: *"); |
| 1241 | } |
| 1242 | |
| 1243 | void Connection::setLinger() { |
| 1244 | if (_fd == -1) { |
| 1245 | return; |
| 1246 | } |
| 1247 | const int secondsToLinger = 1; |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1248 | struct linger linger = {true, secondsToLinger}; |
Austin Schuh | 24adb6b | 2015-09-06 17:37:40 -0700 | [diff] [blame] | 1249 | if (::setsockopt(_fd, SOL_SOCKET, SO_LINGER, &linger, sizeof(linger)) == -1) { |
| 1250 | LS_INFO(_logger, "Unable to set linger on socket"); |
| 1251 | } |
| 1252 | } |
| 1253 | |
| 1254 | bool Connection::hasHeader(const std::string& header) const { |
| 1255 | return _request ? _request->hasHeader(header) : false; |
| 1256 | } |
| 1257 | |
| 1258 | std::string Connection::getHeader(const std::string& header) const { |
| 1259 | return _request ? _request->getHeader(header) : ""; |
| 1260 | } |
| 1261 | |
| 1262 | const std::string& Connection::getRequestUri() const { |
| 1263 | static const std::string empty; |
| 1264 | return _request ? _request->getRequestUri() : empty; |
| 1265 | } |
| 1266 | |
Austin Schuh | 9d82300 | 2019-04-14 12:53:17 -0700 | [diff] [blame^] | 1267 | Server& Connection::server() const { |
| 1268 | return _server.server(); |
| 1269 | } |
| 1270 | |
| 1271 | } // seasocks |