| #include "aos/logging/implementations.h" |
| |
| #include <stdarg.h> |
| #include <inttypes.h> |
| |
| #include <algorithm> |
| #include <chrono> |
| |
| #include "aos/die.h" |
| #include "aos/logging/printf_formats.h" |
| #include "aos/queue_types.h" |
| #include "aos/time/time.h" |
| #include "aos/ipc_lib/queue.h" |
| #include "aos/once.h" |
| |
| namespace aos { |
| namespace logging { |
| namespace { |
| |
| namespace chrono = ::std::chrono; |
| |
| // The root LogImplementation. It only logs to stderr/stdout. |
| // Some of the things specified in the LogImplementation documentation doesn't |
| // apply here (mostly the parts about being able to use LOG) because this is the |
| // root one. |
| class RootLogImplementation : public SimpleLogImplementation { |
| public: |
| void have_other_implementation() { only_implementation_ = false; } |
| |
| private: |
| void set_next(LogImplementation *) override { |
| LOG(FATAL, "can't have a next logger from here\n"); |
| } |
| |
| __attribute__((format(GOOD_PRINTF_FORMAT_TYPE, 3, 0))) |
| void DoLog(log_level level, const char *format, va_list ap) override { |
| LogMessage message; |
| internal::FillInMessage(level, format, ap, &message); |
| internal::PrintMessage(stderr, message); |
| if (!only_implementation_) { |
| fputs("root logger got used, see stderr for message\n", stdout); |
| } |
| } |
| |
| bool only_implementation_ = true; |
| }; |
| |
| RootLogImplementation *root_implementation = nullptr; |
| |
| void SetGlobalImplementation(LogImplementation *implementation) { |
| if (root_implementation == nullptr) { |
| fputs("Somebody didn't call logging::Init()!\n", stderr); |
| abort(); |
| } |
| |
| internal::Context *context = internal::Context::Get(); |
| |
| context->implementation = implementation; |
| internal::global_top_implementation.store(implementation); |
| } |
| |
| void NewContext() { |
| internal::Context::Delete(); |
| } |
| |
| void *DoInit() { |
| SetGlobalImplementation(root_implementation = new RootLogImplementation()); |
| |
| if (pthread_atfork(NULL /*prepare*/, NULL /*parent*/, |
| NewContext /*child*/) != 0) { |
| LOG(FATAL, "pthread_atfork(NULL, NULL, %p) failed\n", |
| NewContext); |
| } |
| |
| return NULL; |
| } |
| |
| } // namespace |
| namespace internal { |
| namespace { |
| |
| void FillInMessageBase(log_level level, LogMessage *message) { |
| Context *context = Context::Get(); |
| |
| message->level = level; |
| message->source = context->source; |
| memcpy(message->name, context->name, context->name_size); |
| message->name_length = context->name_size; |
| |
| monotonic_clock::time_point monotonic_now = monotonic_clock::now(); |
| message->seconds = |
| chrono::duration_cast<chrono::seconds>(monotonic_now.time_since_epoch()) |
| .count(); |
| message->nseconds = |
| chrono::duration_cast<chrono::nanoseconds>( |
| monotonic_now.time_since_epoch() - chrono::seconds(message->seconds)) |
| .count(); |
| |
| message->sequence = context->sequence++; |
| } |
| |
| } // namespace |
| |
| void FillInMessageStructure(log_level level, |
| const ::std::string &message_string, size_t size, |
| const MessageType *type, |
| const ::std::function<size_t(char *)> &serialize, |
| LogMessage *message) { |
| type_cache::AddShm(type->id); |
| message->structure.type_id = type->id; |
| |
| FillInMessageBase(level, message); |
| |
| if (message_string.size() + size > sizeof(message->structure.serialized)) { |
| LOG(FATAL, "serialized struct %s (size %zd) and message %s too big\n", |
| type->name.c_str(), size, message_string.c_str()); |
| } |
| message->structure.string_length = message_string.size(); |
| memcpy(message->structure.serialized, message_string.data(), |
| message->structure.string_length); |
| |
| message->message_length = serialize( |
| &message->structure.serialized[message->structure.string_length]); |
| message->type = LogMessage::Type::kStruct; |
| } |
| |
| void FillInMessageMatrix(log_level level, |
| const ::std::string &message_string, uint32_t type_id, |
| int rows, int cols, const void *data, |
| LogMessage *message) { |
| CHECK(MessageType::IsPrimitive(type_id)); |
| message->matrix.type = type_id; |
| |
| const auto element_size = MessageType::Sizeof(type_id); |
| |
| FillInMessageBase(level, message); |
| |
| message->message_length = rows * cols * element_size; |
| if (message_string.size() + message->message_length > |
| sizeof(message->matrix.data)) { |
| LOG(FATAL, "%dx%d matrix of type %" PRIu32 |
| " (size %u) and message %s is too big\n", |
| rows, cols, type_id, element_size, message_string.c_str()); |
| } |
| message->matrix.string_length = message_string.size(); |
| memcpy(message->matrix.data, message_string.data(), |
| message->matrix.string_length); |
| |
| message->matrix.rows = rows; |
| message->matrix.cols = cols; |
| SerializeMatrix(type_id, &message->matrix.data[message->matrix.string_length], |
| data, rows, cols); |
| message->type = LogMessage::Type::kMatrix; |
| } |
| |
| void FillInMessage(log_level level, const char *format, va_list ap, |
| LogMessage *message) { |
| FillInMessageBase(level, message); |
| |
| message->message_length = |
| ExecuteFormat(message->message, sizeof(message->message), format, ap); |
| message->type = LogMessage::Type::kString; |
| } |
| |
| void PrintMessage(FILE *output, const LogMessage &message) { |
| #define BASE_ARGS \ |
| AOS_LOGGING_BASE_ARGS( \ |
| message.name_length, message.name, static_cast<int32_t>(message.source), \ |
| message.sequence, message.level, message.seconds, message.nseconds) |
| switch (message.type) { |
| case LogMessage::Type::kString: |
| fprintf(output, AOS_LOGGING_BASE_FORMAT "%.*s", BASE_ARGS, |
| static_cast<int>(message.message_length), message.message); |
| break; |
| case LogMessage::Type::kStruct: { |
| char buffer[4096]; |
| size_t output_length = sizeof(buffer); |
| size_t input_length = message.message_length; |
| if (!PrintMessage( |
| buffer, &output_length, |
| message.structure.serialized + message.structure.string_length, |
| &input_length, type_cache::Get(message.structure.type_id))) { |
| LOG(FATAL, |
| "printing message (%.*s) of type %s into %zu-byte buffer failed\n", |
| static_cast<int>(message.message_length), message.message, |
| type_cache::Get(message.structure.type_id).name.c_str(), |
| sizeof(buffer)); |
| } |
| if (input_length > 0) { |
| LOG(WARNING, "%zu extra bytes on message of type %s\n", input_length, |
| type_cache::Get(message.structure.type_id).name.c_str()); |
| } |
| fprintf(output, AOS_LOGGING_BASE_FORMAT "%.*s: %.*s\n", BASE_ARGS, |
| static_cast<int>(message.structure.string_length), |
| message.structure.serialized, |
| static_cast<int>(sizeof(buffer) - output_length), buffer); |
| } break; |
| case LogMessage::Type::kMatrix: { |
| char buffer[1024]; |
| size_t output_length = sizeof(buffer); |
| if (message.message_length != |
| static_cast<size_t>(message.matrix.rows * message.matrix.cols * |
| MessageType::Sizeof(message.matrix.type))) { |
| LOG(FATAL, "expected %d bytes of matrix data but have %zu\n", |
| message.matrix.rows * message.matrix.cols * |
| MessageType::Sizeof(message.matrix.type), |
| message.message_length); |
| } |
| if (!PrintMatrix(buffer, &output_length, |
| message.matrix.data + message.matrix.string_length, |
| message.matrix.type, message.matrix.rows, |
| message.matrix.cols)) { |
| LOG(FATAL, "printing %dx%d matrix of type %" PRIu32 " failed\n", |
| message.matrix.rows, message.matrix.cols, message.matrix.type); |
| } |
| fprintf(output, AOS_LOGGING_BASE_FORMAT "%.*s: %.*s\n", BASE_ARGS, |
| static_cast<int>(message.matrix.string_length), |
| message.matrix.data, |
| static_cast<int>(sizeof(buffer) - output_length), buffer); |
| } break; |
| } |
| #undef BASE_ARGS |
| } |
| |
| } // namespace internal |
| |
| void SimpleLogImplementation::LogStruct( |
| log_level level, const ::std::string &message, size_t size, |
| const MessageType *type, const ::std::function<size_t(char *)> &serialize) { |
| char serialized[1024]; |
| if (size > sizeof(serialized)) { |
| LOG(FATAL, "structure of type %s too big to serialize\n", |
| type->name.c_str()); |
| } |
| size_t used = serialize(serialized); |
| char printed[1024]; |
| size_t printed_bytes = sizeof(printed); |
| if (!PrintMessage(printed, &printed_bytes, serialized, &used, *type)) { |
| LOG(FATAL, "PrintMessage(%p, %p(=%zd), %p, %p(=%zd), %p(name=%s)) failed\n", |
| printed, &printed_bytes, printed_bytes, serialized, &used, used, type, |
| type->name.c_str()); |
| } |
| DoLogVariadic(level, "%.*s: %.*s\n", static_cast<int>(message.size()), |
| message.data(), |
| static_cast<int>(sizeof(printed) - printed_bytes), printed); |
| } |
| |
| void SimpleLogImplementation::LogMatrix( |
| log_level level, const ::std::string &message, uint32_t type_id, |
| int rows, int cols, const void *data) { |
| char serialized[1024]; |
| if (static_cast<size_t>(rows * cols * MessageType::Sizeof(type_id)) > |
| sizeof(serialized)) { |
| LOG(FATAL, "matrix of size %u too big to serialize\n", |
| rows * cols * MessageType::Sizeof(type_id)); |
| } |
| SerializeMatrix(type_id, serialized, data, rows, cols); |
| char printed[1024]; |
| size_t printed_bytes = sizeof(printed); |
| if (!PrintMatrix(printed, &printed_bytes, serialized, type_id, rows, cols)) { |
| LOG(FATAL, "PrintMatrix(%p, %p(=%zd), %p, %" PRIu32 ", %d, %d) failed\n", |
| printed, &printed_bytes, printed_bytes, serialized, type_id, rows, |
| cols); |
| } |
| DoLogVariadic(level, "%.*s: %.*s\n", static_cast<int>(message.size()), |
| message.data(), |
| static_cast<int>(sizeof(printed) - printed_bytes), printed); |
| } |
| |
| void HandleMessageLogImplementation::DoLog(log_level level, const char *format, |
| va_list ap) { |
| LogMessage message; |
| internal::FillInMessage(level, format, ap, &message); |
| HandleMessage(message); |
| } |
| |
| void HandleMessageLogImplementation::LogStruct( |
| log_level level, const ::std::string &message_string, size_t size, |
| const MessageType *type, const ::std::function<size_t(char *)> &serialize) { |
| LogMessage message; |
| internal::FillInMessageStructure(level, message_string, size, type, serialize, |
| &message); |
| HandleMessage(message); |
| } |
| |
| void HandleMessageLogImplementation::LogMatrix( |
| log_level level, const ::std::string &message_string, uint32_t type_id, |
| int rows, int cols, const void *data) { |
| LogMessage message; |
| internal::FillInMessageMatrix(level, message_string, type_id, rows, cols, |
| data, &message); |
| HandleMessage(message); |
| } |
| |
| StreamLogImplementation::StreamLogImplementation(FILE *stream) |
| : stream_(stream) {} |
| |
| void StreamLogImplementation::HandleMessage(const LogMessage &message) { |
| internal::PrintMessage(stream_, message); |
| } |
| |
| void AddImplementation(LogImplementation *implementation) { |
| internal::Context *context = internal::Context::Get(); |
| |
| if (implementation->next() != NULL) { |
| LOG(FATAL, "%p already has a next implementation, but it's not" |
| " being used yet\n", implementation); |
| } |
| |
| LogImplementation *old = context->implementation; |
| if (old != NULL) { |
| implementation->set_next(old); |
| } |
| SetGlobalImplementation(implementation); |
| root_implementation->have_other_implementation(); |
| } |
| |
| void Init() { |
| static Once<void> once(DoInit); |
| once.Get(); |
| } |
| |
| void Load() { |
| internal::Context::Get(); |
| } |
| |
| void Cleanup() { |
| internal::Context::Delete(); |
| } |
| |
| namespace { |
| |
| RawQueue *queue = NULL; |
| |
| int dropped_messages = 0; |
| monotonic_clock::time_point dropped_start, backoff_start; |
| // Wait this long after dropping a message before even trying to write any more. |
| constexpr chrono::milliseconds kDropBackoff = chrono::milliseconds(100); |
| |
| LogMessage *GetMessageOrDie() { |
| LogMessage *message = static_cast<LogMessage *>(queue->GetMessage()); |
| if (message == NULL) { |
| LOG(FATAL, "%p->GetMessage() failed\n", queue); |
| } else { |
| return message; |
| } |
| } |
| |
| void Write(LogMessage *msg) { |
| if (__builtin_expect(dropped_messages > 0, false)) { |
| monotonic_clock::time_point message_time( |
| chrono::seconds(msg->seconds) + chrono::nanoseconds(msg->nseconds)); |
| if (message_time - backoff_start < kDropBackoff) { |
| ++dropped_messages; |
| queue->FreeMessage(msg); |
| return; |
| } |
| |
| LogMessage *dropped_message = GetMessageOrDie(); |
| chrono::seconds dropped_start_sec = chrono::duration_cast<chrono::seconds>( |
| dropped_start.time_since_epoch()); |
| chrono::nanoseconds dropped_start_nsec = |
| chrono::duration_cast<chrono::nanoseconds>( |
| dropped_start.time_since_epoch() - dropped_start_sec); |
| internal::FillInMessageVarargs( |
| ERROR, dropped_message, |
| "%d logs starting at %" PRId32 ".%" PRId32 " dropped\n", |
| dropped_messages, static_cast<int32_t>(dropped_start_sec.count()), |
| static_cast<int32_t>(dropped_start_nsec.count())); |
| if (queue->WriteMessage(dropped_message, RawQueue::kNonBlock)) { |
| dropped_messages = 0; |
| } else { |
| // Don't even bother trying to write this message because it's not likely |
| // to work and it would be confusing to have one log in the middle of a |
| // string of failures get through. |
| ++dropped_messages; |
| backoff_start = message_time; |
| queue->FreeMessage(msg); |
| return; |
| } |
| } |
| if (!queue->WriteMessage(msg, RawQueue::kNonBlock)) { |
| if (dropped_messages == 0) { |
| monotonic_clock::time_point message_time( |
| chrono::seconds(msg->seconds) + chrono::nanoseconds(msg->nseconds)); |
| dropped_start = backoff_start = message_time; |
| } |
| ++dropped_messages; |
| } |
| } |
| |
| class LinuxQueueLogImplementation : public LogImplementation { |
| __attribute__((format(GOOD_PRINTF_FORMAT_TYPE, 3, 0))) |
| void DoLog(log_level level, const char *format, va_list ap) override { |
| LogMessage *message = GetMessageOrDie(); |
| internal::FillInMessage(level, format, ap, message); |
| Write(message); |
| } |
| |
| void LogStruct(log_level level, const ::std::string &message_string, |
| size_t size, const MessageType *type, |
| const ::std::function<size_t(char *)> &serialize) override { |
| LogMessage *message = GetMessageOrDie(); |
| internal::FillInMessageStructure(level, message_string, size, type, |
| serialize, message); |
| Write(message); |
| } |
| |
| void LogMatrix(log_level level, const ::std::string &message_string, |
| uint32_t type_id, int rows, int cols, |
| const void *data) override { |
| LogMessage *message = GetMessageOrDie(); |
| internal::FillInMessageMatrix(level, message_string, type_id, rows, cols, |
| data, message); |
| Write(message); |
| } |
| }; |
| |
| } // namespace |
| |
| RawQueue *GetLoggingQueue() { |
| return RawQueue::Fetch("LoggingQueue", sizeof(LogMessage), 1323, 40000); |
| } |
| |
| void RegisterQueueImplementation() { |
| Init(); |
| |
| queue = GetLoggingQueue(); |
| if (queue == NULL) { |
| Die("logging: couldn't fetch queue\n"); |
| } |
| |
| AddImplementation(new LinuxQueueLogImplementation()); |
| } |
| |
| } // namespace logging |
| } // namespace aos |