Merge "Add a simple multi-node test as an example"
diff --git a/aos/configuration.cc b/aos/configuration.cc
index d794a37..76704a4 100644
--- a/aos/configuration.cc
+++ b/aos/configuration.cc
@@ -10,10 +10,14 @@
 
 #include <map>
 #include <set>
+#include <string>
 #include <string_view>
+#include <vector>
 
 #include "absl/container/btree_set.h"
 #include "absl/strings/str_cat.h"
+#include "absl/strings/str_join.h"
+#include "absl/strings/str_split.h"
 #include "aos/configuration_generated.h"
 #include "aos/flatbuffer_merge.h"
 #include "aos/json_to_flatbuffer.h"
@@ -131,10 +135,33 @@
   return buffer;
 }
 
+std::string RemoveDotDots(const std::string_view filename) {
+  std::vector<std::string> split = absl::StrSplit(filename, '/');
+  auto iterator = split.begin();
+  while (iterator != split.end()) {
+    if (iterator->empty()) {
+      iterator = split.erase(iterator);
+    } else if (*iterator == ".") {
+      iterator = split.erase(iterator);
+    } else if (*iterator == "..") {
+      CHECK(iterator != split.begin())
+          << ": Import path may not start with ..: " << filename;
+      auto previous = iterator;
+      --previous;
+      split.erase(iterator);
+      iterator = split.erase(previous);
+    } else {
+      ++iterator;
+    }
+  }
+  return absl::StrJoin(split, "/");
+}
+
 FlatbufferDetachedBuffer<Configuration> ReadConfig(
     const std::string_view path, absl::btree_set<std::string> *visited_paths,
     const std::vector<std::string_view> &extra_import_paths) {
   std::string binary_path = MaybeReplaceExtension(path, ".json", ".bfbs");
+  VLOG(1) << "Looking up: " << path << ", starting with: " << binary_path;
   bool binary_path_exists = util::PathExists(binary_path);
   std::string raw_path(path);
   // For each .json file, look and see if we can find a .bfbs file next to it
@@ -151,13 +178,15 @@
 
     bool found_path = false;
     for (const auto &import_path : extra_import_paths) {
-      raw_path = std::string(import_path) + "/" + std::string(path);
+      raw_path = std::string(import_path) + "/" + RemoveDotDots(path);
       binary_path = MaybeReplaceExtension(raw_path, ".json", ".bfbs");
+      VLOG(1) << "Checking: " << binary_path;
       binary_path_exists = util::PathExists(binary_path);
       if (binary_path_exists) {
         found_path = true;
         break;
       }
+      VLOG(1) << "Checking: " << raw_path;
       if (util::PathExists(raw_path)) {
         found_path = true;
         break;
@@ -560,11 +589,11 @@
 
 FlatbufferDetachedBuffer<Configuration> ReadConfig(
     const std::string_view path,
-    const std::vector<std::string_view> &import_paths) {
+    const std::vector<std::string_view> &extra_import_paths) {
   // We only want to read a file once.  So track the visited files in a set.
   absl::btree_set<std::string> visited_paths;
   FlatbufferDetachedBuffer<Configuration> read_config =
-      ReadConfig(path, &visited_paths, import_paths);
+      ReadConfig(path, &visited_paths, extra_import_paths);
 
   // If we only read one file, and it had a .bfbs extension, it has to be a
   // fully formatted config.  Do a quick verification and return it.
diff --git a/aos/events/channel_preallocated_allocator.h b/aos/events/channel_preallocated_allocator.h
index c4f0eca..76fb694 100644
--- a/aos/events/channel_preallocated_allocator.h
+++ b/aos/events/channel_preallocated_allocator.h
@@ -62,11 +62,12 @@
   uint8_t *reallocate_downward(uint8_t * /*old_p*/, size_t /*old_size*/,
                                size_t new_size, size_t /*in_use_back*/,
                                size_t /*in_use_front*/) override {
-    LOG(FATAL) << "Requested " << new_size << " bytes, max size "
-               << channel_->max_size() << " for channel "
-               << configuration::CleanedChannelToString(channel_)
-               << ".  Increase the memory reserved to at least " << new_size
-               << ".";
+    LOG(FATAL)
+        << "Requested " << new_size
+        << " bytes (includes extra for room to grow even more), max size "
+        << channel_->max_size() << " for channel "
+        << configuration::CleanedChannelToString(channel_)
+        << ".  Increase the memory reserved to at least " << new_size << ".";
     return nullptr;
   }
 
diff --git a/aos/events/epoll.cc b/aos/events/epoll.cc
index 1c4427b..8cb553b 100644
--- a/aos/events/epoll.cc
+++ b/aos/events/epoll.cc
@@ -4,6 +4,7 @@
 #include <sys/epoll.h>
 #include <sys/timerfd.h>
 #include <unistd.h>
+
 #include <atomic>
 #include <vector>
 
@@ -109,62 +110,66 @@
   }
 
   EventData *const event_data = static_cast<struct EventData *>(event.data.ptr);
-  if (event.events & kInEvents) {
-    CHECK(event_data->in_fn)
-        << ": No handler registered for input events on " << event_data->fd;
-    event_data->in_fn();
-  }
-  if (event.events & kOutEvents) {
-    CHECK(event_data->out_fn)
-        << ": No handler registered for output events on " << event_data->fd;
-    event_data->out_fn();
-  }
-  if (event.events & kErrorEvents) {
-    CHECK(event_data->err_fn)
-        << ": No handler registered for error events on " << event_data->fd;
-    event_data->err_fn();
-  }
+  event_data->DoCallbacks(event.events);
   return true;
 }
 
-void EPoll::Quit() { PCHECK(write(quit_signal_fd_, "q", 1) == 1); }
+void EPoll::Quit() {
+  // Shortcut to break us out of infinite loops. We might write more than once
+  // to the pipe, but we'll stop once the first is read on the other end.
+  if (!run_) {
+    return;
+  }
+  PCHECK(write(quit_signal_fd_, "q", 1) == 1);
+}
 
 void EPoll::OnReadable(int fd, ::std::function<void()> function) {
   EventData *event_data = GetEventData(fd);
   if (event_data == nullptr) {
-    fns_.emplace_back(std::make_unique<EventData>(fd));
+    fns_.emplace_back(std::make_unique<InOutEventData>(fd));
     event_data = fns_.back().get();
   } else {
-    CHECK(!event_data->in_fn) << ": Duplicate in functions for " << fd;
+    CHECK(!static_cast<InOutEventData *>(event_data)->in_fn)
+        << ": Duplicate in functions for " << fd;
   }
-  event_data->in_fn = ::std::move(function);
+  static_cast<InOutEventData *>(event_data)->in_fn = ::std::move(function);
   DoEpollCtl(event_data, event_data->events | kInEvents);
 }
 
 void EPoll::OnError(int fd, ::std::function<void()> function) {
   EventData *event_data = GetEventData(fd);
   if (event_data == nullptr) {
-    fns_.emplace_back(std::make_unique<EventData>(fd));
+    fns_.emplace_back(std::make_unique<InOutEventData>(fd));
     event_data = fns_.back().get();
   } else {
-    CHECK(!event_data->err_fn) << ": Duplicate in functions for " << fd;
+    CHECK(!static_cast<InOutEventData *>(event_data)->err_fn)
+        << ": Duplicate error functions for " << fd;
   }
-  event_data->err_fn = ::std::move(function);
+  static_cast<InOutEventData *>(event_data)->err_fn = ::std::move(function);
   DoEpollCtl(event_data, event_data->events | kErrorEvents);
 }
 
 void EPoll::OnWriteable(int fd, ::std::function<void()> function) {
   EventData *event_data = GetEventData(fd);
   if (event_data == nullptr) {
-    fns_.emplace_back(std::make_unique<EventData>(fd));
+    fns_.emplace_back(std::make_unique<InOutEventData>(fd));
     event_data = fns_.back().get();
   } else {
-    CHECK(!event_data->out_fn) << ": Duplicate out functions for " << fd;
+    CHECK(!static_cast<InOutEventData *>(event_data)->out_fn)
+        << ": Duplicate out functions for " << fd;
   }
-  event_data->out_fn = ::std::move(function);
+  static_cast<InOutEventData *>(event_data)->out_fn = ::std::move(function);
   DoEpollCtl(event_data, event_data->events | kOutEvents);
 }
 
+void EPoll::OnEvents(int fd, ::std::function<void(uint32_t)> function) {
+  if (GetEventData(fd) != nullptr) {
+    LOG(FATAL) << "May not replace OnEvents handlers";
+  }
+  fns_.emplace_back(std::make_unique<SingleEventData>(fd));
+  static_cast<SingleEventData *>(fns_.back().get())->fn = std::move(function);
+}
+
 void EPoll::ForgetClosedFd(int fd) {
   auto element = fns_.begin();
   while (fns_.end() != element) {
@@ -177,6 +182,10 @@
   LOG(FATAL) << "fd " << fd << " not found";
 }
 
+void EPoll::SetEvents(int fd, uint32_t events) {
+  DoEpollCtl(CHECK_NOTNULL(GetEventData(fd)), events);
+}
+
 // Removes fd from the event loop.
 void EPoll::DeleteFd(int fd) {
   auto element = fns_.begin();
@@ -192,6 +201,21 @@
   LOG(FATAL) << "fd " << fd << " not found";
 }
 
+void EPoll::InOutEventData::DoCallbacks(uint32_t events) {
+  if (events & kInEvents) {
+    CHECK(in_fn) << ": No handler registered for input events on " << fd;
+    in_fn();
+  }
+  if (events & kOutEvents) {
+    CHECK(out_fn) << ": No handler registered for output events on " << fd;
+    out_fn();
+  }
+  if (events & kErrorEvents) {
+    CHECK(err_fn) << ": No handler registered for error events on " << fd;
+    err_fn();
+  }
+}
+
 void EPoll::EnableEvents(int fd, uint32_t events) {
   EventData *const event_data = CHECK_NOTNULL(GetEventData(fd));
   DoEpollCtl(event_data, event_data->events | events);
@@ -214,12 +238,14 @@
 
 void EPoll::DoEpollCtl(EventData *event_data, const uint32_t new_events) {
   const uint32_t old_events = event_data->events;
+  if (old_events == new_events) {
+    // Shortcut without calling into the kernel. This happens often with
+    // external event loop integrations that are emulating poll, so make it
+    // fast.
+    return;
+  }
   event_data->events = new_events;
   if (new_events == 0) {
-    if (old_events == 0) {
-      // Not added, and doesn't need to be. Nothing to do here.
-      return;
-    }
     // It was added, but should now be removed.
     PCHECK(epoll_ctl(epoll_fd_, EPOLL_CTL_DEL, event_data->fd, nullptr) == 0);
     return;
diff --git a/aos/events/epoll.h b/aos/events/epoll.h
index 4bcedf1..2b7eb76 100644
--- a/aos/events/epoll.h
+++ b/aos/events/epoll.h
@@ -5,6 +5,7 @@
 #include <sys/epoll.h>
 #include <sys/timerfd.h>
 #include <unistd.h>
+
 #include <atomic>
 #include <functional>
 #include <vector>
@@ -68,21 +69,34 @@
   // Quits.  Async safe.
   void Quit();
 
-  // Called before waiting on the epoll file descriptor.
+  // Adds a function which will be called before waiting on the epoll file
+  // descriptor.
   void BeforeWait(std::function<void()> function);
 
   // Registers a function to be called if the fd becomes readable.
   // Only one function may be registered for readability on each fd.
+  // A fd may be registered exclusively with OnReadable/OnWriteable/OnError OR
+  // OnEvents.
   void OnReadable(int fd, ::std::function<void()> function);
 
   // Registers a function to be called if the fd reports an error.
   // Only one function may be registered for errors on each fd.
+  // A fd may be registered exclusively with OnReadable/OnWriteable/OnError OR
+  // OnEvents.
   void OnError(int fd, ::std::function<void()> function);
 
   // Registers a function to be called if the fd becomes writeable.
   // Only one function may be registered for writability on each fd.
+  // A fd may be registered exclusively with OnReadable/OnWriteable/OnError OR
+  // OnEvents.
   void OnWriteable(int fd, ::std::function<void()> function);
 
+  // Registers a function to be called when the configured events occur on fd.
+  // Which events occur will be passed to the function.
+  // A fd may be registered exclusively with OnReadable/OnWriteable/OnError OR
+  // OnEvents.
+  void OnEvents(int fd, ::std::function<void(uint32_t)> function);
+
   // Removes fd from the event loop.
   // All Fds must be cleaned up before this class is destroyed.
   void DeleteFd(int fd);
@@ -100,19 +114,50 @@
   // writeable.
   void DisableWriteable(int fd) { DisableEvents(fd, kOutEvents); }
 
+  // Sets the epoll events for the given fd. Be careful using this with
+  // OnReadable/OnWriteable/OnError: enabled events which fire with no handler
+  // registered will result in a crash.
+  void SetEvents(int fd, uint32_t events);
+
+  // Returns whether we're currently running. This changes to false when we
+  // start draining events to finish.
+  bool should_run() const { return run_; }
+
  private:
   // Structure whose pointer should be returned by epoll.  Makes looking up the
   // function fast and easy.
   struct EventData {
     EventData(int fd_in) : fd(fd_in) {}
+    virtual ~EventData() = default;
+
     // We use pointers to these objects as persistent identifiers, so they can't
     // be moved.
     EventData(const EventData &) = delete;
     EventData &operator=(const EventData &) = delete;
 
+    // Calls the appropriate callbacks when events are returned from the kernel.
+    virtual void DoCallbacks(uint32_t events) = 0;
+
     const int fd;
     uint32_t events = 0;
+  };
+
+  struct InOutEventData : public EventData {
+    InOutEventData(int fd) : EventData(fd) {}
+    ~InOutEventData() override = default;
+
     std::function<void()> in_fn, out_fn, err_fn;
+
+    void DoCallbacks(uint32_t events) override;
+  };
+
+  struct SingleEventData : public EventData {
+    SingleEventData(int fd) : EventData(fd) {}
+    ~SingleEventData() override = default;
+
+    std::function<void(uint32_t)> fn;
+
+    void DoCallbacks(uint32_t events) override { fn(events); }
   };
 
   void EnableEvents(int fd, uint32_t events);
diff --git a/aos/events/epoll_test.cc b/aos/events/epoll_test.cc
index 66460c2..053a09b 100644
--- a/aos/events/epoll_test.cc
+++ b/aos/events/epoll_test.cc
@@ -3,8 +3,8 @@
 #include <fcntl.h>
 #include <unistd.h>
 
-#include "gtest/gtest.h"
 #include "glog/logging.h"
+#include "gtest/gtest.h"
 
 namespace aos {
 namespace internal {
@@ -48,22 +48,22 @@
 };
 
 class EPollTest : public ::testing::Test {
-  public:
-   void RunFor(std::chrono::nanoseconds duration) {
-     TimerFd timerfd;
-     bool did_quit = false;
-     epoll_.OnReadable(timerfd.fd(), [this, &timerfd, &did_quit]() {
-       CHECK(!did_quit);
-       epoll_.Quit();
-       did_quit = true;
-       timerfd.Read();
-     });
-     timerfd.SetTime(monotonic_clock::now() + duration,
-                     monotonic_clock::duration::zero());
-     epoll_.Run();
-     CHECK(did_quit);
-     epoll_.DeleteFd(timerfd.fd());
-   }
+ public:
+  void RunFor(std::chrono::nanoseconds duration) {
+    TimerFd timerfd;
+    bool did_quit = false;
+    epoll_.OnReadable(timerfd.fd(), [this, &timerfd, &did_quit]() {
+      CHECK(!did_quit);
+      epoll_.Quit();
+      did_quit = true;
+      timerfd.Read();
+    });
+    timerfd.SetTime(monotonic_clock::now() + duration,
+                    monotonic_clock::duration::zero());
+    epoll_.Run();
+    CHECK(did_quit);
+    epoll_.DeleteFd(timerfd.fd());
+  }
 
   // Tests should avoid relying on ordering for events closer in time than this,
   // or waiting for longer than this to ensure events happen in order.
@@ -71,7 +71,7 @@
     return std::chrono::milliseconds(50);
   }
 
-   EPoll epoll_;
+  EPoll epoll_;
 };
 
 // Test that the basics of OnReadable work.
@@ -201,6 +201,11 @@
   epoll_.DeleteFd(pipe.write_fd());
 }
 
+TEST_F(EPollTest, QuitInBeforeWait) {
+  epoll_.BeforeWait([this]() { epoll_.Quit(); });
+  epoll_.Run();
+}
+
 }  // namespace testing
 }  // namespace internal
 }  // namespace aos
diff --git a/aos/events/event_loop.h b/aos/events/event_loop.h
index d23314e..7cb6a5a 100644
--- a/aos/events/event_loop.h
+++ b/aos/events/event_loop.h
@@ -7,6 +7,7 @@
 #include <string>
 #include <string_view>
 
+#include "absl/container/btree_set.h"
 #include "aos/configuration.h"
 #include "aos/configuration_generated.h"
 #include "aos/events/channel_preallocated_allocator.h"
@@ -20,8 +21,6 @@
 #include "aos/time/time.h"
 #include "aos/util/phased_loop.h"
 #include "aos/uuid.h"
-
-#include "absl/container/btree_set.h"
 #include "flatbuffers/flatbuffers.h"
 #include "glog/logging.h"
 
@@ -115,6 +114,7 @@
 
  protected:
   EventLoop *event_loop() { return event_loop_; }
+  const EventLoop *event_loop() const { return event_loop_; }
 
   Context context_;
 
@@ -190,6 +190,7 @@
 
  protected:
   EventLoop *event_loop() { return event_loop_; }
+  const EventLoop *event_loop() const { return event_loop_; }
 
   monotonic_clock::time_point monotonic_sent_time_ = monotonic_clock::min_time;
   realtime_clock::time_point realtime_sent_time_ = realtime_clock::min_time;
@@ -473,8 +474,13 @@
   Ftrace ftrace_;
 };
 
+// Note, it is supported to create only:
+//   multiple fetchers, and (one sender or one watcher) per <name, type>
+//   tuple.
 class EventLoop {
  public:
+  // Holds configuration by reference for the lifetime of this object. It may
+  // never be mutated externally in any way.
   EventLoop(const Configuration *configuration);
 
   virtual ~EventLoop();
@@ -495,10 +501,6 @@
     return GetChannel<T>(channel_name) != nullptr;
   }
 
-  // Note, it is supported to create:
-  //   multiple fetchers, and (one sender or one watcher) per <name, type>
-  //   tuple.
-
   // Makes a class that will always fetch the most recent value
   // sent to the provided channel.
   template <typename T>
@@ -596,7 +598,7 @@
 
   // TODO(austin): OnExit for cleanup.
 
-  // Threadsafe.
+  // May be safely called from any thread.
   bool is_running() const { return is_running_.load(); }
 
   // Sets the scheduler priority to run the event loop at.  This may not be
diff --git a/aos/events/logging/log_cat.cc b/aos/events/logging/log_cat.cc
index 5c69f07..342a491 100644
--- a/aos/events/logging/log_cat.cc
+++ b/aos/events/logging/log_cat.cc
@@ -39,6 +39,8 @@
             "confirming they can be parsed.");
 DEFINE_bool(print_parts_only, false,
             "If true, only print out the results of logfile sorting.");
+DEFINE_bool(channels, false,
+            "If true, print out all the configured channels for this log.");
 
 // Print the flatbuffer out to stdout, both to remove the unnecessary cruft from
 // glog and to allow the user to readily redirect just the logged output
@@ -227,6 +229,15 @@
 
   aos::logger::LogReader reader(logfiles);
 
+  if (FLAGS_channels) {
+    const aos::Configuration *config = reader.configuration();
+    for (const aos::Channel *channel : *config->channels()) {
+      std::cout << channel->name()->c_str() << " " << channel->type()->c_str()
+                << '\n';
+    }
+    return 0;
+  }
+
   aos::FastStringBuilder builder;
 
   aos::SimulatedEventLoopFactory event_loop_factory(reader.configuration());
diff --git a/aos/events/shm_event_loop.cc b/aos/events/shm_event_loop.cc
index 63e1cb9..835210c 100644
--- a/aos/events/shm_event_loop.cc
+++ b/aos/events/shm_event_loop.cc
@@ -477,9 +477,13 @@
     simple_shm_fetcher_.RetrieveData();
   }
 
-  ~ShmFetcher() { context_.data = nullptr; }
+  ~ShmFetcher() override {
+    shm_event_loop()->CheckCurrentThread();
+    context_.data = nullptr;
+  }
 
   std::pair<bool, monotonic_clock::time_point> DoFetchNext() override {
+    shm_event_loop()->CheckCurrentThread();
     if (simple_shm_fetcher_.FetchNext()) {
       context_ = simple_shm_fetcher_.context();
       return std::make_pair(true, monotonic_clock::now());
@@ -488,6 +492,7 @@
   }
 
   std::pair<bool, monotonic_clock::time_point> DoFetch() override {
+    shm_event_loop()->CheckCurrentThread();
     if (simple_shm_fetcher_.Fetch()) {
       context_ = simple_shm_fetcher_.context();
       return std::make_pair(true, monotonic_clock::now());
@@ -500,6 +505,10 @@
   }
 
  private:
+  const ShmEventLoop *shm_event_loop() const {
+    return static_cast<const ShmEventLoop *>(event_loop());
+  }
+
   SimpleShmFetcher simple_shm_fetcher_;
 };
 
@@ -517,7 +526,7 @@
             channel)),
         wake_upper_(lockless_queue_memory_.queue()) {}
 
-  ~ShmSender() override {}
+  ~ShmSender() override { shm_event_loop()->CheckCurrentThread(); }
 
   static ipc_lib::LocklessQueueSender VerifySender(
       std::optional<ipc_lib::LocklessQueueSender> sender,
@@ -530,13 +539,20 @@
                << ", too many senders.";
   }
 
-  void *data() override { return lockless_queue_sender_.Data(); }
-  size_t size() override { return lockless_queue_sender_.size(); }
+  void *data() override {
+    shm_event_loop()->CheckCurrentThread();
+    return lockless_queue_sender_.Data();
+  }
+  size_t size() override {
+    shm_event_loop()->CheckCurrentThread();
+    return lockless_queue_sender_.size();
+  }
   bool DoSend(size_t length,
               aos::monotonic_clock::time_point monotonic_remote_time,
               aos::realtime_clock::time_point realtime_remote_time,
               uint32_t remote_queue_index,
               const UUID &remote_boot_uuid) override {
+    shm_event_loop()->CheckCurrentThread();
     CHECK_LE(length, static_cast<size_t>(channel()->max_size()))
         << ": Sent too big a message on "
         << configuration::CleanedChannelToString(channel());
@@ -547,7 +563,8 @@
         << ": Somebody wrote outside the buffer of their message on channel "
         << configuration::CleanedChannelToString(channel());
 
-    wake_upper_.Wakeup(event_loop()->priority());
+    wake_upper_.Wakeup(event_loop()->is_running() ? event_loop()->priority()
+                                                  : 0);
     return true;
   }
 
@@ -556,6 +573,7 @@
               aos::realtime_clock::time_point realtime_remote_time,
               uint32_t remote_queue_index,
               const UUID &remote_boot_uuid) override {
+    shm_event_loop()->CheckCurrentThread();
     CHECK_LE(length, static_cast<size_t>(channel()->max_size()))
         << ": Sent too big a message on "
         << configuration::CleanedChannelToString(channel());
@@ -565,7 +583,8 @@
         &monotonic_sent_time_, &realtime_sent_time_, &sent_queue_index_))
         << ": Somebody wrote outside the buffer of their message on channel "
         << configuration::CleanedChannelToString(channel());
-    wake_upper_.Wakeup(event_loop()->priority());
+    wake_upper_.Wakeup(event_loop()->is_running() ? event_loop()->priority()
+                                                  : 0);
     // TODO(austin): Return an error if we send too fast.
     return true;
   }
@@ -574,9 +593,16 @@
     return lockless_queue_memory_.GetMutableSharedMemory();
   }
 
-  int buffer_index() override { return lockless_queue_sender_.buffer_index(); }
+  int buffer_index() override {
+    shm_event_loop()->CheckCurrentThread();
+    return lockless_queue_sender_.buffer_index();
+  }
 
  private:
+  const ShmEventLoop *shm_event_loop() const {
+    return static_cast<const ShmEventLoop *>(event_loop());
+  }
+
   MMappedQueue lockless_queue_memory_;
   ipc_lib::LocklessQueueSender lockless_queue_sender_;
   ipc_lib::LocklessQueueWakeUpper wake_upper_;
@@ -599,9 +625,13 @@
     }
   }
 
-  ~ShmWatcherState() override { event_loop_->RemoveEvent(&event_); }
+  ~ShmWatcherState() override {
+    event_loop_->CheckCurrentThread();
+    event_loop_->RemoveEvent(&event_);
+  }
 
   void Startup(EventLoop *event_loop) override {
+    event_loop_->CheckCurrentThread();
     simple_shm_fetcher_.PointAtNextQueueIndex();
     CHECK(RegisterWakeup(event_loop->priority()));
   }
@@ -666,6 +696,7 @@
   }
 
   ~ShmTimerHandler() {
+    shm_event_loop_->CheckCurrentThread();
     Disable();
     shm_event_loop_->epoll_.DeleteFd(timerfd_.fd());
   }
@@ -705,6 +736,7 @@
 
   void Setup(monotonic_clock::time_point base,
              monotonic_clock::duration repeat_offset) override {
+    shm_event_loop_->CheckCurrentThread();
     if (event_.valid()) {
       shm_event_loop_->RemoveEvent(&event_);
     }
@@ -717,6 +749,7 @@
   }
 
   void Disable() override {
+    shm_event_loop_->CheckCurrentThread();
     shm_event_loop_->RemoveEvent(&event_);
     timerfd_.Disable();
     disabled_ = true;
@@ -766,6 +799,7 @@
   }
 
   ~ShmPhasedLoopHandler() override {
+    shm_event_loop_->CheckCurrentThread();
     shm_event_loop_->epoll_.DeleteFd(timerfd_.fd());
     shm_event_loop_->RemoveEvent(&event_);
   }
@@ -773,6 +807,7 @@
  private:
   // Reschedules the timer.
   void Schedule(monotonic_clock::time_point sleep_time) override {
+    shm_event_loop_->CheckCurrentThread();
     if (event_.valid()) {
       shm_event_loop_->RemoveEvent(&event_);
     }
@@ -792,6 +827,7 @@
 
 ::std::unique_ptr<RawFetcher> ShmEventLoop::MakeRawFetcher(
     const Channel *channel) {
+  CheckCurrentThread();
   if (!configuration::ChannelIsReadableOnNode(channel, node())) {
     LOG(FATAL) << "Channel { \"name\": \"" << channel->name()->string_view()
                << "\", \"type\": \"" << channel->type()->string_view()
@@ -805,6 +841,7 @@
 
 ::std::unique_ptr<RawSender> ShmEventLoop::MakeRawSender(
     const Channel *channel) {
+  CheckCurrentThread();
   TakeSender(channel);
 
   return ::std::unique_ptr<RawSender>(new ShmSender(shm_base_, this, channel));
@@ -813,6 +850,7 @@
 void ShmEventLoop::MakeRawWatcher(
     const Channel *channel,
     std::function<void(const Context &context, const void *message)> watcher) {
+  CheckCurrentThread();
   TakeWatcher(channel);
 
   NewWatcher(::std::unique_ptr<WatcherState>(
@@ -822,6 +860,7 @@
 void ShmEventLoop::MakeRawNoArgWatcher(
     const Channel *channel,
     std::function<void(const Context &context)> watcher) {
+  CheckCurrentThread();
   TakeWatcher(channel);
 
   NewWatcher(::std::unique_ptr<WatcherState>(new ShmWatcherState(
@@ -831,6 +870,7 @@
 }
 
 TimerHandler *ShmEventLoop::AddTimer(::std::function<void()> callback) {
+  CheckCurrentThread();
   return NewTimer(::std::unique_ptr<TimerHandler>(
       new ShmTimerHandler(this, ::std::move(callback))));
 }
@@ -839,14 +879,28 @@
     ::std::function<void(int)> callback,
     const monotonic_clock::duration interval,
     const monotonic_clock::duration offset) {
+  CheckCurrentThread();
   return NewPhasedLoop(::std::unique_ptr<PhasedLoopHandler>(
       new ShmPhasedLoopHandler(this, ::std::move(callback), interval, offset)));
 }
 
 void ShmEventLoop::OnRun(::std::function<void()> on_run) {
+  CheckCurrentThread();
   on_run_.push_back(::std::move(on_run));
 }
 
+void ShmEventLoop::CheckCurrentThread() const {
+  if (__builtin_expect(check_mutex_ != nullptr, false)) {
+    CHECK(check_mutex_->is_locked())
+        << ": The configured mutex is not locked while calling a "
+           "ShmEventLoop function";
+  }
+  if (__builtin_expect(!!check_tid_, false)) {
+    CHECK_EQ(syscall(SYS_gettid), *check_tid_)
+        << ": Being called from the wrong thread";
+  }
+}
+
 // This is a bit tricky because watchers can generate new events at any time (as
 // long as it's in the past). We want to check the watchers at least once before
 // declaring there are no events to handle, and we want to check them again if
@@ -1021,6 +1075,7 @@
 };
 
 void ShmEventLoop::Run() {
+  CheckCurrentThread();
   SignalHandler::global()->Register(this);
 
   if (watchers_.size() > 0) {
@@ -1100,6 +1155,7 @@
 void ShmEventLoop::Exit() { epoll_.Quit(); }
 
 ShmEventLoop::~ShmEventLoop() {
+  CheckCurrentThread();
   // Force everything with a registered fd with epoll to be destroyed now.
   timers_.clear();
   phased_loops_.clear();
@@ -1109,6 +1165,7 @@
 }
 
 void ShmEventLoop::SetRuntimeRealtimePriority(int priority) {
+  CheckCurrentThread();
   if (is_running()) {
     LOG(FATAL) << "Cannot set realtime priority while running.";
   }
@@ -1116,6 +1173,7 @@
 }
 
 void ShmEventLoop::SetRuntimeAffinity(const cpu_set_t &cpuset) {
+  CheckCurrentThread();
   if (is_running()) {
     LOG(FATAL) << "Cannot set affinity while running.";
   }
@@ -1123,18 +1181,21 @@
 }
 
 void ShmEventLoop::set_name(const std::string_view name) {
+  CheckCurrentThread();
   name_ = std::string(name);
   UpdateTimingReport();
 }
 
 absl::Span<const char> ShmEventLoop::GetWatcherSharedMemory(
     const Channel *channel) {
+  CheckCurrentThread();
   ShmWatcherState *const watcher_state =
       static_cast<ShmWatcherState *>(GetWatcherState(channel));
   return watcher_state->GetSharedMemory();
 }
 
 int ShmEventLoop::NumberBuffers(const Channel *channel) {
+  CheckCurrentThread();
   return MakeQueueConfiguration(
              channel, chrono::ceil<chrono::seconds>(chrono::nanoseconds(
                           configuration()->channel_storage_duration())))
@@ -1143,14 +1204,19 @@
 
 absl::Span<char> ShmEventLoop::GetShmSenderSharedMemory(
     const aos::RawSender *sender) const {
+  CheckCurrentThread();
   return static_cast<const ShmSender *>(sender)->GetSharedMemory();
 }
 
 absl::Span<const char> ShmEventLoop::GetShmFetcherPrivateMemory(
     const aos::RawFetcher *fetcher) const {
+  CheckCurrentThread();
   return static_cast<const ShmFetcher *>(fetcher)->GetPrivateMemory();
 }
 
-pid_t ShmEventLoop::GetTid() { return syscall(SYS_gettid); }
+pid_t ShmEventLoop::GetTid() {
+  CheckCurrentThread();
+  return syscall(SYS_gettid);
+}
 
 }  // namespace aos
diff --git a/aos/events/shm_event_loop.h b/aos/events/shm_event_loop.h
index 845857c..3245f11 100644
--- a/aos/events/shm_event_loop.h
+++ b/aos/events/shm_event_loop.h
@@ -4,11 +4,11 @@
 #include <vector>
 
 #include "absl/types/span.h"
-
 #include "aos/events/epoll.h"
 #include "aos/events/event_loop.h"
 #include "aos/events/event_loop_generated.h"
 #include "aos/ipc_lib/signalfd.h"
+#include "aos/stl_mutex/stl_mutex.h"
 
 DECLARE_string(application_name);
 DECLARE_string(shm_base);
@@ -92,6 +92,7 @@
   // Returns the local mapping of the shared memory used by the provided Sender.
   template <typename T>
   absl::Span<char> GetSenderSharedMemory(aos::Sender<T> *sender) const {
+    CheckCurrentThread();
     return GetShmSenderSharedMemory(GetRawSender(sender));
   }
 
@@ -103,11 +104,30 @@
   template <typename T>
   absl::Span<const char> GetFetcherPrivateMemory(
       aos::Fetcher<T> *fetcher) const {
+    CheckCurrentThread();
     return GetShmFetcherPrivateMemory(GetRawFetcher(fetcher));
   }
 
   int NumberBuffers(const Channel *channel) override;
 
+  // All public-facing APIs will verify this mutex is held when they are called.
+  // For normal use with everything in a single thread, this is unnecessary.
+  //
+  // This is helpful as a safety check when using a ShmEventLoop with external
+  // synchronization across multiple threads. It will NOT reliably catch race
+  // conditions, but if you have a race condition triggered repeatedly it'll
+  // probably catch it eventually.
+  void CheckForMutex(aos::stl_mutex *check_mutex) {
+    check_mutex_ = check_mutex;
+  }
+
+  // All public-facing APIs will verify they are called in this thread.
+  // For normal use with the whole program in a single thread, this is
+  // unnecessary. It's helpful as a safety check for programs with multiple
+  // threads, where the EventLoop should only be interacted with from a single
+  // one.
+  void LockToThread() { check_tid_ = GetTid(); }
+
  private:
   friend class shm_event_loop_internal::ShmWatcherState;
   friend class shm_event_loop_internal::ShmTimerHandler;
@@ -126,6 +146,8 @@
     return result;
   }
 
+  void CheckCurrentThread() const;
+
   void HandleEvent();
 
   // Returns the TID of the event loop.
@@ -151,6 +173,9 @@
   std::string name_;
   const Node *const node_;
 
+  aos::stl_mutex *check_mutex_ = nullptr;
+  std::optional<pid_t> check_tid_;
+
   internal::EPoll epoll_;
 
   // Only set during Run().
diff --git a/aos/events/shm_event_loop_test.cc b/aos/events/shm_event_loop_test.cc
index 5524597..4c12213 100644
--- a/aos/events/shm_event_loop_test.cc
+++ b/aos/events/shm_event_loop_test.cc
@@ -3,13 +3,12 @@
 #include <string_view>
 
 #include "aos/events/event_loop_param_test.h"
+#include "aos/events/test_message_generated.h"
+#include "aos/network/team_number.h"
 #include "aos/realtime.h"
 #include "glog/logging.h"
 #include "gtest/gtest.h"
 
-#include "aos/events/test_message_generated.h"
-#include "aos/network/team_number.h"
-
 namespace aos {
 namespace testing {
 namespace {
@@ -123,6 +122,36 @@
 
 using ShmEventLoopDeathTest = ShmEventLoopTest;
 
+// Tests that we don't leave the calling thread realtime when calling Send
+// before Run.
+TEST_P(ShmEventLoopTest, SendBeforeRun) {
+  auto loop = factory()->MakePrimary("primary");
+  loop->SetRuntimeRealtimePriority(1);
+
+  auto loop2 = factory()->Make("loop2");
+  loop2->SetRuntimeRealtimePriority(2);
+  loop2->MakeWatcher("/test", [](const TestMessage &) {});
+  // Need the other one running for its watcher to record in SHM that it wants
+  // wakers to boost their priority, so leave it running in a thread for this
+  // test.
+  std::thread loop2_thread(
+      [&loop2]() { static_cast<ShmEventLoop *>(loop2.get())->Run(); });
+  std::this_thread::sleep_for(std::chrono::milliseconds(100));
+
+  auto sender = loop->MakeSender<TestMessage>("/test");
+  EXPECT_FALSE(IsRealtime());
+  {
+    aos::Sender<TestMessage>::Builder msg = sender.MakeBuilder();
+    TestMessage::Builder builder = msg.MakeBuilder<TestMessage>();
+    builder.add_value(200);
+    msg.Send(builder.Finish());
+  }
+  EXPECT_FALSE(IsRealtime());
+
+  static_cast<ShmEventLoop *>(loop2.get())->Exit();
+  loop2_thread.join();
+}
+
 // Tests that every handler type is realtime and runs.  There are threads
 // involved and it's easy to miss one.
 TEST_P(ShmEventLoopTest, AllHandlersAreRealtime) {
diff --git a/aos/network/message_bridge_client_lib.cc b/aos/network/message_bridge_client_lib.cc
index 08350a8..1044b2f 100644
--- a/aos/network/message_bridge_client_lib.cc
+++ b/aos/network/message_bridge_client_lib.cc
@@ -186,24 +186,26 @@
 }
 
 void SctpClientConnection::SendConnect() {
+  VLOG(1) << "Sending Connect";
   // Try to send the connect message.  If that fails, retry.
-  if (!client_.Send(kConnectStream(),
-                    std::string_view(reinterpret_cast<const char *>(
-                                         connect_message_.span().data()),
-                                     connect_message_.span().size()),
-                    0)) {
+  if (client_.Send(kConnectStream(),
+                   std::string_view(reinterpret_cast<const char *>(
+                                        connect_message_.span().data()),
+                                    connect_message_.span().size()),
+                   0)) {
+    ScheduleConnectTimeout();
+  } else {
     NodeDisconnected();
   }
 }
 
 void SctpClientConnection::NodeConnected(sctp_assoc_t assoc_id) {
-  connect_timer_->Disable();
+  ScheduleConnectTimeout();
 
   // We want to tell the kernel to schedule the packets on this new stream with
   // the priority scheduler.  This only needs to be done once per stream.
   client_.SetPriorityScheduler(assoc_id);
 
-  remote_assoc_id_ = assoc_id;
   connection_->mutate_state(State::CONNECTED);
   client_status_->SampleReset(client_index_);
 }
@@ -212,13 +214,14 @@
   connect_timer_->Setup(
       event_loop_->monotonic_now() + chrono::milliseconds(100),
       chrono::milliseconds(100));
-  remote_assoc_id_ = 0;
   connection_->mutate_state(State::DISCONNECTED);
   connection_->mutate_monotonic_offset(0);
   client_status_->SampleReset(client_index_);
 }
 
 void SctpClientConnection::HandleData(const Message *message) {
+  ScheduleConnectTimeout();
+
   const RemoteData *remote_data =
       flatbuffers::GetSizePrefixedRoot<RemoteData>(message->data());
 
diff --git a/aos/network/message_bridge_client_lib.h b/aos/network/message_bridge_client_lib.h
index 2b48906..0552f79 100644
--- a/aos/network/message_bridge_client_lib.h
+++ b/aos/network/message_bridge_client_lib.h
@@ -53,6 +53,14 @@
   void NodeDisconnected();
   void HandleData(const Message *message);
 
+  // Schedules connect_timer_ for a ways in the future. If one of our messages
+  // gets dropped, the server might be waiting for this, so if we don't hear
+  // from the server for a while we'll try sending it again.
+  void ScheduleConnectTimeout() {
+    connect_timer_->Setup(event_loop_->context().monotonic_event_time +
+                          std::chrono::seconds(1));
+  }
+
   // Event loop to register the server on.
   aos::ShmEventLoop *const event_loop_;
 
@@ -81,10 +89,6 @@
   // Timer which fires to handle reconnections.
   aos::TimerHandler *connect_timer_;
 
-  // id of the server once known.  This is only valid if connection_ says
-  // connected.
-  sctp_assoc_t remote_assoc_id_ = 0;
-
   // ClientConnection statistics message to modify.  This will be published
   // periodicially.
   MessageBridgeClientStatus *client_status_;
diff --git a/aos/stl_mutex/stl_mutex.h b/aos/stl_mutex/stl_mutex.h
index 86a5988..e3a930e 100644
--- a/aos/stl_mutex/stl_mutex.h
+++ b/aos/stl_mutex/stl_mutex.h
@@ -61,6 +61,11 @@
   bool owner_died() const { return owner_died_; }
   void consistent() { owner_died_ = false; }
 
+  // Returns whether this mutex is locked by the current thread. This is very
+  // hard to use reliably, please think very carefully before using it for
+  // anything beyond probabilistic assertion checks.
+  bool is_locked() const { return mutex_islocked(&native_handle_); }
+
  private:
   aos_mutex native_handle_;
 
@@ -82,7 +87,7 @@
   constexpr stl_recursive_mutex() {}
 
   void lock() {
-    if (mutex_islocked(mutex_.native_handle())) {
+    if (mutex_.is_locked()) {
       CHECK(!owner_died());
       ++recursive_locks_;
     } else {
@@ -95,7 +100,7 @@
     }
   }
   bool try_lock() {
-    if (mutex_islocked(mutex_.native_handle())) {
+    if (mutex_.is_locked()) {
       CHECK(!owner_died());
       ++recursive_locks_;
       return true;
diff --git a/y2021_bot3/control_loops/python/drivetrain.py b/y2021_bot3/control_loops/python/drivetrain.py
index e5b001a..fdd08c2 100644
--- a/y2021_bot3/control_loops/python/drivetrain.py
+++ b/y2021_bot3/control_loops/python/drivetrain.py
@@ -16,10 +16,11 @@
     J=6.0,
     mass=58.0,
     # TODO(austin): Measure radius a bit better.
-    robot_radius=0.7 / 2.0,
-    wheel_radius=6.0 * 0.0254 / 2.0,
+    robot_radius= 0.39,
+    wheel_radius= 3/39.37,
     motor_type=control_loop.Falcon(),
-    G=(8.0 / 70.0) * (17.0 / 24.0),
+    num_motors = 3,
+    G=8.0 / 80.0,
     q_pos=0.24,
     q_vel=2.5,
     efficiency=0.80,