Squashed 'third_party/abseil/' content from commit ddf8e52a2

Change-Id: I330cdc687395c6605ad027b855e313ff4a2059e9
git-subtree-dir: third_party/abseil
git-subtree-split: ddf8e52a2918dd0ccec75d3e2426125fa3926724
diff --git a/absl/time/internal/cctz/BUILD.bazel b/absl/time/internal/cctz/BUILD.bazel
new file mode 100644
index 0000000..9fceffe
--- /dev/null
+++ b/absl/time/internal/cctz/BUILD.bazel
@@ -0,0 +1,158 @@
+# Copyright 2016 Google Inc. All Rights Reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#   https://www.apache.org/licenses/LICENSE-2.0
+#
+#   Unless required by applicable law or agreed to in writing, software
+#   distributed under the License is distributed on an "AS IS" BASIS,
+#   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+#   See the License for the specific language governing permissions and
+#   limitations under the License.
+
+load("@rules_cc//cc:defs.bzl", "cc_library", "cc_test")
+
+package(features = ["-parse_headers"])
+
+licenses(["notice"])  # Apache License
+
+config_setting(
+    name = "osx",
+    constraint_values = [
+        "@bazel_tools//platforms:osx",
+    ],
+)
+
+config_setting(
+    name = "ios",
+    constraint_values = [
+        "@bazel_tools//platforms:ios",
+    ],
+)
+
+### libraries
+
+cc_library(
+    name = "civil_time",
+    srcs = ["src/civil_time_detail.cc"],
+    hdrs = [
+        "include/cctz/civil_time.h",
+    ],
+    textual_hdrs = ["include/cctz/civil_time_detail.h"],
+    visibility = ["//visibility:public"],
+)
+
+cc_library(
+    name = "time_zone",
+    srcs = [
+        "src/time_zone_fixed.cc",
+        "src/time_zone_fixed.h",
+        "src/time_zone_format.cc",
+        "src/time_zone_if.cc",
+        "src/time_zone_if.h",
+        "src/time_zone_impl.cc",
+        "src/time_zone_impl.h",
+        "src/time_zone_info.cc",
+        "src/time_zone_info.h",
+        "src/time_zone_libc.cc",
+        "src/time_zone_libc.h",
+        "src/time_zone_lookup.cc",
+        "src/time_zone_posix.cc",
+        "src/time_zone_posix.h",
+        "src/tzfile.h",
+        "src/zone_info_source.cc",
+    ],
+    hdrs = [
+        "include/cctz/time_zone.h",
+        "include/cctz/zone_info_source.h",
+    ],
+    linkopts = select({
+        ":osx": [
+            "-framework Foundation",
+        ],
+        ":ios": [
+            "-framework Foundation",
+        ],
+        "//conditions:default": [],
+    }),
+    visibility = ["//visibility:public"],
+    deps = [":civil_time"],
+)
+
+### tests
+
+cc_test(
+    name = "civil_time_test",
+    size = "small",
+    srcs = ["src/civil_time_test.cc"],
+    deps = [
+        ":civil_time",
+        "@com_google_googletest//:gtest_main",
+    ],
+)
+
+cc_test(
+    name = "time_zone_format_test",
+    size = "small",
+    srcs = ["src/time_zone_format_test.cc"],
+    data = [":zoneinfo"],
+    tags = [
+        "no_test_android_arm",
+        "no_test_android_arm64",
+        "no_test_android_x86",
+    ],
+    deps = [
+        ":civil_time",
+        ":time_zone",
+        "@com_google_googletest//:gtest_main",
+    ],
+)
+
+cc_test(
+    name = "time_zone_lookup_test",
+    size = "small",
+    timeout = "moderate",
+    srcs = ["src/time_zone_lookup_test.cc"],
+    data = [":zoneinfo"],
+    tags = [
+        "no_test_android_arm",
+        "no_test_android_arm64",
+        "no_test_android_x86",
+    ],
+    deps = [
+        ":civil_time",
+        ":time_zone",
+        "@com_google_googletest//:gtest_main",
+    ],
+)
+
+### benchmarks
+
+cc_test(
+    name = "cctz_benchmark",
+    srcs = [
+        "src/cctz_benchmark.cc",
+        "src/time_zone_if.h",
+        "src/time_zone_impl.h",
+        "src/time_zone_info.h",
+        "src/tzfile.h",
+    ],
+    linkstatic = 1,
+    tags = ["benchmark"],
+    deps = [
+        ":civil_time",
+        ":time_zone",
+        "@com_github_google_benchmark//:benchmark_main",
+    ],
+)
+
+### examples
+
+### binaries
+
+filegroup(
+    name = "zoneinfo",
+    srcs = glob(["testdata/zoneinfo/**"]),
+)
diff --git a/absl/time/internal/cctz/include/cctz/civil_time.h b/absl/time/internal/cctz/include/cctz/civil_time.h
new file mode 100644
index 0000000..85d0d3f
--- /dev/null
+++ b/absl/time/internal/cctz/include/cctz/civil_time.h
@@ -0,0 +1,329 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
+#define ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
+
+#include "absl/time/internal/cctz/include/cctz/civil_time_detail.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// The term "civil time" refers to the legally recognized human-scale time
+// that is represented by the six fields YYYY-MM-DD hh:mm:ss. Modern-day civil
+// time follows the Gregorian Calendar and is a time-zone-independent concept.
+// A "date" is perhaps the most common example of a civil time (represented in
+// this library as cctz::civil_day). This library provides six classes and a
+// handful of functions that help with rounding, iterating, and arithmetic on
+// civil times while avoiding complications like daylight-saving time (DST).
+//
+// The following six classes form the core of this civil-time library:
+//
+//   * civil_second
+//   * civil_minute
+//   * civil_hour
+//   * civil_day
+//   * civil_month
+//   * civil_year
+//
+// Each class is a simple value type with the same interface for construction
+// and the same six accessors for each of the civil fields (year, month, day,
+// hour, minute, and second, aka YMDHMS). These classes differ only in their
+// alignment, which is indicated by the type name and specifies the field on
+// which arithmetic operates.
+//
+// Each class can be constructed by passing up to six optional integer
+// arguments representing the YMDHMS fields (in that order) to the
+// constructor. Omitted fields are assigned their minimum valid value. Hours,
+// minutes, and seconds will be set to 0, month and day will be set to 1, and
+// since there is no minimum valid year, it will be set to 1970. So, a
+// default-constructed civil-time object will have YMDHMS fields representing
+// "1970-01-01 00:00:00". Fields that are out-of-range are normalized (e.g.,
+// October 32 -> November 1) so that all civil-time objects represent valid
+// values.
+//
+// Each civil-time class is aligned to the civil-time field indicated in the
+// class's name after normalization. Alignment is performed by setting all the
+// inferior fields to their minimum valid value (as described above). The
+// following are examples of how each of the six types would align the fields
+// representing November 22, 2015 at 12:34:56 in the afternoon. (Note: the
+// string format used here is not important; it's just a shorthand way of
+// showing the six YMDHMS fields.)
+//
+//   civil_second  2015-11-22 12:34:56
+//   civil_minute  2015-11-22 12:34:00
+//   civil_hour    2015-11-22 12:00:00
+//   civil_day     2015-11-22 00:00:00
+//   civil_month   2015-11-01 00:00:00
+//   civil_year    2015-01-01 00:00:00
+//
+// Each civil-time type performs arithmetic on the field to which it is
+// aligned. This means that adding 1 to a civil_day increments the day field
+// (normalizing as necessary), and subtracting 7 from a civil_month operates
+// on the month field (normalizing as necessary). All arithmetic produces a
+// valid civil time. Difference requires two similarly aligned civil-time
+// objects and returns the scalar answer in units of the objects' alignment.
+// For example, the difference between two civil_hour objects will give an
+// answer in units of civil hours.
+//
+// In addition to the six civil-time types just described, there are
+// a handful of helper functions and algorithms for performing common
+// calculations. These are described below.
+//
+// Note: In C++14 and later, this library is usable in a constexpr context.
+//
+// CONSTRUCTION:
+//
+// Each of the civil-time types can be constructed in two ways: by directly
+// passing to the constructor up to six (optional) integers representing the
+// YMDHMS fields, or by copying the YMDHMS fields from a differently aligned
+// civil-time type.
+//
+//   civil_day default_value;  // 1970-01-01 00:00:00
+//
+//   civil_day a(2015, 2, 3);           // 2015-02-03 00:00:00
+//   civil_day b(2015, 2, 3, 4, 5, 6);  // 2015-02-03 00:00:00
+//   civil_day c(2015);                 // 2015-01-01 00:00:00
+//
+//   civil_second ss(2015, 2, 3, 4, 5, 6);  // 2015-02-03 04:05:06
+//   civil_minute mm(ss);                   // 2015-02-03 04:05:00
+//   civil_hour hh(mm);                     // 2015-02-03 04:00:00
+//   civil_day d(hh);                       // 2015-02-03 00:00:00
+//   civil_month m(d);                      // 2015-02-01 00:00:00
+//   civil_year y(m);                       // 2015-01-01 00:00:00
+//
+//   m = civil_month(y);     // 2015-01-01 00:00:00
+//   d = civil_day(m);       // 2015-01-01 00:00:00
+//   hh = civil_hour(d);     // 2015-01-01 00:00:00
+//   mm = civil_minute(hh);  // 2015-01-01 00:00:00
+//   ss = civil_second(mm);  // 2015-01-01 00:00:00
+//
+// ALIGNMENT CONVERSION:
+//
+// The alignment of a civil-time object cannot change, but the object may be
+// used to construct a new object with a different alignment. This is referred
+// to as "realigning". When realigning to a type with the same or more
+// precision (e.g., civil_day -> civil_second), the conversion may be
+// performed implicitly since no information is lost. However, if information
+// could be discarded (e.g., civil_second -> civil_day), the conversion must
+// be explicit at the call site.
+//
+//   void fun(const civil_day& day);
+//
+//   civil_second cs;
+//   fun(cs);  // Won't compile because data may be discarded
+//   fun(civil_day(cs));  // OK: explicit conversion
+//
+//   civil_day cd;
+//   fun(cd);  // OK: no conversion needed
+//
+//   civil_month cm;
+//   fun(cm);  // OK: implicit conversion to civil_day
+//
+// NORMALIZATION:
+//
+// Integer arguments passed to the constructor may be out-of-range, in which
+// case they are normalized to produce a valid civil-time object. This enables
+// natural arithmetic on constructor arguments without worrying about the
+// field's range. Normalization guarantees that there are no invalid
+// civil-time objects.
+//
+//   civil_day d(2016, 10, 32);  // Out-of-range day; normalized to 2016-11-01
+//
+// Note: If normalization is undesired, you can signal an error by comparing
+// the constructor arguments to the normalized values returned by the YMDHMS
+// properties.
+//
+// PROPERTIES:
+//
+// All civil-time types have accessors for all six of the civil-time fields:
+// year, month, day, hour, minute, and second. Recall that fields inferior to
+// the type's aligment will be set to their minimum valid value.
+//
+//   civil_day d(2015, 6, 28);
+//   // d.year() == 2015
+//   // d.month() == 6
+//   // d.day() == 28
+//   // d.hour() == 0
+//   // d.minute() == 0
+//   // d.second() == 0
+//
+// COMPARISON:
+//
+// Comparison always considers all six YMDHMS fields, regardless of the type's
+// alignment. Comparison between differently aligned civil-time types is
+// allowed.
+//
+//   civil_day feb_3(2015, 2, 3);  // 2015-02-03 00:00:00
+//   civil_day mar_4(2015, 3, 4);  // 2015-03-04 00:00:00
+//   // feb_3 < mar_4
+//   // civil_year(feb_3) == civil_year(mar_4)
+//
+//   civil_second feb_3_noon(2015, 2, 3, 12, 0, 0);  // 2015-02-03 12:00:00
+//   // feb_3 < feb_3_noon
+//   // feb_3 == civil_day(feb_3_noon)
+//
+//   // Iterates all the days of February 2015.
+//   for (civil_day d(2015, 2, 1); d < civil_month(2015, 3); ++d) {
+//     // ...
+//   }
+//
+// STREAMING:
+//
+// Each civil-time type may be sent to an output stream using operator<<().
+// The output format follows the pattern "YYYY-MM-DDThh:mm:ss" where fields
+// inferior to the type's alignment are omitted.
+//
+//   civil_second cs(2015, 2, 3, 4, 5, 6);
+//   std::cout << cs << "\n";  // Outputs: 2015-02-03T04:05:06
+//
+//   civil_day cd(cs);
+//   std::cout << cd << "\n";  // Outputs: 2015-02-03
+//
+//   civil_year cy(cs);
+//   std::cout << cy << "\n";  // Outputs: 2015
+//
+// ARITHMETIC:
+//
+// Civil-time types support natural arithmetic operators such as addition,
+// subtraction, and difference. Arithmetic operates on the civil-time field
+// indicated in the type's name. Difference requires arguments with the same
+// alignment and returns the answer in units of the alignment.
+//
+//   civil_day a(2015, 2, 3);
+//   ++a;                         // 2015-02-04 00:00:00
+//   --a;                         // 2015-02-03 00:00:00
+//   civil_day b = a + 1;         // 2015-02-04 00:00:00
+//   civil_day c = 1 + b;         // 2015-02-05 00:00:00
+//   int n = c - a;               // n = 2 (civil days)
+//   int m = c - civil_month(c);  // Won't compile: different types.
+//
+// EXAMPLE: Adding a month to January 31.
+//
+// One of the classic questions that arises when considering a civil-time
+// library (or a date library or a date/time library) is this: "What happens
+// when you add a month to January 31?" This is an interesting question
+// because there could be a number of possible answers:
+//
+//   1. March 3 (or 2 if a leap year). This may make sense if the operation
+//      wants the equivalent of February 31.
+//   2. February 28 (or 29 if a leap year). This may make sense if the operation
+//      wants the last day of January to go to the last day of February.
+//   3. Error. The caller may get some error, an exception, an invalid date
+//      object, or maybe false is returned. This may make sense because there is
+//      no single unambiguously correct answer to the question.
+//
+// Practically speaking, any answer that is not what the programmer intended
+// is the wrong answer.
+//
+// This civil-time library avoids the problem by making it impossible to ask
+// ambiguous questions. All civil-time objects are aligned to a particular
+// civil-field boundary (such as aligned to a year, month, day, hour, minute,
+// or second), and arithmetic operates on the field to which the object is
+// aligned. This means that in order to "add a month" the object must first be
+// aligned to a month boundary, which is equivalent to the first day of that
+// month.
+//
+// Of course, there are ways to compute an answer the question at hand using
+// this civil-time library, but they require the programmer to be explicit
+// about the answer they expect. To illustrate, let's see how to compute all
+// three of the above possible answers to the question of "Jan 31 plus 1
+// month":
+//
+//   const civil_day d(2015, 1, 31);
+//
+//   // Answer 1:
+//   // Add 1 to the month field in the constructor, and rely on normalization.
+//   const auto ans_normalized = civil_day(d.year(), d.month() + 1, d.day());
+//   // ans_normalized == 2015-03-03 (aka Feb 31)
+//
+//   // Answer 2:
+//   // Add 1 to month field, capping to the end of next month.
+//   const auto next_month = civil_month(d) + 1;
+//   const auto last_day_of_next_month = civil_day(next_month + 1) - 1;
+//   const auto ans_capped = std::min(ans_normalized, last_day_of_next_month);
+//   // ans_capped == 2015-02-28
+//
+//   // Answer 3:
+//   // Signal an error if the normalized answer is not in next month.
+//   if (civil_month(ans_normalized) != next_month) {
+//     // error, month overflow
+//   }
+//
+using civil_year = detail::civil_year;
+using civil_month = detail::civil_month;
+using civil_day = detail::civil_day;
+using civil_hour = detail::civil_hour;
+using civil_minute = detail::civil_minute;
+using civil_second = detail::civil_second;
+
+// An enum class with members monday, tuesday, wednesday, thursday, friday,
+// saturday, and sunday. These enum values may be sent to an output stream
+// using operator<<(). The result is the full weekday name in English with a
+// leading capital letter.
+//
+//   weekday wd = weekday::thursday;
+//   std::cout << wd << "\n";  // Outputs: Thursday
+//
+using detail::weekday;
+
+// Returns the weekday for the given civil-time value.
+//
+//   civil_day a(2015, 8, 13);
+//   weekday wd = get_weekday(a);  // wd == weekday::thursday
+//
+using detail::get_weekday;
+
+// Returns the civil_day that strictly follows or precedes the given
+// civil_day, and that falls on the given weekday.
+//
+// For example, given:
+//
+//     August 2015
+// Su Mo Tu We Th Fr Sa
+//                    1
+//  2  3  4  5  6  7  8
+//  9 10 11 12 13 14 15
+// 16 17 18 19 20 21 22
+// 23 24 25 26 27 28 29
+// 30 31
+//
+//   civil_day a(2015, 8, 13);  // get_weekday(a) == weekday::thursday
+//   civil_day b = next_weekday(a, weekday::thursday);  // b = 2015-08-20
+//   civil_day c = prev_weekday(a, weekday::thursday);  // c = 2015-08-06
+//
+//   civil_day d = ...
+//   // Gets the following Thursday if d is not already Thursday
+//   civil_day thurs1 = next_weekday(d - 1, weekday::thursday);
+//   // Gets the previous Thursday if d is not already Thursday
+//   civil_day thurs2 = prev_weekday(d + 1, weekday::thursday);
+//
+using detail::next_weekday;
+using detail::prev_weekday;
+
+// Returns the day-of-year for the given civil-time value.
+//
+//   civil_day a(2015, 1, 1);
+//   int yd_jan_1 = get_yearday(a);   // yd_jan_1 = 1
+//   civil_day b(2015, 12, 31);
+//   int yd_dec_31 = get_yearday(b);  // yd_dec_31 = 365
+//
+using detail::get_yearday;
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
diff --git a/absl/time/internal/cctz/include/cctz/civil_time_detail.h b/absl/time/internal/cctz/include/cctz/civil_time_detail.h
new file mode 100644
index 0000000..433078a
--- /dev/null
+++ b/absl/time/internal/cctz/include/cctz/civil_time_detail.h
@@ -0,0 +1,624 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
+#define ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
+
+#include <cstdint>
+#include <limits>
+#include <ostream>
+#include <type_traits>
+
+// Disable constexpr support unless we are in C++14 mode.
+#if __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+#define CONSTEXPR_D constexpr  // data
+#define CONSTEXPR_F constexpr  // function
+#define CONSTEXPR_M constexpr  // member
+#else
+#define CONSTEXPR_D const
+#define CONSTEXPR_F inline
+#define CONSTEXPR_M
+#endif
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// Support years that at least span the range of 64-bit time_t values.
+using year_t = std::int_fast64_t;
+
+// Type alias that indicates an argument is not normalized (e.g., the
+// constructor parameters and operands/results of addition/subtraction).
+using diff_t = std::int_fast64_t;
+
+namespace detail {
+
+// Type aliases that indicate normalized argument values.
+using month_t = std::int_fast8_t;   // [1:12]
+using day_t = std::int_fast8_t;     // [1:31]
+using hour_t = std::int_fast8_t;    // [0:23]
+using minute_t = std::int_fast8_t;  // [0:59]
+using second_t = std::int_fast8_t;  // [0:59]
+
+// Normalized civil-time fields: Y-M-D HH:MM:SS.
+struct fields {
+  CONSTEXPR_M fields(year_t year, month_t month, day_t day,
+                     hour_t hour, minute_t minute, second_t second)
+      : y(year), m(month), d(day), hh(hour), mm(minute), ss(second) {}
+  std::int_least64_t y;
+  std::int_least8_t m;
+  std::int_least8_t d;
+  std::int_least8_t hh;
+  std::int_least8_t mm;
+  std::int_least8_t ss;
+};
+
+struct second_tag {};
+struct minute_tag : second_tag {};
+struct hour_tag : minute_tag {};
+struct day_tag : hour_tag {};
+struct month_tag : day_tag {};
+struct year_tag : month_tag {};
+
+////////////////////////////////////////////////////////////////////////
+
+// Field normalization (without avoidable overflow).
+
+namespace impl {
+
+CONSTEXPR_F bool is_leap_year(year_t y) noexcept {
+  return y % 4 == 0 && (y % 100 != 0 || y % 400 == 0);
+}
+CONSTEXPR_F int year_index(year_t y, month_t m) noexcept {
+  return (static_cast<int>((y + (m > 2)) % 400) + 400) % 400;
+}
+CONSTEXPR_F int days_per_century(year_t y, month_t m) noexcept {
+  const int yi = year_index(y, m);
+  return 36524 + (yi == 0 || yi > 300);
+}
+CONSTEXPR_F int days_per_4years(year_t y, month_t m) noexcept {
+  const int yi = year_index(y, m);
+  return 1460 + (yi == 0 || yi > 300 || (yi - 1) % 100 < 96);
+}
+CONSTEXPR_F int days_per_year(year_t y, month_t m) noexcept {
+  return is_leap_year(y + (m > 2)) ? 366 : 365;
+}
+CONSTEXPR_F int days_per_month(year_t y, month_t m) noexcept {
+  CONSTEXPR_D int k_days_per_month[1 + 12] = {
+      -1, 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31  // non leap year
+  };
+  return k_days_per_month[m] + (m == 2 && is_leap_year(y));
+}
+
+CONSTEXPR_F fields n_day(year_t y, month_t m, diff_t d, diff_t cd,
+                         hour_t hh, minute_t mm, second_t ss) noexcept {
+  y += (cd / 146097) * 400;
+  cd %= 146097;
+  if (cd < 0) {
+    y -= 400;
+    cd += 146097;
+  }
+  y += (d / 146097) * 400;
+  d = d % 146097 + cd;
+  if (d > 0) {
+    if (d > 146097) {
+      y += 400;
+      d -= 146097;
+    }
+  } else {
+    if (d > -365) {
+      // We often hit the previous year when stepping a civil time backwards,
+      // so special case it to avoid counting up by 100/4/1-year chunks.
+      y -= 1;
+      d += days_per_year(y, m);
+    } else {
+      y -= 400;
+      d += 146097;
+    }
+  }
+  if (d > 365) {
+    for (int n = days_per_century(y, m); d > n; n = days_per_century(y, m)) {
+      d -= n;
+      y += 100;
+    }
+    for (int n = days_per_4years(y, m); d > n; n = days_per_4years(y, m)) {
+      d -= n;
+      y += 4;
+    }
+    for (int n = days_per_year(y, m); d > n; n = days_per_year(y, m)) {
+      d -= n;
+      ++y;
+    }
+  }
+  if (d > 28) {
+    for (int n = days_per_month(y, m); d > n; n = days_per_month(y, m)) {
+      d -= n;
+      if (++m > 12) {
+        ++y;
+        m = 1;
+      }
+    }
+  }
+  return fields(y, m, static_cast<day_t>(d), hh, mm, ss);
+}
+CONSTEXPR_F fields n_mon(year_t y, diff_t m, diff_t d, diff_t cd,
+                         hour_t hh, minute_t mm, second_t ss) noexcept {
+  if (m != 12) {
+    y += m / 12;
+    m %= 12;
+    if (m <= 0) {
+      y -= 1;
+      m += 12;
+    }
+  }
+  return n_day(y, static_cast<month_t>(m), d, cd, hh, mm, ss);
+}
+CONSTEXPR_F fields n_hour(year_t y, diff_t m, diff_t d, diff_t cd,
+                          diff_t hh, minute_t mm, second_t ss) noexcept {
+  cd += hh / 24;
+  hh %= 24;
+  if (hh < 0) {
+    cd -= 1;
+    hh += 24;
+  }
+  return n_mon(y, m, d, cd, static_cast<hour_t>(hh), mm, ss);
+}
+CONSTEXPR_F fields n_min(year_t y, diff_t m, diff_t d, diff_t hh, diff_t ch,
+                         diff_t mm, second_t ss) noexcept {
+  ch += mm / 60;
+  mm %= 60;
+  if (mm < 0) {
+    ch -= 1;
+    mm += 60;
+  }
+  return n_hour(y, m, d, hh / 24 + ch / 24, hh % 24 + ch % 24,
+                static_cast<minute_t>(mm), ss);
+}
+CONSTEXPR_F fields n_sec(year_t y, diff_t m, diff_t d, diff_t hh, diff_t mm,
+                         diff_t ss) noexcept {
+  // Optimization for when (non-constexpr) fields are already normalized.
+  if (0 <= ss && ss < 60) {
+    const second_t nss = static_cast<second_t>(ss);
+    if (0 <= mm && mm < 60) {
+      const minute_t nmm = static_cast<minute_t>(mm);
+      if (0 <= hh && hh < 24) {
+        const hour_t nhh = static_cast<hour_t>(hh);
+        if (1 <= d && d <= 28 && 1 <= m && m <= 12) {
+          const day_t nd = static_cast<day_t>(d);
+          const month_t nm = static_cast<month_t>(m);
+          return fields(y, nm, nd, nhh, nmm, nss);
+        }
+        return n_mon(y, m, d, 0, nhh, nmm, nss);
+      }
+      return n_hour(y, m, d, hh / 24, hh % 24, nmm, nss);
+    }
+    return n_min(y, m, d, hh, mm / 60, mm % 60, nss);
+  }
+  diff_t cm = ss / 60;
+  ss %= 60;
+  if (ss < 0) {
+    cm -= 1;
+    ss += 60;
+  }
+  return n_min(y, m, d, hh, mm / 60 + cm / 60, mm % 60 + cm % 60,
+               static_cast<second_t>(ss));
+}
+
+}  // namespace impl
+
+////////////////////////////////////////////////////////////////////////
+
+// Increments the indicated (normalized) field by "n".
+CONSTEXPR_F fields step(second_tag, fields f, diff_t n) noexcept {
+  return impl::n_sec(f.y, f.m, f.d, f.hh, f.mm + n / 60, f.ss + n % 60);
+}
+CONSTEXPR_F fields step(minute_tag, fields f, diff_t n) noexcept {
+  return impl::n_min(f.y, f.m, f.d, f.hh + n / 60, 0, f.mm + n % 60, f.ss);
+}
+CONSTEXPR_F fields step(hour_tag, fields f, diff_t n) noexcept {
+  return impl::n_hour(f.y, f.m, f.d + n / 24, 0, f.hh + n % 24, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(day_tag, fields f, diff_t n) noexcept {
+  return impl::n_day(f.y, f.m, f.d, n, f.hh, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(month_tag, fields f, diff_t n) noexcept {
+  return impl::n_mon(f.y + n / 12, f.m + n % 12, f.d, 0, f.hh, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(year_tag, fields f, diff_t n) noexcept {
+  return fields(f.y + n, f.m, f.d, f.hh, f.mm, f.ss);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+namespace impl {
+
+// Returns (v * f + a) but avoiding intermediate overflow when possible.
+CONSTEXPR_F diff_t scale_add(diff_t v, diff_t f, diff_t a) noexcept {
+  return (v < 0) ? ((v + 1) * f + a) - f : ((v - 1) * f + a) + f;
+}
+
+// Map a (normalized) Y/M/D to the number of days before/after 1970-01-01.
+// Probably overflows for years outside [-292277022656:292277026595].
+CONSTEXPR_F diff_t ymd_ord(year_t y, month_t m, day_t d) noexcept {
+  const diff_t eyear = (m <= 2) ? y - 1 : y;
+  const diff_t era = (eyear >= 0 ? eyear : eyear - 399) / 400;
+  const diff_t yoe = eyear - era * 400;
+  const diff_t doy = (153 * (m + (m > 2 ? -3 : 9)) + 2) / 5 + d - 1;
+  const diff_t doe = yoe * 365 + yoe / 4 - yoe / 100 + doy;
+  return era * 146097 + doe - 719468;
+}
+
+// Returns the difference in days between two normalized Y-M-D tuples.
+// ymd_ord() will encounter integer overflow given extreme year values,
+// yet the difference between two such extreme values may actually be
+// small, so we take a little care to avoid overflow when possible by
+// exploiting the 146097-day cycle.
+CONSTEXPR_F diff_t day_difference(year_t y1, month_t m1, day_t d1,
+                                  year_t y2, month_t m2, day_t d2) noexcept {
+  const diff_t a_c4_off = y1 % 400;
+  const diff_t b_c4_off = y2 % 400;
+  diff_t c4_diff = (y1 - a_c4_off) - (y2 - b_c4_off);
+  diff_t delta = ymd_ord(a_c4_off, m1, d1) - ymd_ord(b_c4_off, m2, d2);
+  if (c4_diff > 0 && delta < 0) {
+    delta += 2 * 146097;
+    c4_diff -= 2 * 400;
+  } else if (c4_diff < 0 && delta > 0) {
+    delta -= 2 * 146097;
+    c4_diff += 2 * 400;
+  }
+  return (c4_diff / 400 * 146097) + delta;
+}
+
+}  // namespace impl
+
+// Returns the difference between fields structs using the indicated unit.
+CONSTEXPR_F diff_t difference(year_tag, fields f1, fields f2) noexcept {
+  return f1.y - f2.y;
+}
+CONSTEXPR_F diff_t difference(month_tag, fields f1, fields f2) noexcept {
+  return impl::scale_add(difference(year_tag{}, f1, f2), 12, (f1.m - f2.m));
+}
+CONSTEXPR_F diff_t difference(day_tag, fields f1, fields f2) noexcept {
+  return impl::day_difference(f1.y, f1.m, f1.d, f2.y, f2.m, f2.d);
+}
+CONSTEXPR_F diff_t difference(hour_tag, fields f1, fields f2) noexcept {
+  return impl::scale_add(difference(day_tag{}, f1, f2), 24, (f1.hh - f2.hh));
+}
+CONSTEXPR_F diff_t difference(minute_tag, fields f1, fields f2) noexcept {
+  return impl::scale_add(difference(hour_tag{}, f1, f2), 60, (f1.mm - f2.mm));
+}
+CONSTEXPR_F diff_t difference(second_tag, fields f1, fields f2) noexcept {
+  return impl::scale_add(difference(minute_tag{}, f1, f2), 60, f1.ss - f2.ss);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+// Aligns the (normalized) fields struct to the indicated field.
+CONSTEXPR_F fields align(second_tag, fields f) noexcept {
+  return f;
+}
+CONSTEXPR_F fields align(minute_tag, fields f) noexcept {
+  return fields{f.y, f.m, f.d, f.hh, f.mm, 0};
+}
+CONSTEXPR_F fields align(hour_tag, fields f) noexcept {
+  return fields{f.y, f.m, f.d, f.hh, 0, 0};
+}
+CONSTEXPR_F fields align(day_tag, fields f) noexcept {
+  return fields{f.y, f.m, f.d, 0, 0, 0};
+}
+CONSTEXPR_F fields align(month_tag, fields f) noexcept {
+  return fields{f.y, f.m, 1, 0, 0, 0};
+}
+CONSTEXPR_F fields align(year_tag, fields f) noexcept {
+  return fields{f.y, 1, 1, 0, 0, 0};
+}
+
+////////////////////////////////////////////////////////////////////////
+
+namespace impl {
+
+template <typename H>
+H AbslHashValueImpl(second_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m, f.d, f.hh, f.mm, f.ss);
+}
+template <typename H>
+H AbslHashValueImpl(minute_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m, f.d, f.hh, f.mm);
+}
+template <typename H>
+H AbslHashValueImpl(hour_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m, f.d, f.hh);
+}
+template <typename H>
+H AbslHashValueImpl(day_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m, f.d);
+}
+template <typename H>
+H AbslHashValueImpl(month_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m);
+}
+template <typename H>
+H AbslHashValueImpl(year_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y);
+}
+
+}  // namespace impl
+
+////////////////////////////////////////////////////////////////////////
+
+template <typename T>
+class civil_time {
+ public:
+  explicit CONSTEXPR_M civil_time(year_t y, diff_t m = 1, diff_t d = 1,
+                                  diff_t hh = 0, diff_t mm = 0,
+                                  diff_t ss = 0) noexcept
+      : civil_time(impl::n_sec(y, m, d, hh, mm, ss)) {}
+
+  CONSTEXPR_M civil_time() noexcept : f_{1970, 1, 1, 0, 0, 0} {}
+  civil_time(const civil_time&) = default;
+  civil_time& operator=(const civil_time&) = default;
+
+  // Conversion between civil times of different alignment. Conversion to
+  // a more precise alignment is allowed implicitly (e.g., day -> hour),
+  // but conversion where information is discarded must be explicit
+  // (e.g., second -> minute).
+  template <typename U, typename S>
+  using preserves_data =
+      typename std::enable_if<std::is_base_of<U, S>::value>::type;
+  template <typename U>
+  CONSTEXPR_M civil_time(const civil_time<U>& ct,
+                         preserves_data<T, U>* = nullptr) noexcept
+      : civil_time(ct.f_) {}
+  template <typename U>
+  explicit CONSTEXPR_M civil_time(const civil_time<U>& ct,
+                                  preserves_data<U, T>* = nullptr) noexcept
+      : civil_time(ct.f_) {}
+
+  // Factories for the maximum/minimum representable civil_time.
+  static CONSTEXPR_F civil_time (max)() {
+    const auto max_year = (std::numeric_limits<std::int_least64_t>::max)();
+    return civil_time(max_year, 12, 31, 23, 59, 59);
+  }
+  static CONSTEXPR_F civil_time (min)() {
+    const auto min_year = (std::numeric_limits<std::int_least64_t>::min)();
+    return civil_time(min_year, 1, 1, 0, 0, 0);
+  }
+
+  // Field accessors.  Note: All but year() return an int.
+  CONSTEXPR_M year_t year() const noexcept { return f_.y; }
+  CONSTEXPR_M int month() const noexcept { return f_.m; }
+  CONSTEXPR_M int day() const noexcept { return f_.d; }
+  CONSTEXPR_M int hour() const noexcept { return f_.hh; }
+  CONSTEXPR_M int minute() const noexcept { return f_.mm; }
+  CONSTEXPR_M int second() const noexcept { return f_.ss; }
+
+  // Assigning arithmetic.
+  CONSTEXPR_M civil_time& operator+=(diff_t n) noexcept {
+    f_ = step(T{}, f_, n);
+    return *this;
+  }
+  CONSTEXPR_M civil_time& operator-=(diff_t n) noexcept {
+    if (n != (std::numeric_limits<diff_t>::min)()) {
+      f_ = step(T{}, f_, -n);
+    } else {
+      f_ = step(T{}, step(T{}, f_, -(n + 1)), 1);
+    }
+    return *this;
+  }
+  CONSTEXPR_M civil_time& operator++() noexcept {
+    return *this += 1;
+  }
+  CONSTEXPR_M civil_time operator++(int) noexcept {
+    const civil_time a = *this;
+    ++*this;
+    return a;
+  }
+  CONSTEXPR_M civil_time& operator--() noexcept {
+    return *this -= 1;
+  }
+  CONSTEXPR_M civil_time operator--(int) noexcept {
+    const civil_time a = *this;
+    --*this;
+    return a;
+  }
+
+  // Binary arithmetic operators.
+  friend CONSTEXPR_F civil_time operator+(civil_time a, diff_t n) noexcept {
+    return a += n;
+  }
+  friend CONSTEXPR_F civil_time operator+(diff_t n, civil_time a) noexcept {
+    return a += n;
+  }
+  friend CONSTEXPR_F civil_time operator-(civil_time a, diff_t n) noexcept {
+    return a -= n;
+  }
+  friend CONSTEXPR_F diff_t operator-(civil_time lhs, civil_time rhs) noexcept {
+    return difference(T{}, lhs.f_, rhs.f_);
+  }
+
+  template <typename H>
+  friend H AbslHashValue(H h, civil_time a) {
+    return impl::AbslHashValueImpl(T{}, std::move(h), a.f_);
+  }
+
+ private:
+  // All instantiations of this template are allowed to call the following
+  // private constructor and access the private fields member.
+  template <typename U>
+  friend class civil_time;
+
+  // The designated constructor that all others eventually call.
+  explicit CONSTEXPR_M civil_time(fields f) noexcept : f_(align(T{}, f)) {}
+
+  fields f_;
+};
+
+// Disallows difference between differently aligned types.
+// auto n = civil_day(...) - civil_hour(...);  // would be confusing.
+template <typename T, typename U>
+CONSTEXPR_F diff_t operator-(civil_time<T>, civil_time<U>) = delete;
+
+using civil_year = civil_time<year_tag>;
+using civil_month = civil_time<month_tag>;
+using civil_day = civil_time<day_tag>;
+using civil_hour = civil_time<hour_tag>;
+using civil_minute = civil_time<minute_tag>;
+using civil_second = civil_time<second_tag>;
+
+////////////////////////////////////////////////////////////////////////
+
+// Relational operators that work with differently aligned objects.
+// Always compares all six fields.
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator<(const civil_time<T1>& lhs,
+                           const civil_time<T2>& rhs) noexcept {
+  return (lhs.year() < rhs.year() ||
+          (lhs.year() == rhs.year() &&
+           (lhs.month() < rhs.month() ||
+            (lhs.month() == rhs.month() &&
+             (lhs.day() < rhs.day() ||
+              (lhs.day() == rhs.day() &&
+               (lhs.hour() < rhs.hour() ||
+                (lhs.hour() == rhs.hour() &&
+                 (lhs.minute() < rhs.minute() ||
+                  (lhs.minute() == rhs.minute() &&
+                   (lhs.second() < rhs.second())))))))))));
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator<=(const civil_time<T1>& lhs,
+                            const civil_time<T2>& rhs) noexcept {
+  return !(rhs < lhs);
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator>=(const civil_time<T1>& lhs,
+                            const civil_time<T2>& rhs) noexcept {
+  return !(lhs < rhs);
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator>(const civil_time<T1>& lhs,
+                           const civil_time<T2>& rhs) noexcept {
+  return rhs < lhs;
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator==(const civil_time<T1>& lhs,
+                            const civil_time<T2>& rhs) noexcept {
+  return lhs.year() == rhs.year() && lhs.month() == rhs.month() &&
+         lhs.day() == rhs.day() && lhs.hour() == rhs.hour() &&
+         lhs.minute() == rhs.minute() && lhs.second() == rhs.second();
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator!=(const civil_time<T1>& lhs,
+                            const civil_time<T2>& rhs) noexcept {
+  return !(lhs == rhs);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+enum class weekday {
+  monday,
+  tuesday,
+  wednesday,
+  thursday,
+  friday,
+  saturday,
+  sunday,
+};
+
+CONSTEXPR_F weekday get_weekday(const civil_second& cs) noexcept {
+  CONSTEXPR_D weekday k_weekday_by_mon_off[13] = {
+      weekday::monday,    weekday::tuesday,  weekday::wednesday,
+      weekday::thursday,  weekday::friday,   weekday::saturday,
+      weekday::sunday,    weekday::monday,   weekday::tuesday,
+      weekday::wednesday, weekday::thursday, weekday::friday,
+      weekday::saturday,
+  };
+  CONSTEXPR_D int k_weekday_offsets[1 + 12] = {
+      -1, 0, 3, 2, 5, 0, 3, 5, 1, 4, 6, 2, 4,
+  };
+  year_t wd = 2400 + (cs.year() % 400) - (cs.month() < 3);
+  wd += wd / 4 - wd / 100 + wd / 400;
+  wd += k_weekday_offsets[cs.month()] + cs.day();
+  return k_weekday_by_mon_off[wd % 7 + 6];
+}
+
+////////////////////////////////////////////////////////////////////////
+
+CONSTEXPR_F civil_day next_weekday(civil_day cd, weekday wd) noexcept {
+  CONSTEXPR_D weekday k_weekdays_forw[14] = {
+      weekday::monday,    weekday::tuesday,  weekday::wednesday,
+      weekday::thursday,  weekday::friday,   weekday::saturday,
+      weekday::sunday,    weekday::monday,   weekday::tuesday,
+      weekday::wednesday, weekday::thursday, weekday::friday,
+      weekday::saturday,  weekday::sunday,
+  };
+  weekday base = get_weekday(cd);
+  for (int i = 0;; ++i) {
+    if (base == k_weekdays_forw[i]) {
+      for (int j = i + 1;; ++j) {
+        if (wd == k_weekdays_forw[j]) {
+          return cd + (j - i);
+        }
+      }
+    }
+  }
+}
+
+CONSTEXPR_F civil_day prev_weekday(civil_day cd, weekday wd) noexcept {
+  CONSTEXPR_D weekday k_weekdays_back[14] = {
+      weekday::sunday,   weekday::saturday,  weekday::friday,
+      weekday::thursday, weekday::wednesday, weekday::tuesday,
+      weekday::monday,   weekday::sunday,    weekday::saturday,
+      weekday::friday,   weekday::thursday,  weekday::wednesday,
+      weekday::tuesday,  weekday::monday,
+  };
+  weekday base = get_weekday(cd);
+  for (int i = 0;; ++i) {
+    if (base == k_weekdays_back[i]) {
+      for (int j = i + 1;; ++j) {
+        if (wd == k_weekdays_back[j]) {
+          return cd - (j - i);
+        }
+      }
+    }
+  }
+}
+
+CONSTEXPR_F int get_yearday(const civil_second& cs) noexcept {
+  CONSTEXPR_D int k_month_offsets[1 + 12] = {
+      -1, 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334,
+  };
+  const int feb29 = (cs.month() > 2 && impl::is_leap_year(cs.year()));
+  return k_month_offsets[cs.month()] + feb29 + cs.day();
+}
+
+////////////////////////////////////////////////////////////////////////
+
+std::ostream& operator<<(std::ostream& os, const civil_year& y);
+std::ostream& operator<<(std::ostream& os, const civil_month& m);
+std::ostream& operator<<(std::ostream& os, const civil_day& d);
+std::ostream& operator<<(std::ostream& os, const civil_hour& h);
+std::ostream& operator<<(std::ostream& os, const civil_minute& m);
+std::ostream& operator<<(std::ostream& os, const civil_second& s);
+std::ostream& operator<<(std::ostream& os, weekday wd);
+
+}  // namespace detail
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#undef CONSTEXPR_M
+#undef CONSTEXPR_F
+#undef CONSTEXPR_D
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
diff --git a/absl/time/internal/cctz/include/cctz/time_zone.h b/absl/time/internal/cctz/include/cctz/time_zone.h
new file mode 100644
index 0000000..ef6c4ba
--- /dev/null
+++ b/absl/time/internal/cctz/include/cctz/time_zone.h
@@ -0,0 +1,385 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+// A library for translating between absolute times (represented by
+// std::chrono::time_points of the std::chrono::system_clock) and civil
+// times (represented by cctz::civil_second) using the rules defined by
+// a time zone (cctz::time_zone).
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
+
+#include <chrono>
+#include <cstdint>
+#include <string>
+#include <utility>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// Convenience aliases. Not intended as public API points.
+template <typename D>
+using time_point = std::chrono::time_point<std::chrono::system_clock, D>;
+using seconds = std::chrono::duration<std::int_fast64_t>;
+using sys_seconds = seconds;  // Deprecated.  Use cctz::seconds instead.
+
+namespace detail {
+template <typename D>
+inline std::pair<time_point<seconds>, D>
+split_seconds(const time_point<D>& tp) {
+  auto sec = std::chrono::time_point_cast<seconds>(tp);
+  auto sub = tp - sec;
+  if (sub.count() < 0) {
+    sec -= seconds(1);
+    sub += seconds(1);
+  }
+  return {sec, std::chrono::duration_cast<D>(sub)};
+}
+inline std::pair<time_point<seconds>, seconds>
+split_seconds(const time_point<seconds>& tp) {
+  return {tp, seconds::zero()};
+}
+}  // namespace detail
+
+// cctz::time_zone is an opaque, small, value-type class representing a
+// geo-political region within which particular rules are used for mapping
+// between absolute and civil times. Time zones are named using the TZ
+// identifiers from the IANA Time Zone Database, such as "America/Los_Angeles"
+// or "Australia/Sydney". Time zones are created from factory functions such
+// as load_time_zone(). Note: strings like "PST" and "EDT" are not valid TZ
+// identifiers.
+//
+// Example:
+//   cctz::time_zone utc = cctz::utc_time_zone();
+//   cctz::time_zone pst = cctz::fixed_time_zone(std::chrono::hours(-8));
+//   cctz::time_zone loc = cctz::local_time_zone();
+//   cctz::time_zone lax;
+//   if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+//
+// See also:
+// - http://www.iana.org/time-zones
+// - https://en.wikipedia.org/wiki/Zoneinfo
+class time_zone {
+ public:
+  time_zone() : time_zone(nullptr) {}  // Equivalent to UTC
+  time_zone(const time_zone&) = default;
+  time_zone& operator=(const time_zone&) = default;
+
+  std::string name() const;
+
+  // An absolute_lookup represents the civil time (cctz::civil_second) within
+  // this time_zone at the given absolute time (time_point). There are
+  // additionally a few other fields that may be useful when working with
+  // older APIs, such as std::tm.
+  //
+  // Example:
+  //   const cctz::time_zone tz = ...
+  //   const auto tp = std::chrono::system_clock::now();
+  //   const cctz::time_zone::absolute_lookup al = tz.lookup(tp);
+  struct absolute_lookup {
+    civil_second cs;
+    // Note: The following fields exist for backward compatibility with older
+    // APIs. Accessing these fields directly is a sign of imprudent logic in
+    // the calling code. Modern time-related code should only access this data
+    // indirectly by way of cctz::format().
+    int offset;        // civil seconds east of UTC
+    bool is_dst;       // is offset non-standard?
+    const char* abbr;  // time-zone abbreviation (e.g., "PST")
+  };
+  absolute_lookup lookup(const time_point<seconds>& tp) const;
+  template <typename D>
+  absolute_lookup lookup(const time_point<D>& tp) const {
+    return lookup(detail::split_seconds(tp).first);
+  }
+
+  // A civil_lookup represents the absolute time(s) (time_point) that
+  // correspond to the given civil time (cctz::civil_second) within this
+  // time_zone. Usually the given civil time represents a unique instant
+  // in time, in which case the conversion is unambiguous. However,
+  // within this time zone, the given civil time may be skipped (e.g.,
+  // during a positive UTC offset shift), or repeated (e.g., during a
+  // negative UTC offset shift). To account for these possibilities,
+  // civil_lookup is richer than just a single time_point.
+  //
+  // In all cases the civil_lookup::kind enum will indicate the nature
+  // of the given civil-time argument, and the pre, trans, and post
+  // members will give the absolute time answers using the pre-transition
+  // offset, the transition point itself, and the post-transition offset,
+  // respectively (all three times are equal if kind == UNIQUE). If any
+  // of these three absolute times is outside the representable range of a
+  // time_point<seconds> the field is set to its maximum/minimum value.
+  //
+  // Example:
+  //   cctz::time_zone lax;
+  //   if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+  //
+  //   // A unique civil time.
+  //   auto jan01 = lax.lookup(cctz::civil_second(2011, 1, 1, 0, 0, 0));
+  //   // jan01.kind == cctz::time_zone::civil_lookup::UNIQUE
+  //   // jan01.pre    is 2011/01/01 00:00:00 -0800
+  //   // jan01.trans  is 2011/01/01 00:00:00 -0800
+  //   // jan01.post   is 2011/01/01 00:00:00 -0800
+  //
+  //   // A Spring DST transition, when there is a gap in civil time.
+  //   auto mar13 = lax.lookup(cctz::civil_second(2011, 3, 13, 2, 15, 0));
+  //   // mar13.kind == cctz::time_zone::civil_lookup::SKIPPED
+  //   // mar13.pre   is 2011/03/13 03:15:00 -0700
+  //   // mar13.trans is 2011/03/13 03:00:00 -0700
+  //   // mar13.post  is 2011/03/13 01:15:00 -0800
+  //
+  //   // A Fall DST transition, when civil times are repeated.
+  //   auto nov06 = lax.lookup(cctz::civil_second(2011, 11, 6, 1, 15, 0));
+  //   // nov06.kind == cctz::time_zone::civil_lookup::REPEATED
+  //   // nov06.pre   is 2011/11/06 01:15:00 -0700
+  //   // nov06.trans is 2011/11/06 01:00:00 -0800
+  //   // nov06.post  is 2011/11/06 01:15:00 -0800
+  struct civil_lookup {
+    enum civil_kind {
+      UNIQUE,    // the civil time was singular (pre == trans == post)
+      SKIPPED,   // the civil time did not exist (pre >= trans > post)
+      REPEATED,  // the civil time was ambiguous (pre < trans <= post)
+    } kind;
+    time_point<seconds> pre;    // uses the pre-transition offset
+    time_point<seconds> trans;  // instant of civil-offset change
+    time_point<seconds> post;   // uses the post-transition offset
+  };
+  civil_lookup lookup(const civil_second& cs) const;
+
+  // Finds the time of the next/previous offset change in this time zone.
+  //
+  // By definition, next_transition(tp, &trans) returns false when tp has
+  // its maximum value, and prev_transition(tp, &trans) returns false
+  // when tp has its minimum value. If the zone has no transitions, the
+  // result will also be false no matter what the argument.
+  //
+  // Otherwise, when tp has its minimum value, next_transition(tp, &trans)
+  // returns true and sets trans to the first recorded transition. Chains
+  // of calls to next_transition()/prev_transition() will eventually return
+  // false, but it is unspecified exactly when next_transition(tp, &trans)
+  // jumps to false, or what time is set by prev_transition(tp, &trans) for
+  // a very distant tp.
+  //
+  // Note: Enumeration of time-zone transitions is for informational purposes
+  // only. Modern time-related code should not care about when offset changes
+  // occur.
+  //
+  // Example:
+  //   cctz::time_zone nyc;
+  //   if (!cctz::load_time_zone("America/New_York", &nyc)) { ... }
+  //   const auto now = std::chrono::system_clock::now();
+  //   auto tp = cctz::time_point<cctz::seconds>::min();
+  //   cctz::time_zone::civil_transition trans;
+  //   while (tp <= now && nyc.next_transition(tp, &trans)) {
+  //     // transition: trans.from -> trans.to
+  //     tp = nyc.lookup(trans.to).trans;
+  //   }
+  struct civil_transition {
+    civil_second from;  // the civil time we jump from
+    civil_second to;    // the civil time we jump to
+  };
+  bool next_transition(const time_point<seconds>& tp,
+                       civil_transition* trans) const;
+  template <typename D>
+  bool next_transition(const time_point<D>& tp,
+                       civil_transition* trans) const {
+    return next_transition(detail::split_seconds(tp).first, trans);
+  }
+  bool prev_transition(const time_point<seconds>& tp,
+                       civil_transition* trans) const;
+  template <typename D>
+  bool prev_transition(const time_point<D>& tp,
+                       civil_transition* trans) const {
+    return prev_transition(detail::split_seconds(tp).first, trans);
+  }
+
+  // version() and description() provide additional information about the
+  // time zone. The content of each of the returned strings is unspecified,
+  // however, when the IANA Time Zone Database is the underlying data source
+  // the version() std::string will be in the familar form (e.g, "2018e") or
+  // empty when unavailable.
+  //
+  // Note: These functions are for informational or testing purposes only.
+  std::string version() const;  // empty when unknown
+  std::string description() const;
+
+  // Relational operators.
+  friend bool operator==(time_zone lhs, time_zone rhs) {
+    return &lhs.effective_impl() == &rhs.effective_impl();
+  }
+  friend bool operator!=(time_zone lhs, time_zone rhs) {
+    return !(lhs == rhs);
+  }
+
+  template <typename H>
+  friend H AbslHashValue(H h, time_zone tz) {
+    return H::combine(std::move(h), &tz.effective_impl());
+  }
+
+  class Impl;
+
+ private:
+  explicit time_zone(const Impl* impl) : impl_(impl) {}
+  const Impl& effective_impl() const;  // handles implicit UTC
+  const Impl* impl_;
+};
+
+// Loads the named time zone. May perform I/O on the initial load.
+// If the name is invalid, or some other kind of error occurs, returns
+// false and "*tz" is set to the UTC time zone.
+bool load_time_zone(const std::string& name, time_zone* tz);
+
+// Returns a time_zone representing UTC. Cannot fail.
+time_zone utc_time_zone();
+
+// Returns a time zone that is a fixed offset (seconds east) from UTC.
+// Note: If the absolute value of the offset is greater than 24 hours
+// you'll get UTC (i.e., zero offset) instead.
+time_zone fixed_time_zone(const seconds& offset);
+
+// Returns a time zone representing the local time zone. Falls back to UTC.
+// Note: local_time_zone.name() may only be something like "localtime".
+time_zone local_time_zone();
+
+// Returns the civil time (cctz::civil_second) within the given time zone at
+// the given absolute time (time_point). Since the additional fields provided
+// by the time_zone::absolute_lookup struct should rarely be needed in modern
+// code, this convert() function is simpler and should be preferred.
+template <typename D>
+inline civil_second convert(const time_point<D>& tp, const time_zone& tz) {
+  return tz.lookup(tp).cs;
+}
+
+// Returns the absolute time (time_point) that corresponds to the given civil
+// time within the given time zone. If the civil time is not unique (i.e., if
+// it was either repeated or non-existent), then the returned time_point is
+// the best estimate that preserves relative order. That is, this function
+// guarantees that if cs1 < cs2, then convert(cs1, tz) <= convert(cs2, tz).
+inline time_point<seconds> convert(const civil_second& cs,
+                                   const time_zone& tz) {
+  const time_zone::civil_lookup cl = tz.lookup(cs);
+  if (cl.kind == time_zone::civil_lookup::SKIPPED) return cl.trans;
+  return cl.pre;
+}
+
+namespace detail {
+using femtoseconds = std::chrono::duration<std::int_fast64_t, std::femto>;
+std::string format(const std::string&, const time_point<seconds>&,
+                   const femtoseconds&, const time_zone&);
+bool parse(const std::string&, const std::string&, const time_zone&,
+           time_point<seconds>*, femtoseconds*, std::string* err = nullptr);
+}  // namespace detail
+
+// Formats the given time_point in the given cctz::time_zone according to
+// the provided format string. Uses strftime()-like formatting options,
+// with the following extensions:
+//
+//   - %Ez  - RFC3339-compatible numeric UTC offset (+hh:mm or -hh:mm)
+//   - %E*z - Full-resolution numeric UTC offset (+hh:mm:ss or -hh:mm:ss)
+//   - %E#S - Seconds with # digits of fractional precision
+//   - %E*S - Seconds with full fractional precision (a literal '*')
+//   - %E#f - Fractional seconds with # digits of precision
+//   - %E*f - Fractional seconds with full precision (a literal '*')
+//   - %E4Y - Four-character years (-999 ... -001, 0000, 0001 ... 9999)
+//
+// Note that %E0S behaves like %S, and %E0f produces no characters. In
+// contrast %E*f always produces at least one digit, which may be '0'.
+//
+// Note that %Y produces as many characters as it takes to fully render the
+// year. A year outside of [-999:9999] when formatted with %E4Y will produce
+// more than four characters, just like %Y.
+//
+// Tip: Format strings should include the UTC offset (e.g., %z, %Ez, or %E*z)
+// so that the resulting string uniquely identifies an absolute time.
+//
+// Example:
+//   cctz::time_zone lax;
+//   if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+//   auto tp = cctz::convert(cctz::civil_second(2013, 1, 2, 3, 4, 5), lax);
+//   std::string f = cctz::format("%H:%M:%S", tp, lax);  // "03:04:05"
+//   f = cctz::format("%H:%M:%E3S", tp, lax);            // "03:04:05.000"
+template <typename D>
+inline std::string format(const std::string& fmt, const time_point<D>& tp,
+                          const time_zone& tz) {
+  const auto p = detail::split_seconds(tp);
+  const auto n = std::chrono::duration_cast<detail::femtoseconds>(p.second);
+  return detail::format(fmt, p.first, n, tz);
+}
+
+// Parses an input string according to the provided format string and
+// returns the corresponding time_point. Uses strftime()-like formatting
+// options, with the same extensions as cctz::format(), but with the
+// exceptions that %E#S is interpreted as %E*S, and %E#f as %E*f. %Ez
+// and %E*z also accept the same inputs.
+//
+// %Y consumes as many numeric characters as it can, so the matching data
+// should always be terminated with a non-numeric. %E4Y always consumes
+// exactly four characters, including any sign.
+//
+// Unspecified fields are taken from the default date and time of ...
+//
+//   "1970-01-01 00:00:00.0 +0000"
+//
+// For example, parsing a string of "15:45" (%H:%M) will return a time_point
+// that represents "1970-01-01 15:45:00.0 +0000".
+//
+// Note that parse() returns time instants, so it makes most sense to parse
+// fully-specified date/time strings that include a UTC offset (%z, %Ez, or
+// %E*z).
+//
+// Note also that parse() only heeds the fields year, month, day, hour,
+// minute, (fractional) second, and UTC offset. Other fields, like weekday (%a
+// or %A), while parsed for syntactic validity, are ignored in the conversion.
+//
+// Date and time fields that are out-of-range will be treated as errors rather
+// than normalizing them like cctz::civil_second() would do. For example, it
+// is an error to parse the date "Oct 32, 2013" because 32 is out of range.
+//
+// A second of ":60" is normalized to ":00" of the following minute with
+// fractional seconds discarded. The following table shows how the given
+// seconds and subseconds will be parsed:
+//
+//   "59.x" -> 59.x  // exact
+//   "60.x" -> 00.0  // normalized
+//   "00.x" -> 00.x  // exact
+//
+// Errors are indicated by returning false.
+//
+// Example:
+//   const cctz::time_zone tz = ...
+//   std::chrono::system_clock::time_point tp;
+//   if (cctz::parse("%Y-%m-%d", "2015-10-09", tz, &tp)) {
+//     ...
+//   }
+template <typename D>
+inline bool parse(const std::string& fmt, const std::string& input,
+                  const time_zone& tz, time_point<D>* tpp) {
+  time_point<seconds> sec;
+  detail::femtoseconds fs;
+  const bool b = detail::parse(fmt, input, tz, &sec, &fs);
+  if (b) {
+    // TODO: Return false if unrepresentable as a time_point<D>.
+    *tpp = std::chrono::time_point_cast<D>(sec);
+    *tpp += std::chrono::duration_cast<D>(fs);
+  }
+  return b;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
diff --git a/absl/time/internal/cctz/include/cctz/zone_info_source.h b/absl/time/internal/cctz/include/cctz/zone_info_source.h
new file mode 100644
index 0000000..2b898d1
--- /dev/null
+++ b/absl/time/internal/cctz/include/cctz/zone_info_source.h
@@ -0,0 +1,96 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
+#define ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
+
+#include <cstddef>
+#include <functional>
+#include <memory>
+#include <string>
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// A stdio-like interface for providing zoneinfo data for a particular zone.
+class ZoneInfoSource {
+ public:
+  virtual ~ZoneInfoSource();
+
+  virtual std::size_t Read(void* ptr, std::size_t size) = 0;  // like fread()
+  virtual int Skip(std::size_t offset) = 0;  // like fseek()
+
+  // Until the zoneinfo data supports versioning information, we provide
+  // a way for a ZoneInfoSource to indicate it out-of-band.  The default
+  // implementation returns an empty std::string.
+  virtual std::string Version() const;
+};
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+namespace absl {
+namespace time_internal {
+namespace cctz_extension {
+
+// A function-pointer type for a factory that returns a ZoneInfoSource
+// given the name of a time zone and a fallback factory.  Returns null
+// when the data for the named zone cannot be found.
+using ZoneInfoSourceFactory =
+    std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource> (*)(
+        const std::string&,
+        const std::function<std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource>(
+            const std::string&)>&);
+
+// The user can control the mapping of zone names to zoneinfo data by
+// providing a definition for cctz_extension::zone_info_source_factory.
+// For example, given functions my_factory() and my_other_factory() that
+// can return a ZoneInfoSource for a named zone, we could inject them into
+// cctz::load_time_zone() with:
+//
+//   namespace cctz_extension {
+//   namespace {
+//   std::unique_ptr<cctz::ZoneInfoSource> CustomFactory(
+//       const std::string& name,
+//       const std::function<std::unique_ptr<cctz::ZoneInfoSource>(
+//           const std::string& name)>& fallback_factory) {
+//     if (auto zip = my_factory(name)) return zip;
+//     if (auto zip = fallback_factory(name)) return zip;
+//     if (auto zip = my_other_factory(name)) return zip;
+//     return nullptr;
+//   }
+//   }  // namespace
+//   ZoneInfoSourceFactory zone_info_source_factory = CustomFactory;
+//   }  // namespace cctz_extension
+//
+// This might be used, say, to use zoneinfo data embedded in the program,
+// or read from a (possibly compressed) file archive, or both.
+//
+// cctz_extension::zone_info_source_factory() will be called:
+//   (1) from the same thread as the cctz::load_time_zone() call,
+//   (2) only once for any zone name, and
+//   (3) serially (i.e., no concurrent execution).
+//
+// The fallback factory obtains zoneinfo data by reading files in ${TZDIR},
+// and it is used automatically when no zone_info_source_factory definition
+// is linked into the program.
+extern ZoneInfoSourceFactory zone_info_source_factory;
+
+}  // namespace cctz_extension
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
diff --git a/absl/time/internal/cctz/src/cctz_benchmark.cc b/absl/time/internal/cctz/src/cctz_benchmark.cc
new file mode 100644
index 0000000..a40f504
--- /dev/null
+++ b/absl/time/internal/cctz/src/cctz_benchmark.cc
@@ -0,0 +1,1031 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <ctime>
+#include <random>
+#include <string>
+#include <vector>
+
+#include "benchmark/benchmark.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "time_zone_impl.h"
+
+namespace {
+
+namespace cctz = absl::time_internal::cctz;
+
+void BM_Difference_Days(benchmark::State& state) {
+  const cctz::civil_day c(2014, 8, 22);
+  const cctz::civil_day epoch(1970, 1, 1);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(c - epoch);
+  }
+}
+BENCHMARK(BM_Difference_Days);
+
+void BM_Step_Days(benchmark::State& state) {
+  const cctz::civil_day kStart(2014, 8, 22);
+  cctz::civil_day c = kStart;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(++c);
+  }
+}
+BENCHMARK(BM_Step_Days);
+
+void BM_GetWeekday(benchmark::State& state) {
+  const cctz::civil_day c(2014, 8, 22);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::get_weekday(c));
+  }
+}
+BENCHMARK(BM_GetWeekday);
+
+void BM_NextWeekday(benchmark::State& state) {
+  const cctz::civil_day kStart(2014, 8, 22);
+  const cctz::civil_day kDays[7] = {
+      kStart + 0, kStart + 1, kStart + 2, kStart + 3,
+      kStart + 4, kStart + 5, kStart + 6,
+  };
+  const cctz::weekday kWeekdays[7] = {
+      cctz::weekday::monday,   cctz::weekday::tuesday, cctz::weekday::wednesday,
+      cctz::weekday::thursday, cctz::weekday::friday,  cctz::weekday::saturday,
+      cctz::weekday::sunday,
+  };
+  while (state.KeepRunningBatch(7 * 7)) {
+    for (const auto from : kDays) {
+      for (const auto to : kWeekdays) {
+        benchmark::DoNotOptimize(cctz::next_weekday(from, to));
+      }
+    }
+  }
+}
+BENCHMARK(BM_NextWeekday);
+
+void BM_PrevWeekday(benchmark::State& state) {
+  const cctz::civil_day kStart(2014, 8, 22);
+  const cctz::civil_day kDays[7] = {
+      kStart + 0, kStart + 1, kStart + 2, kStart + 3,
+      kStart + 4, kStart + 5, kStart + 6,
+  };
+  const cctz::weekday kWeekdays[7] = {
+      cctz::weekday::monday,   cctz::weekday::tuesday, cctz::weekday::wednesday,
+      cctz::weekday::thursday, cctz::weekday::friday,  cctz::weekday::saturday,
+      cctz::weekday::sunday,
+  };
+  while (state.KeepRunningBatch(7 * 7)) {
+    for (const auto from : kDays) {
+      for (const auto to : kWeekdays) {
+        benchmark::DoNotOptimize(cctz::prev_weekday(from, to));
+      }
+    }
+  }
+}
+BENCHMARK(BM_PrevWeekday);
+
+const char RFC3339_full[] = "%Y-%m-%dT%H:%M:%E*S%Ez";
+const char RFC3339_sec[] = "%Y-%m-%dT%H:%M:%S%Ez";
+
+const char RFC1123_full[] = "%a, %d %b %Y %H:%M:%S %z";
+const char RFC1123_no_wday[] = "%d %b %Y %H:%M:%S %z";
+
+// A list of known time-zone names.
+// TODO: Refactor with src/time_zone_lookup_test.cc.
+const char* const kTimeZoneNames[] = {
+  "Africa/Abidjan",
+  "Africa/Accra",
+  "Africa/Addis_Ababa",
+  "Africa/Algiers",
+  "Africa/Asmara",
+  "Africa/Asmera",
+  "Africa/Bamako",
+  "Africa/Bangui",
+  "Africa/Banjul",
+  "Africa/Bissau",
+  "Africa/Blantyre",
+  "Africa/Brazzaville",
+  "Africa/Bujumbura",
+  "Africa/Cairo",
+  "Africa/Casablanca",
+  "Africa/Ceuta",
+  "Africa/Conakry",
+  "Africa/Dakar",
+  "Africa/Dar_es_Salaam",
+  "Africa/Djibouti",
+  "Africa/Douala",
+  "Africa/El_Aaiun",
+  "Africa/Freetown",
+  "Africa/Gaborone",
+  "Africa/Harare",
+  "Africa/Johannesburg",
+  "Africa/Juba",
+  "Africa/Kampala",
+  "Africa/Khartoum",
+  "Africa/Kigali",
+  "Africa/Kinshasa",
+  "Africa/Lagos",
+  "Africa/Libreville",
+  "Africa/Lome",
+  "Africa/Luanda",
+  "Africa/Lubumbashi",
+  "Africa/Lusaka",
+  "Africa/Malabo",
+  "Africa/Maputo",
+  "Africa/Maseru",
+  "Africa/Mbabane",
+  "Africa/Mogadishu",
+  "Africa/Monrovia",
+  "Africa/Nairobi",
+  "Africa/Ndjamena",
+  "Africa/Niamey",
+  "Africa/Nouakchott",
+  "Africa/Ouagadougou",
+  "Africa/Porto-Novo",
+  "Africa/Sao_Tome",
+  "Africa/Timbuktu",
+  "Africa/Tripoli",
+  "Africa/Tunis",
+  "Africa/Windhoek",
+  "America/Adak",
+  "America/Anchorage",
+  "America/Anguilla",
+  "America/Antigua",
+  "America/Araguaina",
+  "America/Argentina/Buenos_Aires",
+  "America/Argentina/Catamarca",
+  "America/Argentina/ComodRivadavia",
+  "America/Argentina/Cordoba",
+  "America/Argentina/Jujuy",
+  "America/Argentina/La_Rioja",
+  "America/Argentina/Mendoza",
+  "America/Argentina/Rio_Gallegos",
+  "America/Argentina/Salta",
+  "America/Argentina/San_Juan",
+  "America/Argentina/San_Luis",
+  "America/Argentina/Tucuman",
+  "America/Argentina/Ushuaia",
+  "America/Aruba",
+  "America/Asuncion",
+  "America/Atikokan",
+  "America/Atka",
+  "America/Bahia",
+  "America/Bahia_Banderas",
+  "America/Barbados",
+  "America/Belem",
+  "America/Belize",
+  "America/Blanc-Sablon",
+  "America/Boa_Vista",
+  "America/Bogota",
+  "America/Boise",
+  "America/Buenos_Aires",
+  "America/Cambridge_Bay",
+  "America/Campo_Grande",
+  "America/Cancun",
+  "America/Caracas",
+  "America/Catamarca",
+  "America/Cayenne",
+  "America/Cayman",
+  "America/Chicago",
+  "America/Chihuahua",
+  "America/Coral_Harbour",
+  "America/Cordoba",
+  "America/Costa_Rica",
+  "America/Creston",
+  "America/Cuiaba",
+  "America/Curacao",
+  "America/Danmarkshavn",
+  "America/Dawson",
+  "America/Dawson_Creek",
+  "America/Denver",
+  "America/Detroit",
+  "America/Dominica",
+  "America/Edmonton",
+  "America/Eirunepe",
+  "America/El_Salvador",
+  "America/Ensenada",
+  "America/Fort_Nelson",
+  "America/Fort_Wayne",
+  "America/Fortaleza",
+  "America/Glace_Bay",
+  "America/Godthab",
+  "America/Goose_Bay",
+  "America/Grand_Turk",
+  "America/Grenada",
+  "America/Guadeloupe",
+  "America/Guatemala",
+  "America/Guayaquil",
+  "America/Guyana",
+  "America/Halifax",
+  "America/Havana",
+  "America/Hermosillo",
+  "America/Indiana/Indianapolis",
+  "America/Indiana/Knox",
+  "America/Indiana/Marengo",
+  "America/Indiana/Petersburg",
+  "America/Indiana/Tell_City",
+  "America/Indiana/Vevay",
+  "America/Indiana/Vincennes",
+  "America/Indiana/Winamac",
+  "America/Indianapolis",
+  "America/Inuvik",
+  "America/Iqaluit",
+  "America/Jamaica",
+  "America/Jujuy",
+  "America/Juneau",
+  "America/Kentucky/Louisville",
+  "America/Kentucky/Monticello",
+  "America/Knox_IN",
+  "America/Kralendijk",
+  "America/La_Paz",
+  "America/Lima",
+  "America/Los_Angeles",
+  "America/Louisville",
+  "America/Lower_Princes",
+  "America/Maceio",
+  "America/Managua",
+  "America/Manaus",
+  "America/Marigot",
+  "America/Martinique",
+  "America/Matamoros",
+  "America/Mazatlan",
+  "America/Mendoza",
+  "America/Menominee",
+  "America/Merida",
+  "America/Metlakatla",
+  "America/Mexico_City",
+  "America/Miquelon",
+  "America/Moncton",
+  "America/Monterrey",
+  "America/Montevideo",
+  "America/Montreal",
+  "America/Montserrat",
+  "America/Nassau",
+  "America/New_York",
+  "America/Nipigon",
+  "America/Nome",
+  "America/Noronha",
+  "America/North_Dakota/Beulah",
+  "America/North_Dakota/Center",
+  "America/North_Dakota/New_Salem",
+  "America/Ojinaga",
+  "America/Panama",
+  "America/Pangnirtung",
+  "America/Paramaribo",
+  "America/Phoenix",
+  "America/Port-au-Prince",
+  "America/Port_of_Spain",
+  "America/Porto_Acre",
+  "America/Porto_Velho",
+  "America/Puerto_Rico",
+  "America/Punta_Arenas",
+  "America/Rainy_River",
+  "America/Rankin_Inlet",
+  "America/Recife",
+  "America/Regina",
+  "America/Resolute",
+  "America/Rio_Branco",
+  "America/Rosario",
+  "America/Santa_Isabel",
+  "America/Santarem",
+  "America/Santiago",
+  "America/Santo_Domingo",
+  "America/Sao_Paulo",
+  "America/Scoresbysund",
+  "America/Shiprock",
+  "America/Sitka",
+  "America/St_Barthelemy",
+  "America/St_Johns",
+  "America/St_Kitts",
+  "America/St_Lucia",
+  "America/St_Thomas",
+  "America/St_Vincent",
+  "America/Swift_Current",
+  "America/Tegucigalpa",
+  "America/Thule",
+  "America/Thunder_Bay",
+  "America/Tijuana",
+  "America/Toronto",
+  "America/Tortola",
+  "America/Vancouver",
+  "America/Virgin",
+  "America/Whitehorse",
+  "America/Winnipeg",
+  "America/Yakutat",
+  "America/Yellowknife",
+  "Antarctica/Casey",
+  "Antarctica/Davis",
+  "Antarctica/DumontDUrville",
+  "Antarctica/Macquarie",
+  "Antarctica/Mawson",
+  "Antarctica/McMurdo",
+  "Antarctica/Palmer",
+  "Antarctica/Rothera",
+  "Antarctica/South_Pole",
+  "Antarctica/Syowa",
+  "Antarctica/Troll",
+  "Antarctica/Vostok",
+  "Arctic/Longyearbyen",
+  "Asia/Aden",
+  "Asia/Almaty",
+  "Asia/Amman",
+  "Asia/Anadyr",
+  "Asia/Aqtau",
+  "Asia/Aqtobe",
+  "Asia/Ashgabat",
+  "Asia/Ashkhabad",
+  "Asia/Atyrau",
+  "Asia/Baghdad",
+  "Asia/Bahrain",
+  "Asia/Baku",
+  "Asia/Bangkok",
+  "Asia/Barnaul",
+  "Asia/Beirut",
+  "Asia/Bishkek",
+  "Asia/Brunei",
+  "Asia/Calcutta",
+  "Asia/Chita",
+  "Asia/Choibalsan",
+  "Asia/Chongqing",
+  "Asia/Chungking",
+  "Asia/Colombo",
+  "Asia/Dacca",
+  "Asia/Damascus",
+  "Asia/Dhaka",
+  "Asia/Dili",
+  "Asia/Dubai",
+  "Asia/Dushanbe",
+  "Asia/Famagusta",
+  "Asia/Gaza",
+  "Asia/Harbin",
+  "Asia/Hebron",
+  "Asia/Ho_Chi_Minh",
+  "Asia/Hong_Kong",
+  "Asia/Hovd",
+  "Asia/Irkutsk",
+  "Asia/Istanbul",
+  "Asia/Jakarta",
+  "Asia/Jayapura",
+  "Asia/Jerusalem",
+  "Asia/Kabul",
+  "Asia/Kamchatka",
+  "Asia/Karachi",
+  "Asia/Kashgar",
+  "Asia/Kathmandu",
+  "Asia/Katmandu",
+  "Asia/Khandyga",
+  "Asia/Kolkata",
+  "Asia/Krasnoyarsk",
+  "Asia/Kuala_Lumpur",
+  "Asia/Kuching",
+  "Asia/Kuwait",
+  "Asia/Macao",
+  "Asia/Macau",
+  "Asia/Magadan",
+  "Asia/Makassar",
+  "Asia/Manila",
+  "Asia/Muscat",
+  "Asia/Nicosia",
+  "Asia/Novokuznetsk",
+  "Asia/Novosibirsk",
+  "Asia/Omsk",
+  "Asia/Oral",
+  "Asia/Phnom_Penh",
+  "Asia/Pontianak",
+  "Asia/Pyongyang",
+  "Asia/Qatar",
+  "Asia/Qostanay",
+  "Asia/Qyzylorda",
+  "Asia/Rangoon",
+  "Asia/Riyadh",
+  "Asia/Saigon",
+  "Asia/Sakhalin",
+  "Asia/Samarkand",
+  "Asia/Seoul",
+  "Asia/Shanghai",
+  "Asia/Singapore",
+  "Asia/Srednekolymsk",
+  "Asia/Taipei",
+  "Asia/Tashkent",
+  "Asia/Tbilisi",
+  "Asia/Tehran",
+  "Asia/Tel_Aviv",
+  "Asia/Thimbu",
+  "Asia/Thimphu",
+  "Asia/Tokyo",
+  "Asia/Tomsk",
+  "Asia/Ujung_Pandang",
+  "Asia/Ulaanbaatar",
+  "Asia/Ulan_Bator",
+  "Asia/Urumqi",
+  "Asia/Ust-Nera",
+  "Asia/Vientiane",
+  "Asia/Vladivostok",
+  "Asia/Yakutsk",
+  "Asia/Yangon",
+  "Asia/Yekaterinburg",
+  "Asia/Yerevan",
+  "Atlantic/Azores",
+  "Atlantic/Bermuda",
+  "Atlantic/Canary",
+  "Atlantic/Cape_Verde",
+  "Atlantic/Faeroe",
+  "Atlantic/Faroe",
+  "Atlantic/Jan_Mayen",
+  "Atlantic/Madeira",
+  "Atlantic/Reykjavik",
+  "Atlantic/South_Georgia",
+  "Atlantic/St_Helena",
+  "Atlantic/Stanley",
+  "Australia/ACT",
+  "Australia/Adelaide",
+  "Australia/Brisbane",
+  "Australia/Broken_Hill",
+  "Australia/Canberra",
+  "Australia/Currie",
+  "Australia/Darwin",
+  "Australia/Eucla",
+  "Australia/Hobart",
+  "Australia/LHI",
+  "Australia/Lindeman",
+  "Australia/Lord_Howe",
+  "Australia/Melbourne",
+  "Australia/NSW",
+  "Australia/North",
+  "Australia/Perth",
+  "Australia/Queensland",
+  "Australia/South",
+  "Australia/Sydney",
+  "Australia/Tasmania",
+  "Australia/Victoria",
+  "Australia/West",
+  "Australia/Yancowinna",
+  "Brazil/Acre",
+  "Brazil/DeNoronha",
+  "Brazil/East",
+  "Brazil/West",
+  "CET",
+  "CST6CDT",
+  "Canada/Atlantic",
+  "Canada/Central",
+  "Canada/Eastern",
+  "Canada/Mountain",
+  "Canada/Newfoundland",
+  "Canada/Pacific",
+  "Canada/Saskatchewan",
+  "Canada/Yukon",
+  "Chile/Continental",
+  "Chile/EasterIsland",
+  "Cuba",
+  "EET",
+  "EST",
+  "EST5EDT",
+  "Egypt",
+  "Eire",
+  "Etc/GMT",
+  "Etc/GMT+0",
+  "Etc/GMT+1",
+  "Etc/GMT+10",
+  "Etc/GMT+11",
+  "Etc/GMT+12",
+  "Etc/GMT+2",
+  "Etc/GMT+3",
+  "Etc/GMT+4",
+  "Etc/GMT+5",
+  "Etc/GMT+6",
+  "Etc/GMT+7",
+  "Etc/GMT+8",
+  "Etc/GMT+9",
+  "Etc/GMT-0",
+  "Etc/GMT-1",
+  "Etc/GMT-10",
+  "Etc/GMT-11",
+  "Etc/GMT-12",
+  "Etc/GMT-13",
+  "Etc/GMT-14",
+  "Etc/GMT-2",
+  "Etc/GMT-3",
+  "Etc/GMT-4",
+  "Etc/GMT-5",
+  "Etc/GMT-6",
+  "Etc/GMT-7",
+  "Etc/GMT-8",
+  "Etc/GMT-9",
+  "Etc/GMT0",
+  "Etc/Greenwich",
+  "Etc/UCT",
+  "Etc/UTC",
+  "Etc/Universal",
+  "Etc/Zulu",
+  "Europe/Amsterdam",
+  "Europe/Andorra",
+  "Europe/Astrakhan",
+  "Europe/Athens",
+  "Europe/Belfast",
+  "Europe/Belgrade",
+  "Europe/Berlin",
+  "Europe/Bratislava",
+  "Europe/Brussels",
+  "Europe/Bucharest",
+  "Europe/Budapest",
+  "Europe/Busingen",
+  "Europe/Chisinau",
+  "Europe/Copenhagen",
+  "Europe/Dublin",
+  "Europe/Gibraltar",
+  "Europe/Guernsey",
+  "Europe/Helsinki",
+  "Europe/Isle_of_Man",
+  "Europe/Istanbul",
+  "Europe/Jersey",
+  "Europe/Kaliningrad",
+  "Europe/Kiev",
+  "Europe/Kirov",
+  "Europe/Lisbon",
+  "Europe/Ljubljana",
+  "Europe/London",
+  "Europe/Luxembourg",
+  "Europe/Madrid",
+  "Europe/Malta",
+  "Europe/Mariehamn",
+  "Europe/Minsk",
+  "Europe/Monaco",
+  "Europe/Moscow",
+  "Europe/Nicosia",
+  "Europe/Oslo",
+  "Europe/Paris",
+  "Europe/Podgorica",
+  "Europe/Prague",
+  "Europe/Riga",
+  "Europe/Rome",
+  "Europe/Samara",
+  "Europe/San_Marino",
+  "Europe/Sarajevo",
+  "Europe/Saratov",
+  "Europe/Simferopol",
+  "Europe/Skopje",
+  "Europe/Sofia",
+  "Europe/Stockholm",
+  "Europe/Tallinn",
+  "Europe/Tirane",
+  "Europe/Tiraspol",
+  "Europe/Ulyanovsk",
+  "Europe/Uzhgorod",
+  "Europe/Vaduz",
+  "Europe/Vatican",
+  "Europe/Vienna",
+  "Europe/Vilnius",
+  "Europe/Volgograd",
+  "Europe/Warsaw",
+  "Europe/Zagreb",
+  "Europe/Zaporozhye",
+  "Europe/Zurich",
+  "GB",
+  "GB-Eire",
+  "GMT",
+  "GMT+0",
+  "GMT-0",
+  "GMT0",
+  "Greenwich",
+  "HST",
+  "Hongkong",
+  "Iceland",
+  "Indian/Antananarivo",
+  "Indian/Chagos",
+  "Indian/Christmas",
+  "Indian/Cocos",
+  "Indian/Comoro",
+  "Indian/Kerguelen",
+  "Indian/Mahe",
+  "Indian/Maldives",
+  "Indian/Mauritius",
+  "Indian/Mayotte",
+  "Indian/Reunion",
+  "Iran",
+  "Israel",
+  "Jamaica",
+  "Japan",
+  "Kwajalein",
+  "Libya",
+  "MET",
+  "MST",
+  "MST7MDT",
+  "Mexico/BajaNorte",
+  "Mexico/BajaSur",
+  "Mexico/General",
+  "NZ",
+  "NZ-CHAT",
+  "Navajo",
+  "PRC",
+  "PST8PDT",
+  "Pacific/Apia",
+  "Pacific/Auckland",
+  "Pacific/Bougainville",
+  "Pacific/Chatham",
+  "Pacific/Chuuk",
+  "Pacific/Easter",
+  "Pacific/Efate",
+  "Pacific/Enderbury",
+  "Pacific/Fakaofo",
+  "Pacific/Fiji",
+  "Pacific/Funafuti",
+  "Pacific/Galapagos",
+  "Pacific/Gambier",
+  "Pacific/Guadalcanal",
+  "Pacific/Guam",
+  "Pacific/Honolulu",
+  "Pacific/Johnston",
+  "Pacific/Kiritimati",
+  "Pacific/Kosrae",
+  "Pacific/Kwajalein",
+  "Pacific/Majuro",
+  "Pacific/Marquesas",
+  "Pacific/Midway",
+  "Pacific/Nauru",
+  "Pacific/Niue",
+  "Pacific/Norfolk",
+  "Pacific/Noumea",
+  "Pacific/Pago_Pago",
+  "Pacific/Palau",
+  "Pacific/Pitcairn",
+  "Pacific/Pohnpei",
+  "Pacific/Ponape",
+  "Pacific/Port_Moresby",
+  "Pacific/Rarotonga",
+  "Pacific/Saipan",
+  "Pacific/Samoa",
+  "Pacific/Tahiti",
+  "Pacific/Tarawa",
+  "Pacific/Tongatapu",
+  "Pacific/Truk",
+  "Pacific/Wake",
+  "Pacific/Wallis",
+  "Pacific/Yap",
+  "Poland",
+  "Portugal",
+  "ROC",
+  "ROK",
+  "Singapore",
+  "Turkey",
+  "UCT",
+  "US/Alaska",
+  "US/Aleutian",
+  "US/Arizona",
+  "US/Central",
+  "US/East-Indiana",
+  "US/Eastern",
+  "US/Hawaii",
+  "US/Indiana-Starke",
+  "US/Michigan",
+  "US/Mountain",
+  "US/Pacific",
+  "US/Samoa",
+  "UTC",
+  "Universal",
+  "W-SU",
+  "WET",
+  "Zulu",
+  nullptr
+};
+
+std::vector<std::string> AllTimeZoneNames() {
+  std::vector<std::string> names;
+  for (const char* const* namep = kTimeZoneNames; *namep != nullptr; ++namep) {
+    names.push_back(std::string("file:") + *namep);
+  }
+  assert(!names.empty());
+
+  std::mt19937 urbg(42);  // a UniformRandomBitGenerator with fixed seed
+  std::shuffle(names.begin(), names.end(), urbg);
+  return names;
+}
+
+cctz::time_zone TestTimeZone() {
+  cctz::time_zone tz;
+  cctz::load_time_zone("America/Los_Angeles", &tz);
+  return tz;
+}
+
+void BM_Zone_LoadUTCTimeZoneFirst(benchmark::State& state) {
+  cctz::time_zone tz;
+  cctz::load_time_zone("UTC", &tz);  // in case we're first
+  cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::load_time_zone("UTC", &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadUTCTimeZoneFirst);
+
+void BM_Zone_LoadUTCTimeZoneLast(benchmark::State& state) {
+  cctz::time_zone tz;
+  for (const auto& name : AllTimeZoneNames()) {
+    cctz::load_time_zone(name, &tz);  // prime cache
+  }
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::load_time_zone("UTC", &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadUTCTimeZoneLast);
+
+void BM_Zone_LoadTimeZoneFirst(benchmark::State& state) {
+  cctz::time_zone tz = cctz::utc_time_zone();  // in case we're first
+  const std::string name = "file:America/Los_Angeles";
+  while (state.KeepRunning()) {
+    state.PauseTiming();
+    cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+    state.ResumeTiming();
+    benchmark::DoNotOptimize(cctz::load_time_zone(name, &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadTimeZoneFirst);
+
+void BM_Zone_LoadTimeZoneCached(benchmark::State& state) {
+  cctz::time_zone tz = cctz::utc_time_zone();  // in case we're first
+  cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+  const std::string name = "file:America/Los_Angeles";
+  cctz::load_time_zone(name, &tz);  // prime cache
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::load_time_zone(name, &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadTimeZoneCached);
+
+void BM_Zone_LoadLocalTimeZoneCached(benchmark::State& state) {
+  cctz::utc_time_zone();  // in case we're first
+  cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+  cctz::local_time_zone();  // prime cache
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::local_time_zone());
+  }
+}
+BENCHMARK(BM_Zone_LoadLocalTimeZoneCached);
+
+void BM_Zone_LoadAllTimeZonesFirst(benchmark::State& state) {
+  cctz::time_zone tz;
+  const std::vector<std::string> names = AllTimeZoneNames();
+  for (auto index = names.size(); state.KeepRunning(); ++index) {
+    if (index == names.size()) {
+      index = 0;
+    }
+    if (index == 0) {
+      state.PauseTiming();
+      cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+      state.ResumeTiming();
+    }
+    benchmark::DoNotOptimize(cctz::load_time_zone(names[index], &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadAllTimeZonesFirst);
+
+void BM_Zone_LoadAllTimeZonesCached(benchmark::State& state) {
+  cctz::time_zone tz;
+  const std::vector<std::string> names = AllTimeZoneNames();
+  for (const auto& name : names) {
+    cctz::load_time_zone(name, &tz);  // prime cache
+  }
+  for (auto index = names.size(); state.KeepRunning(); ++index) {
+    if (index == names.size()) {
+      index = 0;
+    }
+    benchmark::DoNotOptimize(cctz::load_time_zone(names[index], &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadAllTimeZonesCached);
+
+void BM_Zone_TimeZoneEqualityImplicit(benchmark::State& state) {
+  cctz::time_zone tz;  // implicit UTC
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(tz == tz);
+  }
+}
+BENCHMARK(BM_Zone_TimeZoneEqualityImplicit);
+
+void BM_Zone_TimeZoneEqualityExplicit(benchmark::State& state) {
+  cctz::time_zone tz = cctz::utc_time_zone();  // explicit UTC
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(tz == tz);
+  }
+}
+BENCHMARK(BM_Zone_TimeZoneEqualityExplicit);
+
+void BM_Zone_UTCTimeZone(benchmark::State& state) {
+  cctz::time_zone tz;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::utc_time_zone());
+  }
+}
+BENCHMARK(BM_Zone_UTCTimeZone);
+
+// In each "ToCivil" benchmark we switch between two instants separated
+// by at least one transition in order to defeat any internal caching of
+// previous results (e.g., see local_time_hint_).
+//
+// The "UTC" variants use UTC instead of the Google/local time zone.
+
+void BM_Time_ToCivil_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = TestTimeZone();
+  std::chrono::system_clock::time_point tp =
+      std::chrono::system_clock::from_time_t(1384569027);
+  std::chrono::system_clock::time_point tp2 =
+      std::chrono::system_clock::from_time_t(1418962578);
+  while (state.KeepRunning()) {
+    std::swap(tp, tp2);
+    tp += std::chrono::seconds(1);
+    benchmark::DoNotOptimize(cctz::convert(tp, tz));
+  }
+}
+BENCHMARK(BM_Time_ToCivil_CCTZ);
+
+void BM_Time_ToCivil_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  time_t t = 1384569027;
+  time_t t2 = 1418962578;
+  struct tm tm;
+  while (state.KeepRunning()) {
+    std::swap(t, t2);
+    t += 1;
+#if defined(_WIN32) || defined(_WIN64)
+    benchmark::DoNotOptimize(localtime_s(&tm, &t));
+#else
+    benchmark::DoNotOptimize(localtime_r(&t, &tm));
+#endif
+  }
+}
+BENCHMARK(BM_Time_ToCivil_Libc);
+
+void BM_Time_ToCivilUTC_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = cctz::utc_time_zone();
+  std::chrono::system_clock::time_point tp =
+      std::chrono::system_clock::from_time_t(1384569027);
+  while (state.KeepRunning()) {
+    tp += std::chrono::seconds(1);
+    benchmark::DoNotOptimize(cctz::convert(tp, tz));
+  }
+}
+BENCHMARK(BM_Time_ToCivilUTC_CCTZ);
+
+void BM_Time_ToCivilUTC_Libc(benchmark::State& state) {
+  time_t t = 1384569027;
+  struct tm tm;
+  while (state.KeepRunning()) {
+    t += 1;
+#if defined(_WIN32) || defined(_WIN64)
+    benchmark::DoNotOptimize(gmtime_s(&tm, &t));
+#else
+    benchmark::DoNotOptimize(gmtime_r(&t, &tm));
+#endif
+  }
+}
+BENCHMARK(BM_Time_ToCivilUTC_Libc);
+
+// In each "FromCivil" benchmark we switch between two YMDhms values
+// separated by at least one transition in order to defeat any internal
+// caching of previous results (e.g., see time_local_hint_).
+//
+// The "UTC" variants use UTC instead of the Google/local time zone.
+// The "Day0" variants require normalization of the day of month.
+
+void BM_Time_FromCivil_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = TestTimeZone();
+  int i = 0;
+  while (state.KeepRunning()) {
+    if ((i++ & 1) == 0) {
+      benchmark::DoNotOptimize(
+          cctz::convert(cctz::civil_second(2014, 12, 18, 20, 16, 18), tz));
+    } else {
+      benchmark::DoNotOptimize(
+          cctz::convert(cctz::civil_second(2013, 11, 15, 18, 30, 27), tz));
+    }
+  }
+}
+BENCHMARK(BM_Time_FromCivil_CCTZ);
+
+void BM_Time_FromCivil_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  int i = 0;
+  while (state.KeepRunning()) {
+    struct tm tm;
+    if ((i++ & 1) == 0) {
+      tm.tm_year = 2014 - 1900;
+      tm.tm_mon = 12 - 1;
+      tm.tm_mday = 18;
+      tm.tm_hour = 20;
+      tm.tm_min = 16;
+      tm.tm_sec = 18;
+    } else {
+      tm.tm_year = 2013 - 1900;
+      tm.tm_mon = 11 - 1;
+      tm.tm_mday = 15;
+      tm.tm_hour = 18;
+      tm.tm_min = 30;
+      tm.tm_sec = 27;
+    }
+    tm.tm_isdst = -1;
+    benchmark::DoNotOptimize(mktime(&tm));
+  }
+}
+BENCHMARK(BM_Time_FromCivil_Libc);
+
+void BM_Time_FromCivilUTC_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = cctz::utc_time_zone();
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(
+        cctz::convert(cctz::civil_second(2014, 12, 18, 20, 16, 18), tz));
+  }
+}
+BENCHMARK(BM_Time_FromCivilUTC_CCTZ);
+
+// There is no BM_Time_FromCivilUTC_Libc.
+
+void BM_Time_FromCivilDay0_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = TestTimeZone();
+  int i = 0;
+  while (state.KeepRunning()) {
+    if ((i++ & 1) == 0) {
+      benchmark::DoNotOptimize(
+          cctz::convert(cctz::civil_second(2014, 12, 0, 20, 16, 18), tz));
+    } else {
+      benchmark::DoNotOptimize(
+          cctz::convert(cctz::civil_second(2013, 11, 0, 18, 30, 27), tz));
+    }
+  }
+}
+BENCHMARK(BM_Time_FromCivilDay0_CCTZ);
+
+void BM_Time_FromCivilDay0_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  int i = 0;
+  while (state.KeepRunning()) {
+    struct tm tm;
+    if ((i++ & 1) == 0) {
+      tm.tm_year = 2014 - 1900;
+      tm.tm_mon = 12 - 1;
+      tm.tm_mday = 0;
+      tm.tm_hour = 20;
+      tm.tm_min = 16;
+      tm.tm_sec = 18;
+    } else {
+      tm.tm_year = 2013 - 1900;
+      tm.tm_mon = 11 - 1;
+      tm.tm_mday = 0;
+      tm.tm_hour = 18;
+      tm.tm_min = 30;
+      tm.tm_sec = 27;
+    }
+    tm.tm_isdst = -1;
+    benchmark::DoNotOptimize(mktime(&tm));
+  }
+}
+BENCHMARK(BM_Time_FromCivilDay0_Libc);
+
+const char* const kFormats[] = {
+    RFC1123_full,         // 0
+    RFC1123_no_wday,      // 1
+    RFC3339_full,         // 2
+    RFC3339_sec,          // 3
+    "%Y-%m-%dT%H:%M:%S",  // 4
+    "%Y-%m-%d",           // 5
+};
+const int kNumFormats = sizeof(kFormats) / sizeof(kFormats[0]);
+
+void BM_Format_FormatTime(benchmark::State& state) {
+  const std::string fmt = kFormats[state.range(0)];
+  state.SetLabel(fmt);
+  const cctz::time_zone tz = TestTimeZone();
+  const std::chrono::system_clock::time_point tp =
+      cctz::convert(cctz::civil_second(1977, 6, 28, 9, 8, 7), tz) +
+      std::chrono::microseconds(1);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::format(fmt, tp, tz));
+  }
+}
+BENCHMARK(BM_Format_FormatTime)->DenseRange(0, kNumFormats - 1);
+
+void BM_Format_ParseTime(benchmark::State& state) {
+  const std::string fmt = kFormats[state.range(0)];
+  state.SetLabel(fmt);
+  const cctz::time_zone tz = TestTimeZone();
+  std::chrono::system_clock::time_point tp =
+      cctz::convert(cctz::civil_second(1977, 6, 28, 9, 8, 7), tz) +
+      std::chrono::microseconds(1);
+  const std::string when = cctz::format(fmt, tp, tz);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::parse(fmt, when, tz, &tp));
+  }
+}
+BENCHMARK(BM_Format_ParseTime)->DenseRange(0, kNumFormats - 1);
+
+}  // namespace
diff --git a/absl/time/internal/cctz/src/civil_time_detail.cc b/absl/time/internal/cctz/src/civil_time_detail.cc
new file mode 100644
index 0000000..cb40b6b
--- /dev/null
+++ b/absl/time/internal/cctz/src/civil_time_detail.cc
@@ -0,0 +1,90 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/civil_time_detail.h"
+
+#include <iomanip>
+#include <ostream>
+#include <sstream>
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+namespace detail {
+
+// Output stream operators output a format matching YYYY-MM-DDThh:mm:ss,
+// while omitting fields inferior to the type's alignment. For example,
+// civil_day is formatted only as YYYY-MM-DD.
+std::ostream& operator<<(std::ostream& os, const civil_year& y) {
+  std::stringstream ss;
+  ss << y.year();  // No padding.
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_month& m) {
+  std::stringstream ss;
+  ss << civil_year(m) << '-';
+  ss << std::setfill('0') << std::setw(2) << m.month();
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_day& d) {
+  std::stringstream ss;
+  ss << civil_month(d) << '-';
+  ss << std::setfill('0') << std::setw(2) << d.day();
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_hour& h) {
+  std::stringstream ss;
+  ss << civil_day(h) << 'T';
+  ss << std::setfill('0') << std::setw(2) << h.hour();
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_minute& m) {
+  std::stringstream ss;
+  ss << civil_hour(m) << ':';
+  ss << std::setfill('0') << std::setw(2) << m.minute();
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_second& s) {
+  std::stringstream ss;
+  ss << civil_minute(s) << ':';
+  ss << std::setfill('0') << std::setw(2) << s.second();
+  return os << ss.str();
+}
+
+////////////////////////////////////////////////////////////////////////
+
+std::ostream& operator<<(std::ostream& os, weekday wd) {
+  switch (wd) {
+    case weekday::monday:
+      return os << "Monday";
+    case weekday::tuesday:
+      return os << "Tuesday";
+    case weekday::wednesday:
+      return os << "Wednesday";
+    case weekday::thursday:
+      return os << "Thursday";
+    case weekday::friday:
+      return os << "Friday";
+    case weekday::saturday:
+      return os << "Saturday";
+    case weekday::sunday:
+      return os << "Sunday";
+  }
+  return os;  // Should never get here, but -Wreturn-type may warn without this.
+}
+
+}  // namespace detail
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/civil_time_test.cc b/absl/time/internal/cctz/src/civil_time_test.cc
new file mode 100644
index 0000000..10a5ffe
--- /dev/null
+++ b/absl/time/internal/cctz/src/civil_time_test.cc
@@ -0,0 +1,1059 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+
+#include <iomanip>
+#include <limits>
+#include <sstream>
+#include <string>
+#include <type_traits>
+
+#include "gtest/gtest.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+template <typename T>
+std::string Format(const T& t) {
+  std::stringstream ss;
+  ss << t;
+  return ss.str();
+}
+
+}  // namespace
+
+#if __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+// Construction constexpr tests
+
+TEST(CivilTime, Normal) {
+  constexpr civil_second css(2016, 1, 28, 17, 14, 12);
+  static_assert(css.second() == 12, "Normal.second");
+  constexpr civil_minute cmm(2016, 1, 28, 17, 14);
+  static_assert(cmm.minute() == 14, "Normal.minute");
+  constexpr civil_hour chh(2016, 1, 28, 17);
+  static_assert(chh.hour() == 17, "Normal.hour");
+  constexpr civil_day cd(2016, 1, 28);
+  static_assert(cd.day() == 28, "Normal.day");
+  constexpr civil_month cm(2016, 1);
+  static_assert(cm.month() == 1, "Normal.month");
+  constexpr civil_year cy(2016);
+  static_assert(cy.year() == 2016, "Normal.year");
+}
+
+TEST(CivilTime, Conversion) {
+  constexpr civil_year cy(2016);
+  static_assert(cy.year() == 2016, "Conversion.year");
+  constexpr civil_month cm(cy);
+  static_assert(cm.month() == 1, "Conversion.month");
+  constexpr civil_day cd(cm);
+  static_assert(cd.day() == 1, "Conversion.day");
+  constexpr civil_hour chh(cd);
+  static_assert(chh.hour() == 0, "Conversion.hour");
+  constexpr civil_minute cmm(chh);
+  static_assert(cmm.minute() == 0, "Conversion.minute");
+  constexpr civil_second css(cmm);
+  static_assert(css.second() == 0, "Conversion.second");
+}
+
+// Normalization constexpr tests
+
+TEST(CivilTime, Normalized) {
+  constexpr civil_second cs(2016, 1, 28, 17, 14, 12);
+  static_assert(cs.year() == 2016, "Normalized.year");
+  static_assert(cs.month() == 1, "Normalized.month");
+  static_assert(cs.day() == 28, "Normalized.day");
+  static_assert(cs.hour() == 17, "Normalized.hour");
+  static_assert(cs.minute() == 14, "Normalized.minute");
+  static_assert(cs.second() == 12, "Normalized.second");
+}
+
+TEST(CivilTime, SecondOverflow) {
+  constexpr civil_second cs(2016, 1, 28, 17, 14, 121);
+  static_assert(cs.year() == 2016, "SecondOverflow.year");
+  static_assert(cs.month() == 1, "SecondOverflow.month");
+  static_assert(cs.day() == 28, "SecondOverflow.day");
+  static_assert(cs.hour() == 17, "SecondOverflow.hour");
+  static_assert(cs.minute() == 16, "SecondOverflow.minute");
+  static_assert(cs.second() == 1, "SecondOverflow.second");
+}
+
+TEST(CivilTime, SecondUnderflow) {
+  constexpr civil_second cs(2016, 1, 28, 17, 14, -121);
+  static_assert(cs.year() == 2016, "SecondUnderflow.year");
+  static_assert(cs.month() == 1, "SecondUnderflow.month");
+  static_assert(cs.day() == 28, "SecondUnderflow.day");
+  static_assert(cs.hour() == 17, "SecondUnderflow.hour");
+  static_assert(cs.minute() == 11, "SecondUnderflow.minute");
+  static_assert(cs.second() == 59, "SecondUnderflow.second");
+}
+
+TEST(CivilTime, MinuteOverflow) {
+  constexpr civil_second cs(2016, 1, 28, 17, 121, 12);
+  static_assert(cs.year() == 2016, "MinuteOverflow.year");
+  static_assert(cs.month() == 1, "MinuteOverflow.month");
+  static_assert(cs.day() == 28, "MinuteOverflow.day");
+  static_assert(cs.hour() == 19, "MinuteOverflow.hour");
+  static_assert(cs.minute() == 1, "MinuteOverflow.minute");
+  static_assert(cs.second() == 12, "MinuteOverflow.second");
+}
+
+TEST(CivilTime, MinuteUnderflow) {
+  constexpr civil_second cs(2016, 1, 28, 17, -121, 12);
+  static_assert(cs.year() == 2016, "MinuteUnderflow.year");
+  static_assert(cs.month() == 1, "MinuteUnderflow.month");
+  static_assert(cs.day() == 28, "MinuteUnderflow.day");
+  static_assert(cs.hour() == 14, "MinuteUnderflow.hour");
+  static_assert(cs.minute() == 59, "MinuteUnderflow.minute");
+  static_assert(cs.second() == 12, "MinuteUnderflow.second");
+}
+
+TEST(CivilTime, HourOverflow) {
+  constexpr civil_second cs(2016, 1, 28, 49, 14, 12);
+  static_assert(cs.year() == 2016, "HourOverflow.year");
+  static_assert(cs.month() == 1, "HourOverflow.month");
+  static_assert(cs.day() == 30, "HourOverflow.day");
+  static_assert(cs.hour() == 1, "HourOverflow.hour");
+  static_assert(cs.minute() == 14, "HourOverflow.minute");
+  static_assert(cs.second() == 12, "HourOverflow.second");
+}
+
+TEST(CivilTime, HourUnderflow) {
+  constexpr civil_second cs(2016, 1, 28, -49, 14, 12);
+  static_assert(cs.year() == 2016, "HourUnderflow.year");
+  static_assert(cs.month() == 1, "HourUnderflow.month");
+  static_assert(cs.day() == 25, "HourUnderflow.day");
+  static_assert(cs.hour() == 23, "HourUnderflow.hour");
+  static_assert(cs.minute() == 14, "HourUnderflow.minute");
+  static_assert(cs.second() == 12, "HourUnderflow.second");
+}
+
+TEST(CivilTime, MonthOverflow) {
+  constexpr civil_second cs(2016, 25, 28, 17, 14, 12);
+  static_assert(cs.year() == 2018, "MonthOverflow.year");
+  static_assert(cs.month() == 1, "MonthOverflow.month");
+  static_assert(cs.day() == 28, "MonthOverflow.day");
+  static_assert(cs.hour() == 17, "MonthOverflow.hour");
+  static_assert(cs.minute() == 14, "MonthOverflow.minute");
+  static_assert(cs.second() == 12, "MonthOverflow.second");
+}
+
+TEST(CivilTime, MonthUnderflow) {
+  constexpr civil_second cs(2016, -25, 28, 17, 14, 12);
+  static_assert(cs.year() == 2013, "MonthUnderflow.year");
+  static_assert(cs.month() == 11, "MonthUnderflow.month");
+  static_assert(cs.day() == 28, "MonthUnderflow.day");
+  static_assert(cs.hour() == 17, "MonthUnderflow.hour");
+  static_assert(cs.minute() == 14, "MonthUnderflow.minute");
+  static_assert(cs.second() == 12, "MonthUnderflow.second");
+}
+
+TEST(CivilTime, C4Overflow) {
+  constexpr civil_second cs(2016, 1, 292195, 17, 14, 12);
+  static_assert(cs.year() == 2816, "C4Overflow.year");
+  static_assert(cs.month() == 1, "C4Overflow.month");
+  static_assert(cs.day() == 1, "C4Overflow.day");
+  static_assert(cs.hour() == 17, "C4Overflow.hour");
+  static_assert(cs.minute() == 14, "C4Overflow.minute");
+  static_assert(cs.second() == 12, "C4Overflow.second");
+}
+
+TEST(CivilTime, C4Underflow) {
+  constexpr civil_second cs(2016, 1, -292195, 17, 14, 12);
+  static_assert(cs.year() == 1215, "C4Underflow.year");
+  static_assert(cs.month() == 12, "C4Underflow.month");
+  static_assert(cs.day() == 30, "C4Underflow.day");
+  static_assert(cs.hour() == 17, "C4Underflow.hour");
+  static_assert(cs.minute() == 14, "C4Underflow.minute");
+  static_assert(cs.second() == 12, "C4Underflow.second");
+}
+
+TEST(CivilTime, MixedNormalization) {
+  constexpr civil_second cs(2016, -42, 122, 99, -147, 4949);
+  static_assert(cs.year() == 2012, "MixedNormalization.year");
+  static_assert(cs.month() == 10, "MixedNormalization.month");
+  static_assert(cs.day() == 4, "MixedNormalization.day");
+  static_assert(cs.hour() == 1, "MixedNormalization.hour");
+  static_assert(cs.minute() == 55, "MixedNormalization.minute");
+  static_assert(cs.second() == 29, "MixedNormalization.second");
+}
+
+// Relational constexpr tests
+
+TEST(CivilTime, Less) {
+  constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+  constexpr civil_second cs2(2016, 1, 28, 17, 14, 13);
+  constexpr bool less = cs1 < cs2;
+  static_assert(less, "Less");
+}
+
+// Arithmetic constexpr tests
+
+TEST(CivilTime, Addition) {
+  constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+  constexpr civil_second cs2 = cs1 + 50;
+  static_assert(cs2.year() == 2016, "Addition.year");
+  static_assert(cs2.month() == 1, "Addition.month");
+  static_assert(cs2.day() == 28, "Addition.day");
+  static_assert(cs2.hour() == 17, "Addition.hour");
+  static_assert(cs2.minute() == 15, "Addition.minute");
+  static_assert(cs2.second() == 2, "Addition.second");
+}
+
+TEST(CivilTime, Subtraction) {
+  constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+  constexpr civil_second cs2 = cs1 - 50;
+  static_assert(cs2.year() == 2016, "Subtraction.year");
+  static_assert(cs2.month() == 1, "Subtraction.month");
+  static_assert(cs2.day() == 28, "Subtraction.day");
+  static_assert(cs2.hour() == 17, "Subtraction.hour");
+  static_assert(cs2.minute() == 13, "Subtraction.minute");
+  static_assert(cs2.second() == 22, "Subtraction.second");
+}
+
+TEST(CivilTime, Difference) {
+  constexpr civil_day cd1(2016, 1, 28);
+  constexpr civil_day cd2(2015, 1, 28);
+  constexpr int diff = cd1 - cd2;
+  static_assert(diff == 365, "Difference");
+}
+
+// NOTE: Run this with --copt=-ftrapv to detect overflow problems.
+TEST(CivilTime, DifferenceWithHugeYear) {
+  {
+    constexpr civil_day d1(9223372036854775807, 1, 1);
+    constexpr civil_day d2(9223372036854775807, 12, 31);
+    static_assert(d2 - d1 == 364, "DifferenceWithHugeYear");
+  }
+  {
+    constexpr civil_day d1(-9223372036854775807 - 1, 1, 1);
+    constexpr civil_day d2(-9223372036854775807 - 1, 12, 31);
+    static_assert(d2 - d1 == 365, "DifferenceWithHugeYear");
+  }
+  {
+    // Check the limits of the return value at the end of the year range.
+    constexpr civil_day d1(9223372036854775807, 1, 1);
+    constexpr civil_day d2(9198119301927009252, 6, 6);
+    static_assert(d1 - d2 == 9223372036854775807, "DifferenceWithHugeYear");
+    static_assert((d2 - 1) - d1 == -9223372036854775807 - 1,
+                  "DifferenceWithHugeYear");
+  }
+  {
+    // Check the limits of the return value at the start of the year range.
+    constexpr civil_day d1(-9223372036854775807 - 1, 1, 1);
+    constexpr civil_day d2(-9198119301927009254, 7, 28);
+    static_assert(d2 - d1 == 9223372036854775807, "DifferenceWithHugeYear");
+    static_assert(d1 - (d2 + 1) == -9223372036854775807 - 1,
+                  "DifferenceWithHugeYear");
+  }
+  {
+    // Check the limits of the return value from either side of year 0.
+    constexpr civil_day d1(-12626367463883278, 9, 3);
+    constexpr civil_day d2(12626367463883277, 3, 28);
+    static_assert(d2 - d1 == 9223372036854775807, "DifferenceWithHugeYear");
+    static_assert(d1 - (d2 + 1) == -9223372036854775807 - 1,
+                  "DifferenceWithHugeYear");
+  }
+}
+
+// NOTE: Run this with --copt=-ftrapv to detect overflow problems.
+TEST(CivilTime, DifferenceNoIntermediateOverflow) {
+  {
+    // The difference up to the minute field would be below the minimum
+    // diff_t, but the 52 extra seconds brings us back to the minimum.
+    constexpr civil_second s1(-292277022657, 1, 27, 8, 29 - 1, 52);
+    constexpr civil_second s2(1970, 1, 1, 0, 0 - 1, 0);
+    static_assert(s1 - s2 == -9223372036854775807 - 1,
+                  "DifferenceNoIntermediateOverflow");
+  }
+  {
+    // The difference up to the minute field would be above the maximum
+    // diff_t, but the -53 extra seconds brings us back to the maximum.
+    constexpr civil_second s1(292277026596, 12, 4, 15, 30, 7 - 7);
+    constexpr civil_second s2(1970, 1, 1, 0, 0, 0 - 7);
+    static_assert(s1 - s2 == 9223372036854775807,
+                  "DifferenceNoIntermediateOverflow");
+  }
+}
+
+// Helper constexpr tests
+
+TEST(CivilTime, WeekDay) {
+  constexpr civil_day cd(2016, 1, 28);
+  constexpr weekday wd = get_weekday(cd);
+  static_assert(wd == weekday::thursday, "Weekday");
+}
+
+TEST(CivilTime, NextWeekDay) {
+  constexpr civil_day cd(2016, 1, 28);
+  constexpr civil_day next = next_weekday(cd, weekday::thursday);
+  static_assert(next.year() == 2016, "NextWeekDay.year");
+  static_assert(next.month() == 2, "NextWeekDay.month");
+  static_assert(next.day() == 4, "NextWeekDay.day");
+}
+
+TEST(CivilTime, PrevWeekDay) {
+  constexpr civil_day cd(2016, 1, 28);
+  constexpr civil_day prev = prev_weekday(cd, weekday::thursday);
+  static_assert(prev.year() == 2016, "PrevWeekDay.year");
+  static_assert(prev.month() == 1, "PrevWeekDay.month");
+  static_assert(prev.day() == 21, "PrevWeekDay.day");
+}
+
+TEST(CivilTime, YearDay) {
+  constexpr civil_day cd(2016, 1, 28);
+  constexpr int yd = get_yearday(cd);
+  static_assert(yd == 28, "YearDay");
+}
+#endif  // __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+
+// The remaining tests do not use constexpr.
+
+TEST(CivilTime, DefaultConstruction) {
+  civil_second ss;
+  EXPECT_EQ("1970-01-01T00:00:00", Format(ss));
+
+  civil_minute mm;
+  EXPECT_EQ("1970-01-01T00:00", Format(mm));
+
+  civil_hour hh;
+  EXPECT_EQ("1970-01-01T00", Format(hh));
+
+  civil_day d;
+  EXPECT_EQ("1970-01-01", Format(d));
+
+  civil_month m;
+  EXPECT_EQ("1970-01", Format(m));
+
+  civil_year y;
+  EXPECT_EQ("1970", Format(y));
+}
+
+TEST(CivilTime, StructMember) {
+  struct S {
+    civil_day day;
+  };
+  S s = {};
+  EXPECT_EQ(civil_day{}, s.day);
+}
+
+TEST(CivilTime, FieldsConstruction) {
+  EXPECT_EQ("2015-01-02T03:04:05", Format(civil_second(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03:04:00", Format(civil_second(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03:00:00", Format(civil_second(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00:00:00", Format(civil_second(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00:00:00", Format(civil_second(2015, 1)));
+  EXPECT_EQ("2015-01-01T00:00:00", Format(civil_second(2015)));
+
+  EXPECT_EQ("2015-01-02T03:04", Format(civil_minute(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03:04", Format(civil_minute(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03:00", Format(civil_minute(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00:00", Format(civil_minute(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00:00", Format(civil_minute(2015, 1)));
+  EXPECT_EQ("2015-01-01T00:00", Format(civil_minute(2015)));
+
+  EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00", Format(civil_hour(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00", Format(civil_hour(2015, 1)));
+  EXPECT_EQ("2015-01-01T00", Format(civil_hour(2015)));
+
+  EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01", Format(civil_day(2015, 1)));
+  EXPECT_EQ("2015-01-01", Format(civil_day(2015)));
+
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015)));
+
+  EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3)));
+  EXPECT_EQ("2015", Format(civil_year(2015, 1, 2)));
+  EXPECT_EQ("2015", Format(civil_year(2015, 1)));
+  EXPECT_EQ("2015", Format(civil_year(2015)));
+}
+
+TEST(CivilTime, FieldsConstructionLimits) {
+  const int kIntMax = std::numeric_limits<int>::max();
+  EXPECT_EQ("2038-01-19T03:14:07",
+            Format(civil_second(1970, 1, 1, 0, 0, kIntMax)));
+  EXPECT_EQ("6121-02-11T05:21:07",
+            Format(civil_second(1970, 1, 1, 0, kIntMax, kIntMax)));
+  EXPECT_EQ("251104-11-20T12:21:07",
+            Format(civil_second(1970, 1, 1, kIntMax, kIntMax, kIntMax)));
+  EXPECT_EQ("6130715-05-30T12:21:07",
+            Format(civil_second(1970, 1, kIntMax, kIntMax, kIntMax, kIntMax)));
+  EXPECT_EQ(
+      "185087685-11-26T12:21:07",
+      Format(civil_second(1970, kIntMax, kIntMax, kIntMax, kIntMax, kIntMax)));
+
+  const int kIntMin = std::numeric_limits<int>::min();
+  EXPECT_EQ("1901-12-13T20:45:52",
+            Format(civil_second(1970, 1, 1, 0, 0, kIntMin)));
+  EXPECT_EQ("-2182-11-20T18:37:52",
+            Format(civil_second(1970, 1, 1, 0, kIntMin, kIntMin)));
+  EXPECT_EQ("-247165-02-11T10:37:52",
+            Format(civil_second(1970, 1, 1, kIntMin, kIntMin, kIntMin)));
+  EXPECT_EQ("-6126776-08-01T10:37:52",
+            Format(civil_second(1970, 1, kIntMin, kIntMin, kIntMin, kIntMin)));
+  EXPECT_EQ(
+      "-185083747-10-31T10:37:52",
+      Format(civil_second(1970, kIntMin, kIntMin, kIntMin, kIntMin, kIntMin)));
+}
+
+TEST(CivilTime, ImplicitCrossAlignment) {
+  civil_year year(2015);
+  civil_month month = year;
+  civil_day day = month;
+  civil_hour hour = day;
+  civil_minute minute = hour;
+  civil_second second = minute;
+
+  second = year;
+  EXPECT_EQ(second, year);
+  second = month;
+  EXPECT_EQ(second, month);
+  second = day;
+  EXPECT_EQ(second, day);
+  second = hour;
+  EXPECT_EQ(second, hour);
+  second = minute;
+  EXPECT_EQ(second, minute);
+
+  minute = year;
+  EXPECT_EQ(minute, year);
+  minute = month;
+  EXPECT_EQ(minute, month);
+  minute = day;
+  EXPECT_EQ(minute, day);
+  minute = hour;
+  EXPECT_EQ(minute, hour);
+
+  hour = year;
+  EXPECT_EQ(hour, year);
+  hour = month;
+  EXPECT_EQ(hour, month);
+  hour = day;
+  EXPECT_EQ(hour, day);
+
+  day = year;
+  EXPECT_EQ(day, year);
+  day = month;
+  EXPECT_EQ(day, month);
+
+  month = year;
+  EXPECT_EQ(month, year);
+
+  // Ensures unsafe conversions are not allowed.
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_minute>::value));
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_hour>::value));
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_day>::value));
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_month>::value));
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_year>::value));
+
+  EXPECT_FALSE((std::is_convertible<civil_minute, civil_hour>::value));
+  EXPECT_FALSE((std::is_convertible<civil_minute, civil_day>::value));
+  EXPECT_FALSE((std::is_convertible<civil_minute, civil_month>::value));
+  EXPECT_FALSE((std::is_convertible<civil_minute, civil_year>::value));
+
+  EXPECT_FALSE((std::is_convertible<civil_hour, civil_day>::value));
+  EXPECT_FALSE((std::is_convertible<civil_hour, civil_month>::value));
+  EXPECT_FALSE((std::is_convertible<civil_hour, civil_year>::value));
+
+  EXPECT_FALSE((std::is_convertible<civil_day, civil_month>::value));
+  EXPECT_FALSE((std::is_convertible<civil_day, civil_year>::value));
+
+  EXPECT_FALSE((std::is_convertible<civil_month, civil_year>::value));
+}
+
+TEST(CivilTime, ExplicitCrossAlignment) {
+  //
+  // Assign from smaller units -> larger units
+  //
+
+  civil_second second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ("2015-01-02T03:04:05", Format(second));
+
+  civil_minute minute(second);
+  EXPECT_EQ("2015-01-02T03:04", Format(minute));
+
+  civil_hour hour(minute);
+  EXPECT_EQ("2015-01-02T03", Format(hour));
+
+  civil_day day(hour);
+  EXPECT_EQ("2015-01-02", Format(day));
+
+  civil_month month(day);
+  EXPECT_EQ("2015-01", Format(month));
+
+  civil_year year(month);
+  EXPECT_EQ("2015", Format(year));
+
+  //
+  // Now assign from larger units -> smaller units
+  //
+
+  month = civil_month(year);
+  EXPECT_EQ("2015-01", Format(month));
+
+  day = civil_day(month);
+  EXPECT_EQ("2015-01-01", Format(day));
+
+  hour = civil_hour(day);
+  EXPECT_EQ("2015-01-01T00", Format(hour));
+
+  minute = civil_minute(hour);
+  EXPECT_EQ("2015-01-01T00:00", Format(minute));
+
+  second = civil_second(minute);
+  EXPECT_EQ("2015-01-01T00:00:00", Format(second));
+}
+
+// Metafunction to test whether difference is allowed between two types.
+template <typename T1, typename T2>
+struct HasDifference {
+  template <typename U1, typename U2>
+  static std::false_type test(...);
+  template <typename U1, typename U2>
+  static std::true_type test(decltype(std::declval<U1>() - std::declval<U2>()));
+  static constexpr bool value = decltype(test<T1, T2>(0))::value;
+};
+
+TEST(CivilTime, DisallowCrossAlignedDifference) {
+  // Difference is allowed between types with the same alignment.
+  static_assert(HasDifference<civil_second, civil_second>::value, "");
+  static_assert(HasDifference<civil_minute, civil_minute>::value, "");
+  static_assert(HasDifference<civil_hour, civil_hour>::value, "");
+  static_assert(HasDifference<civil_day, civil_day>::value, "");
+  static_assert(HasDifference<civil_month, civil_month>::value, "");
+  static_assert(HasDifference<civil_year, civil_year>::value, "");
+
+  // Difference is disallowed between types with different alignments.
+  static_assert(!HasDifference<civil_second, civil_minute>::value, "");
+  static_assert(!HasDifference<civil_second, civil_hour>::value, "");
+  static_assert(!HasDifference<civil_second, civil_day>::value, "");
+  static_assert(!HasDifference<civil_second, civil_month>::value, "");
+  static_assert(!HasDifference<civil_second, civil_year>::value, "");
+
+  static_assert(!HasDifference<civil_minute, civil_hour>::value, "");
+  static_assert(!HasDifference<civil_minute, civil_day>::value, "");
+  static_assert(!HasDifference<civil_minute, civil_month>::value, "");
+  static_assert(!HasDifference<civil_minute, civil_year>::value, "");
+
+  static_assert(!HasDifference<civil_hour, civil_day>::value, "");
+  static_assert(!HasDifference<civil_hour, civil_month>::value, "");
+  static_assert(!HasDifference<civil_hour, civil_year>::value, "");
+
+  static_assert(!HasDifference<civil_day, civil_month>::value, "");
+  static_assert(!HasDifference<civil_day, civil_year>::value, "");
+
+  static_assert(!HasDifference<civil_month, civil_year>::value, "");
+}
+
+TEST(CivilTime, ValueSemantics) {
+  const civil_hour a(2015, 1, 2, 3);
+  const civil_hour b = a;
+  const civil_hour c(b);
+  civil_hour d;
+  d = c;
+  EXPECT_EQ("2015-01-02T03", Format(d));
+}
+
+TEST(CivilTime, Relational) {
+  // Tests that the alignment unit is ignored in comparison.
+  const civil_year year(2014);
+  const civil_month month(year);
+  EXPECT_EQ(year, month);
+
+#define TEST_RELATIONAL(OLDER, YOUNGER) \
+  do {                                  \
+    EXPECT_FALSE(OLDER < OLDER);        \
+    EXPECT_FALSE(OLDER > OLDER);        \
+    EXPECT_TRUE(OLDER >= OLDER);        \
+    EXPECT_TRUE(OLDER <= OLDER);        \
+    EXPECT_FALSE(YOUNGER < YOUNGER);    \
+    EXPECT_FALSE(YOUNGER > YOUNGER);    \
+    EXPECT_TRUE(YOUNGER >= YOUNGER);    \
+    EXPECT_TRUE(YOUNGER <= YOUNGER);    \
+    EXPECT_EQ(OLDER, OLDER);            \
+    EXPECT_NE(OLDER, YOUNGER);          \
+    EXPECT_LT(OLDER, YOUNGER);          \
+    EXPECT_LE(OLDER, YOUNGER);          \
+    EXPECT_GT(YOUNGER, OLDER);          \
+    EXPECT_GE(YOUNGER, OLDER);          \
+  } while (0)
+
+  // Alignment is ignored in comparison (verified above), so kSecond is used
+  // to test comparison in all field positions.
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+                  civil_second(2015, 1, 1, 0, 0, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+                  civil_second(2014, 2, 1, 0, 0, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+                  civil_second(2014, 1, 2, 0, 0, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+                  civil_second(2014, 1, 1, 1, 0, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 1, 0, 0),
+                  civil_second(2014, 1, 1, 1, 1, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 1, 1, 0),
+                  civil_second(2014, 1, 1, 1, 1, 1));
+
+  // Tests the relational operators of two different civil-time types.
+  TEST_RELATIONAL(civil_day(2014, 1, 1), civil_minute(2014, 1, 1, 1, 1));
+  TEST_RELATIONAL(civil_day(2014, 1, 1), civil_month(2014, 2));
+
+#undef TEST_RELATIONAL
+}
+
+TEST(CivilTime, Arithmetic) {
+  civil_second second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ("2015-01-02T03:04:06", Format(second += 1));
+  EXPECT_EQ("2015-01-02T03:04:07", Format(second + 1));
+  EXPECT_EQ("2015-01-02T03:04:08", Format(2 + second));
+  EXPECT_EQ("2015-01-02T03:04:05", Format(second - 1));
+  EXPECT_EQ("2015-01-02T03:04:05", Format(second -= 1));
+  EXPECT_EQ("2015-01-02T03:04:05", Format(second++));
+  EXPECT_EQ("2015-01-02T03:04:07", Format(++second));
+  EXPECT_EQ("2015-01-02T03:04:07", Format(second--));
+  EXPECT_EQ("2015-01-02T03:04:05", Format(--second));
+
+  civil_minute minute(2015, 1, 2, 3, 4);
+  EXPECT_EQ("2015-01-02T03:05", Format(minute += 1));
+  EXPECT_EQ("2015-01-02T03:06", Format(minute + 1));
+  EXPECT_EQ("2015-01-02T03:07", Format(2 + minute));
+  EXPECT_EQ("2015-01-02T03:04", Format(minute - 1));
+  EXPECT_EQ("2015-01-02T03:04", Format(minute -= 1));
+  EXPECT_EQ("2015-01-02T03:04", Format(minute++));
+  EXPECT_EQ("2015-01-02T03:06", Format(++minute));
+  EXPECT_EQ("2015-01-02T03:06", Format(minute--));
+  EXPECT_EQ("2015-01-02T03:04", Format(--minute));
+
+  civil_hour hour(2015, 1, 2, 3);
+  EXPECT_EQ("2015-01-02T04", Format(hour += 1));
+  EXPECT_EQ("2015-01-02T05", Format(hour + 1));
+  EXPECT_EQ("2015-01-02T06", Format(2 + hour));
+  EXPECT_EQ("2015-01-02T03", Format(hour - 1));
+  EXPECT_EQ("2015-01-02T03", Format(hour -= 1));
+  EXPECT_EQ("2015-01-02T03", Format(hour++));
+  EXPECT_EQ("2015-01-02T05", Format(++hour));
+  EXPECT_EQ("2015-01-02T05", Format(hour--));
+  EXPECT_EQ("2015-01-02T03", Format(--hour));
+
+  civil_day day(2015, 1, 2);
+  EXPECT_EQ("2015-01-03", Format(day += 1));
+  EXPECT_EQ("2015-01-04", Format(day + 1));
+  EXPECT_EQ("2015-01-05", Format(2 + day));
+  EXPECT_EQ("2015-01-02", Format(day - 1));
+  EXPECT_EQ("2015-01-02", Format(day -= 1));
+  EXPECT_EQ("2015-01-02", Format(day++));
+  EXPECT_EQ("2015-01-04", Format(++day));
+  EXPECT_EQ("2015-01-04", Format(day--));
+  EXPECT_EQ("2015-01-02", Format(--day));
+
+  civil_month month(2015, 1);
+  EXPECT_EQ("2015-02", Format(month += 1));
+  EXPECT_EQ("2015-03", Format(month + 1));
+  EXPECT_EQ("2015-04", Format(2 + month));
+  EXPECT_EQ("2015-01", Format(month - 1));
+  EXPECT_EQ("2015-01", Format(month -= 1));
+  EXPECT_EQ("2015-01", Format(month++));
+  EXPECT_EQ("2015-03", Format(++month));
+  EXPECT_EQ("2015-03", Format(month--));
+  EXPECT_EQ("2015-01", Format(--month));
+
+  civil_year year(2015);
+  EXPECT_EQ("2016", Format(year += 1));
+  EXPECT_EQ("2017", Format(year + 1));
+  EXPECT_EQ("2018", Format(2 + year));
+  EXPECT_EQ("2015", Format(year - 1));
+  EXPECT_EQ("2015", Format(year -= 1));
+  EXPECT_EQ("2015", Format(year++));
+  EXPECT_EQ("2017", Format(++year));
+  EXPECT_EQ("2017", Format(year--));
+  EXPECT_EQ("2015", Format(--year));
+}
+
+TEST(CivilTime, ArithmeticLimits) {
+  const int kIntMax = std::numeric_limits<int>::max();
+  const int kIntMin = std::numeric_limits<int>::min();
+
+  civil_second second(1970, 1, 1, 0, 0, 0);
+  second += kIntMax;
+  EXPECT_EQ("2038-01-19T03:14:07", Format(second));
+  second -= kIntMax;
+  EXPECT_EQ("1970-01-01T00:00:00", Format(second));
+  second += kIntMin;
+  EXPECT_EQ("1901-12-13T20:45:52", Format(second));
+  second -= kIntMin;
+  EXPECT_EQ("1970-01-01T00:00:00", Format(second));
+
+  civil_minute minute(1970, 1, 1, 0, 0);
+  minute += kIntMax;
+  EXPECT_EQ("6053-01-23T02:07", Format(minute));
+  minute -= kIntMax;
+  EXPECT_EQ("1970-01-01T00:00", Format(minute));
+  minute += kIntMin;
+  EXPECT_EQ("-2114-12-08T21:52", Format(minute));
+  minute -= kIntMin;
+  EXPECT_EQ("1970-01-01T00:00", Format(minute));
+
+  civil_hour hour(1970, 1, 1, 0);
+  hour += kIntMax;
+  EXPECT_EQ("246953-10-09T07", Format(hour));
+  hour -= kIntMax;
+  EXPECT_EQ("1970-01-01T00", Format(hour));
+  hour += kIntMin;
+  EXPECT_EQ("-243014-03-24T16", Format(hour));
+  hour -= kIntMin;
+  EXPECT_EQ("1970-01-01T00", Format(hour));
+
+  civil_day day(1970, 1, 1);
+  day += kIntMax;
+  EXPECT_EQ("5881580-07-11", Format(day));
+  day -= kIntMax;
+  EXPECT_EQ("1970-01-01", Format(day));
+  day += kIntMin;
+  EXPECT_EQ("-5877641-06-23", Format(day));
+  day -= kIntMin;
+  EXPECT_EQ("1970-01-01", Format(day));
+
+  civil_month month(1970, 1);
+  month += kIntMax;
+  EXPECT_EQ("178958940-08", Format(month));
+  month -= kIntMax;
+  EXPECT_EQ("1970-01", Format(month));
+  month += kIntMin;
+  EXPECT_EQ("-178955001-05", Format(month));
+  month -= kIntMin;
+  EXPECT_EQ("1970-01", Format(month));
+
+  civil_year year(0);
+  year += kIntMax;
+  EXPECT_EQ("2147483647", Format(year));
+  year -= kIntMax;
+  EXPECT_EQ("0", Format(year));
+  year += kIntMin;
+  EXPECT_EQ("-2147483648", Format(year));
+  year -= kIntMin;
+  EXPECT_EQ("0", Format(year));
+}
+
+TEST(CivilTime, ArithmeticDifference) {
+  civil_second second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ(0, second - second);
+  EXPECT_EQ(10, (second + 10) - second);
+  EXPECT_EQ(-10, (second - 10) - second);
+
+  civil_minute minute(2015, 1, 2, 3, 4);
+  EXPECT_EQ(0, minute - minute);
+  EXPECT_EQ(10, (minute + 10) - minute);
+  EXPECT_EQ(-10, (minute - 10) - minute);
+
+  civil_hour hour(2015, 1, 2, 3);
+  EXPECT_EQ(0, hour - hour);
+  EXPECT_EQ(10, (hour + 10) - hour);
+  EXPECT_EQ(-10, (hour - 10) - hour);
+
+  civil_day day(2015, 1, 2);
+  EXPECT_EQ(0, day - day);
+  EXPECT_EQ(10, (day + 10) - day);
+  EXPECT_EQ(-10, (day - 10) - day);
+
+  civil_month month(2015, 1);
+  EXPECT_EQ(0, month - month);
+  EXPECT_EQ(10, (month + 10) - month);
+  EXPECT_EQ(-10, (month - 10) - month);
+
+  civil_year year(2015);
+  EXPECT_EQ(0, year - year);
+  EXPECT_EQ(10, (year + 10) - year);
+  EXPECT_EQ(-10, (year - 10) - year);
+}
+
+TEST(CivilTime, DifferenceLimits) {
+  const int kIntMax = std::numeric_limits<int>::max();
+  const int kIntMin = std::numeric_limits<int>::min();
+
+  // Check day arithmetic at the end of the year range.
+  const civil_day max_day(kIntMax, 12, 31);
+  EXPECT_EQ(1, max_day - (max_day - 1));
+  EXPECT_EQ(-1, (max_day - 1) - max_day);
+
+  // Check day arithmetic at the end of the year range.
+  const civil_day min_day(kIntMin, 1, 1);
+  EXPECT_EQ(1, (min_day + 1) - min_day);
+  EXPECT_EQ(-1, min_day - (min_day + 1));
+
+  // Check the limits of the return value.
+  const civil_day d1(1970, 1, 1);
+  const civil_day d2(5881580, 7, 11);
+  EXPECT_EQ(kIntMax, d2 - d1);
+  EXPECT_EQ(kIntMin, d1 - (d2 + 1));
+}
+
+TEST(CivilTime, Properties) {
+  civil_second ss(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, ss.year());
+  EXPECT_EQ(2, ss.month());
+  EXPECT_EQ(3, ss.day());
+  EXPECT_EQ(4, ss.hour());
+  EXPECT_EQ(5, ss.minute());
+  EXPECT_EQ(6, ss.second());
+  EXPECT_EQ(weekday::tuesday, get_weekday(ss));
+  EXPECT_EQ(34, get_yearday(ss));
+
+  civil_minute mm(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, mm.year());
+  EXPECT_EQ(2, mm.month());
+  EXPECT_EQ(3, mm.day());
+  EXPECT_EQ(4, mm.hour());
+  EXPECT_EQ(5, mm.minute());
+  EXPECT_EQ(0, mm.second());
+  EXPECT_EQ(weekday::tuesday, get_weekday(mm));
+  EXPECT_EQ(34, get_yearday(mm));
+
+  civil_hour hh(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, hh.year());
+  EXPECT_EQ(2, hh.month());
+  EXPECT_EQ(3, hh.day());
+  EXPECT_EQ(4, hh.hour());
+  EXPECT_EQ(0, hh.minute());
+  EXPECT_EQ(0, hh.second());
+  EXPECT_EQ(weekday::tuesday, get_weekday(hh));
+  EXPECT_EQ(34, get_yearday(hh));
+
+  civil_day d(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, d.year());
+  EXPECT_EQ(2, d.month());
+  EXPECT_EQ(3, d.day());
+  EXPECT_EQ(0, d.hour());
+  EXPECT_EQ(0, d.minute());
+  EXPECT_EQ(0, d.second());
+  EXPECT_EQ(weekday::tuesday, get_weekday(d));
+  EXPECT_EQ(34, get_yearday(d));
+
+  civil_month m(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, m.year());
+  EXPECT_EQ(2, m.month());
+  EXPECT_EQ(1, m.day());
+  EXPECT_EQ(0, m.hour());
+  EXPECT_EQ(0, m.minute());
+  EXPECT_EQ(0, m.second());
+  EXPECT_EQ(weekday::sunday, get_weekday(m));
+  EXPECT_EQ(32, get_yearday(m));
+
+  civil_year y(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, y.year());
+  EXPECT_EQ(1, y.month());
+  EXPECT_EQ(1, y.day());
+  EXPECT_EQ(0, y.hour());
+  EXPECT_EQ(0, y.minute());
+  EXPECT_EQ(0, y.second());
+  EXPECT_EQ(weekday::thursday, get_weekday(y));
+  EXPECT_EQ(1, get_yearday(y));
+}
+
+TEST(CivilTime, OutputStream) {
+  // Tests formatting of civil_year, which does not pad.
+  EXPECT_EQ("2016", Format(civil_year(2016)));
+  EXPECT_EQ("123", Format(civil_year(123)));
+  EXPECT_EQ("0", Format(civil_year(0)));
+  EXPECT_EQ("-1", Format(civil_year(-1)));
+
+  // Tests formatting of sub-year types, which pad to 2 digits
+  EXPECT_EQ("2016-02", Format(civil_month(2016, 2)));
+  EXPECT_EQ("2016-02-03", Format(civil_day(2016, 2, 3)));
+  EXPECT_EQ("2016-02-03T04", Format(civil_hour(2016, 2, 3, 4)));
+  EXPECT_EQ("2016-02-03T04:05", Format(civil_minute(2016, 2, 3, 4, 5)));
+  EXPECT_EQ("2016-02-03T04:05:06", Format(civil_second(2016, 2, 3, 4, 5, 6)));
+
+  // Tests formatting of weekday.
+  EXPECT_EQ("Monday", Format(weekday::monday));
+  EXPECT_EQ("Tuesday", Format(weekday::tuesday));
+  EXPECT_EQ("Wednesday", Format(weekday::wednesday));
+  EXPECT_EQ("Thursday", Format(weekday::thursday));
+  EXPECT_EQ("Friday", Format(weekday::friday));
+  EXPECT_EQ("Saturday", Format(weekday::saturday));
+  EXPECT_EQ("Sunday", Format(weekday::sunday));
+}
+
+TEST(CivilTime, OutputStreamLeftFillWidth) {
+  civil_second cs(2016, 2, 3, 4, 5, 6);
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_year(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016.................X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_month(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02..............X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_day(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03...........X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_hour(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04........X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_minute(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04:05.....X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_second(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04:05:06..X..", ss.str());
+  }
+}
+
+TEST(CivilTime, NextPrevWeekday) {
+  // Jan 1, 1970 was a Thursday.
+  const civil_day thursday(1970, 1, 1);
+  EXPECT_EQ(weekday::thursday, get_weekday(thursday));
+
+  // Thursday -> Thursday
+  civil_day d = next_weekday(thursday, weekday::thursday);
+  EXPECT_EQ(7, d - thursday) << Format(d);
+  EXPECT_EQ(d - 14, prev_weekday(thursday, weekday::thursday));
+
+  // Thursday -> Friday
+  d = next_weekday(thursday, weekday::friday);
+  EXPECT_EQ(1, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::friday));
+
+  // Thursday -> Saturday
+  d = next_weekday(thursday, weekday::saturday);
+  EXPECT_EQ(2, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::saturday));
+
+  // Thursday -> Sunday
+  d = next_weekday(thursday, weekday::sunday);
+  EXPECT_EQ(3, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::sunday));
+
+  // Thursday -> Monday
+  d = next_weekday(thursday, weekday::monday);
+  EXPECT_EQ(4, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::monday));
+
+  // Thursday -> Tuesday
+  d = next_weekday(thursday, weekday::tuesday);
+  EXPECT_EQ(5, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::tuesday));
+
+  // Thursday -> Wednesday
+  d = next_weekday(thursday, weekday::wednesday);
+  EXPECT_EQ(6, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::wednesday));
+}
+
+TEST(CivilTime, NormalizeWithHugeYear) {
+  civil_month c(9223372036854775807, 1);
+  EXPECT_EQ("9223372036854775807-01", Format(c));
+  c = c - 1;  // Causes normalization
+  EXPECT_EQ("9223372036854775806-12", Format(c));
+
+  c = civil_month(-9223372036854775807 - 1, 1);
+  EXPECT_EQ("-9223372036854775808-01", Format(c));
+  c = c + 12;  // Causes normalization
+  EXPECT_EQ("-9223372036854775807-01", Format(c));
+}
+
+TEST(CivilTime, LeapYears) {
+  // Test data for leap years.
+  const struct {
+    int year;
+    int days;
+    struct {
+      int month;
+      int day;
+    } leap_day;  // The date of the day after Feb 28.
+  } kLeapYearTable[]{
+      {1900, 365, {3, 1}},
+      {1999, 365, {3, 1}},
+      {2000, 366, {2, 29}},  // leap year
+      {2001, 365, {3, 1}},
+      {2002, 365, {3, 1}},
+      {2003, 365, {3, 1}},
+      {2004, 366, {2, 29}},  // leap year
+      {2005, 365, {3, 1}},
+      {2006, 365, {3, 1}},
+      {2007, 365, {3, 1}},
+      {2008, 366, {2, 29}},  // leap year
+      {2009, 365, {3, 1}},
+      {2100, 365, {3, 1}},
+  };
+
+  for (const auto& e : kLeapYearTable) {
+    // Tests incrementing through the leap day.
+    const civil_day feb28(e.year, 2, 28);
+    const civil_day next_day = feb28 + 1;
+    EXPECT_EQ(e.leap_day.month, next_day.month());
+    EXPECT_EQ(e.leap_day.day, next_day.day());
+
+    // Tests difference in days of leap years.
+    const civil_year year(feb28);
+    const civil_year next_year = year + 1;
+    EXPECT_EQ(e.days, civil_day(next_year) - civil_day(year));
+  }
+}
+
+TEST(CivilTime, FirstThursdayInMonth) {
+  const civil_day nov1(2014, 11, 1);
+  const civil_day thursday = next_weekday(nov1 - 1, weekday::thursday);
+  EXPECT_EQ("2014-11-06", Format(thursday));
+
+  // Bonus: Date of Thanksgiving in the United States
+  // Rule: Fourth Thursday of November
+  const civil_day thanksgiving = thursday + 7 * 3;
+  EXPECT_EQ("2014-11-27", Format(thanksgiving));
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_fixed.cc b/absl/time/internal/cctz/src/time_zone_fixed.cc
new file mode 100644
index 0000000..b0d159a
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_fixed.cc
@@ -0,0 +1,138 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "time_zone_fixed.h"
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <cstring>
+#include <string>
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// The prefix used for the internal names of fixed-offset zones.
+const char kFixedZonePrefix[] = "Fixed/UTC";
+
+const char kDigits[] = "0123456789";
+
+char* Format02d(char* p, int v) {
+  *p++ = kDigits[(v / 10) % 10];
+  *p++ = kDigits[v % 10];
+  return p;
+}
+
+int Parse02d(const char* p) {
+  if (const char* ap = std::strchr(kDigits, *p)) {
+    int v = static_cast<int>(ap - kDigits);
+    if (const char* bp = std::strchr(kDigits, *++p)) {
+      return (v * 10) + static_cast<int>(bp - kDigits);
+    }
+  }
+  return -1;
+}
+
+}  // namespace
+
+bool FixedOffsetFromName(const std::string& name, seconds* offset) {
+  if (name.compare(0, std::string::npos, "UTC", 3) == 0) {
+    *offset = seconds::zero();
+    return true;
+  }
+
+  const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+  const char* const ep = kFixedZonePrefix + prefix_len;
+  if (name.size() != prefix_len + 9)  // <prefix>+99:99:99
+    return false;
+  if (!std::equal(kFixedZonePrefix, ep, name.begin()))
+    return false;
+  const char* np = name.data() + prefix_len;
+  if (np[0] != '+' && np[0] != '-')
+    return false;
+  if (np[3] != ':' || np[6] != ':')  // see note below about large offsets
+    return false;
+
+  int hours = Parse02d(np + 1);
+  if (hours == -1) return false;
+  int mins = Parse02d(np + 4);
+  if (mins == -1) return false;
+  int secs = Parse02d(np + 7);
+  if (secs == -1) return false;
+
+  secs += ((hours * 60) + mins) * 60;
+  if (secs > 24 * 60 * 60) return false;  // outside supported offset range
+  *offset = seconds(secs * (np[0] == '-' ? -1 : 1));  // "-" means west
+  return true;
+}
+
+std::string FixedOffsetToName(const seconds& offset) {
+  if (offset == seconds::zero()) return "UTC";
+  if (offset < std::chrono::hours(-24) || offset > std::chrono::hours(24)) {
+    // We don't support fixed-offset zones more than 24 hours
+    // away from UTC to avoid complications in rendering such
+    // offsets and to (somewhat) limit the total number of zones.
+    return "UTC";
+  }
+  int seconds = static_cast<int>(offset.count());
+  const char sign = (seconds < 0 ? '-' : '+');
+  int minutes = seconds / 60;
+  seconds %= 60;
+  if (sign == '-') {
+    if (seconds > 0) {
+      seconds -= 60;
+      minutes += 1;
+    }
+    seconds = -seconds;
+    minutes = -minutes;
+  }
+  int hours = minutes / 60;
+  minutes %= 60;
+  const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+  char buf[prefix_len + sizeof("-24:00:00")];
+  char* ep = std::copy(kFixedZonePrefix, kFixedZonePrefix + prefix_len, buf);
+  *ep++ = sign;
+  ep = Format02d(ep, hours);
+  *ep++ = ':';
+  ep = Format02d(ep, minutes);
+  *ep++ = ':';
+  ep = Format02d(ep, seconds);
+  *ep++ = '\0';
+  assert(ep == buf + sizeof(buf));
+  return buf;
+}
+
+std::string FixedOffsetToAbbr(const seconds& offset) {
+  std::string abbr = FixedOffsetToName(offset);
+  const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+  if (abbr.size() == prefix_len + 9) {         // <prefix>+99:99:99
+    abbr.erase(0, prefix_len);                 // +99:99:99
+    abbr.erase(6, 1);                          // +99:9999
+    abbr.erase(3, 1);                          // +999999
+    if (abbr[5] == '0' && abbr[6] == '0') {    // +999900
+      abbr.erase(5, 2);                        // +9999
+      if (abbr[3] == '0' && abbr[4] == '0') {  // +9900
+        abbr.erase(3, 2);                      // +99
+      }
+    }
+  }
+  return abbr;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_fixed.h b/absl/time/internal/cctz/src/time_zone_fixed.h
new file mode 100644
index 0000000..9c1f5e7
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_fixed.h
@@ -0,0 +1,49 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
+
+#include <string>
+
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// Helper functions for dealing with the names and abbreviations
+// of time zones that are a fixed offset (seconds east) from UTC.
+// FixedOffsetFromName() extracts the offset from a valid fixed-offset
+// name, while FixedOffsetToName() and FixedOffsetToAbbr() generate
+// the canonical zone name and abbreviation respectively for the given
+// offset.
+//
+// A fixed-offset name looks like "Fixed/UTC<+-><hours>:<mins>:<secs>".
+// Its abbreviation is of the form "UTC(<+->H?H(MM(SS)?)?)?" where the
+// optional pieces are omitted when their values are zero.  (Note that
+// the sign is the opposite of that used in a POSIX TZ specification.)
+//
+// Note: FixedOffsetFromName() fails on syntax errors or when the parsed
+// offset exceeds 24 hours.  FixedOffsetToName() and FixedOffsetToAbbr()
+// both produce "UTC" when the argument offset exceeds 24 hours.
+bool FixedOffsetFromName(const std::string& name, seconds* offset);
+std::string FixedOffsetToName(const seconds& offset);
+std::string FixedOffsetToAbbr(const seconds& offset);
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
diff --git a/absl/time/internal/cctz/src/time_zone_format.cc b/absl/time/internal/cctz/src/time_zone_format.cc
new file mode 100644
index 0000000..84e280b
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_format.cc
@@ -0,0 +1,919 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#if !defined(HAS_STRPTIME)
+# if !defined(_MSC_VER) && !defined(__MINGW32__)
+#  define HAS_STRPTIME 1  // assume everyone has strptime() except windows
+# endif
+#endif
+
+#if defined(HAS_STRPTIME) && HAS_STRPTIME
+# if !defined(_XOPEN_SOURCE)
+#  define _XOPEN_SOURCE  // Definedness suffices for strptime.
+# endif
+#endif
+
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+// Include time.h directly since, by C++ standards, ctime doesn't have to
+// declare strptime.
+#include <time.h>
+
+#include <cctype>
+#include <chrono>
+#include <cstddef>
+#include <cstdint>
+#include <cstring>
+#include <ctime>
+#include <limits>
+#include <string>
+#include <vector>
+#if !HAS_STRPTIME
+#include <iomanip>
+#include <sstream>
+#endif
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "time_zone_if.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+namespace detail {
+
+namespace {
+
+#if !HAS_STRPTIME
+// Build a strptime() using C++11's std::get_time().
+char* strptime(const char* s, const char* fmt, std::tm* tm) {
+  std::istringstream input(s);
+  input >> std::get_time(tm, fmt);
+  if (input.fail()) return nullptr;
+  return const_cast<char*>(s) +
+         (input.eof() ? strlen(s) : static_cast<std::size_t>(input.tellg()));
+}
+#endif
+
+std::tm ToTM(const time_zone::absolute_lookup& al) {
+  std::tm tm{};
+  tm.tm_sec = al.cs.second();
+  tm.tm_min = al.cs.minute();
+  tm.tm_hour = al.cs.hour();
+  tm.tm_mday = al.cs.day();
+  tm.tm_mon = al.cs.month() - 1;
+
+  // Saturate tm.tm_year is cases of over/underflow.
+  if (al.cs.year() < std::numeric_limits<int>::min() + 1900) {
+    tm.tm_year = std::numeric_limits<int>::min();
+  } else if (al.cs.year() - 1900 > std::numeric_limits<int>::max()) {
+    tm.tm_year = std::numeric_limits<int>::max();
+  } else {
+    tm.tm_year = static_cast<int>(al.cs.year() - 1900);
+  }
+
+  switch (get_weekday(al.cs)) {
+    case weekday::sunday:
+      tm.tm_wday = 0;
+      break;
+    case weekday::monday:
+      tm.tm_wday = 1;
+      break;
+    case weekday::tuesday:
+      tm.tm_wday = 2;
+      break;
+    case weekday::wednesday:
+      tm.tm_wday = 3;
+      break;
+    case weekday::thursday:
+      tm.tm_wday = 4;
+      break;
+    case weekday::friday:
+      tm.tm_wday = 5;
+      break;
+    case weekday::saturday:
+      tm.tm_wday = 6;
+      break;
+  }
+  tm.tm_yday = get_yearday(al.cs) - 1;
+  tm.tm_isdst = al.is_dst ? 1 : 0;
+  return tm;
+}
+
+const char kDigits[] = "0123456789";
+
+// Formats a 64-bit integer in the given field width.  Note that it is up
+// to the caller of Format64() [and Format02d()/FormatOffset()] to ensure
+// that there is sufficient space before ep to hold the conversion.
+char* Format64(char* ep, int width, std::int_fast64_t v) {
+  bool neg = false;
+  if (v < 0) {
+    --width;
+    neg = true;
+    if (v == std::numeric_limits<std::int_fast64_t>::min()) {
+      // Avoid negating minimum value.
+      std::int_fast64_t last_digit = -(v % 10);
+      v /= 10;
+      if (last_digit < 0) {
+        ++v;
+        last_digit += 10;
+      }
+      --width;
+      *--ep = kDigits[last_digit];
+    }
+    v = -v;
+  }
+  do {
+    --width;
+    *--ep = kDigits[v % 10];
+  } while (v /= 10);
+  while (--width >= 0) *--ep = '0';  // zero pad
+  if (neg) *--ep = '-';
+  return ep;
+}
+
+// Formats [0 .. 99] as %02d.
+char* Format02d(char* ep, int v) {
+  *--ep = kDigits[v % 10];
+  *--ep = kDigits[(v / 10) % 10];
+  return ep;
+}
+
+// Formats a UTC offset, like +00:00.
+char* FormatOffset(char* ep, int offset, const char* mode) {
+  // TODO: Follow the RFC3339 "Unknown Local Offset Convention" and
+  // generate a "negative zero" when we're formatting a zero offset
+  // as the result of a failed load_time_zone().
+  char sign = '+';
+  if (offset < 0) {
+    offset = -offset;  // bounded by 24h so no overflow
+    sign = '-';
+  }
+  const int seconds = offset % 60;
+  const int minutes = (offset /= 60) % 60;
+  const int hours = offset /= 60;
+  const char sep = mode[0];
+  const bool ext = (sep != '\0' && mode[1] == '*');
+  const bool ccc = (ext && mode[2] == ':');
+  if (ext && (!ccc || seconds != 0)) {
+    ep = Format02d(ep, seconds);
+    *--ep = sep;
+  } else {
+    // If we're not rendering seconds, sub-minute negative offsets
+    // should get a positive sign (e.g., offset=-10s => "+00:00").
+    if (hours == 0 && minutes == 0) sign = '+';
+  }
+  if (!ccc || minutes != 0 || seconds != 0) {
+    ep = Format02d(ep, minutes);
+    if (sep != '\0') *--ep = sep;
+  }
+  ep = Format02d(ep, hours);
+  *--ep = sign;
+  return ep;
+}
+
+// Formats a std::tm using strftime(3).
+void FormatTM(std::string* out, const std::string& fmt, const std::tm& tm) {
+  // strftime(3) returns the number of characters placed in the output
+  // array (which may be 0 characters).  It also returns 0 to indicate
+  // an error, like the array wasn't large enough.  To accommodate this,
+  // the following code grows the buffer size from 2x the format std::string
+  // length up to 32x.
+  for (std::size_t i = 2; i != 32; i *= 2) {
+    std::size_t buf_size = fmt.size() * i;
+    std::vector<char> buf(buf_size);
+    if (std::size_t len = strftime(&buf[0], buf_size, fmt.c_str(), &tm)) {
+      out->append(&buf[0], len);
+      return;
+    }
+  }
+}
+
+// Used for %E#S/%E#f specifiers and for data values in parse().
+template <typename T>
+const char* ParseInt(const char* dp, int width, T min, T max, T* vp) {
+  if (dp != nullptr) {
+    const T kmin = std::numeric_limits<T>::min();
+    bool erange = false;
+    bool neg = false;
+    T value = 0;
+    if (*dp == '-') {
+      neg = true;
+      if (width <= 0 || --width != 0) {
+        ++dp;
+      } else {
+        dp = nullptr;  // width was 1
+      }
+    }
+    if (const char* const bp = dp) {
+      while (const char* cp = strchr(kDigits, *dp)) {
+        int d = static_cast<int>(cp - kDigits);
+        if (d >= 10) break;
+        if (value < kmin / 10) {
+          erange = true;
+          break;
+        }
+        value *= 10;
+        if (value < kmin + d) {
+          erange = true;
+          break;
+        }
+        value -= d;
+        dp += 1;
+        if (width > 0 && --width == 0) break;
+      }
+      if (dp != bp && !erange && (neg || value != kmin)) {
+        if (!neg || value != 0) {
+          if (!neg) value = -value;  // make positive
+          if (min <= value && value <= max) {
+            *vp = value;
+          } else {
+            dp = nullptr;
+          }
+        } else {
+          dp = nullptr;
+        }
+      } else {
+        dp = nullptr;
+      }
+    }
+  }
+  return dp;
+}
+
+// The number of base-10 digits that can be represented by a signed 64-bit
+// integer.  That is, 10^kDigits10_64 <= 2^63 - 1 < 10^(kDigits10_64 + 1).
+const int kDigits10_64 = 18;
+
+// 10^n for everything that can be represented by a signed 64-bit integer.
+const std::int_fast64_t kExp10[kDigits10_64 + 1] = {
+    1,
+    10,
+    100,
+    1000,
+    10000,
+    100000,
+    1000000,
+    10000000,
+    100000000,
+    1000000000,
+    10000000000,
+    100000000000,
+    1000000000000,
+    10000000000000,
+    100000000000000,
+    1000000000000000,
+    10000000000000000,
+    100000000000000000,
+    1000000000000000000,
+};
+
+}  // namespace
+
+// Uses strftime(3) to format the given Time.  The following extended format
+// specifiers are also supported:
+//
+//   - %Ez  - RFC3339-compatible numeric UTC offset (+hh:mm or -hh:mm)
+//   - %E*z - Full-resolution numeric UTC offset (+hh:mm:ss or -hh:mm:ss)
+//   - %E#S - Seconds with # digits of fractional precision
+//   - %E*S - Seconds with full fractional precision (a literal '*')
+//   - %E4Y - Four-character years (-999 ... -001, 0000, 0001 ... 9999)
+//
+// The standard specifiers from RFC3339_* (%Y, %m, %d, %H, %M, and %S) are
+// handled internally for performance reasons.  strftime(3) is slow due to
+// a POSIX requirement to respect changes to ${TZ}.
+//
+// The TZ/GNU %s extension is handled internally because strftime() has
+// to use mktime() to generate it, and that assumes the local time zone.
+//
+// We also handle the %z and %Z specifiers to accommodate platforms that do
+// not support the tm_gmtoff and tm_zone extensions to std::tm.
+//
+// Requires that zero() <= fs < seconds(1).
+std::string format(const std::string& format, const time_point<seconds>& tp,
+                   const detail::femtoseconds& fs, const time_zone& tz) {
+  std::string result;
+  result.reserve(format.size());  // A reasonable guess for the result size.
+  const time_zone::absolute_lookup al = tz.lookup(tp);
+  const std::tm tm = ToTM(al);
+
+  // Scratch buffer for internal conversions.
+  char buf[3 + kDigits10_64];  // enough for longest conversion
+  char* const ep = buf + sizeof(buf);
+  char* bp;  // works back from ep
+
+  // Maintain three, disjoint subsequences that span format.
+  //   [format.begin() ... pending) : already formatted into result
+  //   [pending ... cur) : formatting pending, but no special cases
+  //   [cur ... format.end()) : unexamined
+  // Initially, everything is in the unexamined part.
+  const char* pending = format.c_str();  // NUL terminated
+  const char* cur = pending;
+  const char* end = pending + format.length();
+
+  while (cur != end) {  // while something is unexamined
+    // Moves cur to the next percent sign.
+    const char* start = cur;
+    while (cur != end && *cur != '%') ++cur;
+
+    // If the new pending text is all ordinary, copy it out.
+    if (cur != start && pending == start) {
+      result.append(pending, static_cast<std::size_t>(cur - pending));
+      pending = start = cur;
+    }
+
+    // Span the sequential percent signs.
+    const char* percent = cur;
+    while (cur != end && *cur == '%') ++cur;
+
+    // If the new pending text is all percents, copy out one
+    // percent for every matched pair, then skip those pairs.
+    if (cur != start && pending == start) {
+      std::size_t escaped = static_cast<std::size_t>(cur - pending) / 2;
+      result.append(pending, escaped);
+      pending += escaped * 2;
+      // Also copy out a single trailing percent.
+      if (pending != cur && cur == end) {
+        result.push_back(*pending++);
+      }
+    }
+
+    // Loop unless we have an unescaped percent.
+    if (cur == end || (cur - percent) % 2 == 0) continue;
+
+    // Simple specifiers that we handle ourselves.
+    if (strchr("YmdeHMSzZs%", *cur)) {
+      if (cur - 1 != pending) {
+        FormatTM(&result, std::string(pending, cur - 1), tm);
+      }
+      switch (*cur) {
+        case 'Y':
+          // This avoids the tm.tm_year overflow problem for %Y, however
+          // tm.tm_year will still be used by other specifiers like %D.
+          bp = Format64(ep, 0, al.cs.year());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'm':
+          bp = Format02d(ep, al.cs.month());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'd':
+        case 'e':
+          bp = Format02d(ep, al.cs.day());
+          if (*cur == 'e' && *bp == '0') *bp = ' ';  // for Windows
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'H':
+          bp = Format02d(ep, al.cs.hour());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'M':
+          bp = Format02d(ep, al.cs.minute());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'S':
+          bp = Format02d(ep, al.cs.second());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'z':
+          bp = FormatOffset(ep, al.offset, "");
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'Z':
+          result.append(al.abbr);
+          break;
+        case 's':
+          bp = Format64(ep, 0, ToUnixSeconds(tp));
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case '%':
+          result.push_back('%');
+          break;
+      }
+      pending = ++cur;
+      continue;
+    }
+
+    // More complex specifiers that we handle ourselves.
+    if (*cur == ':' && cur + 1 != end) {
+      if (*(cur + 1) == 'z') {
+        // Formats %:z.
+        if (cur - 1 != pending) {
+          FormatTM(&result, std::string(pending, cur - 1), tm);
+        }
+        bp = FormatOffset(ep, al.offset, ":");
+        result.append(bp, static_cast<std::size_t>(ep - bp));
+        pending = cur += 2;
+        continue;
+      }
+      if (*(cur + 1) == ':' && cur + 2 != end) {
+        if (*(cur + 2) == 'z') {
+          // Formats %::z.
+          if (cur - 1 != pending) {
+            FormatTM(&result, std::string(pending, cur - 1), tm);
+          }
+          bp = FormatOffset(ep, al.offset, ":*");
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          pending = cur += 3;
+          continue;
+        }
+        if (*(cur + 2) == ':' && cur + 3 != end) {
+          if (*(cur + 3) == 'z') {
+            // Formats %:::z.
+            if (cur - 1 != pending) {
+              FormatTM(&result, std::string(pending, cur - 1), tm);
+            }
+            bp = FormatOffset(ep, al.offset, ":*:");
+            result.append(bp, static_cast<std::size_t>(ep - bp));
+            pending = cur += 4;
+            continue;
+          }
+        }
+      }
+    }
+
+    // Loop if there is no E modifier.
+    if (*cur != 'E' || ++cur == end) continue;
+
+    // Format our extensions.
+    if (*cur == 'z') {
+      // Formats %Ez.
+      if (cur - 2 != pending) {
+        FormatTM(&result, std::string(pending, cur - 2), tm);
+      }
+      bp = FormatOffset(ep, al.offset, ":");
+      result.append(bp, static_cast<std::size_t>(ep - bp));
+      pending = ++cur;
+    } else if (*cur == '*' && cur + 1 != end && *(cur + 1) == 'z') {
+      // Formats %E*z.
+      if (cur - 2 != pending) {
+        FormatTM(&result, std::string(pending, cur - 2), tm);
+      }
+      bp = FormatOffset(ep, al.offset, ":*");
+      result.append(bp, static_cast<std::size_t>(ep - bp));
+      pending = cur += 2;
+    } else if (*cur == '*' && cur + 1 != end &&
+               (*(cur + 1) == 'S' || *(cur + 1) == 'f')) {
+      // Formats %E*S or %E*F.
+      if (cur - 2 != pending) {
+        FormatTM(&result, std::string(pending, cur - 2), tm);
+      }
+      char* cp = ep;
+      bp = Format64(cp, 15, fs.count());
+      while (cp != bp && cp[-1] == '0') --cp;
+      switch (*(cur + 1)) {
+        case 'S':
+          if (cp != bp) *--bp = '.';
+          bp = Format02d(bp, al.cs.second());
+          break;
+        case 'f':
+          if (cp == bp) *--bp = '0';
+          break;
+      }
+      result.append(bp, static_cast<std::size_t>(cp - bp));
+      pending = cur += 2;
+    } else if (*cur == '4' && cur + 1 != end && *(cur + 1) == 'Y') {
+      // Formats %E4Y.
+      if (cur - 2 != pending) {
+        FormatTM(&result, std::string(pending, cur - 2), tm);
+      }
+      bp = Format64(ep, 4, al.cs.year());
+      result.append(bp, static_cast<std::size_t>(ep - bp));
+      pending = cur += 2;
+    } else if (std::isdigit(*cur)) {
+      // Possibly found %E#S or %E#f.
+      int n = 0;
+      if (const char* np = ParseInt(cur, 0, 0, 1024, &n)) {
+        if (*np == 'S' || *np == 'f') {
+          // Formats %E#S or %E#f.
+          if (cur - 2 != pending) {
+            FormatTM(&result, std::string(pending, cur - 2), tm);
+          }
+          bp = ep;
+          if (n > 0) {
+            if (n > kDigits10_64) n = kDigits10_64;
+            bp = Format64(bp, n, (n > 15) ? fs.count() * kExp10[n - 15]
+                                          : fs.count() / kExp10[15 - n]);
+            if (*np == 'S') *--bp = '.';
+          }
+          if (*np == 'S') bp = Format02d(bp, al.cs.second());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          pending = cur = ++np;
+        }
+      }
+    }
+  }
+
+  // Formats any remaining data.
+  if (end != pending) {
+    FormatTM(&result, std::string(pending, end), tm);
+  }
+
+  return result;
+}
+
+namespace {
+
+const char* ParseOffset(const char* dp, const char* mode, int* offset) {
+  if (dp != nullptr) {
+    const char first = *dp++;
+    if (first == '+' || first == '-') {
+      char sep = mode[0];
+      int hours = 0;
+      int minutes = 0;
+      int seconds = 0;
+      const char* ap = ParseInt(dp, 2, 0, 23, &hours);
+      if (ap != nullptr && ap - dp == 2) {
+        dp = ap;
+        if (sep != '\0' && *ap == sep) ++ap;
+        const char* bp = ParseInt(ap, 2, 0, 59, &minutes);
+        if (bp != nullptr && bp - ap == 2) {
+          dp = bp;
+          if (sep != '\0' && *bp == sep) ++bp;
+          const char* cp = ParseInt(bp, 2, 0, 59, &seconds);
+          if (cp != nullptr && cp - bp == 2) dp = cp;
+        }
+        *offset = ((hours * 60 + minutes) * 60) + seconds;
+        if (first == '-') *offset = -*offset;
+      } else {
+        dp = nullptr;
+      }
+    } else if (first == 'Z') {  // Zulu
+      *offset = 0;
+    } else {
+      dp = nullptr;
+    }
+  }
+  return dp;
+}
+
+const char* ParseZone(const char* dp, std::string* zone) {
+  zone->clear();
+  if (dp != nullptr) {
+    while (*dp != '\0' && !std::isspace(*dp)) zone->push_back(*dp++);
+    if (zone->empty()) dp = nullptr;
+  }
+  return dp;
+}
+
+const char* ParseSubSeconds(const char* dp, detail::femtoseconds* subseconds) {
+  if (dp != nullptr) {
+    std::int_fast64_t v = 0;
+    std::int_fast64_t exp = 0;
+    const char* const bp = dp;
+    while (const char* cp = strchr(kDigits, *dp)) {
+      int d = static_cast<int>(cp - kDigits);
+      if (d >= 10) break;
+      if (exp < 15) {
+        exp += 1;
+        v *= 10;
+        v += d;
+      }
+      ++dp;
+    }
+    if (dp != bp) {
+      v *= kExp10[15 - exp];
+      *subseconds = detail::femtoseconds(v);
+    } else {
+      dp = nullptr;
+    }
+  }
+  return dp;
+}
+
+// Parses a string into a std::tm using strptime(3).
+const char* ParseTM(const char* dp, const char* fmt, std::tm* tm) {
+  if (dp != nullptr) {
+    dp = strptime(dp, fmt, tm);
+  }
+  return dp;
+}
+
+}  // namespace
+
+// Uses strptime(3) to parse the given input.  Supports the same extended
+// format specifiers as format(), although %E#S and %E*S are treated
+// identically (and similarly for %E#f and %E*f).  %Ez and %E*z also accept
+// the same inputs.
+//
+// The standard specifiers from RFC3339_* (%Y, %m, %d, %H, %M, and %S) are
+// handled internally so that we can normally avoid strptime() altogether
+// (which is particularly helpful when the native implementation is broken).
+//
+// The TZ/GNU %s extension is handled internally because strptime() has to
+// use localtime_r() to generate it, and that assumes the local time zone.
+//
+// We also handle the %z specifier to accommodate platforms that do not
+// support the tm_gmtoff extension to std::tm.  %Z is parsed but ignored.
+bool parse(const std::string& format, const std::string& input,
+           const time_zone& tz, time_point<seconds>* sec,
+           detail::femtoseconds* fs, std::string* err) {
+  // The unparsed input.
+  const char* data = input.c_str();  // NUL terminated
+
+  // Skips leading whitespace.
+  while (std::isspace(*data)) ++data;
+
+  const year_t kyearmax = std::numeric_limits<year_t>::max();
+  const year_t kyearmin = std::numeric_limits<year_t>::min();
+
+  // Sets default values for unspecified fields.
+  bool saw_year = false;
+  year_t year = 1970;
+  std::tm tm{};
+  tm.tm_year = 1970 - 1900;
+  tm.tm_mon = 1 - 1;  // Jan
+  tm.tm_mday = 1;
+  tm.tm_hour = 0;
+  tm.tm_min = 0;
+  tm.tm_sec = 0;
+  tm.tm_wday = 4;  // Thu
+  tm.tm_yday = 0;
+  tm.tm_isdst = 0;
+  auto subseconds = detail::femtoseconds::zero();
+  bool saw_offset = false;
+  int offset = 0;  // No offset from passed tz.
+  std::string zone = "UTC";
+
+  const char* fmt = format.c_str();  // NUL terminated
+  bool twelve_hour = false;
+  bool afternoon = false;
+
+  bool saw_percent_s = false;
+  std::int_fast64_t percent_s = 0;
+
+  // Steps through format, one specifier at a time.
+  while (data != nullptr && *fmt != '\0') {
+    if (std::isspace(*fmt)) {
+      while (std::isspace(*data)) ++data;
+      while (std::isspace(*++fmt)) continue;
+      continue;
+    }
+
+    if (*fmt != '%') {
+      if (*data == *fmt) {
+        ++data;
+        ++fmt;
+      } else {
+        data = nullptr;
+      }
+      continue;
+    }
+
+    const char* percent = fmt;
+    if (*++fmt == '\0') {
+      data = nullptr;
+      continue;
+    }
+    switch (*fmt++) {
+      case 'Y':
+        // Symmetrically with FormatTime(), directly handing %Y avoids the
+        // tm.tm_year overflow problem.  However, tm.tm_year will still be
+        // used by other specifiers like %D.
+        data = ParseInt(data, 0, kyearmin, kyearmax, &year);
+        if (data != nullptr) saw_year = true;
+        continue;
+      case 'm':
+        data = ParseInt(data, 2, 1, 12, &tm.tm_mon);
+        if (data != nullptr) tm.tm_mon -= 1;
+        continue;
+      case 'd':
+      case 'e':
+        data = ParseInt(data, 2, 1, 31, &tm.tm_mday);
+        continue;
+      case 'H':
+        data = ParseInt(data, 2, 0, 23, &tm.tm_hour);
+        twelve_hour = false;
+        continue;
+      case 'M':
+        data = ParseInt(data, 2, 0, 59, &tm.tm_min);
+        continue;
+      case 'S':
+        data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+        continue;
+      case 'I':
+      case 'l':
+      case 'r':  // probably uses %I
+        twelve_hour = true;
+        break;
+      case 'R':  // uses %H
+      case 'T':  // uses %H
+      case 'c':  // probably uses %H
+      case 'X':  // probably uses %H
+        twelve_hour = false;
+        break;
+      case 'z':
+        data = ParseOffset(data, "", &offset);
+        if (data != nullptr) saw_offset = true;
+        continue;
+      case 'Z':  // ignored; zone abbreviations are ambiguous
+        data = ParseZone(data, &zone);
+        continue;
+      case 's':
+        data = ParseInt(data, 0,
+                        std::numeric_limits<std::int_fast64_t>::min(),
+                        std::numeric_limits<std::int_fast64_t>::max(),
+                        &percent_s);
+        if (data != nullptr) saw_percent_s = true;
+        continue;
+      case ':':
+        if (fmt[0] == 'z' ||
+            (fmt[0] == ':' &&
+             (fmt[1] == 'z' || (fmt[1] == ':' && fmt[2] == 'z')))) {
+          data = ParseOffset(data, ":", &offset);
+          if (data != nullptr) saw_offset = true;
+          fmt += (fmt[0] == 'z') ? 1 : (fmt[1] == 'z') ? 2 : 3;
+          continue;
+        }
+        break;
+      case '%':
+        data = (*data == '%' ? data + 1 : nullptr);
+        continue;
+      case 'E':
+        if (fmt[0] == 'z' || (fmt[0] == '*' && fmt[1] == 'z')) {
+          data = ParseOffset(data, ":", &offset);
+          if (data != nullptr) saw_offset = true;
+          fmt += (fmt[0] == 'z') ? 1 : 2;
+          continue;
+        }
+        if (fmt[0] == '*' && fmt[1] == 'S') {
+          data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+          if (data != nullptr && *data == '.') {
+            data = ParseSubSeconds(data + 1, &subseconds);
+          }
+          fmt += 2;
+          continue;
+        }
+        if (fmt[0] == '*' && fmt[1] == 'f') {
+          if (data != nullptr && std::isdigit(*data)) {
+            data = ParseSubSeconds(data, &subseconds);
+          }
+          fmt += 2;
+          continue;
+        }
+        if (fmt[0] == '4' && fmt[1] == 'Y') {
+          const char* bp = data;
+          data = ParseInt(data, 4, year_t{-999}, year_t{9999}, &year);
+          if (data != nullptr) {
+            if (data - bp == 4) {
+              saw_year = true;
+            } else {
+              data = nullptr;  // stopped too soon
+            }
+          }
+          fmt += 2;
+          continue;
+        }
+        if (std::isdigit(*fmt)) {
+          int n = 0;  // value ignored
+          if (const char* np = ParseInt(fmt, 0, 0, 1024, &n)) {
+            if (*np == 'S') {
+              data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+              if (data != nullptr && *data == '.') {
+                data = ParseSubSeconds(data + 1, &subseconds);
+              }
+              fmt = ++np;
+              continue;
+            }
+            if (*np == 'f') {
+              if (data != nullptr && std::isdigit(*data)) {
+                data = ParseSubSeconds(data, &subseconds);
+              }
+              fmt = ++np;
+              continue;
+            }
+          }
+        }
+        if (*fmt == 'c') twelve_hour = false;  // probably uses %H
+        if (*fmt == 'X') twelve_hour = false;  // probably uses %H
+        if (*fmt != '\0') ++fmt;
+        break;
+      case 'O':
+        if (*fmt == 'H') twelve_hour = false;
+        if (*fmt == 'I') twelve_hour = true;
+        if (*fmt != '\0') ++fmt;
+        break;
+    }
+
+    // Parses the current specifier.
+    const char* orig_data = data;
+    std::string spec(percent, static_cast<std::size_t>(fmt - percent));
+    data = ParseTM(data, spec.c_str(), &tm);
+
+    // If we successfully parsed %p we need to remember whether the result
+    // was AM or PM so that we can adjust tm_hour before time_zone::lookup().
+    // So reparse the input with a known AM hour, and check if it is shifted
+    // to a PM hour.
+    if (spec == "%p" && data != nullptr) {
+      std::string test_input = "1";
+      test_input.append(orig_data, static_cast<std::size_t>(data - orig_data));
+      const char* test_data = test_input.c_str();
+      std::tm tmp{};
+      ParseTM(test_data, "%I%p", &tmp);
+      afternoon = (tmp.tm_hour == 13);
+    }
+  }
+
+  // Adjust a 12-hour tm_hour value if it should be in the afternoon.
+  if (twelve_hour && afternoon && tm.tm_hour < 12) {
+    tm.tm_hour += 12;
+  }
+
+  if (data == nullptr) {
+    if (err != nullptr) *err = "Failed to parse input";
+    return false;
+  }
+
+  // Skip any remaining whitespace.
+  while (std::isspace(*data)) ++data;
+
+  // parse() must consume the entire input std::string.
+  if (*data != '\0') {
+    if (err != nullptr) *err = "Illegal trailing data in input string";
+    return false;
+  }
+
+  // If we saw %s then we ignore anything else and return that time.
+  if (saw_percent_s) {
+    *sec = FromUnixSeconds(percent_s);
+    *fs = detail::femtoseconds::zero();
+    return true;
+  }
+
+  // If we saw %z, %Ez, or %E*z then we want to interpret the parsed fields
+  // in UTC and then shift by that offset.  Otherwise we want to interpret
+  // the fields directly in the passed time_zone.
+  time_zone ptz = saw_offset ? utc_time_zone() : tz;
+
+  // Allows a leap second of 60 to normalize forward to the following ":00".
+  if (tm.tm_sec == 60) {
+    tm.tm_sec -= 1;
+    offset -= 1;
+    subseconds = detail::femtoseconds::zero();
+  }
+
+  if (!saw_year) {
+    year = year_t{tm.tm_year};
+    if (year > kyearmax - 1900) {
+      // Platform-dependent, maybe unreachable.
+      if (err != nullptr) *err = "Out-of-range year";
+      return false;
+    }
+    year += 1900;
+  }
+
+  const int month = tm.tm_mon + 1;
+  civil_second cs(year, month, tm.tm_mday, tm.tm_hour, tm.tm_min, tm.tm_sec);
+
+  // parse() should not allow normalization. Due to the restricted field
+  // ranges above (see ParseInt()), the only possibility is for days to roll
+  // into months. That is, parsing "Sep 31" should not produce "Oct 1".
+  if (cs.month() != month || cs.day() != tm.tm_mday) {
+    if (err != nullptr) *err = "Out-of-range field";
+    return false;
+  }
+
+  // Accounts for the offset adjustment before converting to absolute time.
+  if ((offset < 0 && cs > civil_second::max() + offset) ||
+      (offset > 0 && cs < civil_second::min() + offset)) {
+    if (err != nullptr) *err = "Out-of-range field";
+    return false;
+  }
+  cs -= offset;
+
+  const auto tp = ptz.lookup(cs).pre;
+  // Checks for overflow/underflow and returns an error as necessary.
+  if (tp == time_point<seconds>::max()) {
+    const auto al = ptz.lookup(time_point<seconds>::max());
+    if (cs > al.cs) {
+      if (err != nullptr) *err = "Out-of-range field";
+      return false;
+    }
+  }
+  if (tp == time_point<seconds>::min()) {
+    const auto al = ptz.lookup(time_point<seconds>::min());
+    if (cs < al.cs) {
+      if (err != nullptr) *err = "Out-of-range field";
+      return false;
+    }
+  }
+
+  *sec = tp;
+  *fs = subseconds;
+  return true;
+}
+
+}  // namespace detail
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_format_test.cc b/absl/time/internal/cctz/src/time_zone_format_test.cc
new file mode 100644
index 0000000..705ccdc
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_format_test.cc
@@ -0,0 +1,1495 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+#include <chrono>
+#include <iomanip>
+#include <sstream>
+#include <string>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+
+namespace chrono = std::chrono;
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// This helper is a macro so that failed expectations show up with the
+// correct line numbers.
+#define ExpectTime(tp, tz, y, m, d, hh, mm, ss, off, isdst, zone) \
+  do {                                                            \
+    time_zone::absolute_lookup al = tz.lookup(tp);                \
+    EXPECT_EQ(y, al.cs.year());                                   \
+    EXPECT_EQ(m, al.cs.month());                                  \
+    EXPECT_EQ(d, al.cs.day());                                    \
+    EXPECT_EQ(hh, al.cs.hour());                                  \
+    EXPECT_EQ(mm, al.cs.minute());                                \
+    EXPECT_EQ(ss, al.cs.second());                                \
+    EXPECT_EQ(off, al.offset);                                    \
+    EXPECT_TRUE(isdst == al.is_dst);                              \
+    EXPECT_STREQ(zone, al.abbr);                                  \
+  } while (0)
+
+const char RFC3339_full[] = "%Y-%m-%dT%H:%M:%E*S%Ez";
+const char RFC3339_sec[] =  "%Y-%m-%dT%H:%M:%S%Ez";
+
+const char RFC1123_full[] = "%a, %d %b %Y %H:%M:%S %z";
+const char RFC1123_no_wday[] =  "%d %b %Y %H:%M:%S %z";
+
+// A helper that tests the given format specifier by itself, and with leading
+// and trailing characters.  For example: TestFormatSpecifier(tp, "%a", "Thu").
+template <typename D>
+void TestFormatSpecifier(time_point<D> tp, time_zone tz, const std::string& fmt,
+                         const std::string& ans) {
+  EXPECT_EQ(ans, format(fmt, tp, tz)) << fmt;
+  EXPECT_EQ("xxx " + ans, format("xxx " + fmt, tp, tz));
+  EXPECT_EQ(ans + " yyy", format(fmt + " yyy", tp, tz));
+  EXPECT_EQ("xxx " + ans + " yyy", format("xxx " + fmt + " yyy", tp, tz));
+}
+
+}  // namespace
+
+//
+// Testing format()
+//
+
+TEST(Format, TimePointResolution) {
+  const char kFmt[] = "%H:%M:%E*S";
+  const time_zone utc = utc_time_zone();
+  const time_point<chrono::nanoseconds> t0 =
+      chrono::system_clock::from_time_t(1420167845) +
+      chrono::milliseconds(123) + chrono::microseconds(456) +
+      chrono::nanoseconds(789);
+  EXPECT_EQ(
+      "03:04:05.123456789",
+      format(kFmt, chrono::time_point_cast<chrono::nanoseconds>(t0), utc));
+  EXPECT_EQ(
+      "03:04:05.123456",
+      format(kFmt, chrono::time_point_cast<chrono::microseconds>(t0), utc));
+  EXPECT_EQ(
+      "03:04:05.123",
+      format(kFmt, chrono::time_point_cast<chrono::milliseconds>(t0), utc));
+  EXPECT_EQ("03:04:05",
+            format(kFmt, chrono::time_point_cast<chrono::seconds>(t0), utc));
+  EXPECT_EQ("03:04:05",
+            format(kFmt, chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0), utc));
+  EXPECT_EQ("03:04:00",
+            format(kFmt, chrono::time_point_cast<chrono::minutes>(t0), utc));
+  EXPECT_EQ("03:00:00",
+            format(kFmt, chrono::time_point_cast<chrono::hours>(t0), utc));
+}
+
+TEST(Format, TimePointExtendedResolution) {
+  const char kFmt[] = "%H:%M:%E*S";
+  const time_zone utc = utc_time_zone();
+  const time_point<absl::time_internal::cctz::seconds> tp =
+      chrono::time_point_cast<absl::time_internal::cctz::seconds>(
+          chrono::system_clock::from_time_t(0)) +
+      chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56);
+
+  EXPECT_EQ(
+      "12:34:56.123456789012345",
+      detail::format(kFmt, tp, detail::femtoseconds(123456789012345), utc));
+  EXPECT_EQ(
+      "12:34:56.012345678901234",
+      detail::format(kFmt, tp, detail::femtoseconds(12345678901234), utc));
+  EXPECT_EQ(
+      "12:34:56.001234567890123",
+      detail::format(kFmt, tp, detail::femtoseconds(1234567890123), utc));
+  EXPECT_EQ(
+      "12:34:56.000123456789012",
+      detail::format(kFmt, tp, detail::femtoseconds(123456789012), utc));
+
+  EXPECT_EQ("12:34:56.000000000000123",
+            detail::format(kFmt, tp, detail::femtoseconds(123), utc));
+  EXPECT_EQ("12:34:56.000000000000012",
+            detail::format(kFmt, tp, detail::femtoseconds(12), utc));
+  EXPECT_EQ("12:34:56.000000000000001",
+            detail::format(kFmt, tp, detail::femtoseconds(1), utc));
+}
+
+TEST(Format, Basics) {
+  time_zone tz = utc_time_zone();
+  time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+
+  // Starts with a couple basic edge cases.
+  EXPECT_EQ("", format("", tp, tz));
+  EXPECT_EQ(" ", format(" ", tp, tz));
+  EXPECT_EQ("  ", format("  ", tp, tz));
+  EXPECT_EQ("xxx", format("xxx", tp, tz));
+  std::string big(128, 'x');
+  EXPECT_EQ(big, format(big, tp, tz));
+  // Cause the 1024-byte buffer to grow.
+  std::string bigger(100000, 'x');
+  EXPECT_EQ(bigger, format(bigger, tp, tz));
+
+  tp += chrono::hours(13) + chrono::minutes(4) + chrono::seconds(5);
+  tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+        chrono::nanoseconds(8);
+  EXPECT_EQ("1970-01-01", format("%Y-%m-%d", tp, tz));
+  EXPECT_EQ("13:04:05", format("%H:%M:%S", tp, tz));
+  EXPECT_EQ("13:04:05.006", format("%H:%M:%E3S", tp, tz));
+  EXPECT_EQ("13:04:05.006007", format("%H:%M:%E6S", tp, tz));
+  EXPECT_EQ("13:04:05.006007008", format("%H:%M:%E9S", tp, tz));
+}
+
+TEST(Format, PosixConversions) {
+  const time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+
+  TestFormatSpecifier(tp, tz, "%d", "01");
+  TestFormatSpecifier(tp, tz, "%e", " 1");  // extension but internal support
+  TestFormatSpecifier(tp, tz, "%H", "00");
+  TestFormatSpecifier(tp, tz, "%I", "12");
+  TestFormatSpecifier(tp, tz, "%j", "001");
+  TestFormatSpecifier(tp, tz, "%m", "01");
+  TestFormatSpecifier(tp, tz, "%M", "00");
+  TestFormatSpecifier(tp, tz, "%S", "00");
+  TestFormatSpecifier(tp, tz, "%U", "00");
+#if !defined(__EMSCRIPTEN__)
+  TestFormatSpecifier(tp, tz, "%w", "4");  // 4=Thursday
+#endif
+  TestFormatSpecifier(tp, tz, "%W", "00");
+  TestFormatSpecifier(tp, tz, "%y", "70");
+  TestFormatSpecifier(tp, tz, "%Y", "1970");
+  TestFormatSpecifier(tp, tz, "%z", "+0000");
+  TestFormatSpecifier(tp, tz, "%Z", "UTC");
+  TestFormatSpecifier(tp, tz, "%%", "%");
+
+#if defined(__linux__)
+  // SU/C99/TZ extensions
+  TestFormatSpecifier(tp, tz, "%C", "19");
+  TestFormatSpecifier(tp, tz, "%D", "01/01/70");
+  TestFormatSpecifier(tp, tz, "%F", "1970-01-01");
+  TestFormatSpecifier(tp, tz, "%g", "70");
+  TestFormatSpecifier(tp, tz, "%G", "1970");
+  TestFormatSpecifier(tp, tz, "%k", " 0");
+  TestFormatSpecifier(tp, tz, "%l", "12");
+  TestFormatSpecifier(tp, tz, "%n", "\n");
+  TestFormatSpecifier(tp, tz, "%R", "00:00");
+  TestFormatSpecifier(tp, tz, "%t", "\t");
+  TestFormatSpecifier(tp, tz, "%T", "00:00:00");
+  TestFormatSpecifier(tp, tz, "%u", "4");  // 4=Thursday
+  TestFormatSpecifier(tp, tz, "%V", "01");
+  TestFormatSpecifier(tp, tz, "%s", "0");
+#endif
+}
+
+TEST(Format, LocaleSpecific) {
+  const time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+
+  TestFormatSpecifier(tp, tz, "%a", "Thu");
+  TestFormatSpecifier(tp, tz, "%A", "Thursday");
+  TestFormatSpecifier(tp, tz, "%b", "Jan");
+  TestFormatSpecifier(tp, tz, "%B", "January");
+
+  // %c should at least produce the numeric year and time-of-day.
+  const std::string s = format("%c", tp, utc_time_zone());
+  EXPECT_THAT(s, testing::HasSubstr("1970"));
+  EXPECT_THAT(s, testing::HasSubstr("00:00:00"));
+
+  TestFormatSpecifier(tp, tz, "%p", "AM");
+  TestFormatSpecifier(tp, tz, "%x", "01/01/70");
+  TestFormatSpecifier(tp, tz, "%X", "00:00:00");
+
+#if defined(__linux__)
+  // SU/C99/TZ extensions
+  TestFormatSpecifier(tp, tz, "%h", "Jan");  // Same as %b
+  TestFormatSpecifier(tp, tz, "%P", "am");
+  TestFormatSpecifier(tp, tz, "%r", "12:00:00 AM");
+
+  // Modified conversion specifiers %E_
+  TestFormatSpecifier(tp, tz, "%Ec", "Thu Jan  1 00:00:00 1970");
+  TestFormatSpecifier(tp, tz, "%EC", "19");
+  TestFormatSpecifier(tp, tz, "%Ex", "01/01/70");
+  TestFormatSpecifier(tp, tz, "%EX", "00:00:00");
+  TestFormatSpecifier(tp, tz, "%Ey", "70");
+  TestFormatSpecifier(tp, tz, "%EY", "1970");
+
+  // Modified conversion specifiers %O_
+  TestFormatSpecifier(tp, tz, "%Od", "01");
+  TestFormatSpecifier(tp, tz, "%Oe", " 1");
+  TestFormatSpecifier(tp, tz, "%OH", "00");
+  TestFormatSpecifier(tp, tz, "%OI", "12");
+  TestFormatSpecifier(tp, tz, "%Om", "01");
+  TestFormatSpecifier(tp, tz, "%OM", "00");
+  TestFormatSpecifier(tp, tz, "%OS", "00");
+  TestFormatSpecifier(tp, tz, "%Ou", "4");  // 4=Thursday
+  TestFormatSpecifier(tp, tz, "%OU", "00");
+  TestFormatSpecifier(tp, tz, "%OV", "01");
+  TestFormatSpecifier(tp, tz, "%Ow", "4");  // 4=Thursday
+  TestFormatSpecifier(tp, tz, "%OW", "00");
+  TestFormatSpecifier(tp, tz, "%Oy", "70");
+#endif
+}
+
+TEST(Format, Escaping) {
+  const time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+
+  TestFormatSpecifier(tp, tz, "%%", "%");
+  TestFormatSpecifier(tp, tz, "%%a", "%a");
+  TestFormatSpecifier(tp, tz, "%%b", "%b");
+  TestFormatSpecifier(tp, tz, "%%Ea", "%Ea");
+  TestFormatSpecifier(tp, tz, "%%Es", "%Es");
+  TestFormatSpecifier(tp, tz, "%%E3S", "%E3S");
+  TestFormatSpecifier(tp, tz, "%%OS", "%OS");
+  TestFormatSpecifier(tp, tz, "%%O3S", "%O3S");
+
+  // Multiple levels of escaping.
+  TestFormatSpecifier(tp, tz, "%%%Y", "%1970");
+  TestFormatSpecifier(tp, tz, "%%%E3S", "%00.000");
+  TestFormatSpecifier(tp, tz, "%%%%E3S", "%%E3S");
+}
+
+TEST(Format, ExtendedSeconds) {
+  const time_zone tz = utc_time_zone();
+
+  // No subseconds.
+  time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+  tp += chrono::seconds(5);
+  EXPECT_EQ("05", format("%E*S", tp, tz));
+  EXPECT_EQ("05", format("%E0S", tp, tz));
+  EXPECT_EQ("05.0", format("%E1S", tp, tz));
+  EXPECT_EQ("05.00", format("%E2S", tp, tz));
+  EXPECT_EQ("05.000", format("%E3S", tp, tz));
+  EXPECT_EQ("05.0000", format("%E4S", tp, tz));
+  EXPECT_EQ("05.00000", format("%E5S", tp, tz));
+  EXPECT_EQ("05.000000", format("%E6S", tp, tz));
+  EXPECT_EQ("05.0000000", format("%E7S", tp, tz));
+  EXPECT_EQ("05.00000000", format("%E8S", tp, tz));
+  EXPECT_EQ("05.000000000", format("%E9S", tp, tz));
+  EXPECT_EQ("05.0000000000", format("%E10S", tp, tz));
+  EXPECT_EQ("05.00000000000", format("%E11S", tp, tz));
+  EXPECT_EQ("05.000000000000", format("%E12S", tp, tz));
+  EXPECT_EQ("05.0000000000000", format("%E13S", tp, tz));
+  EXPECT_EQ("05.00000000000000", format("%E14S", tp, tz));
+  EXPECT_EQ("05.000000000000000", format("%E15S", tp, tz));
+
+  // With subseconds.
+  tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+        chrono::nanoseconds(8);
+  EXPECT_EQ("05.006007008", format("%E*S", tp, tz));
+  EXPECT_EQ("05", format("%E0S", tp, tz));
+  EXPECT_EQ("05.0", format("%E1S", tp, tz));
+  EXPECT_EQ("05.00", format("%E2S", tp, tz));
+  EXPECT_EQ("05.006", format("%E3S", tp, tz));
+  EXPECT_EQ("05.0060", format("%E4S", tp, tz));
+  EXPECT_EQ("05.00600", format("%E5S", tp, tz));
+  EXPECT_EQ("05.006007", format("%E6S", tp, tz));
+  EXPECT_EQ("05.0060070", format("%E7S", tp, tz));
+  EXPECT_EQ("05.00600700", format("%E8S", tp, tz));
+  EXPECT_EQ("05.006007008", format("%E9S", tp, tz));
+  EXPECT_EQ("05.0060070080", format("%E10S", tp, tz));
+  EXPECT_EQ("05.00600700800", format("%E11S", tp, tz));
+  EXPECT_EQ("05.006007008000", format("%E12S", tp, tz));
+  EXPECT_EQ("05.0060070080000", format("%E13S", tp, tz));
+  EXPECT_EQ("05.00600700800000", format("%E14S", tp, tz));
+  EXPECT_EQ("05.006007008000000", format("%E15S", tp, tz));
+
+  // Times before the Unix epoch.
+  tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1);
+  EXPECT_EQ("1969-12-31 23:59:59.999999",
+            format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+
+  // Here is a "%E*S" case we got wrong for a while.  While the first
+  // instant below is correctly rendered as "...:07.333304", the second
+  // one used to appear as "...:07.33330499999999999".
+  tp = chrono::system_clock::from_time_t(0) +
+       chrono::microseconds(1395024427333304);
+  EXPECT_EQ("2014-03-17 02:47:07.333304",
+            format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+  tp += chrono::microseconds(1);
+  EXPECT_EQ("2014-03-17 02:47:07.333305",
+            format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+}
+
+TEST(Format, ExtendedSubeconds) {
+  const time_zone tz = utc_time_zone();
+
+  // No subseconds.
+  time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+  tp += chrono::seconds(5);
+  EXPECT_EQ("0", format("%E*f", tp, tz));
+  EXPECT_EQ("", format("%E0f", tp, tz));
+  EXPECT_EQ("0", format("%E1f", tp, tz));
+  EXPECT_EQ("00", format("%E2f", tp, tz));
+  EXPECT_EQ("000", format("%E3f", tp, tz));
+  EXPECT_EQ("0000", format("%E4f", tp, tz));
+  EXPECT_EQ("00000", format("%E5f", tp, tz));
+  EXPECT_EQ("000000", format("%E6f", tp, tz));
+  EXPECT_EQ("0000000", format("%E7f", tp, tz));
+  EXPECT_EQ("00000000", format("%E8f", tp, tz));
+  EXPECT_EQ("000000000", format("%E9f", tp, tz));
+  EXPECT_EQ("0000000000", format("%E10f", tp, tz));
+  EXPECT_EQ("00000000000", format("%E11f", tp, tz));
+  EXPECT_EQ("000000000000", format("%E12f", tp, tz));
+  EXPECT_EQ("0000000000000", format("%E13f", tp, tz));
+  EXPECT_EQ("00000000000000", format("%E14f", tp, tz));
+  EXPECT_EQ("000000000000000", format("%E15f", tp, tz));
+
+  // With subseconds.
+  tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+        chrono::nanoseconds(8);
+  EXPECT_EQ("006007008", format("%E*f", tp, tz));
+  EXPECT_EQ("", format("%E0f", tp, tz));
+  EXPECT_EQ("0", format("%E1f", tp, tz));
+  EXPECT_EQ("00", format("%E2f", tp, tz));
+  EXPECT_EQ("006", format("%E3f", tp, tz));
+  EXPECT_EQ("0060", format("%E4f", tp, tz));
+  EXPECT_EQ("00600", format("%E5f", tp, tz));
+  EXPECT_EQ("006007", format("%E6f", tp, tz));
+  EXPECT_EQ("0060070", format("%E7f", tp, tz));
+  EXPECT_EQ("00600700", format("%E8f", tp, tz));
+  EXPECT_EQ("006007008", format("%E9f", tp, tz));
+  EXPECT_EQ("0060070080", format("%E10f", tp, tz));
+  EXPECT_EQ("00600700800", format("%E11f", tp, tz));
+  EXPECT_EQ("006007008000", format("%E12f", tp, tz));
+  EXPECT_EQ("0060070080000", format("%E13f", tp, tz));
+  EXPECT_EQ("00600700800000", format("%E14f", tp, tz));
+  EXPECT_EQ("006007008000000", format("%E15f", tp, tz));
+
+  // Times before the Unix epoch.
+  tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1);
+  EXPECT_EQ("1969-12-31 23:59:59.999999",
+            format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+
+  // Here is a "%E*S" case we got wrong for a while.  While the first
+  // instant below is correctly rendered as "...:07.333304", the second
+  // one used to appear as "...:07.33330499999999999".
+  tp = chrono::system_clock::from_time_t(0) +
+       chrono::microseconds(1395024427333304);
+  EXPECT_EQ("2014-03-17 02:47:07.333304",
+            format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+  tp += chrono::microseconds(1);
+  EXPECT_EQ("2014-03-17 02:47:07.333305",
+            format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+}
+
+TEST(Format, CompareExtendSecondsVsSubseconds) {
+  const time_zone tz = utc_time_zone();
+
+  // This test case illustrates the differences/similarities between:
+  //   fmt_A: %E<prec>S
+  //   fmt_B: %S.%E<prec>f
+  auto fmt_A = [](const std::string& prec) { return "%E" + prec + "S"; };
+  auto fmt_B = [](const std::string& prec) { return "%S.%E" + prec + "f"; };
+
+  // No subseconds:
+  time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+  tp += chrono::seconds(5);
+  // ... %E*S and %S.%E*f are different.
+  EXPECT_EQ("05", format(fmt_A("*"), tp, tz));
+  EXPECT_EQ("05.0", format(fmt_B("*"), tp, tz));
+  // ... %E0S and %S.%E0f are different.
+  EXPECT_EQ("05", format(fmt_A("0"), tp, tz));
+  EXPECT_EQ("05.", format(fmt_B("0"), tp, tz));
+  // ... %E<prec>S and %S.%E<prec>f are the same for prec in [1:15].
+  for (int prec = 1; prec <= 15; ++prec) {
+    const std::string a = format(fmt_A(std::to_string(prec)), tp, tz);
+    const std::string b = format(fmt_B(std::to_string(prec)), tp, tz);
+    EXPECT_EQ(a, b) << "prec=" << prec;
+  }
+
+  // With subseconds:
+  // ... %E*S and %S.%E*f are the same.
+  tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+        chrono::nanoseconds(8);
+  EXPECT_EQ("05.006007008", format(fmt_A("*"), tp, tz));
+  EXPECT_EQ("05.006007008", format(fmt_B("*"), tp, tz));
+  // ... %E0S and %S.%E0f are different.
+  EXPECT_EQ("05", format(fmt_A("0"), tp, tz));
+  EXPECT_EQ("05.", format(fmt_B("0"), tp, tz));
+  // ... %E<prec>S and %S.%E<prec>f are the same for prec in [1:15].
+  for (int prec = 1; prec <= 15; ++prec) {
+    const std::string a = format(fmt_A(std::to_string(prec)), tp, tz);
+    const std::string b = format(fmt_B(std::to_string(prec)), tp, tz);
+    EXPECT_EQ(a, b) << "prec=" << prec;
+  }
+}
+
+TEST(Format, ExtendedOffset) {
+  const auto tp = chrono::system_clock::from_time_t(0);
+
+  auto tz = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+  TestFormatSpecifier(tp, tz, "%z", "+0000");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+  tz = fixed_time_zone(chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "+0000");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+  tz = fixed_time_zone(-chrono::seconds(56));  // NOTE: +00:00
+  TestFormatSpecifier(tp, tz, "%z", "+0000");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+  tz = fixed_time_zone(chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%z", "+0034");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:34");
+
+  tz = fixed_time_zone(-chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%z", "-0034");
+  TestFormatSpecifier(tp, tz, "%:z", "-00:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "-00:34");
+
+  tz = fixed_time_zone(chrono::minutes(34) + chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "+0034");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:34");
+
+  tz = fixed_time_zone(-chrono::minutes(34) - chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "-0034");
+  TestFormatSpecifier(tp, tz, "%:z", "-00:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "-00:34");
+
+  tz = fixed_time_zone(chrono::hours(12));
+  TestFormatSpecifier(tp, tz, "%z", "+1200");
+  TestFormatSpecifier(tp, tz, "%:z", "+12:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+12:00");
+
+  tz = fixed_time_zone(-chrono::hours(12));
+  TestFormatSpecifier(tp, tz, "%z", "-1200");
+  TestFormatSpecifier(tp, tz, "%:z", "-12:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "-12:00");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "+1200");
+  TestFormatSpecifier(tp, tz, "%:z", "+12:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+12:00");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "-1200");
+  TestFormatSpecifier(tp, tz, "%:z", "-12:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "-12:00");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%z", "+1234");
+  TestFormatSpecifier(tp, tz, "%:z", "+12:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "+12:34");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%z", "-1234");
+  TestFormatSpecifier(tp, tz, "%:z", "-12:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "-12:34");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34) +
+                       chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "+1234");
+  TestFormatSpecifier(tp, tz, "%:z", "+12:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "+12:34");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34) -
+                       chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "-1234");
+  TestFormatSpecifier(tp, tz, "%:z", "-12:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "-12:34");
+}
+
+TEST(Format, ExtendedSecondOffset) {
+  const auto tp = chrono::system_clock::from_time_t(0);
+
+  auto tz = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+  TestFormatSpecifier(tp, tz, "%E*z", "+00:00:00");
+  TestFormatSpecifier(tp, tz, "%::z", "+00:00:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "+00");
+
+  tz = fixed_time_zone(chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "+00:00:56");
+  TestFormatSpecifier(tp, tz, "%::z", "+00:00:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "+00:00:56");
+
+  tz = fixed_time_zone(-chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "-00:00:56");
+  TestFormatSpecifier(tp, tz, "%::z", "-00:00:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "-00:00:56");
+
+  tz = fixed_time_zone(chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%E*z", "+00:34:00");
+  TestFormatSpecifier(tp, tz, "%::z", "+00:34:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "+00:34");
+
+  tz = fixed_time_zone(-chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%E*z", "-00:34:00");
+  TestFormatSpecifier(tp, tz, "%::z", "-00:34:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "-00:34");
+
+  tz = fixed_time_zone(chrono::minutes(34) + chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "+00:34:56");
+  TestFormatSpecifier(tp, tz, "%::z", "+00:34:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "+00:34:56");
+
+  tz = fixed_time_zone(-chrono::minutes(34) - chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "-00:34:56");
+  TestFormatSpecifier(tp, tz, "%::z", "-00:34:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "-00:34:56");
+
+  tz = fixed_time_zone(chrono::hours(12));
+  TestFormatSpecifier(tp, tz, "%E*z", "+12:00:00");
+  TestFormatSpecifier(tp, tz, "%::z", "+12:00:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "+12");
+
+  tz = fixed_time_zone(-chrono::hours(12));
+  TestFormatSpecifier(tp, tz, "%E*z", "-12:00:00");
+  TestFormatSpecifier(tp, tz, "%::z", "-12:00:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "-12");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "+12:00:56");
+  TestFormatSpecifier(tp, tz, "%::z", "+12:00:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "+12:00:56");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "-12:00:56");
+  TestFormatSpecifier(tp, tz, "%::z", "-12:00:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "-12:00:56");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%E*z", "+12:34:00");
+  TestFormatSpecifier(tp, tz, "%::z", "+12:34:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "+12:34");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%E*z", "-12:34:00");
+  TestFormatSpecifier(tp, tz, "%::z", "-12:34:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "-12:34");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34) +
+                       chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "+12:34:56");
+  TestFormatSpecifier(tp, tz, "%::z", "+12:34:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "+12:34:56");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34) -
+                       chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "-12:34:56");
+  TestFormatSpecifier(tp, tz, "%::z", "-12:34:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "-12:34:56");
+}
+
+TEST(Format, ExtendedYears) {
+  const time_zone utc = utc_time_zone();
+  const char e4y_fmt[] = "%E4Y%m%d";  // no separators
+
+  // %E4Y zero-pads the year to produce at least 4 chars, including the sign.
+  auto tp = convert(civil_second(-999, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-9991127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(-99, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-0991127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(-9, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-0091127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(-1, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-0011127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(0, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("00001127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(1, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("00011127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(9, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("00091127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(99, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("00991127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(999, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("09991127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(9999, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("99991127", format(e4y_fmt, tp, utc));
+
+  // When the year is outside [-999:9999], more than 4 chars are produced.
+  tp = convert(civil_second(-1000, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-10001127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(10000, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("100001127", format(e4y_fmt, tp, utc));
+}
+
+TEST(Format, RFC3339Format) {
+  time_zone tz;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+
+  time_point<chrono::nanoseconds> tp =
+      convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::milliseconds(100);
+  EXPECT_EQ("1977-06-28T09:08:07.1-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::milliseconds(20);
+  EXPECT_EQ("1977-06-28T09:08:07.12-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::milliseconds(3);
+  EXPECT_EQ("1977-06-28T09:08:07.123-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::microseconds(400);
+  EXPECT_EQ("1977-06-28T09:08:07.1234-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::microseconds(50);
+  EXPECT_EQ("1977-06-28T09:08:07.12345-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::microseconds(6);
+  EXPECT_EQ("1977-06-28T09:08:07.123456-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::nanoseconds(700);
+  EXPECT_EQ("1977-06-28T09:08:07.1234567-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::nanoseconds(80);
+  EXPECT_EQ("1977-06-28T09:08:07.12345678-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::nanoseconds(9);
+  EXPECT_EQ("1977-06-28T09:08:07.123456789-07:00",
+            format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+}
+
+TEST(Format, RFC1123Format) {  // locale specific
+  time_zone tz;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+
+  auto tp = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+  EXPECT_EQ("Tue, 28 Jun 1977 09:08:07 -0700", format(RFC1123_full, tp, tz));
+  EXPECT_EQ("28 Jun 1977 09:08:07 -0700", format(RFC1123_no_wday, tp, tz));
+}
+
+//
+// Testing parse()
+//
+
+TEST(Parse, TimePointResolution) {
+  const char kFmt[] = "%H:%M:%E*S";
+  const time_zone utc = utc_time_zone();
+
+  time_point<chrono::nanoseconds> tp_ns;
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_ns));
+  EXPECT_EQ("03:04:05.123456789", format(kFmt, tp_ns, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ns));
+  EXPECT_EQ("03:04:05.123456", format(kFmt, tp_ns, utc));
+
+  time_point<chrono::microseconds> tp_us;
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_us));
+  EXPECT_EQ("03:04:05.123456", format(kFmt, tp_us, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_us));
+  EXPECT_EQ("03:04:05.123456", format(kFmt, tp_us, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_us));
+  EXPECT_EQ("03:04:05.123", format(kFmt, tp_us, utc));
+
+  time_point<chrono::milliseconds> tp_ms;
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ms));
+  EXPECT_EQ("03:04:05.123", format(kFmt, tp_ms, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_ms));
+  EXPECT_EQ("03:04:05.123", format(kFmt, tp_ms, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_ms));
+  EXPECT_EQ("03:04:05", format(kFmt, tp_ms, utc));
+
+  time_point<chrono::seconds> tp_s;
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_s));
+  EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_s));
+  EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc));
+
+  time_point<chrono::minutes> tp_m;
+  EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_m));
+  EXPECT_EQ("03:04:00", format(kFmt, tp_m, utc));
+
+  time_point<chrono::hours> tp_h;
+  EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_h));
+  EXPECT_EQ("03:00:00", format(kFmt, tp_h, utc));
+}
+
+TEST(Parse, TimePointExtendedResolution) {
+  const char kFmt[] = "%H:%M:%E*S";
+  const time_zone utc = utc_time_zone();
+
+  time_point<absl::time_internal::cctz::seconds> tp;
+  detail::femtoseconds fs;
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.123456789012345", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.123456789012345", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.012345678901234", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.012345678901234", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.001234567890123", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.001234567890123", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000123", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.000000000000123", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000012", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.000000000000012", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000001", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.000000000000001", detail::format(kFmt, tp, fs, utc));
+}
+
+TEST(Parse, Basics) {
+  time_zone tz = utc_time_zone();
+  time_point<chrono::nanoseconds> tp =
+      chrono::system_clock::from_time_t(1234567890);
+
+  // Simple edge cases.
+  EXPECT_TRUE(parse("", "", tz, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(0), tp);  // everything defaulted
+  EXPECT_TRUE(parse(" ", " ", tz, &tp));
+  EXPECT_TRUE(parse("  ", "  ", tz, &tp));
+  EXPECT_TRUE(parse("x", "x", tz, &tp));
+  EXPECT_TRUE(parse("xxx", "xxx", tz, &tp));
+
+  EXPECT_TRUE(
+      parse("%Y-%m-%d %H:%M:%S %z", "2013-06-28 19:08:09 -0800", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 29, 3, 8, 9, 0, false, "UTC");
+}
+
+TEST(Parse, WithTimeZone) {
+  time_zone tz;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+  time_point<chrono::nanoseconds> tp;
+
+  // We can parse a std::string without a UTC offset if we supply a timezone.
+  EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2013-06-28 19:08:09", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 19, 8, 9, -7 * 60 * 60, true, "PDT");
+
+  // But the timezone is ignored when a UTC offset is present.
+  EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S %z", "2013-06-28 19:08:09 +0800",
+                    utc_time_zone(), &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 19 - 8 - 7, 8, 9, -7 * 60 * 60, true, "PDT");
+
+  // Check a skipped time (a Spring DST transition). parse() uses the
+  // pre-transition offset.
+  EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2011-03-13 02:15:00", tz, &tp));
+  ExpectTime(tp, tz, 2011, 3, 13, 3, 15, 0, -7 * 60 * 60, true, "PDT");
+
+  // Check a repeated time (a Fall DST transition).  parse() uses the
+  // pre-transition offset.
+  EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2011-11-06 01:15:00", tz, &tp));
+  ExpectTime(tp, tz, 2011, 11, 6, 1, 15, 0, -7 * 60 * 60, true, "PDT");
+}
+
+TEST(Parse, LeapSecond) {
+  time_zone tz;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+  time_point<chrono::nanoseconds> tp;
+
+  // ":59" -> ":59"
+  EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:59-08:00", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 8, 8, 59, -7 * 60 * 60, true, "PDT");
+
+  // ":59.5" -> ":59.5"
+  EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:59.5-08:00", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 8, 8, 59, -7 * 60 * 60, true, "PDT");
+
+  // ":60" -> ":00"
+  EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:60-08:00", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 8, 9, 0, -7 * 60 * 60, true, "PDT");
+
+  // ":60.5" -> ":00.0"
+  EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:60.5-08:00", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 8, 9, 0, -7 * 60 * 60, true, "PDT");
+
+  // ":61" -> error
+  EXPECT_FALSE(parse(RFC3339_full, "2013-06-28T07:08:61-08:00", tz, &tp));
+}
+
+TEST(Parse, ErrorCases) {
+  const time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+
+  // Illegal trailing data.
+  EXPECT_FALSE(parse("%S", "123", tz, &tp));
+
+  // Can't parse an illegal format specifier.
+  EXPECT_FALSE(parse("%Q", "x", tz, &tp));
+
+  // Fails because of trailing, unparsed data "blah".
+  EXPECT_FALSE(parse("%m-%d", "2-3 blah", tz, &tp));
+
+  // Trailing whitespace is allowed.
+  EXPECT_TRUE(parse("%m-%d", "2-3  ", tz, &tp));
+  EXPECT_EQ(2, convert(tp, utc_time_zone()).month());
+  EXPECT_EQ(3, convert(tp, utc_time_zone()).day());
+
+  // Feb 31 requires normalization.
+  EXPECT_FALSE(parse("%m-%d", "2-31", tz, &tp));
+
+  // Check that we cannot have spaces in UTC offsets.
+  EXPECT_TRUE(parse("%z", "-0203", tz, &tp));
+  EXPECT_FALSE(parse("%z", "- 2 3", tz, &tp));
+  EXPECT_TRUE(parse("%Ez", "-02:03", tz, &tp));
+  EXPECT_FALSE(parse("%Ez", "- 2: 3", tz, &tp));
+
+  // Check that we reject other malformed UTC offsets.
+  EXPECT_FALSE(parse("%Ez", "+-08:00", tz, &tp));
+  EXPECT_FALSE(parse("%Ez", "-+08:00", tz, &tp));
+
+  // Check that we do not accept "-0" in fields that allow zero.
+  EXPECT_FALSE(parse("%Y", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%E4Y", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%H", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%M", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%S", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%z", "+-000", tz, &tp));
+  EXPECT_FALSE(parse("%Ez", "+-0:00", tz, &tp));
+  EXPECT_FALSE(parse("%z", "-00-0", tz, &tp));
+  EXPECT_FALSE(parse("%Ez", "-00:-0", tz, &tp));
+}
+
+TEST(Parse, PosixConversions) {
+  time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+  const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+
+  tp = reset;
+  EXPECT_TRUE(parse("%d", "15", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).day());
+
+  // %e is an extension, but is supported internally.
+  tp = reset;
+  EXPECT_TRUE(parse("%e", "15", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).day());  // Equivalent to %d
+
+  tp = reset;
+  EXPECT_TRUE(parse("%H", "17", tz, &tp));
+  EXPECT_EQ(17, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%I", "5", tz, &tp));
+  EXPECT_EQ(5, convert(tp, tz).hour());
+
+  // %j is parsed but ignored.
+  EXPECT_TRUE(parse("%j", "32", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%m", "11", tz, &tp));
+  EXPECT_EQ(11, convert(tp, tz).month());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%M", "33", tz, &tp));
+  EXPECT_EQ(33, convert(tp, tz).minute());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%S", "55", tz, &tp));
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  // %U is parsed but ignored.
+  EXPECT_TRUE(parse("%U", "15", tz, &tp));
+
+  // %w is parsed but ignored.
+  EXPECT_TRUE(parse("%w", "2", tz, &tp));
+
+  // %W is parsed but ignored.
+  EXPECT_TRUE(parse("%W", "22", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%y", "04", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Y", "2004", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  EXPECT_TRUE(parse("%%", "%", tz, &tp));
+
+#if defined(__linux__)
+  // SU/C99/TZ extensions
+
+  // Because we handle each (non-internal) specifier in a separate call
+  // to strptime(), there is no way to group %C and %y together.  So we
+  // just skip the %C/%y case.
+#if 0
+  tp = reset;
+  EXPECT_TRUE(parse("%C %y", "20 04", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+#endif
+
+  tp = reset;
+  EXPECT_TRUE(parse("%D", "02/03/04", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());
+  EXPECT_EQ(3, convert(tp, tz).day());
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  EXPECT_TRUE(parse("%n", "\n", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%R", "03:44", tz, &tp));
+  EXPECT_EQ(3, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+
+  EXPECT_TRUE(parse("%t", "\t\v\f\n\r ", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%T", "03:44:55", tz, &tp));
+  EXPECT_EQ(3, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%s", "1234567890", tz, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+  // %s conversion, like %z/%Ez, pays no heed to the optional zone.
+  time_zone lax;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax));
+  tp = reset;
+  EXPECT_TRUE(parse("%s", "1234567890", lax, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+  // This is most important when the time has the same YMDhms
+  // breakdown in the zone as some other time.  For example, ...
+  //  1414917000 in US/Pacific -> Sun Nov 2 01:30:00 2014 (PDT)
+  //  1414920600 in US/Pacific -> Sun Nov 2 01:30:00 2014 (PST)
+  tp = reset;
+  EXPECT_TRUE(parse("%s", "1414917000", lax, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(1414917000), tp);
+  tp = reset;
+  EXPECT_TRUE(parse("%s", "1414920600", lax, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(1414920600), tp);
+#endif
+}
+
+TEST(Parse, LocaleSpecific) {
+  time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+  const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+
+  // %a is parsed but ignored.
+  EXPECT_TRUE(parse("%a", "Mon", tz, &tp));
+
+  // %A is parsed but ignored.
+  EXPECT_TRUE(parse("%A", "Monday", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%b", "Feb", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%B", "February", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());
+
+  // %p is parsed but ignored if it's alone.  But it's used with %I.
+  EXPECT_TRUE(parse("%p", "AM", tz, &tp));
+  tp = reset;
+  EXPECT_TRUE(parse("%I %p", "5 PM", tz, &tp));
+  EXPECT_EQ(17, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%x", "02/03/04", tz, &tp));
+  if (convert(tp, tz).month() == 2) {
+    EXPECT_EQ(3, convert(tp, tz).day());
+  } else {
+    EXPECT_EQ(2, convert(tp, tz).day());
+    EXPECT_EQ(3, convert(tp, tz).month());
+  }
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%X", "15:44:55", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+#if defined(__linux__)
+  // SU/C99/TZ extensions
+
+  tp = reset;
+  EXPECT_TRUE(parse("%h", "Feb", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());  // Equivalent to %b
+
+  tp = reset;
+  EXPECT_TRUE(parse("%l %p", "5 PM", tz, &tp));
+  EXPECT_EQ(17, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%r", "03:44:55 PM", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Ec", "Tue Nov 19 05:06:07 2013", tz, &tp));
+  EXPECT_EQ(convert(civil_second(2013, 11, 19, 5, 6, 7), tz), tp);
+
+  // Modified conversion specifiers %E_
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Ex", "02/03/04", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());
+  EXPECT_EQ(3, convert(tp, tz).day());
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%EX", "15:44:55", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  // %Ey, the year offset from %EC, doesn't really make sense alone as there
+  // is no way to represent it in tm_year (%EC is not simply the century).
+  // Yet, because we handle each (non-internal) specifier in a separate call
+  // to strptime(), there is no way to group %EC and %Ey either.  So we just
+  // skip the %EC and %Ey cases.
+
+  tp = reset;
+  EXPECT_TRUE(parse("%EY", "2004", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  // Modified conversion specifiers %O_
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Od", "15", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).day());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Oe", "15", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).day());  // Equivalent to %d
+
+  tp = reset;
+  EXPECT_TRUE(parse("%OH", "17", tz, &tp));
+  EXPECT_EQ(17, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%OI", "5", tz, &tp));
+  EXPECT_EQ(5, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Om", "11", tz, &tp));
+  EXPECT_EQ(11, convert(tp, tz).month());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%OM", "33", tz, &tp));
+  EXPECT_EQ(33, convert(tp, tz).minute());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%OS", "55", tz, &tp));
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  // %OU is parsed but ignored.
+  EXPECT_TRUE(parse("%OU", "15", tz, &tp));
+
+  // %Ow is parsed but ignored.
+  EXPECT_TRUE(parse("%Ow", "2", tz, &tp));
+
+  // %OW is parsed but ignored.
+  EXPECT_TRUE(parse("%OW", "22", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Oy", "04", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+#endif
+}
+
+TEST(Parse, ExtendedSeconds) {
+  const time_zone tz = utc_time_zone();
+  const time_point<chrono::nanoseconds> unix_epoch =
+      chrono::system_clock::from_time_t(0);
+
+  // All %E<prec>S cases are treated the same as %E*S on input.
+  auto precisions = {"*", "0", "1",  "2",  "3",  "4",  "5",  "6", "7",
+                     "8", "9", "10", "11", "12", "13", "14", "15"};
+  for (const std::string& prec : precisions) {
+    const std::string fmt = "%E" + prec + "S";
+    SCOPED_TRACE(fmt);
+    time_point<chrono::nanoseconds> tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "5", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.0", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.00", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.6", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.60", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.600", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.67", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.670", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.678", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(678), tp);
+  }
+
+  // Here is a "%E*S" case we got wrong for a while.  The fractional
+  // part of the first instant is less than 2^31 and was correctly
+  // parsed, while the second (and any subsecond field >=2^31) failed.
+  time_point<chrono::nanoseconds> tp = unix_epoch;
+  EXPECT_TRUE(parse("%E*S", "0.2147483647", tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+  tp = unix_epoch;
+  EXPECT_TRUE(parse("%E*S", "0.2147483648", tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+
+  // We should also be able to specify long strings of digits far
+  // beyond the current resolution and have them convert the same way.
+  tp = unix_epoch;
+  EXPECT_TRUE(parse(
+      "%E*S", "0.214748364801234567890123456789012345678901234567890123456789",
+      tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+}
+
+TEST(Parse, ExtendedSecondsScan) {
+  const time_zone tz = utc_time_zone();
+  time_point<chrono::nanoseconds> tp;
+  for (int ms = 0; ms < 1000; ms += 111) {
+    for (int us = 0; us < 1000; us += 27) {
+      const int micros = ms * 1000 + us;
+      for (int ns = 0; ns < 1000; ns += 9) {
+        const auto expected = chrono::system_clock::from_time_t(0) +
+                              chrono::nanoseconds(micros * 1000 + ns);
+        std::ostringstream oss;
+        oss << "0." << std::setfill('0') << std::setw(3);
+        oss << ms << std::setw(3) << us << std::setw(3) << ns;
+        const std::string input = oss.str();
+        EXPECT_TRUE(parse("%E*S", input, tz, &tp));
+        EXPECT_EQ(expected, tp) << input;
+      }
+    }
+  }
+}
+
+TEST(Parse, ExtendedSubeconds) {
+  const time_zone tz = utc_time_zone();
+  const time_point<chrono::nanoseconds> unix_epoch =
+      chrono::system_clock::from_time_t(0);
+
+  // All %E<prec>f cases are treated the same as %E*f on input.
+  auto precisions = {"*", "0", "1",  "2",  "3",  "4",  "5",  "6", "7",
+                     "8", "9", "10", "11", "12", "13", "14", "15"};
+  for (const std::string& prec : precisions) {
+    const std::string fmt = "%E" + prec + "f";
+    SCOPED_TRACE(fmt);
+    time_point<chrono::nanoseconds> tp = unix_epoch - chrono::seconds(1);
+    EXPECT_TRUE(parse(fmt, "", tz, &tp));
+    EXPECT_EQ(unix_epoch, tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "6", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "60", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "600", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "67", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "670", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "678", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(678), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "6789", tz, &tp));
+    EXPECT_EQ(
+        unix_epoch + chrono::milliseconds(678) + chrono::microseconds(900), tp);
+  }
+
+  // Here is a "%E*f" case we got wrong for a while.  The fractional
+  // part of the first instant is less than 2^31 and was correctly
+  // parsed, while the second (and any subsecond field >=2^31) failed.
+  time_point<chrono::nanoseconds> tp = unix_epoch;
+  EXPECT_TRUE(parse("%E*f", "2147483647", tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+  tp = unix_epoch;
+  EXPECT_TRUE(parse("%E*f", "2147483648", tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+
+  // We should also be able to specify long strings of digits far
+  // beyond the current resolution and have them convert the same way.
+  tp = unix_epoch;
+  EXPECT_TRUE(parse(
+      "%E*f", "214748364801234567890123456789012345678901234567890123456789",
+      tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+}
+
+TEST(Parse, ExtendedSubecondsScan) {
+  time_point<chrono::nanoseconds> tp;
+  const time_zone tz = utc_time_zone();
+  for (int ms = 0; ms < 1000; ms += 111) {
+    for (int us = 0; us < 1000; us += 27) {
+      const int micros = ms * 1000 + us;
+      for (int ns = 0; ns < 1000; ns += 9) {
+        std::ostringstream oss;
+        oss << std::setfill('0') << std::setw(3) << ms;
+        oss << std::setw(3) << us << std::setw(3) << ns;
+        const std::string nanos = oss.str();
+        const auto expected = chrono::system_clock::from_time_t(0) +
+                              chrono::nanoseconds(micros * 1000 + ns);
+        for (int ps = 0; ps < 1000; ps += 250) {
+          std::ostringstream oss;
+          oss << std::setfill('0') << std::setw(3) << ps;
+          const std::string input = nanos + oss.str() + "999";
+          EXPECT_TRUE(parse("%E*f", input, tz, &tp));
+          EXPECT_EQ(expected + chrono::nanoseconds(ps) / 1000, tp) << input;
+        }
+      }
+    }
+  }
+}
+
+TEST(Parse, ExtendedOffset) {
+  const time_zone utc = utc_time_zone();
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  EXPECT_TRUE(parse("%Ez", "+00:00", utc, &tp));
+  EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse("%Ez", "-12:34", utc, &tp));
+  EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+  EXPECT_TRUE(parse("%Ez", "+12:34", utc, &tp));
+  EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+  EXPECT_FALSE(parse("%Ez", "-12:3", utc, &tp));
+
+  for (auto fmt : {"%Ez", "%z"}) {
+    EXPECT_TRUE(parse(fmt, "+0000", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-1234", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+1234", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-123", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+00", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-12", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+12", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 12, 0, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-1", utc, &tp));
+  }
+}
+
+TEST(Parse, ExtendedSecondOffset) {
+  const time_zone utc = utc_time_zone();
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  for (auto fmt : {"%Ez", "%E*z", "%:z", "%::z", "%:::z"}) {
+    EXPECT_TRUE(parse(fmt, "+00:00:00", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-12:34:56", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 56), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+12:34:56", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 25, 4), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-12:34:5", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+000000", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-123456", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 56), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+123456", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 25, 4), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-12345", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+00:00", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-12:34", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+12:34", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-12:3", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+0000", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-1234", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+1234", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-123", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+00", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-12", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+12", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 12, 0, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-1", utc, &tp));
+  }
+}
+
+TEST(Parse, ExtendedYears) {
+  const time_zone utc = utc_time_zone();
+  const char e4y_fmt[] = "%E4Y%m%d";  // no separators
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  // %E4Y consumes exactly four chars, including any sign.
+  EXPECT_TRUE(parse(e4y_fmt, "-9991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(-999, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "-0991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(-99, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "-0091127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(-9, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "-0011127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(-1, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "00001127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(0, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "00011127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(1, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "00091127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(9, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "00991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(99, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "09991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(999, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "99991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(9999, 11, 27, 0, 0, 0), utc), tp);
+
+  // When the year is outside [-999:9999], the parse fails.
+  EXPECT_FALSE(parse(e4y_fmt, "-10001127", utc, &tp));
+  EXPECT_FALSE(parse(e4y_fmt, "100001127", utc, &tp));
+}
+
+TEST(Parse, RFC3339Format) {
+  const time_zone tz = utc_time_zone();
+  time_point<chrono::nanoseconds> tp;
+  EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00+00:00", tz, &tp));
+  ExpectTime(tp, tz, 2014, 2, 12, 20, 21, 0, 0, false, "UTC");
+
+  // Check that %Ez also accepts "Z" as a synonym for "+00:00".
+  time_point<chrono::nanoseconds> tp2;
+  EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00Z", tz, &tp2));
+  EXPECT_EQ(tp, tp2);
+}
+
+TEST(Parse, MaxRange) {
+  const time_zone utc = utc_time_zone();
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  // tests the upper limit using +00:00 offset
+  EXPECT_TRUE(
+      parse(RFC3339_sec, "292277026596-12-04T15:30:07+00:00", utc, &tp));
+  EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max());
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "292277026596-12-04T15:30:08+00:00", utc, &tp));
+
+  // tests the upper limit using -01:00 offset
+  EXPECT_TRUE(
+      parse(RFC3339_sec, "292277026596-12-04T14:30:07-01:00", utc, &tp));
+  EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max());
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "292277026596-12-04T15:30:07-01:00", utc, &tp));
+
+  // tests the lower limit using +00:00 offset
+  EXPECT_TRUE(
+      parse(RFC3339_sec, "-292277022657-01-27T08:29:52+00:00", utc, &tp));
+  EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min());
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "-292277022657-01-27T08:29:51+00:00", utc, &tp));
+
+  // tests the lower limit using +01:00 offset
+  EXPECT_TRUE(
+      parse(RFC3339_sec, "-292277022657-01-27T09:29:52+01:00", utc, &tp));
+  EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min());
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "-292277022657-01-27T08:29:51+01:00", utc, &tp));
+
+  // tests max/min civil-second overflow
+  EXPECT_FALSE(parse(RFC3339_sec, "9223372036854775807-12-31T23:59:59-00:01",
+                     utc, &tp));
+  EXPECT_FALSE(parse(RFC3339_sec, "-9223372036854775808-01-01T00:00:00+00:01",
+                     utc, &tp));
+
+  // TODO: Add tests that parsing times with fractional seconds overflow
+  // appropriately. This can't be done until cctz::parse() properly detects
+  // overflow when combining the chrono seconds and femto.
+}
+
+//
+// Roundtrip test for format()/parse().
+//
+
+TEST(FormatParse, RoundTrip) {
+  time_zone lax;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax));
+  const auto in = convert(civil_second(1977, 6, 28, 9, 8, 7), lax);
+  const auto subseconds = chrono::nanoseconds(654321);
+
+  // RFC3339, which renders subseconds.
+  {
+    time_point<chrono::nanoseconds> out;
+    const std::string s = format(RFC3339_full, in + subseconds, lax);
+    EXPECT_TRUE(parse(RFC3339_full, s, lax, &out)) << s;
+    EXPECT_EQ(in + subseconds, out);  // RFC3339_full includes %Ez
+  }
+
+  // RFC1123, which only does whole seconds.
+  {
+    time_point<chrono::nanoseconds> out;
+    const std::string s = format(RFC1123_full, in, lax);
+    EXPECT_TRUE(parse(RFC1123_full, s, lax, &out)) << s;
+    EXPECT_EQ(in, out);  // RFC1123_full includes %z
+  }
+
+#if defined(_WIN32) || defined(_WIN64)
+  // Initial investigations indicate the %c does not roundtrip on Windows.
+  // TODO: Figure out what is going on here (perhaps a locale problem).
+#elif defined(__EMSCRIPTEN__)
+  // strftime() and strptime() use different defintions for "%c" under
+  // emscripten (see https://github.com/kripken/emscripten/pull/7491),
+  // causing its round-trip test to fail.
+#else
+  // Even though we don't know what %c will produce, it should roundtrip,
+  // but only in the 0-offset timezone.
+  {
+    time_point<chrono::nanoseconds> out;
+    time_zone utc = utc_time_zone();
+    const std::string s = format("%c", in, utc);
+    EXPECT_TRUE(parse("%c", s, utc, &out)) << s;
+    EXPECT_EQ(in, out);
+  }
+#endif
+}
+
+TEST(FormatParse, RoundTripDistantFuture) {
+  const time_zone utc = utc_time_zone();
+  const time_point<absl::time_internal::cctz::seconds> in = time_point<absl::time_internal::cctz::seconds>::max();
+  const std::string s = format(RFC3339_full, in, utc);
+  time_point<absl::time_internal::cctz::seconds> out;
+  EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s;
+  EXPECT_EQ(in, out);
+}
+
+TEST(FormatParse, RoundTripDistantPast) {
+  const time_zone utc = utc_time_zone();
+  const time_point<absl::time_internal::cctz::seconds> in = time_point<absl::time_internal::cctz::seconds>::min();
+  const std::string s = format(RFC3339_full, in, utc);
+  time_point<absl::time_internal::cctz::seconds> out;
+  EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s;
+  EXPECT_EQ(in, out);
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_if.cc b/absl/time/internal/cctz/src/time_zone_if.cc
new file mode 100644
index 0000000..09aaee5
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_if.cc
@@ -0,0 +1,41 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "time_zone_if.h"
+#include "time_zone_info.h"
+#include "time_zone_libc.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+std::unique_ptr<TimeZoneIf> TimeZoneIf::Load(const std::string& name) {
+  // Support "libc:localtime" and "libc:*" to access the legacy
+  // localtime and UTC support respectively from the C library.
+  if (name.compare(0, 5, "libc:") == 0) {
+    return std::unique_ptr<TimeZoneIf>(new TimeZoneLibC(name.substr(5)));
+  }
+
+  // Otherwise use the "zoneinfo" implementation by default.
+  std::unique_ptr<TimeZoneInfo> tz(new TimeZoneInfo);
+  if (!tz->Load(name)) tz.reset();
+  return std::unique_ptr<TimeZoneIf>(tz.release());
+}
+
+// Defined out-of-line to avoid emitting a weak vtable in all TUs.
+TimeZoneIf::~TimeZoneIf() {}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_if.h b/absl/time/internal/cctz/src/time_zone_if.h
new file mode 100644
index 0000000..d000b7a
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_if.h
@@ -0,0 +1,72 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
+
+#include <chrono>
+#include <cstdint>
+#include <memory>
+#include <string>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// A simple interface used to hide time-zone complexities from time_zone::Impl.
+// Subclasses implement the functions for civil-time conversions in the zone.
+class TimeZoneIf {
+ public:
+  // A factory function for TimeZoneIf implementations.
+  static std::unique_ptr<TimeZoneIf> Load(const std::string& name);
+
+  virtual ~TimeZoneIf();
+
+  virtual time_zone::absolute_lookup BreakTime(
+      const time_point<seconds>& tp) const = 0;
+  virtual time_zone::civil_lookup MakeTime(
+      const civil_second& cs) const = 0;
+
+  virtual bool NextTransition(const time_point<seconds>& tp,
+                              time_zone::civil_transition* trans) const = 0;
+  virtual bool PrevTransition(const time_point<seconds>& tp,
+                              time_zone::civil_transition* trans) const = 0;
+
+  virtual std::string Version() const = 0;
+  virtual std::string Description() const = 0;
+
+ protected:
+  TimeZoneIf() {}
+};
+
+// Convert between time_point<seconds> and a count of seconds since the
+// Unix epoch.  We assume that the std::chrono::system_clock and the
+// Unix clock are second aligned, but not that they share an epoch.
+inline std::int_fast64_t ToUnixSeconds(const time_point<seconds>& tp) {
+  return (tp - std::chrono::time_point_cast<seconds>(
+                   std::chrono::system_clock::from_time_t(0))).count();
+}
+inline time_point<seconds> FromUnixSeconds(std::int_fast64_t t) {
+  return std::chrono::time_point_cast<seconds>(
+             std::chrono::system_clock::from_time_t(0)) + seconds(t);
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
diff --git a/absl/time/internal/cctz/src/time_zone_impl.cc b/absl/time/internal/cctz/src/time_zone_impl.cc
new file mode 100644
index 0000000..a26151d
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_impl.cc
@@ -0,0 +1,113 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "time_zone_impl.h"
+
+#include <mutex>
+#include <string>
+#include <unordered_map>
+#include <utility>
+
+#include "time_zone_fixed.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// time_zone::Impls are linked into a map to support fast lookup by name.
+using TimeZoneImplByName =
+    std::unordered_map<std::string, const time_zone::Impl*>;
+TimeZoneImplByName* time_zone_map = nullptr;
+
+// Mutual exclusion for time_zone_map.
+std::mutex& TimeZoneMutex() {
+  // This mutex is intentionally "leaked" to avoid the static deinitialization
+  // order fiasco (std::mutex's destructor is not trivial on many platforms).
+  static std::mutex* time_zone_mutex = new std::mutex;
+  return *time_zone_mutex;
+}
+
+}  // namespace
+
+time_zone time_zone::Impl::UTC() {
+  return time_zone(UTCImpl());
+}
+
+bool time_zone::Impl::LoadTimeZone(const std::string& name, time_zone* tz) {
+  const time_zone::Impl* const utc_impl = UTCImpl();
+
+  // First check for UTC (which is never a key in time_zone_map).
+  auto offset = seconds::zero();
+  if (FixedOffsetFromName(name, &offset) && offset == seconds::zero()) {
+    *tz = time_zone(utc_impl);
+    return true;
+  }
+
+  // Then check, under a shared lock, whether the time zone has already
+  // been loaded. This is the common path. TODO: Move to shared_mutex.
+  {
+    std::lock_guard<std::mutex> lock(TimeZoneMutex());
+    if (time_zone_map != nullptr) {
+      TimeZoneImplByName::const_iterator itr = time_zone_map->find(name);
+      if (itr != time_zone_map->end()) {
+        *tz = time_zone(itr->second);
+        return itr->second != utc_impl;
+      }
+    }
+  }
+
+  // Now check again, under an exclusive lock.
+  std::lock_guard<std::mutex> lock(TimeZoneMutex());
+  if (time_zone_map == nullptr) time_zone_map = new TimeZoneImplByName;
+  const Impl*& impl = (*time_zone_map)[name];
+  if (impl == nullptr) {
+    // The first thread in loads the new time zone.
+    Impl* new_impl = new Impl(name);
+    new_impl->zone_ = TimeZoneIf::Load(new_impl->name_);
+    if (new_impl->zone_ == nullptr) {
+      delete new_impl;  // free the nascent Impl
+      impl = utc_impl;  // and fallback to UTC
+    } else {
+      impl = new_impl;  // install new time zone
+    }
+  }
+  *tz = time_zone(impl);
+  return impl != utc_impl;
+}
+
+void time_zone::Impl::ClearTimeZoneMapTestOnly() {
+  std::lock_guard<std::mutex> lock(TimeZoneMutex());
+  if (time_zone_map != nullptr) {
+    // Existing time_zone::Impl* entries are in the wild, so we simply
+    // leak them.  Future requests will result in reloading the data.
+    time_zone_map->clear();
+  }
+}
+
+time_zone::Impl::Impl(const std::string& name) : name_(name) {}
+
+const time_zone::Impl* time_zone::Impl::UTCImpl() {
+  static Impl* utc_impl = [] {
+    Impl* impl = new Impl("UTC");
+    impl->zone_ = TimeZoneIf::Load(impl->name_);  // never fails
+    return impl;
+  }();
+  return utc_impl;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_impl.h b/absl/time/internal/cctz/src/time_zone_impl.h
new file mode 100644
index 0000000..b73fad9
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_impl.h
@@ -0,0 +1,90 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
+
+#include <memory>
+#include <string>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "time_zone_if.h"
+#include "time_zone_info.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// time_zone::Impl is the internal object referenced by a cctz::time_zone.
+class time_zone::Impl {
+ public:
+  // The UTC time zone. Also used for other time zones that fail to load.
+  static time_zone UTC();
+
+  // Load a named time zone. Returns false if the name is invalid, or if
+  // some other kind of error occurs. Note that loading "UTC" never fails.
+  static bool LoadTimeZone(const std::string& name, time_zone* tz);
+
+  // Clears the map of cached time zones.  Primarily for use in benchmarks
+  // that gauge the performance of loading/parsing the time-zone data.
+  static void ClearTimeZoneMapTestOnly();
+
+  // The primary key is the time-zone ID (e.g., "America/New_York").
+  const std::string& Name() const {
+    // TODO: It would nice if the zoneinfo data included the zone name.
+    return name_;
+  }
+
+  // Breaks a time_point down to civil-time components in this time zone.
+  time_zone::absolute_lookup BreakTime(const time_point<seconds>& tp) const {
+    return zone_->BreakTime(tp);
+  }
+
+  // Converts the civil-time components in this time zone into a time_point.
+  // That is, the opposite of BreakTime(). The requested civil time may be
+  // ambiguous or illegal due to a change of UTC offset.
+  time_zone::civil_lookup MakeTime(const civil_second& cs) const {
+    return zone_->MakeTime(cs);
+  }
+
+  // Finds the time of the next/previous offset change in this time zone.
+  bool NextTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const {
+    return zone_->NextTransition(tp, trans);
+  }
+  bool PrevTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const {
+    return zone_->PrevTransition(tp, trans);
+  }
+
+  // Returns an implementation-defined version std::string for this time zone.
+  std::string Version() const { return zone_->Version(); }
+
+  // Returns an implementation-defined description of this time zone.
+  std::string Description() const { return zone_->Description(); }
+
+ private:
+  explicit Impl(const std::string& name);
+  static const Impl* UTCImpl();
+
+  const std::string name_;
+  std::unique_ptr<TimeZoneIf> zone_;
+};
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
diff --git a/absl/time/internal/cctz/src/time_zone_info.cc b/absl/time/internal/cctz/src/time_zone_info.cc
new file mode 100644
index 0000000..9db72e0
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_info.cc
@@ -0,0 +1,975 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+// This file implements the TimeZoneIf interface using the "zoneinfo"
+// data provided by the IANA Time Zone Database (i.e., the only real game
+// in town).
+//
+// TimeZoneInfo represents the history of UTC-offset changes within a time
+// zone. Most changes are due to daylight-saving rules, but occasionally
+// shifts are made to the time-zone's base offset. The database only attempts
+// to be definitive for times since 1970, so be wary of local-time conversions
+// before that. Also, rule and zone-boundary changes are made at the whim
+// of governments, so the conversion of future times needs to be taken with
+// a grain of salt.
+//
+// For more information see tzfile(5), http://www.iana.org/time-zones, or
+// https://en.wikipedia.org/wiki/Zoneinfo.
+//
+// Note that we assume the proleptic Gregorian calendar and 60-second
+// minutes throughout.
+
+#include "time_zone_info.h"
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <cstdint>
+#include <cstdio>
+#include <cstdlib>
+#include <cstring>
+#include <functional>
+#include <iostream>
+#include <memory>
+#include <sstream>
+#include <string>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "time_zone_fixed.h"
+#include "time_zone_posix.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+inline bool IsLeap(year_t year) {
+  return (year % 4) == 0 && ((year % 100) != 0 || (year % 400) == 0);
+}
+
+// The number of days in non-leap and leap years respectively.
+const std::int_least32_t kDaysPerYear[2] = {365, 366};
+
+// The day offsets of the beginning of each (1-based) month in non-leap and
+// leap years respectively (e.g., 335 days before December in a leap year).
+const std::int_least16_t kMonthOffsets[2][1 + 12 + 1] = {
+  {-1, 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334, 365},
+  {-1, 0, 31, 60, 91, 121, 152, 182, 213, 244, 274, 305, 335, 366},
+};
+
+// We reject leap-second encoded zoneinfo and so assume 60-second minutes.
+const std::int_least32_t kSecsPerDay = 24 * 60 * 60;
+
+// 400-year chunks always have 146097 days (20871 weeks).
+const std::int_least64_t kSecsPer400Years = 146097LL * kSecsPerDay;
+
+// Like kDaysPerYear[] but scaled up by a factor of kSecsPerDay.
+const std::int_least32_t kSecsPerYear[2] = {
+  365 * kSecsPerDay,
+  366 * kSecsPerDay,
+};
+
+// Single-byte, unsigned numeric values are encoded directly.
+inline std::uint_fast8_t Decode8(const char* cp) {
+  return static_cast<std::uint_fast8_t>(*cp) & 0xff;
+}
+
+// Multi-byte, numeric values are encoded using a MSB first,
+// twos-complement representation. These helpers decode, from
+// the given address, 4-byte and 8-byte values respectively.
+// Note: If int_fastXX_t == intXX_t and this machine is not
+// twos complement, then there will be at least one input value
+// we cannot represent.
+std::int_fast32_t Decode32(const char* cp) {
+  std::uint_fast32_t v = 0;
+  for (int i = 0; i != (32 / 8); ++i) v = (v << 8) | Decode8(cp++);
+  const std::int_fast32_t s32max = 0x7fffffff;
+  const auto s32maxU = static_cast<std::uint_fast32_t>(s32max);
+  if (v <= s32maxU) return static_cast<std::int_fast32_t>(v);
+  return static_cast<std::int_fast32_t>(v - s32maxU - 1) - s32max - 1;
+}
+
+std::int_fast64_t Decode64(const char* cp) {
+  std::uint_fast64_t v = 0;
+  for (int i = 0; i != (64 / 8); ++i) v = (v << 8) | Decode8(cp++);
+  const std::int_fast64_t s64max = 0x7fffffffffffffff;
+  const auto s64maxU = static_cast<std::uint_fast64_t>(s64max);
+  if (v <= s64maxU) return static_cast<std::int_fast64_t>(v);
+  return static_cast<std::int_fast64_t>(v - s64maxU - 1) - s64max - 1;
+}
+
+// Generate a year-relative offset for a PosixTransition.
+std::int_fast64_t TransOffset(bool leap_year, int jan1_weekday,
+                              const PosixTransition& pt) {
+  std::int_fast64_t days = 0;
+  switch (pt.date.fmt) {
+    case PosixTransition::J: {
+      days = pt.date.j.day;
+      if (!leap_year || days < kMonthOffsets[1][3]) days -= 1;
+      break;
+    }
+    case PosixTransition::N: {
+      days = pt.date.n.day;
+      break;
+    }
+    case PosixTransition::M: {
+      const bool last_week = (pt.date.m.week == 5);
+      days = kMonthOffsets[leap_year][pt.date.m.month + last_week];
+      const std::int_fast64_t weekday = (jan1_weekday + days) % 7;
+      if (last_week) {
+        days -= (weekday + 7 - 1 - pt.date.m.weekday) % 7 + 1;
+      } else {
+        days += (pt.date.m.weekday + 7 - weekday) % 7;
+        days += (pt.date.m.week - 1) * 7;
+      }
+      break;
+    }
+  }
+  return (days * kSecsPerDay) + pt.time.offset;
+}
+
+inline time_zone::civil_lookup MakeUnique(const time_point<seconds>& tp) {
+  time_zone::civil_lookup cl;
+  cl.kind = time_zone::civil_lookup::UNIQUE;
+  cl.pre = cl.trans = cl.post = tp;
+  return cl;
+}
+
+inline time_zone::civil_lookup MakeUnique(std::int_fast64_t unix_time) {
+  return MakeUnique(FromUnixSeconds(unix_time));
+}
+
+inline time_zone::civil_lookup MakeSkipped(const Transition& tr,
+                                           const civil_second& cs) {
+  time_zone::civil_lookup cl;
+  cl.kind = time_zone::civil_lookup::SKIPPED;
+  cl.pre = FromUnixSeconds(tr.unix_time - 1 + (cs - tr.prev_civil_sec));
+  cl.trans = FromUnixSeconds(tr.unix_time);
+  cl.post = FromUnixSeconds(tr.unix_time - (tr.civil_sec - cs));
+  return cl;
+}
+
+inline time_zone::civil_lookup MakeRepeated(const Transition& tr,
+                                            const civil_second& cs) {
+  time_zone::civil_lookup cl;
+  cl.kind = time_zone::civil_lookup::REPEATED;
+  cl.pre = FromUnixSeconds(tr.unix_time - 1 - (tr.prev_civil_sec - cs));
+  cl.trans = FromUnixSeconds(tr.unix_time);
+  cl.post = FromUnixSeconds(tr.unix_time + (cs - tr.civil_sec));
+  return cl;
+}
+
+inline civil_second YearShift(const civil_second& cs, year_t shift) {
+  return civil_second(cs.year() + shift, cs.month(), cs.day(),
+                      cs.hour(), cs.minute(), cs.second());
+}
+
+}  // namespace
+
+// What (no leap-seconds) UTC+seconds zoneinfo would look like.
+bool TimeZoneInfo::ResetToBuiltinUTC(const seconds& offset) {
+  transition_types_.resize(1);
+  TransitionType& tt(transition_types_.back());
+  tt.utc_offset = static_cast<std::int_least32_t>(offset.count());
+  tt.is_dst = false;
+  tt.abbr_index = 0;
+
+  // We temporarily add some redundant, contemporary (2013 through 2023)
+  // transitions for performance reasons.  See TimeZoneInfo::LocalTime().
+  // TODO: Fix the performance issue and remove the extra transitions.
+  transitions_.clear();
+  transitions_.reserve(12);
+  for (const std::int_fast64_t unix_time : {
+           -(1LL << 59),  // BIG_BANG
+           1356998400LL,  // 2013-01-01T00:00:00+00:00
+           1388534400LL,  // 2014-01-01T00:00:00+00:00
+           1420070400LL,  // 2015-01-01T00:00:00+00:00
+           1451606400LL,  // 2016-01-01T00:00:00+00:00
+           1483228800LL,  // 2017-01-01T00:00:00+00:00
+           1514764800LL,  // 2018-01-01T00:00:00+00:00
+           1546300800LL,  // 2019-01-01T00:00:00+00:00
+           1577836800LL,  // 2020-01-01T00:00:00+00:00
+           1609459200LL,  // 2021-01-01T00:00:00+00:00
+           1640995200LL,  // 2022-01-01T00:00:00+00:00
+           1672531200LL,  // 2023-01-01T00:00:00+00:00
+           2147483647LL,  // 2^31 - 1
+       }) {
+    Transition& tr(*transitions_.emplace(transitions_.end()));
+    tr.unix_time = unix_time;
+    tr.type_index = 0;
+    tr.civil_sec = LocalTime(tr.unix_time, tt).cs;
+    tr.prev_civil_sec = tr.civil_sec - 1;
+  }
+
+  default_transition_type_ = 0;
+  abbreviations_ = FixedOffsetToAbbr(offset);
+  abbreviations_.append(1, '\0');  // add NUL
+  future_spec_.clear();  // never needed for a fixed-offset zone
+  extended_ = false;
+
+  tt.civil_max = LocalTime(seconds::max().count(), tt).cs;
+  tt.civil_min = LocalTime(seconds::min().count(), tt).cs;
+
+  transitions_.shrink_to_fit();
+  return true;
+}
+
+// Builds the in-memory header using the raw bytes from the file.
+bool TimeZoneInfo::Header::Build(const tzhead& tzh) {
+  std::int_fast32_t v;
+  if ((v = Decode32(tzh.tzh_timecnt)) < 0) return false;
+  timecnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_typecnt)) < 0) return false;
+  typecnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_charcnt)) < 0) return false;
+  charcnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_leapcnt)) < 0) return false;
+  leapcnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_ttisstdcnt)) < 0) return false;
+  ttisstdcnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_ttisutcnt)) < 0) return false;
+  ttisutcnt = static_cast<std::size_t>(v);
+  return true;
+}
+
+// How many bytes of data are associated with this header. The result
+// depends upon whether this is a section with 4-byte or 8-byte times.
+std::size_t TimeZoneInfo::Header::DataLength(std::size_t time_len) const {
+  std::size_t len = 0;
+  len += (time_len + 1) * timecnt;  // unix_time + type_index
+  len += (4 + 1 + 1) * typecnt;     // utc_offset + is_dst + abbr_index
+  len += 1 * charcnt;               // abbreviations
+  len += (time_len + 4) * leapcnt;  // leap-time + TAI-UTC
+  len += 1 * ttisstdcnt;            // UTC/local indicators
+  len += 1 * ttisutcnt;             // standard/wall indicators
+  return len;
+}
+
+// Check that the TransitionType has the expected offset/is_dst/abbreviation.
+void TimeZoneInfo::CheckTransition(const std::string& name,
+                                   const TransitionType& tt,
+                                   std::int_fast32_t offset, bool is_dst,
+                                   const std::string& abbr) const {
+  if (tt.utc_offset != offset || tt.is_dst != is_dst ||
+      &abbreviations_[tt.abbr_index] != abbr) {
+    std::clog << name << ": Transition"
+              << " offset=" << tt.utc_offset << "/"
+              << (tt.is_dst ? "DST" : "STD")
+              << "/abbr=" << &abbreviations_[tt.abbr_index]
+              << " does not match POSIX spec '" << future_spec_ << "'\n";
+  }
+}
+
+// zic(8) can generate no-op transitions when a zone changes rules at an
+// instant when there is actually no discontinuity.  So we check whether
+// two transitions have equivalent types (same offset/is_dst/abbr).
+bool TimeZoneInfo::EquivTransitions(std::uint_fast8_t tt1_index,
+                                    std::uint_fast8_t tt2_index) const {
+  if (tt1_index == tt2_index) return true;
+  const TransitionType& tt1(transition_types_[tt1_index]);
+  const TransitionType& tt2(transition_types_[tt2_index]);
+  if (tt1.is_dst != tt2.is_dst) return false;
+  if (tt1.utc_offset != tt2.utc_offset) return false;
+  if (tt1.abbr_index != tt2.abbr_index) return false;
+  return true;
+}
+
+// Use the POSIX-TZ-environment-variable-style string to handle times
+// in years after the last transition stored in the zoneinfo data.
+void TimeZoneInfo::ExtendTransitions(const std::string& name,
+                                     const Header& hdr) {
+  extended_ = false;
+  bool extending = !future_spec_.empty();
+
+  PosixTimeZone posix;
+  if (extending && !ParsePosixSpec(future_spec_, &posix)) {
+    std::clog << name << ": Failed to parse '" << future_spec_ << "'\n";
+    extending = false;
+  }
+
+  if (extending && posix.dst_abbr.empty()) {  // std only
+    // The future specification should match the last/default transition,
+    // and that means that handling the future will fall out naturally.
+    std::uint_fast8_t index = default_transition_type_;
+    if (hdr.timecnt != 0) index = transitions_[hdr.timecnt - 1].type_index;
+    const TransitionType& tt(transition_types_[index]);
+    CheckTransition(name, tt, posix.std_offset, false, posix.std_abbr);
+    extending = false;
+  }
+
+  if (extending && hdr.timecnt < 2) {
+    std::clog << name << ": Too few transitions for POSIX spec\n";
+    extending = false;
+  }
+
+  if (!extending) {
+    // Ensure that there is always a transition in the second half of the
+    // time line (the BIG_BANG transition is in the first half) so that the
+    // signed difference between a civil_second and the civil_second of its
+    // previous transition is always representable, without overflow.
+    const Transition& last(transitions_.back());
+    if (last.unix_time < 0) {
+      const std::uint_fast8_t type_index = last.type_index;
+      Transition& tr(*transitions_.emplace(transitions_.end()));
+      tr.unix_time = 2147483647;  // 2038-01-19T03:14:07+00:00
+      tr.type_index = type_index;
+    }
+    return;  // last transition wins
+  }
+
+  // Extend the transitions for an additional 400 years using the
+  // future specification. Years beyond those can be handled by
+  // mapping back to a cycle-equivalent year within that range.
+  // zic(8) should probably do this so that we don't have to.
+  // TODO: Reduce the extension by the number of compatible
+  // transitions already in place.
+  transitions_.reserve(hdr.timecnt + 400 * 2 + 1);
+  transitions_.resize(hdr.timecnt + 400 * 2);
+  extended_ = true;
+
+  // The future specification should match the last two transitions,
+  // and those transitions should have different is_dst flags.  Note
+  // that nothing says the UTC offset used by the is_dst transition
+  // must be greater than that used by the !is_dst transition.  (See
+  // Europe/Dublin, for example.)
+  const Transition* tr0 = &transitions_[hdr.timecnt - 1];
+  const Transition* tr1 = &transitions_[hdr.timecnt - 2];
+  const TransitionType* tt0 = &transition_types_[tr0->type_index];
+  const TransitionType* tt1 = &transition_types_[tr1->type_index];
+  const TransitionType& dst(tt0->is_dst ? *tt0 : *tt1);
+  const TransitionType& std(tt0->is_dst ? *tt1 : *tt0);
+  CheckTransition(name, dst, posix.dst_offset, true, posix.dst_abbr);
+  CheckTransition(name, std, posix.std_offset, false, posix.std_abbr);
+
+  // Add the transitions to tr1 and back to tr0 for each extra year.
+  last_year_ = LocalTime(tr0->unix_time, *tt0).cs.year();
+  bool leap_year = IsLeap(last_year_);
+  const civil_day jan1(last_year_, 1, 1);
+  std::int_fast64_t jan1_time = civil_second(jan1) - civil_second();
+  int jan1_weekday = (static_cast<int>(get_weekday(jan1)) + 1) % 7;
+  Transition* tr = &transitions_[hdr.timecnt];  // next trans to fill
+  if (LocalTime(tr1->unix_time, *tt1).cs.year() != last_year_) {
+    // Add a single extra transition to align to a calendar year.
+    transitions_.resize(transitions_.size() + 1);
+    assert(tr == &transitions_[hdr.timecnt]);  // no reallocation
+    const PosixTransition& pt1(tt0->is_dst ? posix.dst_end : posix.dst_start);
+    std::int_fast64_t tr1_offset = TransOffset(leap_year, jan1_weekday, pt1);
+    tr->unix_time = jan1_time + tr1_offset - tt0->utc_offset;
+    tr++->type_index = tr1->type_index;
+    tr0 = &transitions_[hdr.timecnt];
+    tr1 = &transitions_[hdr.timecnt - 1];
+    tt0 = &transition_types_[tr0->type_index];
+    tt1 = &transition_types_[tr1->type_index];
+  }
+  const PosixTransition& pt1(tt0->is_dst ? posix.dst_end : posix.dst_start);
+  const PosixTransition& pt0(tt0->is_dst ? posix.dst_start : posix.dst_end);
+  for (const year_t limit = last_year_ + 400; last_year_ < limit;) {
+    last_year_ += 1;  // an additional year of generated transitions
+    jan1_time += kSecsPerYear[leap_year];
+    jan1_weekday = (jan1_weekday + kDaysPerYear[leap_year]) % 7;
+    leap_year = !leap_year && IsLeap(last_year_);
+    std::int_fast64_t tr1_offset = TransOffset(leap_year, jan1_weekday, pt1);
+    tr->unix_time = jan1_time + tr1_offset - tt0->utc_offset;
+    tr++->type_index = tr1->type_index;
+    std::int_fast64_t tr0_offset = TransOffset(leap_year, jan1_weekday, pt0);
+    tr->unix_time = jan1_time + tr0_offset - tt1->utc_offset;
+    tr++->type_index = tr0->type_index;
+  }
+  assert(tr == &transitions_[0] + transitions_.size());
+}
+
+bool TimeZoneInfo::Load(const std::string& name, ZoneInfoSource* zip) {
+  // Read and validate the header.
+  tzhead tzh;
+  if (zip->Read(&tzh, sizeof(tzh)) != sizeof(tzh))
+    return false;
+  if (strncmp(tzh.tzh_magic, TZ_MAGIC, sizeof(tzh.tzh_magic)) != 0)
+    return false;
+  Header hdr;
+  if (!hdr.Build(tzh))
+    return false;
+  std::size_t time_len = 4;
+  if (tzh.tzh_version[0] != '\0') {
+    // Skip the 4-byte data.
+    if (zip->Skip(hdr.DataLength(time_len)) != 0)
+      return false;
+    // Read and validate the header for the 8-byte data.
+    if (zip->Read(&tzh, sizeof(tzh)) != sizeof(tzh))
+      return false;
+    if (strncmp(tzh.tzh_magic, TZ_MAGIC, sizeof(tzh.tzh_magic)) != 0)
+      return false;
+    if (tzh.tzh_version[0] == '\0')
+      return false;
+    if (!hdr.Build(tzh))
+      return false;
+    time_len = 8;
+  }
+  if (hdr.typecnt == 0)
+    return false;
+  if (hdr.leapcnt != 0) {
+    // This code assumes 60-second minutes so we do not want
+    // the leap-second encoded zoneinfo. We could reverse the
+    // compensation, but the "right" encoding is rarely used
+    // so currently we simply reject such data.
+    return false;
+  }
+  if (hdr.ttisstdcnt != 0 && hdr.ttisstdcnt != hdr.typecnt)
+    return false;
+  if (hdr.ttisutcnt != 0 && hdr.ttisutcnt != hdr.typecnt)
+    return false;
+
+  // Read the data into a local buffer.
+  std::size_t len = hdr.DataLength(time_len);
+  std::vector<char> tbuf(len);
+  if (zip->Read(tbuf.data(), len) != len)
+    return false;
+  const char* bp = tbuf.data();
+
+  // Decode and validate the transitions.
+  transitions_.reserve(hdr.timecnt + 2);  // We might add a couple.
+  transitions_.resize(hdr.timecnt);
+  for (std::size_t i = 0; i != hdr.timecnt; ++i) {
+    transitions_[i].unix_time = (time_len == 4) ? Decode32(bp) : Decode64(bp);
+    bp += time_len;
+    if (i != 0) {
+      // Check that the transitions are ordered by time (as zic guarantees).
+      if (!Transition::ByUnixTime()(transitions_[i - 1], transitions_[i]))
+        return false;  // out of order
+    }
+  }
+  bool seen_type_0 = false;
+  for (std::size_t i = 0; i != hdr.timecnt; ++i) {
+    transitions_[i].type_index = Decode8(bp++);
+    if (transitions_[i].type_index >= hdr.typecnt)
+      return false;
+    if (transitions_[i].type_index == 0)
+      seen_type_0 = true;
+  }
+
+  // Decode and validate the transition types.
+  transition_types_.resize(hdr.typecnt);
+  for (std::size_t i = 0; i != hdr.typecnt; ++i) {
+    transition_types_[i].utc_offset =
+        static_cast<std::int_least32_t>(Decode32(bp));
+    if (transition_types_[i].utc_offset >= kSecsPerDay ||
+        transition_types_[i].utc_offset <= -kSecsPerDay)
+      return false;
+    bp += 4;
+    transition_types_[i].is_dst = (Decode8(bp++) != 0);
+    transition_types_[i].abbr_index = Decode8(bp++);
+    if (transition_types_[i].abbr_index >= hdr.charcnt)
+      return false;
+  }
+
+  // Determine the before-first-transition type.
+  default_transition_type_ = 0;
+  if (seen_type_0 && hdr.timecnt != 0) {
+    std::uint_fast8_t index = 0;
+    if (transition_types_[0].is_dst) {
+      index = transitions_[0].type_index;
+      while (index != 0 && transition_types_[index].is_dst)
+        --index;
+    }
+    while (index != hdr.typecnt && transition_types_[index].is_dst)
+      ++index;
+    if (index != hdr.typecnt)
+      default_transition_type_ = index;
+  }
+
+  // Copy all the abbreviations.
+  abbreviations_.assign(bp, hdr.charcnt);
+  bp += hdr.charcnt;
+
+  // Skip the unused portions. We've already dispensed with leap-second
+  // encoded zoneinfo. The ttisstd/ttisgmt indicators only apply when
+  // interpreting a POSIX spec that does not include start/end rules, and
+  // that isn't the case here (see "zic -p").
+  bp += (8 + 4) * hdr.leapcnt;  // leap-time + TAI-UTC
+  bp += 1 * hdr.ttisstdcnt;     // UTC/local indicators
+  bp += 1 * hdr.ttisutcnt;      // standard/wall indicators
+  assert(bp == tbuf.data() + tbuf.size());
+
+  future_spec_.clear();
+  if (tzh.tzh_version[0] != '\0') {
+    // Snarf up the NL-enclosed future POSIX spec. Note
+    // that version '3' files utilize an extended format.
+    auto get_char = [](ZoneInfoSource* azip) -> int {
+      unsigned char ch;  // all non-EOF results are positive
+      return (azip->Read(&ch, 1) == 1) ? ch : EOF;
+    };
+    if (get_char(zip) != '\n')
+      return false;
+    for (int c = get_char(zip); c != '\n'; c = get_char(zip)) {
+      if (c == EOF)
+        return false;
+      future_spec_.push_back(static_cast<char>(c));
+    }
+  }
+
+  // We don't check for EOF so that we're forwards compatible.
+
+  // If we did not find version information during the standard loading
+  // process (as of tzh_version '3' that is unsupported), then ask the
+  // ZoneInfoSource for any out-of-bound version std::string it may be privy to.
+  if (version_.empty()) {
+    version_ = zip->Version();
+  }
+
+  // Trim redundant transitions. zic may have added these to work around
+  // differences between the glibc and reference implementations (see
+  // zic.c:dontmerge) and the Qt library (see zic.c:WORK_AROUND_QTBUG_53071).
+  // For us, they just get in the way when we do future_spec_ extension.
+  while (hdr.timecnt > 1) {
+    if (!EquivTransitions(transitions_[hdr.timecnt - 1].type_index,
+                          transitions_[hdr.timecnt - 2].type_index)) {
+      break;
+    }
+    hdr.timecnt -= 1;
+  }
+  transitions_.resize(hdr.timecnt);
+
+  // Ensure that there is always a transition in the first half of the
+  // time line (the second half is handled in ExtendTransitions()) so that
+  // the signed difference between a civil_second and the civil_second of
+  // its previous transition is always representable, without overflow.
+  // A contemporary zic will usually have already done this for us.
+  if (transitions_.empty() || transitions_.front().unix_time >= 0) {
+    Transition& tr(*transitions_.emplace(transitions_.begin()));
+    tr.unix_time = -(1LL << 59);  // see tz/zic.c "BIG_BANG"
+    tr.type_index = default_transition_type_;
+    hdr.timecnt += 1;
+  }
+
+  // Extend the transitions using the future specification.
+  ExtendTransitions(name, hdr);
+
+  // Compute the local civil time for each transition and the preceding
+  // second. These will be used for reverse conversions in MakeTime().
+  const TransitionType* ttp = &transition_types_[default_transition_type_];
+  for (std::size_t i = 0; i != transitions_.size(); ++i) {
+    Transition& tr(transitions_[i]);
+    tr.prev_civil_sec = LocalTime(tr.unix_time, *ttp).cs - 1;
+    ttp = &transition_types_[tr.type_index];
+    tr.civil_sec = LocalTime(tr.unix_time, *ttp).cs;
+    if (i != 0) {
+      // Check that the transitions are ordered by civil time. Essentially
+      // this means that an offset change cannot cross another such change.
+      // No one does this in practice, and we depend on it in MakeTime().
+      if (!Transition::ByCivilTime()(transitions_[i - 1], tr))
+        return false;  // out of order
+    }
+  }
+
+  // Compute the maximum/minimum civil times that can be converted to a
+  // time_point<seconds> for each of the zone's transition types.
+  for (auto& tt : transition_types_) {
+    tt.civil_max = LocalTime(seconds::max().count(), tt).cs;
+    tt.civil_min = LocalTime(seconds::min().count(), tt).cs;
+  }
+
+  transitions_.shrink_to_fit();
+  return true;
+}
+
+namespace {
+
+// fopen(3) adaptor.
+inline FILE* FOpen(const char* path, const char* mode) {
+#if defined(_MSC_VER)
+  FILE* fp;
+  if (fopen_s(&fp, path, mode) != 0) fp = nullptr;
+  return fp;
+#else
+  return fopen(path, mode);  // TODO: Enable the close-on-exec flag.
+#endif
+}
+
+// A stdio(3)-backed implementation of ZoneInfoSource.
+class FileZoneInfoSource : public ZoneInfoSource {
+ public:
+  static std::unique_ptr<ZoneInfoSource> Open(const std::string& name);
+
+  std::size_t Read(void* ptr, std::size_t size) override {
+    size = std::min(size, len_);
+    std::size_t nread = fread(ptr, 1, size, fp_.get());
+    len_ -= nread;
+    return nread;
+  }
+  int Skip(std::size_t offset) override {
+    offset = std::min(offset, len_);
+    int rc = fseek(fp_.get(), static_cast<long>(offset), SEEK_CUR);
+    if (rc == 0) len_ -= offset;
+    return rc;
+  }
+  std::string Version() const override {
+    // TODO: It would nice if the zoneinfo data included the tzdb version.
+    return std::string();
+  }
+
+ protected:
+  explicit FileZoneInfoSource(
+      FILE* fp, std::size_t len = std::numeric_limits<std::size_t>::max())
+      : fp_(fp, fclose), len_(len) {}
+
+ private:
+  std::unique_ptr<FILE, int(*)(FILE*)> fp_;
+  std::size_t len_;
+};
+
+std::unique_ptr<ZoneInfoSource> FileZoneInfoSource::Open(
+    const std::string& name) {
+  // Use of the "file:" prefix is intended for testing purposes only.
+  if (name.compare(0, 5, "file:") == 0) return Open(name.substr(5));
+
+  // Map the time-zone name to a path name.
+  std::string path;
+  if (name.empty() || name[0] != '/') {
+    const char* tzdir = "/usr/share/zoneinfo";
+    char* tzdir_env = nullptr;
+#if defined(_MSC_VER)
+    _dupenv_s(&tzdir_env, nullptr, "TZDIR");
+#else
+    tzdir_env = std::getenv("TZDIR");
+#endif
+    if (tzdir_env && *tzdir_env) tzdir = tzdir_env;
+    path += tzdir;
+    path += '/';
+#if defined(_MSC_VER)
+    free(tzdir_env);
+#endif
+  }
+  path += name;
+
+  // Open the zoneinfo file.
+  FILE* fp = FOpen(path.c_str(), "rb");
+  if (fp == nullptr) return nullptr;
+  std::size_t length = 0;
+  if (fseek(fp, 0, SEEK_END) == 0) {
+    long pos = ftell(fp);
+    if (pos >= 0) {
+      length = static_cast<std::size_t>(pos);
+    }
+    rewind(fp);
+  }
+  return std::unique_ptr<ZoneInfoSource>(new FileZoneInfoSource(fp, length));
+}
+
+class AndroidZoneInfoSource : public FileZoneInfoSource {
+ public:
+  static std::unique_ptr<ZoneInfoSource> Open(const std::string& name);
+  std::string Version() const override { return version_; }
+
+ private:
+  explicit AndroidZoneInfoSource(FILE* fp, std::size_t len, const char* vers)
+      : FileZoneInfoSource(fp, len), version_(vers) {}
+  std::string version_;
+};
+
+std::unique_ptr<ZoneInfoSource> AndroidZoneInfoSource::Open(
+    const std::string& name) {
+  // Use of the "file:" prefix is intended for testing purposes only.
+  if (name.compare(0, 5, "file:") == 0) return Open(name.substr(5));
+
+  // See Android's libc/tzcode/bionic.cpp for additional information.
+  for (const char* tzdata : {"/data/misc/zoneinfo/current/tzdata",
+                             "/system/usr/share/zoneinfo/tzdata"}) {
+    std::unique_ptr<FILE, int (*)(FILE*)> fp(FOpen(tzdata, "rb"), fclose);
+    if (fp.get() == nullptr) continue;
+
+    char hbuf[24];  // covers header.zonetab_offset too
+    if (fread(hbuf, 1, sizeof(hbuf), fp.get()) != sizeof(hbuf)) continue;
+    if (strncmp(hbuf, "tzdata", 6) != 0) continue;
+    const char* vers = (hbuf[11] == '\0') ? hbuf + 6 : "";
+    const std::int_fast32_t index_offset = Decode32(hbuf + 12);
+    const std::int_fast32_t data_offset = Decode32(hbuf + 16);
+    if (index_offset < 0 || data_offset < index_offset) continue;
+    if (fseek(fp.get(), static_cast<long>(index_offset), SEEK_SET) != 0)
+      continue;
+
+    char ebuf[52];  // covers entry.unused too
+    const std::size_t index_size =
+        static_cast<std::size_t>(data_offset - index_offset);
+    const std::size_t zonecnt = index_size / sizeof(ebuf);
+    if (zonecnt * sizeof(ebuf) != index_size) continue;
+    for (std::size_t i = 0; i != zonecnt; ++i) {
+      if (fread(ebuf, 1, sizeof(ebuf), fp.get()) != sizeof(ebuf)) break;
+      const std::int_fast32_t start = data_offset + Decode32(ebuf + 40);
+      const std::int_fast32_t length = Decode32(ebuf + 44);
+      if (start < 0 || length < 0) break;
+      ebuf[40] = '\0';  // ensure zone name is NUL terminated
+      if (strcmp(name.c_str(), ebuf) == 0) {
+        if (fseek(fp.get(), static_cast<long>(start), SEEK_SET) != 0) break;
+        return std::unique_ptr<ZoneInfoSource>(new AndroidZoneInfoSource(
+            fp.release(), static_cast<std::size_t>(length), vers));
+      }
+    }
+  }
+
+  return nullptr;
+}
+
+}  // namespace
+
+bool TimeZoneInfo::Load(const std::string& name) {
+  // We can ensure that the loading of UTC or any other fixed-offset
+  // zone never fails because the simple, fixed-offset state can be
+  // internally generated. Note that this depends on our choice to not
+  // accept leap-second encoded ("right") zoneinfo.
+  auto offset = seconds::zero();
+  if (FixedOffsetFromName(name, &offset)) {
+    return ResetToBuiltinUTC(offset);
+  }
+
+  // Find and use a ZoneInfoSource to load the named zone.
+  auto zip = cctz_extension::zone_info_source_factory(
+      name, [](const std::string& name) -> std::unique_ptr<ZoneInfoSource> {
+        if (auto zip = FileZoneInfoSource::Open(name)) return zip;
+        if (auto zip = AndroidZoneInfoSource::Open(name)) return zip;
+        return nullptr;
+      });
+  return zip != nullptr && Load(name, zip.get());
+}
+
+// BreakTime() translation for a particular transition type.
+time_zone::absolute_lookup TimeZoneInfo::LocalTime(
+    std::int_fast64_t unix_time, const TransitionType& tt) const {
+  // A civil time in "+offset" looks like (time+offset) in UTC.
+  // Note: We perform two additions in the civil_second domain to
+  // sidestep the chance of overflow in (unix_time + tt.utc_offset).
+  return {(civil_second() + unix_time) + tt.utc_offset,
+          tt.utc_offset, tt.is_dst, &abbreviations_[tt.abbr_index]};
+}
+
+// BreakTime() translation for a particular transition.
+time_zone::absolute_lookup TimeZoneInfo::LocalTime(
+    std::int_fast64_t unix_time, const Transition& tr) const {
+  const TransitionType& tt = transition_types_[tr.type_index];
+  // Note: (unix_time - tr.unix_time) will never overflow as we
+  // have ensured that there is always a "nearby" transition.
+  return {tr.civil_sec + (unix_time - tr.unix_time),  // TODO: Optimize.
+          tt.utc_offset, tt.is_dst, &abbreviations_[tt.abbr_index]};
+}
+
+// MakeTime() translation with a conversion-preserving +N * 400-year shift.
+time_zone::civil_lookup TimeZoneInfo::TimeLocal(const civil_second& cs,
+                                                year_t c4_shift) const {
+  assert(last_year_ - 400 < cs.year() && cs.year() <= last_year_);
+  time_zone::civil_lookup cl = MakeTime(cs);
+  if (c4_shift > seconds::max().count() / kSecsPer400Years) {
+    cl.pre = cl.trans = cl.post = time_point<seconds>::max();
+  } else {
+    const auto offset = seconds(c4_shift * kSecsPer400Years);
+    const auto limit = time_point<seconds>::max() - offset;
+    for (auto* tp : {&cl.pre, &cl.trans, &cl.post}) {
+      if (*tp > limit) {
+        *tp = time_point<seconds>::max();
+      } else {
+        *tp += offset;
+      }
+    }
+  }
+  return cl;
+}
+
+time_zone::absolute_lookup TimeZoneInfo::BreakTime(
+    const time_point<seconds>& tp) const {
+  std::int_fast64_t unix_time = ToUnixSeconds(tp);
+  const std::size_t timecnt = transitions_.size();
+  assert(timecnt != 0);  // We always add a transition.
+
+  if (unix_time < transitions_[0].unix_time) {
+    return LocalTime(unix_time, transition_types_[default_transition_type_]);
+  }
+  if (unix_time >= transitions_[timecnt - 1].unix_time) {
+    // After the last transition. If we extended the transitions using
+    // future_spec_, shift back to a supported year using the 400-year
+    // cycle of calendaric equivalence and then compensate accordingly.
+    if (extended_) {
+      const std::int_fast64_t diff =
+          unix_time - transitions_[timecnt - 1].unix_time;
+      const year_t shift = diff / kSecsPer400Years + 1;
+      const auto d = seconds(shift * kSecsPer400Years);
+      time_zone::absolute_lookup al = BreakTime(tp - d);
+      al.cs = YearShift(al.cs, shift * 400);
+      return al;
+    }
+    return LocalTime(unix_time, transitions_[timecnt - 1]);
+  }
+
+  const std::size_t hint = local_time_hint_.load(std::memory_order_relaxed);
+  if (0 < hint && hint < timecnt) {
+    if (transitions_[hint - 1].unix_time <= unix_time) {
+      if (unix_time < transitions_[hint].unix_time) {
+        return LocalTime(unix_time, transitions_[hint - 1]);
+      }
+    }
+  }
+
+  const Transition target = {unix_time, 0, civil_second(), civil_second()};
+  const Transition* begin = &transitions_[0];
+  const Transition* tr = std::upper_bound(begin, begin + timecnt, target,
+                                          Transition::ByUnixTime());
+  local_time_hint_.store(static_cast<std::size_t>(tr - begin),
+                         std::memory_order_relaxed);
+  return LocalTime(unix_time, *--tr);
+}
+
+time_zone::civil_lookup TimeZoneInfo::MakeTime(const civil_second& cs) const {
+  const std::size_t timecnt = transitions_.size();
+  assert(timecnt != 0);  // We always add a transition.
+
+  // Find the first transition after our target civil time.
+  const Transition* tr = nullptr;
+  const Transition* begin = &transitions_[0];
+  const Transition* end = begin + timecnt;
+  if (cs < begin->civil_sec) {
+    tr = begin;
+  } else if (cs >= transitions_[timecnt - 1].civil_sec) {
+    tr = end;
+  } else {
+    const std::size_t hint = time_local_hint_.load(std::memory_order_relaxed);
+    if (0 < hint && hint < timecnt) {
+      if (transitions_[hint - 1].civil_sec <= cs) {
+        if (cs < transitions_[hint].civil_sec) {
+          tr = begin + hint;
+        }
+      }
+    }
+    if (tr == nullptr) {
+      const Transition target = {0, 0, cs, civil_second()};
+      tr = std::upper_bound(begin, end, target, Transition::ByCivilTime());
+      time_local_hint_.store(static_cast<std::size_t>(tr - begin),
+                             std::memory_order_relaxed);
+    }
+  }
+
+  if (tr == begin) {
+    if (tr->prev_civil_sec >= cs) {
+      // Before first transition, so use the default offset.
+      const TransitionType& tt(transition_types_[default_transition_type_]);
+      if (cs < tt.civil_min) return MakeUnique(time_point<seconds>::min());
+      return MakeUnique(cs - (civil_second() + tt.utc_offset));
+    }
+    // tr->prev_civil_sec < cs < tr->civil_sec
+    return MakeSkipped(*tr, cs);
+  }
+
+  if (tr == end) {
+    if (cs > (--tr)->prev_civil_sec) {
+      // After the last transition. If we extended the transitions using
+      // future_spec_, shift back to a supported year using the 400-year
+      // cycle of calendaric equivalence and then compensate accordingly.
+      if (extended_ && cs.year() > last_year_) {
+        const year_t shift = (cs.year() - last_year_ - 1) / 400 + 1;
+        return TimeLocal(YearShift(cs, shift * -400), shift);
+      }
+      const TransitionType& tt(transition_types_[tr->type_index]);
+      if (cs > tt.civil_max) return MakeUnique(time_point<seconds>::max());
+      return MakeUnique(tr->unix_time + (cs - tr->civil_sec));
+    }
+    // tr->civil_sec <= cs <= tr->prev_civil_sec
+    return MakeRepeated(*tr, cs);
+  }
+
+  if (tr->prev_civil_sec < cs) {
+    // tr->prev_civil_sec < cs < tr->civil_sec
+    return MakeSkipped(*tr, cs);
+  }
+
+  if (cs <= (--tr)->prev_civil_sec) {
+    // tr->civil_sec <= cs <= tr->prev_civil_sec
+    return MakeRepeated(*tr, cs);
+  }
+
+  // In between transitions.
+  return MakeUnique(tr->unix_time + (cs - tr->civil_sec));
+}
+
+std::string TimeZoneInfo::Version() const {
+  return version_;
+}
+
+std::string TimeZoneInfo::Description() const {
+  std::ostringstream oss;
+  oss << "#trans=" << transitions_.size();
+  oss << " #types=" << transition_types_.size();
+  oss << " spec='" << future_spec_ << "'";
+  return oss.str();
+}
+
+bool TimeZoneInfo::NextTransition(const time_point<seconds>& tp,
+                                  time_zone::civil_transition* trans) const {
+  if (transitions_.empty()) return false;
+  const Transition* begin = &transitions_[0];
+  const Transition* end = begin + transitions_.size();
+  if (begin->unix_time <= -(1LL << 59)) {
+    // Do not report the BIG_BANG found in recent zoneinfo data as it is
+    // really a sentinel, not a transition.  See tz/zic.c.
+    ++begin;
+  }
+  std::int_fast64_t unix_time = ToUnixSeconds(tp);
+  const Transition target = {unix_time, 0, civil_second(), civil_second()};
+  const Transition* tr = std::upper_bound(begin, end, target,
+                                          Transition::ByUnixTime());
+  for (; tr != end; ++tr) {  // skip no-op transitions
+    std::uint_fast8_t prev_type_index =
+        (tr == begin) ? default_transition_type_ : tr[-1].type_index;
+    if (!EquivTransitions(prev_type_index, tr[0].type_index)) break;
+  }
+  // When tr == end we return false, ignoring future_spec_.
+  if (tr == end) return false;
+  trans->from = tr->prev_civil_sec + 1;
+  trans->to = tr->civil_sec;
+  return true;
+}
+
+bool TimeZoneInfo::PrevTransition(const time_point<seconds>& tp,
+                                  time_zone::civil_transition* trans) const {
+  if (transitions_.empty()) return false;
+  const Transition* begin = &transitions_[0];
+  const Transition* end = begin + transitions_.size();
+  if (begin->unix_time <= -(1LL << 59)) {
+    // Do not report the BIG_BANG found in recent zoneinfo data as it is
+    // really a sentinel, not a transition.  See tz/zic.c.
+    ++begin;
+  }
+  std::int_fast64_t unix_time = ToUnixSeconds(tp);
+  if (FromUnixSeconds(unix_time) != tp) {
+    if (unix_time == std::numeric_limits<std::int_fast64_t>::max()) {
+      if (end == begin) return false;  // Ignore future_spec_.
+      trans->from = (--end)->prev_civil_sec + 1;
+      trans->to = end->civil_sec;
+      return true;
+    }
+    unix_time += 1;  // ceils
+  }
+  const Transition target = {unix_time, 0, civil_second(), civil_second()};
+  const Transition* tr = std::lower_bound(begin, end, target,
+                                          Transition::ByUnixTime());
+  for (; tr != begin; --tr) {  // skip no-op transitions
+    std::uint_fast8_t prev_type_index =
+        (tr - 1 == begin) ? default_transition_type_ : tr[-2].type_index;
+    if (!EquivTransitions(prev_type_index, tr[-1].type_index)) break;
+  }
+  // When tr == end we return the "last" transition, ignoring future_spec_.
+  if (tr == begin) return false;
+  trans->from = (--tr)->prev_civil_sec + 1;
+  trans->to = tr->civil_sec;
+  return true;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_info.h b/absl/time/internal/cctz/src/time_zone_info.h
new file mode 100644
index 0000000..81cd402
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_info.h
@@ -0,0 +1,136 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
+
+#include <atomic>
+#include <cstddef>
+#include <cstdint>
+#include <string>
+#include <vector>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+#include "time_zone_if.h"
+#include "tzfile.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// A transition to a new UTC offset.
+struct Transition {
+  std::int_least64_t unix_time;   // the instant of this transition
+  std::uint_least8_t type_index;  // index of the transition type
+  civil_second civil_sec;         // local civil time of transition
+  civil_second prev_civil_sec;    // local civil time one second earlier
+
+  struct ByUnixTime {
+    inline bool operator()(const Transition& lhs, const Transition& rhs) const {
+      return lhs.unix_time < rhs.unix_time;
+    }
+  };
+  struct ByCivilTime {
+    inline bool operator()(const Transition& lhs, const Transition& rhs) const {
+      return lhs.civil_sec < rhs.civil_sec;
+    }
+  };
+};
+
+// The characteristics of a particular transition.
+struct TransitionType {
+  std::int_least32_t utc_offset;  // the new prevailing UTC offset
+  civil_second civil_max;         // max convertible civil time for offset
+  civil_second civil_min;         // min convertible civil time for offset
+  bool is_dst;                    // did we move into daylight-saving time
+  std::uint_least8_t abbr_index;  // index of the new abbreviation
+};
+
+// A time zone backed by the IANA Time Zone Database (zoneinfo).
+class TimeZoneInfo : public TimeZoneIf {
+ public:
+  TimeZoneInfo() = default;
+  TimeZoneInfo(const TimeZoneInfo&) = delete;
+  TimeZoneInfo& operator=(const TimeZoneInfo&) = delete;
+
+  // Loads the zoneinfo for the given name, returning true if successful.
+  bool Load(const std::string& name);
+
+  // TimeZoneIf implementations.
+  time_zone::absolute_lookup BreakTime(
+      const time_point<seconds>& tp) const override;
+  time_zone::civil_lookup MakeTime(
+      const civil_second& cs) const override;
+  bool NextTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const override;
+  bool PrevTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const override;
+  std::string Version() const override;
+  std::string Description() const override;
+
+ private:
+  struct Header {  // counts of:
+    std::size_t timecnt;     // transition times
+    std::size_t typecnt;     // transition types
+    std::size_t charcnt;     // zone abbreviation characters
+    std::size_t leapcnt;     // leap seconds (we expect none)
+    std::size_t ttisstdcnt;  // UTC/local indicators (unused)
+    std::size_t ttisutcnt;   // standard/wall indicators (unused)
+
+    bool Build(const tzhead& tzh);
+    std::size_t DataLength(std::size_t time_len) const;
+  };
+
+  void CheckTransition(const std::string& name, const TransitionType& tt,
+                       std::int_fast32_t offset, bool is_dst,
+                       const std::string& abbr) const;
+  bool EquivTransitions(std::uint_fast8_t tt1_index,
+                        std::uint_fast8_t tt2_index) const;
+  void ExtendTransitions(const std::string& name, const Header& hdr);
+
+  bool ResetToBuiltinUTC(const seconds& offset);
+  bool Load(const std::string& name, ZoneInfoSource* zip);
+
+  // Helpers for BreakTime() and MakeTime().
+  time_zone::absolute_lookup LocalTime(std::int_fast64_t unix_time,
+                                       const TransitionType& tt) const;
+  time_zone::absolute_lookup LocalTime(std::int_fast64_t unix_time,
+                                       const Transition& tr) const;
+  time_zone::civil_lookup TimeLocal(const civil_second& cs,
+                                    year_t c4_shift) const;
+
+  std::vector<Transition> transitions_;  // ordered by unix_time and civil_sec
+  std::vector<TransitionType> transition_types_;  // distinct transition types
+  std::uint_fast8_t default_transition_type_;  // for before first transition
+  std::string abbreviations_;  // all the NUL-terminated abbreviations
+
+  std::string version_;      // the tzdata version if available
+  std::string future_spec_;  // for after the last zic transition
+  bool extended_;            // future_spec_ was used to generate transitions
+  year_t last_year_;         // the final year of the generated transitions
+
+  // We remember the transitions found during the last BreakTime() and
+  // MakeTime() calls. If the next request is for the same transition we
+  // will avoid re-searching.
+  mutable std::atomic<std::size_t> local_time_hint_ = {};  // BreakTime() hint
+  mutable std::atomic<std::size_t> time_local_hint_ = {};  // MakeTime() hint
+};
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
diff --git a/absl/time/internal/cctz/src/time_zone_libc.cc b/absl/time/internal/cctz/src/time_zone_libc.cc
new file mode 100644
index 0000000..6095e76
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_libc.cc
@@ -0,0 +1,307 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#if defined(_WIN32) || defined(_WIN64)
+#define _CRT_SECURE_NO_WARNINGS 1
+#endif
+
+#include "time_zone_libc.h"
+
+#include <chrono>
+#include <ctime>
+#include <limits>
+#include <utility>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+#if defined(_WIN32) || defined(_WIN64)
+// Uses the globals: '_timezone', '_dstbias' and '_tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(_timezone + _dstbias) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return _timezone + (is_dst ? _dstbias : 0);
+}
+auto tm_zone(const std::tm& tm) -> decltype(_tzname[0]) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return _tzname[is_dst];
+}
+#elif defined(__sun)
+// Uses the globals: 'timezone', 'altzone' and 'tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(timezone) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return is_dst ? altzone : timezone;
+}
+auto tm_zone(const std::tm& tm) -> decltype(tzname[0]) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return tzname[is_dst];
+}
+#elif defined(__native_client__) || defined(__myriad2__) || \
+    defined(__EMSCRIPTEN__)
+// Uses the globals: 'timezone' and 'tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(_timezone + 0) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return _timezone + (is_dst ? 60 * 60 : 0);
+}
+auto tm_zone(const std::tm& tm) -> decltype(tzname[0]) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return tzname[is_dst];
+}
+#else
+// Adapt to different spellings of the struct std::tm extension fields.
+#if defined(tm_gmtoff)
+auto tm_gmtoff(const std::tm& tm) -> decltype(tm.tm_gmtoff) {
+  return tm.tm_gmtoff;
+}
+#elif defined(__tm_gmtoff)
+auto tm_gmtoff(const std::tm& tm) -> decltype(tm.__tm_gmtoff) {
+  return tm.__tm_gmtoff;
+}
+#else
+template <typename T>
+auto tm_gmtoff(const T& tm) -> decltype(tm.tm_gmtoff) {
+  return tm.tm_gmtoff;
+}
+template <typename T>
+auto tm_gmtoff(const T& tm) -> decltype(tm.__tm_gmtoff) {
+  return tm.__tm_gmtoff;
+}
+#endif  // tm_gmtoff
+#if defined(tm_zone)
+auto tm_zone(const std::tm& tm) -> decltype(tm.tm_zone) {
+  return tm.tm_zone;
+}
+#elif defined(__tm_zone)
+auto tm_zone(const std::tm& tm) -> decltype(tm.__tm_zone) {
+  return tm.__tm_zone;
+}
+#else
+template <typename T>
+auto tm_zone(const T& tm) -> decltype(tm.tm_zone) {
+  return tm.tm_zone;
+}
+template <typename T>
+auto tm_zone(const T& tm) -> decltype(tm.__tm_zone) {
+  return tm.__tm_zone;
+}
+#endif  // tm_zone
+#endif
+
+inline std::tm* gm_time(const std::time_t *timep, std::tm *result) {
+#if defined(_WIN32) || defined(_WIN64)
+    return gmtime_s(result, timep) ? nullptr : result;
+#else
+    return gmtime_r(timep, result);
+#endif
+}
+
+inline std::tm* local_time(const std::time_t *timep, std::tm *result) {
+#if defined(_WIN32) || defined(_WIN64)
+    return localtime_s(result, timep) ? nullptr : result;
+#else
+    return localtime_r(timep, result);
+#endif
+}
+
+// Converts a civil second and "dst" flag into a time_t and UTC offset.
+// Returns false if time_t cannot represent the requested civil second.
+// Caller must have already checked that cs.year() will fit into a tm_year.
+bool make_time(const civil_second& cs, int is_dst, std::time_t* t, int* off) {
+  std::tm tm;
+  tm.tm_year = static_cast<int>(cs.year() - year_t{1900});
+  tm.tm_mon = cs.month() - 1;
+  tm.tm_mday = cs.day();
+  tm.tm_hour = cs.hour();
+  tm.tm_min = cs.minute();
+  tm.tm_sec = cs.second();
+  tm.tm_isdst = is_dst;
+  *t = std::mktime(&tm);
+  if (*t == std::time_t{-1}) {
+    std::tm tm2;
+    const std::tm* tmp = local_time(t, &tm2);
+    if (tmp == nullptr || tmp->tm_year != tm.tm_year ||
+        tmp->tm_mon != tm.tm_mon || tmp->tm_mday != tm.tm_mday ||
+        tmp->tm_hour != tm.tm_hour || tmp->tm_min != tm.tm_min ||
+        tmp->tm_sec != tm.tm_sec) {
+      // A true error (not just one second before the epoch).
+      return false;
+    }
+  }
+  *off = static_cast<int>(tm_gmtoff(tm));
+  return true;
+}
+
+// Find the least time_t in [lo:hi] where local time matches offset, given:
+// (1) lo doesn't match, (2) hi does, and (3) there is only one transition.
+std::time_t find_trans(std::time_t lo, std::time_t hi, int offset) {
+  std::tm tm;
+  while (lo + 1 != hi) {
+    const std::time_t mid = lo + (hi - lo) / 2;
+    if (std::tm* tmp = local_time(&mid, &tm)) {
+      if (tm_gmtoff(*tmp) == offset) {
+        hi = mid;
+      } else {
+        lo = mid;
+      }
+    } else {
+      // If std::tm cannot hold some result we resort to a linear search,
+      // ignoring all failed conversions.  Slow, but never really happens.
+      while (++lo != hi) {
+        if (std::tm* tmp = local_time(&lo, &tm)) {
+          if (tm_gmtoff(*tmp) == offset) break;
+        }
+      }
+      return lo;
+    }
+  }
+  return hi;
+}
+
+}  // namespace
+
+TimeZoneLibC::TimeZoneLibC(const std::string& name)
+    : local_(name == "localtime") {}
+
+time_zone::absolute_lookup TimeZoneLibC::BreakTime(
+    const time_point<seconds>& tp) const {
+  time_zone::absolute_lookup al;
+  al.offset = 0;
+  al.is_dst = false;
+  al.abbr = "-00";
+
+  const std::int_fast64_t s = ToUnixSeconds(tp);
+
+  // If std::time_t cannot hold the input we saturate the output.
+  if (s < std::numeric_limits<std::time_t>::min()) {
+    al.cs = civil_second::min();
+    return al;
+  }
+  if (s > std::numeric_limits<std::time_t>::max()) {
+    al.cs = civil_second::max();
+    return al;
+  }
+
+  const std::time_t t = static_cast<std::time_t>(s);
+  std::tm tm;
+  std::tm* tmp = local_ ? local_time(&t, &tm) : gm_time(&t, &tm);
+
+  // If std::tm cannot hold the result we saturate the output.
+  if (tmp == nullptr) {
+    al.cs = (s < 0) ? civil_second::min() : civil_second::max();
+    return al;
+  }
+
+  const year_t year = tmp->tm_year + year_t{1900};
+  al.cs = civil_second(year, tmp->tm_mon + 1, tmp->tm_mday,
+                       tmp->tm_hour, tmp->tm_min, tmp->tm_sec);
+  al.offset = static_cast<int>(tm_gmtoff(*tmp));
+  al.abbr = local_ ? tm_zone(*tmp) : "UTC";  // as expected by cctz
+  al.is_dst = tmp->tm_isdst > 0;
+  return al;
+}
+
+time_zone::civil_lookup TimeZoneLibC::MakeTime(const civil_second& cs) const {
+  if (!local_) {
+    // If time_point<seconds> cannot hold the result we saturate.
+    static const civil_second min_tp_cs =
+        civil_second() + ToUnixSeconds(time_point<seconds>::min());
+    static const civil_second max_tp_cs =
+        civil_second() + ToUnixSeconds(time_point<seconds>::max());
+    const time_point<seconds> tp =
+        (cs < min_tp_cs)
+            ? time_point<seconds>::min()
+            : (cs > max_tp_cs) ? time_point<seconds>::max()
+                               : FromUnixSeconds(cs - civil_second());
+    return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+  }
+
+  // If tm_year cannot hold the requested year we saturate the result.
+  if (cs.year() < 0) {
+    if (cs.year() < std::numeric_limits<int>::min() + year_t{1900}) {
+      const time_point<seconds> tp = time_point<seconds>::min();
+      return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+    }
+  } else {
+    if (cs.year() - year_t{1900} > std::numeric_limits<int>::max()) {
+      const time_point<seconds> tp = time_point<seconds>::max();
+      return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+    }
+  }
+
+  // We probe with "is_dst" values of 0 and 1 to try to distinguish unique
+  // civil seconds from skipped or repeated ones.  This is not always possible
+  // however, as the "dst" flag does not change over some offset transitions.
+  // We are also subject to the vagaries of mktime() implementations.
+  std::time_t t0, t1;
+  int offset0, offset1;
+  if (make_time(cs, 0, &t0, &offset0) && make_time(cs, 1, &t1, &offset1)) {
+    if (t0 == t1) {
+      // The civil time was singular (pre == trans == post).
+      const time_point<seconds> tp = FromUnixSeconds(t0);
+      return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+    }
+
+    if (t0 > t1) {
+      std::swap(t0, t1);
+      std::swap(offset0, offset1);
+    }
+    const std::time_t tt = find_trans(t0, t1, offset1);
+    const time_point<seconds> trans = FromUnixSeconds(tt);
+
+    if (offset0 < offset1) {
+      // The civil time did not exist (pre >= trans > post).
+      const time_point<seconds> pre = FromUnixSeconds(t1);
+      const time_point<seconds> post = FromUnixSeconds(t0);
+      return {time_zone::civil_lookup::SKIPPED, pre, trans, post};
+    }
+
+    // The civil time was ambiguous (pre < trans <= post).
+    const time_point<seconds> pre = FromUnixSeconds(t0);
+    const time_point<seconds> post = FromUnixSeconds(t1);
+    return {time_zone::civil_lookup::REPEATED, pre, trans, post};
+  }
+
+  // make_time() failed somehow so we saturate the result.
+  const time_point<seconds> tp = (cs < civil_second())
+                                     ? time_point<seconds>::min()
+                                     : time_point<seconds>::max();
+  return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+}
+
+bool TimeZoneLibC::NextTransition(const time_point<seconds>&,
+                                  time_zone::civil_transition*) const {
+  return false;
+}
+
+bool TimeZoneLibC::PrevTransition(const time_point<seconds>&,
+                                  time_zone::civil_transition*) const {
+  return false;
+}
+
+std::string TimeZoneLibC::Version() const {
+  return std::string();  // unknown
+}
+
+std::string TimeZoneLibC::Description() const {
+  return local_ ? "localtime" : "UTC";
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_libc.h b/absl/time/internal/cctz/src/time_zone_libc.h
new file mode 100644
index 0000000..0d18e9a
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_libc.h
@@ -0,0 +1,53 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
+
+#include <string>
+
+#include "time_zone_if.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// A time zone backed by gmtime_r(3), localtime_r(3), and mktime(3),
+// and which therefore only supports UTC and the local time zone.
+// TODO: Add support for fixed offsets from UTC.
+class TimeZoneLibC : public TimeZoneIf {
+ public:
+  explicit TimeZoneLibC(const std::string& name);
+
+  // TimeZoneIf implementations.
+  time_zone::absolute_lookup BreakTime(
+      const time_point<seconds>& tp) const override;
+  time_zone::civil_lookup MakeTime(
+      const civil_second& cs) const override;
+  bool NextTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const override;
+  bool PrevTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const override;
+  std::string Version() const override;
+  std::string Description() const override;
+
+ private:
+  const bool local_;  // localtime or UTC
+};
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
diff --git a/absl/time/internal/cctz/src/time_zone_lookup.cc b/absl/time/internal/cctz/src/time_zone_lookup.cc
new file mode 100644
index 0000000..3c53dd1
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_lookup.cc
@@ -0,0 +1,187 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+#if defined(__ANDROID__)
+#include <sys/system_properties.h>
+#if defined(__ANDROID_API__) && __ANDROID_API__ >= 21
+#include <dlfcn.h>
+#endif
+#endif
+
+#if defined(__APPLE__)
+#include <CoreFoundation/CFTimeZone.h>
+#include <vector>
+#endif
+
+#include <cstdlib>
+#include <cstring>
+#include <string>
+
+#include "time_zone_fixed.h"
+#include "time_zone_impl.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+#if defined(__ANDROID__) && defined(__ANDROID_API__) && __ANDROID_API__ >= 21
+namespace {
+// Android 'L' removes __system_property_get() from the NDK, however
+// it is still a hidden symbol in libc so we use dlsym() to access it.
+// See Chromium's base/sys_info_android.cc for a similar example.
+
+using property_get_func = int (*)(const char*, char*);
+
+property_get_func LoadSystemPropertyGet() {
+  int flag = RTLD_LAZY | RTLD_GLOBAL;
+#if defined(RTLD_NOLOAD)
+  flag |= RTLD_NOLOAD;  // libc.so should already be resident
+#endif
+  if (void* handle = dlopen("libc.so", flag)) {
+    void* sym = dlsym(handle, "__system_property_get");
+    dlclose(handle);
+    return reinterpret_cast<property_get_func>(sym);
+  }
+  return nullptr;
+}
+
+int __system_property_get(const char* name, char* value) {
+  static property_get_func system_property_get = LoadSystemPropertyGet();
+  return system_property_get ? system_property_get(name, value) : -1;
+}
+
+}  // namespace
+#endif
+
+std::string time_zone::name() const {
+  return effective_impl().Name();
+}
+
+time_zone::absolute_lookup time_zone::lookup(
+    const time_point<seconds>& tp) const {
+  return effective_impl().BreakTime(tp);
+}
+
+time_zone::civil_lookup time_zone::lookup(const civil_second& cs) const {
+  return effective_impl().MakeTime(cs);
+}
+
+bool time_zone::next_transition(const time_point<seconds>& tp,
+                                civil_transition* trans) const {
+  return effective_impl().NextTransition(tp, trans);
+}
+
+bool time_zone::prev_transition(const time_point<seconds>& tp,
+                                civil_transition* trans) const {
+  return effective_impl().PrevTransition(tp, trans);
+}
+
+std::string time_zone::version() const {
+  return effective_impl().Version();
+}
+
+std::string time_zone::description() const {
+  return effective_impl().Description();
+}
+
+const time_zone::Impl& time_zone::effective_impl() const {
+  if (impl_ == nullptr) {
+    // Dereferencing an implicit-UTC time_zone is expected to be
+    // rare, so we don't mind paying a small synchronization cost.
+    return *time_zone::Impl::UTC().impl_;
+  }
+  return *impl_;
+}
+
+bool load_time_zone(const std::string& name, time_zone* tz) {
+  return time_zone::Impl::LoadTimeZone(name, tz);
+}
+
+time_zone utc_time_zone() {
+  return time_zone::Impl::UTC();  // avoid name lookup
+}
+
+time_zone fixed_time_zone(const seconds& offset) {
+  time_zone tz;
+  load_time_zone(FixedOffsetToName(offset), &tz);
+  return tz;
+}
+
+time_zone local_time_zone() {
+  const char* zone = ":localtime";
+#if defined(__ANDROID__)
+  char sysprop[PROP_VALUE_MAX];
+  if (__system_property_get("persist.sys.timezone", sysprop) > 0) {
+    zone = sysprop;
+  }
+#endif
+#if defined(__APPLE__)
+  std::vector<char> buffer;
+  CFTimeZoneRef tz_default = CFTimeZoneCopyDefault();
+  if (CFStringRef tz_name = CFTimeZoneGetName(tz_default)) {
+    CFStringEncoding encoding = kCFStringEncodingUTF8;
+    CFIndex length = CFStringGetLength(tz_name);
+    buffer.resize(CFStringGetMaximumSizeForEncoding(length, encoding) + 1);
+    if (CFStringGetCString(tz_name, &buffer[0], buffer.size(), encoding)) {
+      zone = &buffer[0];
+    }
+  }
+  CFRelease(tz_default);
+#endif
+
+  // Allow ${TZ} to override to default zone.
+  char* tz_env = nullptr;
+#if defined(_MSC_VER)
+  _dupenv_s(&tz_env, nullptr, "TZ");
+#else
+  tz_env = std::getenv("TZ");
+#endif
+  if (tz_env) zone = tz_env;
+
+  // We only support the "[:]<zone-name>" form.
+  if (*zone == ':') ++zone;
+
+  // Map "localtime" to a system-specific name, but
+  // allow ${LOCALTIME} to override the default name.
+  char* localtime_env = nullptr;
+  if (strcmp(zone, "localtime") == 0) {
+#if defined(_MSC_VER)
+    // System-specific default is just "localtime".
+    _dupenv_s(&localtime_env, nullptr, "LOCALTIME");
+#else
+    zone = "/etc/localtime";  // System-specific default.
+    localtime_env = std::getenv("LOCALTIME");
+#endif
+    if (localtime_env) zone = localtime_env;
+  }
+
+  const std::string name = zone;
+#if defined(_MSC_VER)
+  free(localtime_env);
+  free(tz_env);
+#endif
+
+  time_zone tz;
+  load_time_zone(name, &tz);  // Falls back to UTC.
+  // TODO: Follow the RFC3339 "Unknown Local Offset Convention" and
+  // arrange for %z to generate "-0000" when we don't know the local
+  // offset because the load_time_zone() failed and we're using UTC.
+  return tz;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_lookup_test.cc b/absl/time/internal/cctz/src/time_zone_lookup_test.cc
new file mode 100644
index 0000000..42dd6d5
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_lookup_test.cc
@@ -0,0 +1,1436 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+#include <chrono>
+#include <cstddef>
+#include <cstdlib>
+#include <future>
+#include <limits>
+#include <string>
+#include <thread>
+#include <vector>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "gtest/gtest.h"
+
+namespace chrono = std::chrono;
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// A list of known time-zone names.
+const char* const kTimeZoneNames[] = {
+  "Africa/Abidjan",
+  "Africa/Accra",
+  "Africa/Addis_Ababa",
+  "Africa/Algiers",
+  "Africa/Asmara",
+  "Africa/Asmera",
+  "Africa/Bamako",
+  "Africa/Bangui",
+  "Africa/Banjul",
+  "Africa/Bissau",
+  "Africa/Blantyre",
+  "Africa/Brazzaville",
+  "Africa/Bujumbura",
+  "Africa/Cairo",
+  "Africa/Casablanca",
+  "Africa/Ceuta",
+  "Africa/Conakry",
+  "Africa/Dakar",
+  "Africa/Dar_es_Salaam",
+  "Africa/Djibouti",
+  "Africa/Douala",
+  "Africa/El_Aaiun",
+  "Africa/Freetown",
+  "Africa/Gaborone",
+  "Africa/Harare",
+  "Africa/Johannesburg",
+  "Africa/Juba",
+  "Africa/Kampala",
+  "Africa/Khartoum",
+  "Africa/Kigali",
+  "Africa/Kinshasa",
+  "Africa/Lagos",
+  "Africa/Libreville",
+  "Africa/Lome",
+  "Africa/Luanda",
+  "Africa/Lubumbashi",
+  "Africa/Lusaka",
+  "Africa/Malabo",
+  "Africa/Maputo",
+  "Africa/Maseru",
+  "Africa/Mbabane",
+  "Africa/Mogadishu",
+  "Africa/Monrovia",
+  "Africa/Nairobi",
+  "Africa/Ndjamena",
+  "Africa/Niamey",
+  "Africa/Nouakchott",
+  "Africa/Ouagadougou",
+  "Africa/Porto-Novo",
+  "Africa/Sao_Tome",
+  "Africa/Timbuktu",
+  "Africa/Tripoli",
+  "Africa/Tunis",
+  "Africa/Windhoek",
+  "America/Adak",
+  "America/Anchorage",
+  "America/Anguilla",
+  "America/Antigua",
+  "America/Araguaina",
+  "America/Argentina/Buenos_Aires",
+  "America/Argentina/Catamarca",
+  "America/Argentina/ComodRivadavia",
+  "America/Argentina/Cordoba",
+  "America/Argentina/Jujuy",
+  "America/Argentina/La_Rioja",
+  "America/Argentina/Mendoza",
+  "America/Argentina/Rio_Gallegos",
+  "America/Argentina/Salta",
+  "America/Argentina/San_Juan",
+  "America/Argentina/San_Luis",
+  "America/Argentina/Tucuman",
+  "America/Argentina/Ushuaia",
+  "America/Aruba",
+  "America/Asuncion",
+  "America/Atikokan",
+  "America/Atka",
+  "America/Bahia",
+  "America/Bahia_Banderas",
+  "America/Barbados",
+  "America/Belem",
+  "America/Belize",
+  "America/Blanc-Sablon",
+  "America/Boa_Vista",
+  "America/Bogota",
+  "America/Boise",
+  "America/Buenos_Aires",
+  "America/Cambridge_Bay",
+  "America/Campo_Grande",
+  "America/Cancun",
+  "America/Caracas",
+  "America/Catamarca",
+  "America/Cayenne",
+  "America/Cayman",
+  "America/Chicago",
+  "America/Chihuahua",
+  "America/Coral_Harbour",
+  "America/Cordoba",
+  "America/Costa_Rica",
+  "America/Creston",
+  "America/Cuiaba",
+  "America/Curacao",
+  "America/Danmarkshavn",
+  "America/Dawson",
+  "America/Dawson_Creek",
+  "America/Denver",
+  "America/Detroit",
+  "America/Dominica",
+  "America/Edmonton",
+  "America/Eirunepe",
+  "America/El_Salvador",
+  "America/Ensenada",
+  "America/Fort_Nelson",
+  "America/Fort_Wayne",
+  "America/Fortaleza",
+  "America/Glace_Bay",
+  "America/Godthab",
+  "America/Goose_Bay",
+  "America/Grand_Turk",
+  "America/Grenada",
+  "America/Guadeloupe",
+  "America/Guatemala",
+  "America/Guayaquil",
+  "America/Guyana",
+  "America/Halifax",
+  "America/Havana",
+  "America/Hermosillo",
+  "America/Indiana/Indianapolis",
+  "America/Indiana/Knox",
+  "America/Indiana/Marengo",
+  "America/Indiana/Petersburg",
+  "America/Indiana/Tell_City",
+  "America/Indiana/Vevay",
+  "America/Indiana/Vincennes",
+  "America/Indiana/Winamac",
+  "America/Indianapolis",
+  "America/Inuvik",
+  "America/Iqaluit",
+  "America/Jamaica",
+  "America/Jujuy",
+  "America/Juneau",
+  "America/Kentucky/Louisville",
+  "America/Kentucky/Monticello",
+  "America/Knox_IN",
+  "America/Kralendijk",
+  "America/La_Paz",
+  "America/Lima",
+  "America/Los_Angeles",
+  "America/Louisville",
+  "America/Lower_Princes",
+  "America/Maceio",
+  "America/Managua",
+  "America/Manaus",
+  "America/Marigot",
+  "America/Martinique",
+  "America/Matamoros",
+  "America/Mazatlan",
+  "America/Mendoza",
+  "America/Menominee",
+  "America/Merida",
+  "America/Metlakatla",
+  "America/Mexico_City",
+  "America/Miquelon",
+  "America/Moncton",
+  "America/Monterrey",
+  "America/Montevideo",
+  "America/Montreal",
+  "America/Montserrat",
+  "America/Nassau",
+  "America/New_York",
+  "America/Nipigon",
+  "America/Nome",
+  "America/Noronha",
+  "America/North_Dakota/Beulah",
+  "America/North_Dakota/Center",
+  "America/North_Dakota/New_Salem",
+  "America/Ojinaga",
+  "America/Panama",
+  "America/Pangnirtung",
+  "America/Paramaribo",
+  "America/Phoenix",
+  "America/Port-au-Prince",
+  "America/Port_of_Spain",
+  "America/Porto_Acre",
+  "America/Porto_Velho",
+  "America/Puerto_Rico",
+  "America/Punta_Arenas",
+  "America/Rainy_River",
+  "America/Rankin_Inlet",
+  "America/Recife",
+  "America/Regina",
+  "America/Resolute",
+  "America/Rio_Branco",
+  "America/Rosario",
+  "America/Santa_Isabel",
+  "America/Santarem",
+  "America/Santiago",
+  "America/Santo_Domingo",
+  "America/Sao_Paulo",
+  "America/Scoresbysund",
+  "America/Shiprock",
+  "America/Sitka",
+  "America/St_Barthelemy",
+  "America/St_Johns",
+  "America/St_Kitts",
+  "America/St_Lucia",
+  "America/St_Thomas",
+  "America/St_Vincent",
+  "America/Swift_Current",
+  "America/Tegucigalpa",
+  "America/Thule",
+  "America/Thunder_Bay",
+  "America/Tijuana",
+  "America/Toronto",
+  "America/Tortola",
+  "America/Vancouver",
+  "America/Virgin",
+  "America/Whitehorse",
+  "America/Winnipeg",
+  "America/Yakutat",
+  "America/Yellowknife",
+  "Antarctica/Casey",
+  "Antarctica/Davis",
+  "Antarctica/DumontDUrville",
+  "Antarctica/Macquarie",
+  "Antarctica/Mawson",
+  "Antarctica/McMurdo",
+  "Antarctica/Palmer",
+  "Antarctica/Rothera",
+  "Antarctica/South_Pole",
+  "Antarctica/Syowa",
+  "Antarctica/Troll",
+  "Antarctica/Vostok",
+  "Arctic/Longyearbyen",
+  "Asia/Aden",
+  "Asia/Almaty",
+  "Asia/Amman",
+  "Asia/Anadyr",
+  "Asia/Aqtau",
+  "Asia/Aqtobe",
+  "Asia/Ashgabat",
+  "Asia/Ashkhabad",
+  "Asia/Atyrau",
+  "Asia/Baghdad",
+  "Asia/Bahrain",
+  "Asia/Baku",
+  "Asia/Bangkok",
+  "Asia/Barnaul",
+  "Asia/Beirut",
+  "Asia/Bishkek",
+  "Asia/Brunei",
+  "Asia/Calcutta",
+  "Asia/Chita",
+  "Asia/Choibalsan",
+  "Asia/Chongqing",
+  "Asia/Chungking",
+  "Asia/Colombo",
+  "Asia/Dacca",
+  "Asia/Damascus",
+  "Asia/Dhaka",
+  "Asia/Dili",
+  "Asia/Dubai",
+  "Asia/Dushanbe",
+  "Asia/Famagusta",
+  "Asia/Gaza",
+  "Asia/Harbin",
+  "Asia/Hebron",
+  "Asia/Ho_Chi_Minh",
+  "Asia/Hong_Kong",
+  "Asia/Hovd",
+  "Asia/Irkutsk",
+  "Asia/Istanbul",
+  "Asia/Jakarta",
+  "Asia/Jayapura",
+  "Asia/Jerusalem",
+  "Asia/Kabul",
+  "Asia/Kamchatka",
+  "Asia/Karachi",
+  "Asia/Kashgar",
+  "Asia/Kathmandu",
+  "Asia/Katmandu",
+  "Asia/Khandyga",
+  "Asia/Kolkata",
+  "Asia/Krasnoyarsk",
+  "Asia/Kuala_Lumpur",
+  "Asia/Kuching",
+  "Asia/Kuwait",
+  "Asia/Macao",
+  "Asia/Macau",
+  "Asia/Magadan",
+  "Asia/Makassar",
+  "Asia/Manila",
+  "Asia/Muscat",
+  "Asia/Nicosia",
+  "Asia/Novokuznetsk",
+  "Asia/Novosibirsk",
+  "Asia/Omsk",
+  "Asia/Oral",
+  "Asia/Phnom_Penh",
+  "Asia/Pontianak",
+  "Asia/Pyongyang",
+  "Asia/Qatar",
+  "Asia/Qostanay",
+  "Asia/Qyzylorda",
+  "Asia/Rangoon",
+  "Asia/Riyadh",
+  "Asia/Saigon",
+  "Asia/Sakhalin",
+  "Asia/Samarkand",
+  "Asia/Seoul",
+  "Asia/Shanghai",
+  "Asia/Singapore",
+  "Asia/Srednekolymsk",
+  "Asia/Taipei",
+  "Asia/Tashkent",
+  "Asia/Tbilisi",
+  "Asia/Tehran",
+  "Asia/Tel_Aviv",
+  "Asia/Thimbu",
+  "Asia/Thimphu",
+  "Asia/Tokyo",
+  "Asia/Tomsk",
+  "Asia/Ujung_Pandang",
+  "Asia/Ulaanbaatar",
+  "Asia/Ulan_Bator",
+  "Asia/Urumqi",
+  "Asia/Ust-Nera",
+  "Asia/Vientiane",
+  "Asia/Vladivostok",
+  "Asia/Yakutsk",
+  "Asia/Yangon",
+  "Asia/Yekaterinburg",
+  "Asia/Yerevan",
+  "Atlantic/Azores",
+  "Atlantic/Bermuda",
+  "Atlantic/Canary",
+  "Atlantic/Cape_Verde",
+  "Atlantic/Faeroe",
+  "Atlantic/Faroe",
+  "Atlantic/Jan_Mayen",
+  "Atlantic/Madeira",
+  "Atlantic/Reykjavik",
+  "Atlantic/South_Georgia",
+  "Atlantic/St_Helena",
+  "Atlantic/Stanley",
+  "Australia/ACT",
+  "Australia/Adelaide",
+  "Australia/Brisbane",
+  "Australia/Broken_Hill",
+  "Australia/Canberra",
+  "Australia/Currie",
+  "Australia/Darwin",
+  "Australia/Eucla",
+  "Australia/Hobart",
+  "Australia/LHI",
+  "Australia/Lindeman",
+  "Australia/Lord_Howe",
+  "Australia/Melbourne",
+  "Australia/NSW",
+  "Australia/North",
+  "Australia/Perth",
+  "Australia/Queensland",
+  "Australia/South",
+  "Australia/Sydney",
+  "Australia/Tasmania",
+  "Australia/Victoria",
+  "Australia/West",
+  "Australia/Yancowinna",
+  "Brazil/Acre",
+  "Brazil/DeNoronha",
+  "Brazil/East",
+  "Brazil/West",
+  "CET",
+  "CST6CDT",
+  "Canada/Atlantic",
+  "Canada/Central",
+  "Canada/Eastern",
+  "Canada/Mountain",
+  "Canada/Newfoundland",
+  "Canada/Pacific",
+  "Canada/Saskatchewan",
+  "Canada/Yukon",
+  "Chile/Continental",
+  "Chile/EasterIsland",
+  "Cuba",
+  "EET",
+  "EST",
+  "EST5EDT",
+  "Egypt",
+  "Eire",
+  "Etc/GMT",
+  "Etc/GMT+0",
+  "Etc/GMT+1",
+  "Etc/GMT+10",
+  "Etc/GMT+11",
+  "Etc/GMT+12",
+  "Etc/GMT+2",
+  "Etc/GMT+3",
+  "Etc/GMT+4",
+  "Etc/GMT+5",
+  "Etc/GMT+6",
+  "Etc/GMT+7",
+  "Etc/GMT+8",
+  "Etc/GMT+9",
+  "Etc/GMT-0",
+  "Etc/GMT-1",
+  "Etc/GMT-10",
+  "Etc/GMT-11",
+  "Etc/GMT-12",
+  "Etc/GMT-13",
+  "Etc/GMT-14",
+  "Etc/GMT-2",
+  "Etc/GMT-3",
+  "Etc/GMT-4",
+  "Etc/GMT-5",
+  "Etc/GMT-6",
+  "Etc/GMT-7",
+  "Etc/GMT-8",
+  "Etc/GMT-9",
+  "Etc/GMT0",
+  "Etc/Greenwich",
+  "Etc/UCT",
+  "Etc/UTC",
+  "Etc/Universal",
+  "Etc/Zulu",
+  "Europe/Amsterdam",
+  "Europe/Andorra",
+  "Europe/Astrakhan",
+  "Europe/Athens",
+  "Europe/Belfast",
+  "Europe/Belgrade",
+  "Europe/Berlin",
+  "Europe/Bratislava",
+  "Europe/Brussels",
+  "Europe/Bucharest",
+  "Europe/Budapest",
+  "Europe/Busingen",
+  "Europe/Chisinau",
+  "Europe/Copenhagen",
+  "Europe/Dublin",
+  "Europe/Gibraltar",
+  "Europe/Guernsey",
+  "Europe/Helsinki",
+  "Europe/Isle_of_Man",
+  "Europe/Istanbul",
+  "Europe/Jersey",
+  "Europe/Kaliningrad",
+  "Europe/Kiev",
+  "Europe/Kirov",
+  "Europe/Lisbon",
+  "Europe/Ljubljana",
+  "Europe/London",
+  "Europe/Luxembourg",
+  "Europe/Madrid",
+  "Europe/Malta",
+  "Europe/Mariehamn",
+  "Europe/Minsk",
+  "Europe/Monaco",
+  "Europe/Moscow",
+  "Europe/Nicosia",
+  "Europe/Oslo",
+  "Europe/Paris",
+  "Europe/Podgorica",
+  "Europe/Prague",
+  "Europe/Riga",
+  "Europe/Rome",
+  "Europe/Samara",
+  "Europe/San_Marino",
+  "Europe/Sarajevo",
+  "Europe/Saratov",
+  "Europe/Simferopol",
+  "Europe/Skopje",
+  "Europe/Sofia",
+  "Europe/Stockholm",
+  "Europe/Tallinn",
+  "Europe/Tirane",
+  "Europe/Tiraspol",
+  "Europe/Ulyanovsk",
+  "Europe/Uzhgorod",
+  "Europe/Vaduz",
+  "Europe/Vatican",
+  "Europe/Vienna",
+  "Europe/Vilnius",
+  "Europe/Volgograd",
+  "Europe/Warsaw",
+  "Europe/Zagreb",
+  "Europe/Zaporozhye",
+  "Europe/Zurich",
+  "GB",
+  "GB-Eire",
+  "GMT",
+  "GMT+0",
+  "GMT-0",
+  "GMT0",
+  "Greenwich",
+  "HST",
+  "Hongkong",
+  "Iceland",
+  "Indian/Antananarivo",
+  "Indian/Chagos",
+  "Indian/Christmas",
+  "Indian/Cocos",
+  "Indian/Comoro",
+  "Indian/Kerguelen",
+  "Indian/Mahe",
+  "Indian/Maldives",
+  "Indian/Mauritius",
+  "Indian/Mayotte",
+  "Indian/Reunion",
+  "Iran",
+  "Israel",
+  "Jamaica",
+  "Japan",
+  "Kwajalein",
+  "Libya",
+  "MET",
+  "MST",
+  "MST7MDT",
+  "Mexico/BajaNorte",
+  "Mexico/BajaSur",
+  "Mexico/General",
+  "NZ",
+  "NZ-CHAT",
+  "Navajo",
+  "PRC",
+  "PST8PDT",
+  "Pacific/Apia",
+  "Pacific/Auckland",
+  "Pacific/Bougainville",
+  "Pacific/Chatham",
+  "Pacific/Chuuk",
+  "Pacific/Easter",
+  "Pacific/Efate",
+  "Pacific/Enderbury",
+  "Pacific/Fakaofo",
+  "Pacific/Fiji",
+  "Pacific/Funafuti",
+  "Pacific/Galapagos",
+  "Pacific/Gambier",
+  "Pacific/Guadalcanal",
+  "Pacific/Guam",
+  "Pacific/Honolulu",
+  "Pacific/Johnston",
+  "Pacific/Kiritimati",
+  "Pacific/Kosrae",
+  "Pacific/Kwajalein",
+  "Pacific/Majuro",
+  "Pacific/Marquesas",
+  "Pacific/Midway",
+  "Pacific/Nauru",
+  "Pacific/Niue",
+  "Pacific/Norfolk",
+  "Pacific/Noumea",
+  "Pacific/Pago_Pago",
+  "Pacific/Palau",
+  "Pacific/Pitcairn",
+  "Pacific/Pohnpei",
+  "Pacific/Ponape",
+  "Pacific/Port_Moresby",
+  "Pacific/Rarotonga",
+  "Pacific/Saipan",
+  "Pacific/Samoa",
+  "Pacific/Tahiti",
+  "Pacific/Tarawa",
+  "Pacific/Tongatapu",
+  "Pacific/Truk",
+  "Pacific/Wake",
+  "Pacific/Wallis",
+  "Pacific/Yap",
+  "Poland",
+  "Portugal",
+  "ROC",
+  "ROK",
+  "Singapore",
+  "Turkey",
+  "UCT",
+  "US/Alaska",
+  "US/Aleutian",
+  "US/Arizona",
+  "US/Central",
+  "US/East-Indiana",
+  "US/Eastern",
+  "US/Hawaii",
+  "US/Indiana-Starke",
+  "US/Michigan",
+  "US/Mountain",
+  "US/Pacific",
+  "US/Samoa",
+  "UTC",
+  "Universal",
+  "W-SU",
+  "WET",
+  "Zulu",
+  nullptr
+};
+
+// Helper to return a loaded time zone by value (UTC on error).
+time_zone LoadZone(const std::string& name) {
+  time_zone tz;
+  load_time_zone(name, &tz);
+  return tz;
+}
+
+// This helper is a macro so that failed expectations show up with the
+// correct line numbers.
+#define ExpectTime(tp, tz, y, m, d, hh, mm, ss, off, isdst, zone) \
+  do {                                                            \
+    time_zone::absolute_lookup al = tz.lookup(tp);                \
+    EXPECT_EQ(y, al.cs.year());                                   \
+    EXPECT_EQ(m, al.cs.month());                                  \
+    EXPECT_EQ(d, al.cs.day());                                    \
+    EXPECT_EQ(hh, al.cs.hour());                                  \
+    EXPECT_EQ(mm, al.cs.minute());                                \
+    EXPECT_EQ(ss, al.cs.second());                                \
+    EXPECT_EQ(off, al.offset);                                    \
+    EXPECT_TRUE(isdst == al.is_dst);                              \
+    /* EXPECT_STREQ(zone, al.abbr); */                            \
+  } while (0)
+
+// These tests sometimes run on platforms that have zoneinfo data so old
+// that the transition we are attempting to check does not exist, most
+// notably Android emulators.  Fortunately, AndroidZoneInfoSource supports
+// time_zone::version() so, in cases where we've learned that it matters,
+// we can make the check conditionally.
+int VersionCmp(time_zone tz, const std::string& target) {
+  std::string version = tz.version();
+  if (version.empty() && !target.empty()) return 1;  // unknown > known
+  return version.compare(target);
+}
+
+}  // namespace
+
+#if !defined(__EMSCRIPTEN__)
+TEST(TimeZones, LoadZonesConcurrently) {
+  std::promise<void> ready_promise;
+  std::shared_future<void> ready_future(ready_promise.get_future());
+  auto load_zones = [ready_future](std::promise<void>* started,
+                                   std::set<std::string>* failures) {
+    started->set_value();
+    ready_future.wait();
+    for (const char* const* np = kTimeZoneNames; *np != nullptr; ++np) {
+      std::string zone = *np;
+      time_zone tz;
+      if (load_time_zone(zone, &tz)) {
+        EXPECT_EQ(zone, tz.name());
+      } else {
+        failures->insert(zone);
+      }
+    }
+  };
+
+  const std::size_t n_threads = 128;
+  std::vector<std::thread> threads;
+  std::vector<std::set<std::string>> thread_failures(n_threads);
+  for (std::size_t i = 0; i != n_threads; ++i) {
+    std::promise<void> started;
+    threads.emplace_back(load_zones, &started, &thread_failures[i]);
+    started.get_future().wait();
+  }
+  ready_promise.set_value();
+  for (auto& thread : threads) {
+    thread.join();
+  }
+
+  // Allow a small number of failures to account for skew between
+  // the contents of kTimeZoneNames and the zoneinfo data source.
+#if defined(__ANDROID__)
+  // Cater to the possibility of using an even older zoneinfo data
+  // source when running on Android, where it is difficult to override
+  // the bionic tzdata provided by the test environment.
+  const std::size_t max_failures = 20;
+#else
+  const std::size_t max_failures = 3;
+#endif
+  std::set<std::string> failures;
+  for (const auto& thread_failure : thread_failures) {
+    failures.insert(thread_failure.begin(), thread_failure.end());
+  }
+  EXPECT_LE(failures.size(), max_failures) << testing::PrintToString(failures);
+}
+#endif
+
+TEST(TimeZone, NamedTimeZones) {
+  const time_zone utc = utc_time_zone();
+  EXPECT_EQ("UTC", utc.name());
+  const time_zone nyc = LoadZone("America/New_York");
+  EXPECT_EQ("America/New_York", nyc.name());
+  const time_zone syd = LoadZone("Australia/Sydney");
+  EXPECT_EQ("Australia/Sydney", syd.name());
+  const time_zone fixed0 = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+  EXPECT_EQ("UTC", fixed0.name());
+  const time_zone fixed_pos = fixed_time_zone(
+      chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
+  EXPECT_EQ("Fixed/UTC+03:25:45", fixed_pos.name());
+  const time_zone fixed_neg = fixed_time_zone(
+      -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
+  EXPECT_EQ("Fixed/UTC-12:34:56", fixed_neg.name());
+}
+
+TEST(TimeZone, Failures) {
+  time_zone tz;
+  EXPECT_FALSE(load_time_zone(":America/Los_Angeles", &tz));
+
+  tz = LoadZone("America/Los_Angeles");
+  EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
+  EXPECT_EQ(chrono::system_clock::from_time_t(0),
+            convert(civil_second(1970, 1, 1, 0, 0, 0), tz));  // UTC
+
+  // Ensures that the load still fails on a subsequent attempt.
+  tz = LoadZone("America/Los_Angeles");
+  EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
+  EXPECT_EQ(chrono::system_clock::from_time_t(0),
+            convert(civil_second(1970, 1, 1, 0, 0, 0), tz));  // UTC
+
+  // Loading an empty std::string timezone should fail.
+  tz = LoadZone("America/Los_Angeles");
+  EXPECT_FALSE(load_time_zone("", &tz));
+  EXPECT_EQ(chrono::system_clock::from_time_t(0),
+            convert(civil_second(1970, 1, 1, 0, 0, 0), tz));  // UTC
+}
+
+TEST(TimeZone, Equality) {
+  const time_zone a;
+  const time_zone b;
+  EXPECT_EQ(a, b);
+  EXPECT_EQ(a.name(), b.name());
+
+  const time_zone implicit_utc;
+  const time_zone explicit_utc = utc_time_zone();
+  EXPECT_EQ(implicit_utc, explicit_utc);
+  EXPECT_EQ(implicit_utc.name(), explicit_utc.name());
+
+  const time_zone fixed_zero = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+  EXPECT_EQ(fixed_zero, LoadZone(fixed_zero.name()));
+  EXPECT_EQ(fixed_zero, explicit_utc);
+
+  const time_zone fixed_utc = LoadZone("Fixed/UTC+00:00:00");
+  EXPECT_EQ(fixed_utc, LoadZone(fixed_utc.name()));
+  EXPECT_EQ(fixed_utc, explicit_utc);
+
+  const time_zone fixed_pos = fixed_time_zone(
+      chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
+  EXPECT_EQ(fixed_pos, LoadZone(fixed_pos.name()));
+  EXPECT_NE(fixed_pos, explicit_utc);
+  const time_zone fixed_neg = fixed_time_zone(
+      -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
+  EXPECT_EQ(fixed_neg, LoadZone(fixed_neg.name()));
+  EXPECT_NE(fixed_neg, explicit_utc);
+
+  const time_zone fixed_lim = fixed_time_zone(chrono::hours(24));
+  EXPECT_EQ(fixed_lim, LoadZone(fixed_lim.name()));
+  EXPECT_NE(fixed_lim, explicit_utc);
+  const time_zone fixed_ovfl =
+      fixed_time_zone(chrono::hours(24) + chrono::seconds(1));
+  EXPECT_EQ(fixed_ovfl, LoadZone(fixed_ovfl.name()));
+  EXPECT_EQ(fixed_ovfl, explicit_utc);
+
+  EXPECT_EQ(fixed_time_zone(chrono::seconds(1)),
+            fixed_time_zone(chrono::seconds(1)));
+
+  const time_zone local = local_time_zone();
+  EXPECT_EQ(local, LoadZone(local.name()));
+
+  time_zone la = LoadZone("America/Los_Angeles");
+  time_zone nyc = LoadZone("America/New_York");
+  EXPECT_NE(la, nyc);
+}
+
+TEST(StdChronoTimePoint, TimeTAlignment) {
+  // Ensures that the Unix epoch and the system clock epoch are an integral
+  // number of seconds apart. This simplifies conversions to/from time_t.
+  auto diff = chrono::system_clock::time_point() -
+              chrono::system_clock::from_time_t(0);
+  EXPECT_EQ(chrono::system_clock::time_point::duration::zero(),
+            diff % chrono::seconds(1));
+}
+
+TEST(BreakTime, TimePointResolution) {
+  const time_zone utc = utc_time_zone();
+  const auto t0 = chrono::system_clock::from_time_t(0);
+
+  ExpectTime(chrono::time_point_cast<chrono::nanoseconds>(t0), utc,
+             1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::microseconds>(t0), utc,
+             1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::milliseconds>(t0), utc,
+             1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::seconds>(t0), utc,
+             1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0), utc,
+             1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::minutes>(t0), utc,
+             1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::hours>(t0), utc,
+             1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+}
+
+TEST(BreakTime, LocalTimeInUTC) {
+  const time_zone tz = utc_time_zone();
+  const auto tp = chrono::system_clock::from_time_t(0);
+  ExpectTime(tp, tz, 1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInUTCUnaligned) {
+  const time_zone tz = utc_time_zone();
+  const auto tp =
+      chrono::system_clock::from_time_t(0) - chrono::milliseconds(500);
+  ExpectTime(tp, tz, 1969, 12, 31, 23, 59, 59, 0, false, "UTC");
+  EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimePosix) {
+  // See IEEE Std 1003.1-1988 B.2.3 General Terms, Epoch.
+  const time_zone tz = utc_time_zone();
+  const auto tp = chrono::system_clock::from_time_t(536457599);
+  ExpectTime(tp, tz, 1986, 12, 31, 23, 59, 59, 0, false, "UTC");
+  EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(TimeZoneImpl, LocalTimeInFixed) {
+  const absl::time_internal::cctz::seconds offset =
+      -(chrono::hours(8) + chrono::minutes(33) + chrono::seconds(47));
+  const time_zone tz = fixed_time_zone(offset);
+  const auto tp = chrono::system_clock::from_time_t(0);
+  ExpectTime(tp, tz, 1969, 12, 31, 15, 26, 13, offset.count(), false,
+             "-083347");
+  EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInNewYork) {
+  const time_zone tz = LoadZone("America/New_York");
+  const auto tp = chrono::system_clock::from_time_t(45);
+  ExpectTime(tp, tz, 1969, 12, 31, 19, 0, 45, -5 * 60 * 60, false, "EST");
+  EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInMTV) {
+  const time_zone tz = LoadZone("America/Los_Angeles");
+  const auto tp = chrono::system_clock::from_time_t(1380855729);
+  ExpectTime(tp, tz, 2013, 10, 3, 20, 2, 9, -7 * 60 * 60, true, "PDT");
+  EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInSydney) {
+  const time_zone tz = LoadZone("Australia/Sydney");
+  const auto tp = chrono::system_clock::from_time_t(90);
+  ExpectTime(tp, tz, 1970, 1, 1, 10, 1, 30, 10 * 60 * 60, false, "AEST");
+  EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(MakeTime, TimePointResolution) {
+  const time_zone utc = utc_time_zone();
+  const time_point<chrono::nanoseconds> tp_ns =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_ns, utc));
+  const time_point<chrono::microseconds> tp_us =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_us, utc));
+  const time_point<chrono::milliseconds> tp_ms =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_ms, utc));
+  const time_point<chrono::seconds> tp_s =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_s, utc));
+  const time_point<absl::time_internal::cctz::seconds> tp_s64 =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_s64, utc));
+
+  // These next two require chrono::time_point_cast because the conversion
+  // from a resolution of seconds (the return value of convert()) to a
+  // coarser resolution requires an explicit cast.
+  const time_point<chrono::minutes> tp_m =
+      chrono::time_point_cast<chrono::minutes>(
+          convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
+  EXPECT_EQ("04:00", format("%M:%E*S", tp_m, utc));
+  const time_point<chrono::hours> tp_h =
+      chrono::time_point_cast<chrono::hours>(
+          convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
+  EXPECT_EQ("00:00", format("%M:%E*S", tp_h, utc));
+}
+
+TEST(MakeTime, Normalization) {
+  const time_zone tz = LoadZone("America/New_York");
+  const auto tp = convert(civil_second(2009, 2, 13, 18, 31, 30), tz);
+  EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+  // Now requests for the same time_point but with out-of-range fields.
+  EXPECT_EQ(tp, convert(civil_second(2008, 14, 13, 18, 31, 30), tz));  // month
+  EXPECT_EQ(tp, convert(civil_second(2009, 1, 44, 18, 31, 30), tz));   // day
+  EXPECT_EQ(tp, convert(civil_second(2009, 2, 12, 42, 31, 30), tz));   // hour
+  EXPECT_EQ(tp, convert(civil_second(2009, 2, 13, 17, 91, 30), tz));   // minute
+  EXPECT_EQ(tp, convert(civil_second(2009, 2, 13, 18, 30, 90), tz));   // second
+}
+
+// NOTE: Run this with -ftrapv to detect overflow problems.
+TEST(MakeTime, SysSecondsLimits) {
+  const char RFC3339[] =  "%Y-%m-%dT%H:%M:%S%Ez";
+  const time_zone utc = utc_time_zone();
+  const time_zone east = fixed_time_zone(chrono::hours(14));
+  const time_zone west = fixed_time_zone(-chrono::hours(14));
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  // Approach the maximal time_point<cctz::seconds> value from below.
+  tp = convert(civil_second(292277026596, 12, 4, 15, 30, 6), utc);
+  EXPECT_EQ("292277026596-12-04T15:30:06+00:00", format(RFC3339, tp, utc));
+  tp = convert(civil_second(292277026596, 12, 4, 15, 30, 7), utc);
+  EXPECT_EQ("292277026596-12-04T15:30:07+00:00", format(RFC3339, tp, utc));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second(292277026596, 12, 4, 15, 30, 8), utc);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second::max(), utc);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+  // Checks that we can also get the maximal value for a far-east zone.
+  tp = convert(civil_second(292277026596, 12, 5, 5, 30, 7), east);
+  EXPECT_EQ("292277026596-12-05T05:30:07+14:00", format(RFC3339, tp, east));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second(292277026596, 12, 5, 5, 30, 8), east);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second::max(), east);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+  // Checks that we can also get the maximal value for a far-west zone.
+  tp = convert(civil_second(292277026596, 12, 4, 1, 30, 7), west);
+  EXPECT_EQ("292277026596-12-04T01:30:07-14:00", format(RFC3339, tp, west));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second(292277026596, 12, 4, 7, 30, 8), west);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second::max(), west);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+  // Approach the minimal time_point<cctz::seconds> value from above.
+  tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 53), utc);
+  EXPECT_EQ("-292277022657-01-27T08:29:53+00:00", format(RFC3339, tp, utc));
+  tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 52), utc);
+  EXPECT_EQ("-292277022657-01-27T08:29:52+00:00", format(RFC3339, tp, utc));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 51), utc);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second::min(), utc);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+  // Checks that we can also get the minimal value for a far-east zone.
+  tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 52), east);
+  EXPECT_EQ("-292277022657-01-27T22:29:52+14:00", format(RFC3339, tp, east));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 51), east);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second::min(), east);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+  // Checks that we can also get the minimal value for a far-west zone.
+  tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 52), west);
+  EXPECT_EQ("-292277022657-01-26T18:29:52-14:00", format(RFC3339, tp, west));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 51), west);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second::min(), west);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+  // Some similar checks for the "libc" time-zone implementation.
+  if (sizeof(std::time_t) >= 8) {
+    // Checks that "tm_year + 1900", as used by the "libc" implementation,
+    // can produce year values beyond the range on an int without overflow.
+#if defined(_WIN32) || defined(_WIN64)
+    // localtime_s() and gmtime_s() don't believe in years outside [1970:3000].
+#else
+    const time_zone utc = LoadZone("libc:UTC");
+    const year_t max_tm_year = year_t{std::numeric_limits<int>::max()} + 1900;
+    tp = convert(civil_second(max_tm_year, 12, 31, 23, 59, 59), utc);
+    EXPECT_EQ("2147485547-12-31T23:59:59+00:00", format(RFC3339, tp, utc));
+    const year_t min_tm_year = year_t{std::numeric_limits<int>::min()} + 1900;
+    tp = convert(civil_second(min_tm_year, 1, 1, 0, 0, 0), utc);
+    EXPECT_EQ("-2147481748-01-01T00:00:00+00:00", format(RFC3339, tp, utc));
+#endif
+  }
+}
+
+TEST(MakeTime, LocalTimeLibC) {
+  // Checks that cctz and libc agree on transition points in [1970:2037].
+  //
+  // We limit this test case to environments where:
+  //  1) we know how to change the time zone used by localtime()/mktime(),
+  //  2) cctz and localtime()/mktime() will use similar-enough tzdata, and
+  //  3) we have some idea about how mktime() behaves during transitions.
+#if defined(__linux__) && !defined(__ANDROID__)
+  const char* const ep = getenv("TZ");
+  std::string tz_name = (ep != nullptr) ? ep : "";
+  for (const char* const* np = kTimeZoneNames; *np != nullptr; ++np) {
+    ASSERT_EQ(0, setenv("TZ", *np, 1));  // change what "localtime" means
+    const auto zi = local_time_zone();
+    const auto lc = LoadZone("libc:localtime");
+    time_zone::civil_transition trans;
+    for (auto tp = zi.lookup(civil_second()).trans;
+         zi.next_transition(tp, &trans);
+         tp = zi.lookup(trans.to).trans) {
+      const auto fcl = zi.lookup(trans.from);
+      const auto tcl = zi.lookup(trans.to);
+      civil_second cs;  // compare cs in zi and lc
+      if (fcl.kind == time_zone::civil_lookup::UNIQUE) {
+        if (tcl.kind == time_zone::civil_lookup::UNIQUE) {
+          // Both unique; must be an is_dst or abbr change.
+          ASSERT_EQ(trans.from, trans.to);
+          const auto trans = fcl.trans;
+          const auto tal = zi.lookup(trans);
+          const auto tprev = trans - absl::time_internal::cctz::seconds(1);
+          const auto pal = zi.lookup(tprev);
+          if (pal.is_dst == tal.is_dst) {
+            ASSERT_STRNE(pal.abbr, tal.abbr);
+          }
+          continue;
+        }
+        ASSERT_EQ(time_zone::civil_lookup::REPEATED, tcl.kind);
+        cs = trans.to;
+      } else {
+        ASSERT_EQ(time_zone::civil_lookup::UNIQUE, tcl.kind);
+        ASSERT_EQ(time_zone::civil_lookup::SKIPPED, fcl.kind);
+        cs = trans.from;
+      }
+      if (cs.year() > 2037) break;  // limit test time (and to 32-bit time_t)
+      const auto cl_zi = zi.lookup(cs);
+      if (zi.lookup(cl_zi.pre).is_dst == zi.lookup(cl_zi.post).is_dst) {
+        // The "libc" implementation cannot correctly classify transitions
+        // that don't change the "tm_isdst" flag.  In Europe/Volgograd, for
+        // example, there is a SKIPPED transition from +03 to +04 with dst=F
+        // on both sides ...
+        //   1540681199 = 2018-10-28 01:59:59 +03:00:00 [dst=F off=10800]
+        //   1540681200 = 2018-10-28 03:00:00 +04:00:00 [dst=F off=14400]
+        // but std::mktime(2018-10-28 02:00:00, tm_isdst=0) fails, unlike,
+        // say, the similar Europe/Chisinau transition from +02 to +03 ...
+        //   1521935999 = 2018-03-25 01:59:59 +02:00:00 [dst=F off=7200]
+        //   1521936000 = 2018-03-25 03:00:00 +03:00:00 [dst=T off=10800]
+        // where std::mktime(2018-03-25 02:00:00, tm_isdst=0) succeeds and
+        // returns 1521936000.
+        continue;
+      }
+      if (cs == civil_second(2037, 10, 4, 2, 0, 0)) {
+        const std::string tzname = *np;
+        if (tzname == "Africa/Casablanca" || tzname == "Africa/El_Aaiun") {
+          // The "libc" implementation gets this transition wrong (at least
+          // until 2018g when it was removed), returning an offset of 3600
+          // instead of 0.  TODO: Revert this when 2018g is ubiquitous.
+          continue;
+        }
+      }
+      const auto cl_lc = lc.lookup(cs);
+      SCOPED_TRACE(testing::Message() << "For " << cs << " in " << *np);
+      EXPECT_EQ(cl_zi.kind, cl_lc.kind);
+      EXPECT_EQ(cl_zi.pre, cl_lc.pre);
+      EXPECT_EQ(cl_zi.trans, cl_lc.trans);
+      EXPECT_EQ(cl_zi.post, cl_lc.post);
+    }
+  }
+  if (ep == nullptr) {
+    ASSERT_EQ(0, unsetenv("TZ"));
+  } else {
+    ASSERT_EQ(0, setenv("TZ", tz_name.c_str(), 1));
+  }
+#endif
+}
+
+TEST(NextTransition, UTC) {
+  const auto tz = utc_time_zone();
+  time_zone::civil_transition trans;
+
+  auto tp = time_point<absl::time_internal::cctz::seconds>::min();
+  EXPECT_FALSE(tz.next_transition(tp, &trans));
+
+  tp = time_point<absl::time_internal::cctz::seconds>::max();
+  EXPECT_FALSE(tz.next_transition(tp, &trans));
+}
+
+TEST(PrevTransition, UTC) {
+  const auto tz = utc_time_zone();
+  time_zone::civil_transition trans;
+
+  auto tp = time_point<absl::time_internal::cctz::seconds>::max();
+  EXPECT_FALSE(tz.prev_transition(tp, &trans));
+
+  tp = time_point<absl::time_internal::cctz::seconds>::min();
+  EXPECT_FALSE(tz.prev_transition(tp, &trans));
+}
+
+TEST(NextTransition, AmericaNewYork) {
+  const auto tz = LoadZone("America/New_York");
+  time_zone::civil_transition trans;
+
+  auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
+  EXPECT_TRUE(tz.next_transition(tp, &trans));
+  EXPECT_EQ(civil_second(2018, 11, 4, 2, 0, 0), trans.from);
+  EXPECT_EQ(civil_second(2018, 11, 4, 1, 0, 0), trans.to);
+
+  tp = time_point<absl::time_internal::cctz::seconds>::max();
+  EXPECT_FALSE(tz.next_transition(tp, &trans));
+
+  tp = time_point<absl::time_internal::cctz::seconds>::min();
+  EXPECT_TRUE(tz.next_transition(tp, &trans));
+  if (trans.from == civil_second(1918, 3, 31, 2, 0, 0)) {
+    // It looks like the tzdata is only 32 bit (probably macOS),
+    // which bottoms out at 1901-12-13T20:45:52+00:00.
+    EXPECT_EQ(civil_second(1918, 3, 31, 3, 0, 0), trans.to);
+  } else {
+    EXPECT_EQ(civil_second(1883, 11, 18, 12, 3, 58), trans.from);
+    EXPECT_EQ(civil_second(1883, 11, 18, 12, 0, 0), trans.to);
+  }
+}
+
+TEST(PrevTransition, AmericaNewYork) {
+  const auto tz = LoadZone("America/New_York");
+  time_zone::civil_transition trans;
+
+  auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
+  EXPECT_TRUE(tz.prev_transition(tp, &trans));
+  EXPECT_EQ(civil_second(2018, 3, 11, 2, 0, 0), trans.from);
+  EXPECT_EQ(civil_second(2018, 3, 11, 3, 0, 0), trans.to);
+
+  tp = time_point<absl::time_internal::cctz::seconds>::min();
+  EXPECT_FALSE(tz.prev_transition(tp, &trans));
+
+  tp = time_point<absl::time_internal::cctz::seconds>::max();
+  EXPECT_TRUE(tz.prev_transition(tp, &trans));
+  // We have a transition but we don't know which one.
+}
+
+TEST(TimeZoneEdgeCase, AmericaNewYork) {
+  const time_zone tz = LoadZone("America/New_York");
+
+  // Spring 1:59:59 -> 3:00:00
+  auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -5 * 3600, false, "EST");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -4 * 3600, true, "EDT");
+
+  // Fall 1:59:59 -> 1:00:00
+  tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -4 * 3600, true, "EDT");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -5 * 3600, false, "EST");
+}
+
+TEST(TimeZoneEdgeCase, AmericaLosAngeles) {
+  const time_zone tz = LoadZone("America/Los_Angeles");
+
+  // Spring 1:59:59 -> 3:00:00
+  auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -8 * 3600, false, "PST");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -7 * 3600, true, "PDT");
+
+  // Fall 1:59:59 -> 1:00:00
+  tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, true, "PDT");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -8 * 3600, false, "PST");
+}
+
+TEST(TimeZoneEdgeCase, ArizonaNoTransition) {
+  const time_zone tz = LoadZone("America/Phoenix");
+
+  // No transition in Spring.
+  auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -7 * 3600, false, "MST");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 3, 10, 2, 0, 0, -7 * 3600, false, "MST");
+
+  // No transition in Fall.
+  tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, false, "MST");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 11, 3, 2, 0, 0, -7 * 3600, false, "MST");
+}
+
+TEST(TimeZoneEdgeCase, AsiaKathmandu) {
+  const time_zone tz = LoadZone("Asia/Kathmandu");
+
+  // A non-DST offset change from +0530 to +0545
+  //
+  //   504901799 == Tue, 31 Dec 1985 23:59:59 +0530 (+0530)
+  //   504901800 == Wed,  1 Jan 1986 00:15:00 +0545 (+0545)
+  auto tp = convert(civil_second(1985, 12, 31, 23, 59, 59), tz);
+  ExpectTime(tp, tz, 1985, 12, 31, 23, 59, 59, 5.5 * 3600, false, "+0530");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 1986, 1, 1, 0, 15, 0, 5.75 * 3600, false, "+0545");
+}
+
+TEST(TimeZoneEdgeCase, PacificChatham) {
+  const time_zone tz = LoadZone("Pacific/Chatham");
+
+  // One-hour DST offset changes, but at atypical values
+  //
+  //   1365256799 == Sun,  7 Apr 2013 03:44:59 +1345 (+1345)
+  //   1365256800 == Sun,  7 Apr 2013 02:45:00 +1245 (+1245)
+  auto tp = convert(civil_second(2013, 4, 7, 3, 44, 59), tz);
+  ExpectTime(tp, tz, 2013, 4, 7, 3, 44, 59, 13.75 * 3600, true, "+1345");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 4, 7, 2, 45, 0, 12.75 * 3600, false, "+1245");
+
+  //   1380376799 == Sun, 29 Sep 2013 02:44:59 +1245 (+1245)
+  //   1380376800 == Sun, 29 Sep 2013 03:45:00 +1345 (+1345)
+  tp = convert(civil_second(2013, 9, 29, 2, 44, 59), tz);
+  ExpectTime(tp, tz, 2013, 9, 29, 2, 44, 59, 12.75 * 3600, false, "+1245");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 9, 29, 3, 45, 0, 13.75 * 3600, true, "+1345");
+}
+
+TEST(TimeZoneEdgeCase, AustraliaLordHowe) {
+  const time_zone tz = LoadZone("Australia/Lord_Howe");
+
+  // Half-hour DST offset changes
+  //
+  //   1365260399 == Sun,  7 Apr 2013 01:59:59 +1100 (+11)
+  //   1365260400 == Sun,  7 Apr 2013 01:30:00 +1030 (+1030)
+  auto tp = convert(civil_second(2013, 4, 7, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 4, 7, 1, 59, 59, 11 * 3600, true, "+11");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 4, 7, 1, 30, 0, 10.5 * 3600, false, "+1030");
+
+  //   1380986999 == Sun,  6 Oct 2013 01:59:59 +1030 (+1030)
+  //   1380987000 == Sun,  6 Oct 2013 02:30:00 +1100 (+11)
+  tp = convert(civil_second(2013, 10, 6, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 10, 6, 1, 59, 59, 10.5 * 3600, false, "+1030");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 10, 6, 2, 30, 0, 11 * 3600, true, "+11");
+}
+
+TEST(TimeZoneEdgeCase, PacificApia) {
+  const time_zone tz = LoadZone("Pacific/Apia");
+
+  // At the end of December 2011, Samoa jumped forward by one day,
+  // skipping 30 December from the local calendar, when the nation
+  // moved to the west of the International Date Line.
+  //
+  // A one-day, non-DST offset change
+  //
+  //   1325239199 == Thu, 29 Dec 2011 23:59:59 -1000 (-10)
+  //   1325239200 == Sat, 31 Dec 2011 00:00:00 +1400 (+14)
+  auto tp = convert(civil_second(2011, 12, 29, 23, 59, 59), tz);
+  ExpectTime(tp, tz, 2011, 12, 29, 23, 59, 59, -10 * 3600, true, "-10");
+  EXPECT_EQ(363, get_yearday(convert(tp, tz)));
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2011, 12, 31, 0, 0, 0, 14 * 3600, true, "+14");
+  EXPECT_EQ(365, get_yearday(convert(tp, tz)));
+}
+
+TEST(TimeZoneEdgeCase, AfricaCairo) {
+  const time_zone tz = LoadZone("Africa/Cairo");
+
+  if (VersionCmp(tz, "2014c") >= 0) {
+    // An interesting case of midnight not existing.
+    //
+    //   1400191199 == Thu, 15 May 2014 23:59:59 +0200 (EET)
+    //   1400191200 == Fri, 16 May 2014 01:00:00 +0300 (EEST)
+    auto tp = convert(civil_second(2014, 5, 15, 23, 59, 59), tz);
+    ExpectTime(tp, tz, 2014, 5, 15, 23, 59, 59, 2 * 3600, false, "EET");
+    tp += absl::time_internal::cctz::seconds(1);
+    ExpectTime(tp, tz, 2014, 5, 16, 1, 0, 0, 3 * 3600, true, "EEST");
+  }
+}
+
+TEST(TimeZoneEdgeCase, AfricaMonrovia) {
+  const time_zone tz = LoadZone("Africa/Monrovia");
+
+  if (VersionCmp(tz, "2017b") >= 0) {
+    // Strange offset change -00:44:30 -> +00:00:00 (non-DST)
+    //
+    //   63593069 == Thu,  6 Jan 1972 23:59:59 -0044 (MMT)
+    //   63593070 == Fri,  7 Jan 1972 00:44:30 +0000 (GMT)
+    auto tp = convert(civil_second(1972, 1, 6, 23, 59, 59), tz);
+    ExpectTime(tp, tz, 1972, 1, 6, 23, 59, 59, -44.5 * 60, false, "MMT");
+    tp += absl::time_internal::cctz::seconds(1);
+    ExpectTime(tp, tz, 1972, 1, 7, 0, 44, 30, 0 * 60, false, "GMT");
+  }
+}
+
+TEST(TimeZoneEdgeCase, AmericaJamaica) {
+  // Jamaica discontinued DST transitions in 1983, and is now at a
+  // constant -0500.  This makes it an interesting edge-case target.
+  // Note that the 32-bit times used in a (tzh_version == 0) zoneinfo
+  // file cannot represent the abbreviation-only transition of 1890,
+  // so we ignore the abbreviation by expecting what we received.
+  const time_zone tz = LoadZone("America/Jamaica");
+
+  // Before the first transition.
+  if (!tz.version().empty() && VersionCmp(tz, "2018d") >= 0) {
+    // We avoid the expectations on the -18430 offset below unless we are
+    // certain we have commit 907241e (Fix off-by-1 error for Jamaica and
+    // T&C before 1913) from 2018d.  TODO: Remove the "version() not empty"
+    // part when 2018d is generally available from /usr/share/zoneinfo.
+    auto tp = convert(civil_second(1889, 12, 31, 0, 0, 0), tz);
+    ExpectTime(tp, tz, 1889, 12, 31, 0, 0, 0, -18430, false,
+               tz.lookup(tp).abbr);
+
+    // Over the first (abbreviation-change only) transition.
+    //   -2524503170 == Tue, 31 Dec 1889 23:59:59 -0507 (LMT)
+    //   -2524503169 == Wed,  1 Jan 1890 00:00:00 -0507 (KMT)
+    tp = convert(civil_second(1889, 12, 31, 23, 59, 59), tz);
+    ExpectTime(tp, tz, 1889, 12, 31, 23, 59, 59, -18430, false,
+               tz.lookup(tp).abbr);
+    tp += absl::time_internal::cctz::seconds(1);
+    ExpectTime(tp, tz, 1890, 1, 1, 0, 0, 0, -18430, false, "KMT");
+  }
+
+  // Over the last (DST) transition.
+  //     436341599 == Sun, 30 Oct 1983 01:59:59 -0400 (EDT)
+  //     436341600 == Sun, 30 Oct 1983 01:00:00 -0500 (EST)
+  auto tp = convert(civil_second(1983, 10, 30, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 1983, 10, 30, 1, 59, 59, -4 * 3600, true, "EDT");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 1983, 10, 30, 1, 0, 0, -5 * 3600, false, "EST");
+
+  // After the last transition.
+  tp = convert(civil_second(1983, 12, 31, 23, 59, 59), tz);
+  ExpectTime(tp, tz, 1983, 12, 31, 23, 59, 59, -5 * 3600, false, "EST");
+}
+
+TEST(TimeZoneEdgeCase, WET) {
+  // Cover some non-existent times within forward transitions.
+  const time_zone tz = LoadZone("WET");
+
+  // Before the first transition.
+  auto tp = convert(civil_second(1977, 1, 1, 0, 0, 0), tz);
+  ExpectTime(tp, tz, 1977, 1, 1, 0, 0, 0, 0, false, "WET");
+
+  // Over the first transition.
+  //     228877199 == Sun,  3 Apr 1977 00:59:59 +0000 (WET)
+  //     228877200 == Sun,  3 Apr 1977 02:00:00 +0100 (WEST)
+  tp = convert(civil_second(1977, 4, 3, 0, 59, 59), tz);
+  ExpectTime(tp, tz, 1977, 4, 3, 0, 59, 59, 0, false, "WET");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
+
+  // A non-existent time within the first transition.
+  time_zone::civil_lookup cl1 = tz.lookup(civil_second(1977, 4, 3, 1, 15, 0));
+  EXPECT_EQ(time_zone::civil_lookup::SKIPPED, cl1.kind);
+  ExpectTime(cl1.pre, tz, 1977, 4, 3, 2, 15, 0, 1 * 3600, true, "WEST");
+  ExpectTime(cl1.trans, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
+  ExpectTime(cl1.post, tz, 1977, 4, 3, 0, 15, 0, 0 * 3600, false, "WET");
+
+  // A non-existent time within the second forward transition.
+  time_zone::civil_lookup cl2 = tz.lookup(civil_second(1978, 4, 2, 1, 15, 0));
+  EXPECT_EQ(time_zone::civil_lookup::SKIPPED, cl2.kind);
+  ExpectTime(cl2.pre, tz, 1978, 4, 2, 2, 15, 0, 1 * 3600, true, "WEST");
+  ExpectTime(cl2.trans, tz, 1978, 4, 2, 2, 0, 0, 1 * 3600, true, "WEST");
+  ExpectTime(cl2.post, tz, 1978, 4, 2, 0, 15, 0, 0 * 3600, false, "WET");
+}
+
+TEST(TimeZoneEdgeCase, FixedOffsets) {
+  const time_zone gmtm5 = LoadZone("Etc/GMT+5");  // -0500
+  auto tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtm5);
+  ExpectTime(tp, gmtm5, 1970, 1, 1, 0, 0, 0, -5 * 3600, false, "-05");
+  EXPECT_EQ(chrono::system_clock::from_time_t(5 * 3600), tp);
+
+  const time_zone gmtp5 = LoadZone("Etc/GMT-5");  // +0500
+  tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtp5);
+  ExpectTime(tp, gmtp5, 1970, 1, 1, 0, 0, 0, 5 * 3600, false, "+05");
+  EXPECT_EQ(chrono::system_clock::from_time_t(-5 * 3600), tp);
+}
+
+TEST(TimeZoneEdgeCase, NegativeYear) {
+  // Tests transition from year 0 (aka 1BCE) to year -1.
+  const time_zone tz = utc_time_zone();
+  auto tp = convert(civil_second(0, 1, 1, 0, 0, 0), tz);
+  ExpectTime(tp, tz, 0, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
+  EXPECT_EQ(weekday::saturday, get_weekday(convert(tp, tz)));
+  tp -= absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, -1, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
+  EXPECT_EQ(weekday::friday, get_weekday(convert(tp, tz)));
+}
+
+TEST(TimeZoneEdgeCase, UTC32bitLimit) {
+  const time_zone tz = utc_time_zone();
+
+  // Limits of signed 32-bit time_t
+  //
+  //   2147483647 == Tue, 19 Jan 2038 03:14:07 +0000 (UTC)
+  //   2147483648 == Tue, 19 Jan 2038 03:14:08 +0000 (UTC)
+  auto tp = convert(civil_second(2038, 1, 19, 3, 14, 7), tz);
+  ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 7, 0 * 3600, false, "UTC");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 8, 0 * 3600, false, "UTC");
+}
+
+TEST(TimeZoneEdgeCase, UTC5DigitYear) {
+  const time_zone tz = utc_time_zone();
+
+  // Rollover to 5-digit year
+  //
+  //   253402300799 == Fri, 31 Dec 9999 23:59:59 +0000 (UTC)
+  //   253402300800 == Sat,  1 Jan 1000 00:00:00 +0000 (UTC)
+  auto tp = convert(civil_second(9999, 12, 31, 23, 59, 59), tz);
+  ExpectTime(tp, tz, 9999, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 10000, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_posix.cc b/absl/time/internal/cctz/src/time_zone_posix.cc
new file mode 100644
index 0000000..038740e
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_posix.cc
@@ -0,0 +1,155 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "time_zone_posix.h"
+
+#include <cstddef>
+#include <cstring>
+#include <limits>
+#include <string>
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+const char kDigits[] = "0123456789";
+
+const char* ParseInt(const char* p, int min, int max, int* vp) {
+  int value = 0;
+  const char* op = p;
+  const int kMaxInt = std::numeric_limits<int>::max();
+  for (; const char* dp = strchr(kDigits, *p); ++p) {
+    int d = static_cast<int>(dp - kDigits);
+    if (d >= 10) break;  // '\0'
+    if (value > kMaxInt / 10) return nullptr;
+    value *= 10;
+    if (value > kMaxInt - d) return nullptr;
+    value += d;
+  }
+  if (p == op || value < min || value > max) return nullptr;
+  *vp = value;
+  return p;
+}
+
+// abbr = <.*?> | [^-+,\d]{3,}
+const char* ParseAbbr(const char* p, std::string* abbr) {
+  const char* op = p;
+  if (*p == '<') {  // special zoneinfo <...> form
+    while (*++p != '>') {
+      if (*p == '\0') return nullptr;
+    }
+    abbr->assign(op + 1, static_cast<std::size_t>(p - op) - 1);
+    return ++p;
+  }
+  while (*p != '\0') {
+    if (strchr("-+,", *p)) break;
+    if (strchr(kDigits, *p)) break;
+    ++p;
+  }
+  if (p - op < 3) return nullptr;
+  abbr->assign(op, static_cast<std::size_t>(p - op));
+  return p;
+}
+
+// offset = [+|-]hh[:mm[:ss]] (aggregated into single seconds value)
+const char* ParseOffset(const char* p, int min_hour, int max_hour, int sign,
+                        std::int_fast32_t* offset) {
+  if (p == nullptr) return nullptr;
+  if (*p == '+' || *p == '-') {
+    if (*p++ == '-') sign = -sign;
+  }
+  int hours = 0;
+  int minutes = 0;
+  int seconds = 0;
+
+  p = ParseInt(p, min_hour, max_hour, &hours);
+  if (p == nullptr) return nullptr;
+  if (*p == ':') {
+    p = ParseInt(p + 1, 0, 59, &minutes);
+    if (p == nullptr) return nullptr;
+    if (*p == ':') {
+      p = ParseInt(p + 1, 0, 59, &seconds);
+      if (p == nullptr) return nullptr;
+    }
+  }
+  *offset = sign * ((((hours * 60) + minutes) * 60) + seconds);
+  return p;
+}
+
+// datetime = ( Jn | n | Mm.w.d ) [ / offset ]
+const char* ParseDateTime(const char* p, PosixTransition* res) {
+  if (p != nullptr && *p == ',') {
+    if (*++p == 'M') {
+      int month = 0;
+      if ((p = ParseInt(p + 1, 1, 12, &month)) != nullptr && *p == '.') {
+        int week = 0;
+        if ((p = ParseInt(p + 1, 1, 5, &week)) != nullptr && *p == '.') {
+          int weekday = 0;
+          if ((p = ParseInt(p + 1, 0, 6, &weekday)) != nullptr) {
+            res->date.fmt = PosixTransition::M;
+            res->date.m.month = static_cast<std::int_fast8_t>(month);
+            res->date.m.week = static_cast<std::int_fast8_t>(week);
+            res->date.m.weekday = static_cast<std::int_fast8_t>(weekday);
+          }
+        }
+      }
+    } else if (*p == 'J') {
+      int day = 0;
+      if ((p = ParseInt(p + 1, 1, 365, &day)) != nullptr) {
+        res->date.fmt = PosixTransition::J;
+        res->date.j.day = static_cast<std::int_fast16_t>(day);
+      }
+    } else {
+      int day = 0;
+      if ((p = ParseInt(p, 0, 365, &day)) != nullptr) {
+        res->date.fmt = PosixTransition::N;
+        res->date.n.day = static_cast<std::int_fast16_t>(day);
+      }
+    }
+  }
+  if (p != nullptr) {
+    res->time.offset = 2 * 60 * 60;  // default offset is 02:00:00
+    if (*p == '/') p = ParseOffset(p + 1, -167, 167, 1, &res->time.offset);
+  }
+  return p;
+}
+
+}  // namespace
+
+// spec = std offset [ dst [ offset ] , datetime , datetime ]
+bool ParsePosixSpec(const std::string& spec, PosixTimeZone* res) {
+  const char* p = spec.c_str();
+  if (*p == ':') return false;
+
+  p = ParseAbbr(p, &res->std_abbr);
+  p = ParseOffset(p, 0, 24, -1, &res->std_offset);
+  if (p == nullptr) return false;
+  if (*p == '\0') return true;
+
+  p = ParseAbbr(p, &res->dst_abbr);
+  if (p == nullptr) return false;
+  res->dst_offset = res->std_offset + (60 * 60);  // default
+  if (*p != ',') p = ParseOffset(p, 0, 24, -1, &res->dst_offset);
+
+  p = ParseDateTime(p, &res->dst_start);
+  p = ParseDateTime(p, &res->dst_end);
+
+  return p != nullptr && *p == '\0';
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/src/time_zone_posix.h b/absl/time/internal/cctz/src/time_zone_posix.h
new file mode 100644
index 0000000..6a60022
--- /dev/null
+++ b/absl/time/internal/cctz/src/time_zone_posix.h
@@ -0,0 +1,128 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+// Parsing of a POSIX zone spec as described in the TZ part of section 8.3 in
+// http://pubs.opengroup.org/onlinepubs/009695399/basedefs/xbd_chap08.html.
+//
+// The current POSIX spec for America/Los_Angeles is "PST8PDT,M3.2.0,M11.1.0",
+// which would be broken down as ...
+//
+//   PosixTimeZone {
+//     std_abbr = "PST"
+//     std_offset = -28800
+//     dst_abbr = "PDT"
+//     dst_offset = -25200
+//     dst_start = PosixTransition {
+//       date {
+//         m {
+//           month = 3
+//           week = 2
+//           weekday = 0
+//         }
+//       }
+//       time {
+//         offset = 7200
+//       }
+//     }
+//     dst_end = PosixTransition {
+//       date {
+//         m {
+//           month = 11
+//           week = 1
+//           weekday = 0
+//         }
+//       }
+//       time {
+//         offset = 7200
+//       }
+//     }
+//   }
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
+
+#include <cstdint>
+#include <string>
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// The date/time of the transition. The date is specified as either:
+// (J) the Nth day of the year (1 <= N <= 365), excluding leap days, or
+// (N) the Nth day of the year (0 <= N <= 365), including leap days, or
+// (M) the Nth weekday of a month (e.g., the 2nd Sunday in March).
+// The time, specified as a day offset, identifies the particular moment
+// of the transition, and may be negative or >= 24h, and in which case
+// it would take us to another day, and perhaps week, or even month.
+struct PosixTransition {
+  enum DateFormat { J, N, M };
+
+  struct Date {
+    struct NonLeapDay {
+      std::int_fast16_t day;  // day of non-leap year [1:365]
+    };
+    struct Day {
+      std::int_fast16_t day;  // day of year [0:365]
+    };
+    struct MonthWeekWeekday {
+      std::int_fast8_t month;    // month of year [1:12]
+      std::int_fast8_t week;     // week of month [1:5] (5==last)
+      std::int_fast8_t weekday;  // 0==Sun, ..., 6=Sat
+    };
+
+    DateFormat fmt;
+
+    union {
+      NonLeapDay j;
+      Day n;
+      MonthWeekWeekday m;
+    };
+  };
+
+  struct Time {
+    std::int_fast32_t offset;  // seconds before/after 00:00:00
+  };
+
+  Date date;
+  Time time;
+};
+
+// The entirety of a POSIX-string specified time-zone rule. The standard
+// abbreviation and offset are always given. If the time zone includes
+// daylight saving, then the daylight abbrevation is non-empty and the
+// remaining fields are also valid. Note that the start/end transitions
+// are not ordered---in the southern hemisphere the transition to end
+// daylight time occurs first in any particular year.
+struct PosixTimeZone {
+  std::string std_abbr;
+  std::int_fast32_t std_offset;
+
+  std::string dst_abbr;
+  std::int_fast32_t dst_offset;
+  PosixTransition dst_start;
+  PosixTransition dst_end;
+};
+
+// Breaks down a POSIX time-zone specification into its constituent pieces,
+// filling in any missing values (DST offset, or start/end transition times)
+// with the standard-defined defaults. Returns false if the specification
+// could not be parsed (although some fields of *res may have been altered).
+bool ParsePosixSpec(const std::string& spec, PosixTimeZone* res);
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
diff --git a/absl/time/internal/cctz/src/tzfile.h b/absl/time/internal/cctz/src/tzfile.h
new file mode 100644
index 0000000..51b1f1f
--- /dev/null
+++ b/absl/time/internal/cctz/src/tzfile.h
@@ -0,0 +1,123 @@
+/* Layout and location of TZif files.  */
+
+#ifndef TZFILE_H
+
+#define TZFILE_H
+
+/*
+** This file is in the public domain, so clarified as of
+** 1996-06-05 by Arthur David Olson.
+*/
+
+/*
+** This header is for use ONLY with the time conversion code.
+** There is no guarantee that it will remain unchanged,
+** or that it will remain at all.
+** Do NOT copy it to any system include directory.
+** Thank you!
+*/
+
+/*
+** Information about time zone files.
+*/
+
+#ifndef TZDIR
+#define TZDIR	"/usr/share/zoneinfo" /* Time zone object file directory */
+#endif /* !defined TZDIR */
+
+#ifndef TZDEFAULT
+#define TZDEFAULT	"/etc/localtime"
+#endif /* !defined TZDEFAULT */
+
+#ifndef TZDEFRULES
+#define TZDEFRULES	"posixrules"
+#endif /* !defined TZDEFRULES */
+
+
+/* See Internet RFC 8536 for more details about the following format.  */
+
+/*
+** Each file begins with. . .
+*/
+
+#define	TZ_MAGIC	"TZif"
+
+struct tzhead {
+	char	tzh_magic[4];		/* TZ_MAGIC */
+	char	tzh_version[1];		/* '\0' or '2' or '3' as of 2013 */
+	char	tzh_reserved[15];	/* reserved; must be zero */
+	char	tzh_ttisutcnt[4];	/* coded number of trans. time flags */
+	char	tzh_ttisstdcnt[4];	/* coded number of trans. time flags */
+	char	tzh_leapcnt[4];		/* coded number of leap seconds */
+	char	tzh_timecnt[4];		/* coded number of transition times */
+	char	tzh_typecnt[4];		/* coded number of local time types */
+	char	tzh_charcnt[4];		/* coded number of abbr. chars */
+};
+
+/*
+** . . .followed by. . .
+**
+**	tzh_timecnt (char [4])s		coded transition times a la time(2)
+**	tzh_timecnt (unsigned char)s	types of local time starting at above
+**	tzh_typecnt repetitions of
+**		one (char [4])		coded UT offset in seconds
+**		one (unsigned char)	used to set tm_isdst
+**		one (unsigned char)	that's an abbreviation list index
+**	tzh_charcnt (char)s		'\0'-terminated zone abbreviations
+**	tzh_leapcnt repetitions of
+**		one (char [4])		coded leap second transition times
+**		one (char [4])		total correction after above
+**	tzh_ttisstdcnt (char)s		indexed by type; if 1, transition
+**					time is standard time, if 0,
+**					transition time is local (wall clock)
+**					time; if absent, transition times are
+**					assumed to be local time
+**	tzh_ttisutcnt (char)s		indexed by type; if 1, transition
+**					time is UT, if 0, transition time is
+**					local time; if absent, transition
+**					times are assumed to be local time.
+**					When this is 1, the corresponding
+**					std/wall indicator must also be 1.
+*/
+
+/*
+** If tzh_version is '2' or greater, the above is followed by a second instance
+** of tzhead and a second instance of the data in which each coded transition
+** time uses 8 rather than 4 chars,
+** then a POSIX-TZ-environment-variable-style std::string for use in handling
+** instants after the last transition time stored in the file
+** (with nothing between the newlines if there is no POSIX representation for
+** such instants).
+**
+** If tz_version is '3' or greater, the above is extended as follows.
+** First, the POSIX TZ std::string's hour offset may range from -167
+** through 167 as compared to the POSIX-required 0 through 24.
+** Second, its DST start time may be January 1 at 00:00 and its stop
+** time December 31 at 24:00 plus the difference between DST and
+** standard time, indicating DST all year.
+*/
+
+/*
+** In the current implementation, "tzset()" refuses to deal with files that
+** exceed any of the limits below.
+*/
+
+#ifndef TZ_MAX_TIMES
+#define TZ_MAX_TIMES	2000
+#endif /* !defined TZ_MAX_TIMES */
+
+#ifndef TZ_MAX_TYPES
+/* This must be at least 17 for Europe/Samara and Europe/Vilnius.  */
+#define TZ_MAX_TYPES	256 /* Limited by what (unsigned char)'s can hold */
+#endif /* !defined TZ_MAX_TYPES */
+
+#ifndef TZ_MAX_CHARS
+#define TZ_MAX_CHARS	50	/* Maximum number of abbreviation characters */
+				/* (limited by what unsigned chars can hold) */
+#endif /* !defined TZ_MAX_CHARS */
+
+#ifndef TZ_MAX_LEAPS
+#define TZ_MAX_LEAPS	50	/* Maximum number of leap second corrections */
+#endif /* !defined TZ_MAX_LEAPS */
+
+#endif /* !defined TZFILE_H */
diff --git a/absl/time/internal/cctz/src/zone_info_source.cc b/absl/time/internal/cctz/src/zone_info_source.cc
new file mode 100644
index 0000000..42f50c5
--- /dev/null
+++ b/absl/time/internal/cctz/src/zone_info_source.cc
@@ -0,0 +1,77 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+
+namespace absl {
+namespace time_internal {
+namespace cctz {
+
+// Defined out-of-line to avoid emitting a weak vtable in all TUs.
+ZoneInfoSource::~ZoneInfoSource() {}
+std::string ZoneInfoSource::Version() const { return std::string(); }
+
+}  // namespace cctz
+}  // namespace time_internal
+}  // namespace absl
+
+namespace absl {
+namespace time_internal {
+namespace cctz_extension {
+
+namespace {
+
+// A default for cctz_extension::zone_info_source_factory, which simply
+// defers to the fallback factory.
+std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource> DefaultFactory(
+    const std::string& name,
+    const std::function<std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource>(
+        const std::string& name)>& fallback_factory) {
+  return fallback_factory(name);
+}
+
+}  // namespace
+
+// A "weak" definition for cctz_extension::zone_info_source_factory.
+// The user may override this with their own "strong" definition (see
+// zone_info_source.h).
+#if !defined(__has_attribute)
+#define __has_attribute(x) 0
+#endif
+#if __has_attribute(weak) || defined(__GNUC__)
+ZoneInfoSourceFactory zone_info_source_factory
+    __attribute__((weak)) = DefaultFactory;
+#elif defined(_MSC_VER) && !defined(_LIBCPP_VERSION)
+extern ZoneInfoSourceFactory zone_info_source_factory;
+extern ZoneInfoSourceFactory default_factory;
+ZoneInfoSourceFactory default_factory = DefaultFactory;
+#if defined(_M_IX86)
+#pragma comment( \
+    linker,      \
+    "/alternatename:?zone_info_source_factory@cctz_extension@time_internal@absl@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@absl@@U?$default_delete@VZoneInfoSource@cctz@time_internal@absl@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@5@ABV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@absl@@U?$default_delete@VZoneInfoSource@cctz@time_internal@absl@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@5@@ZA=?default_factory@cctz_extension@time_internal@absl@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@absl@@U?$default_delete@VZoneInfoSource@cctz@time_internal@absl@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@5@ABV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@absl@@U?$default_delete@VZoneInfoSource@cctz@time_internal@absl@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@5@@ZA")
+#elif defined(_M_IA_64) || defined(_M_AMD64) || defined(_M_ARM64)
+#pragma comment( \
+    linker,      \
+    "/alternatename:?zone_info_source_factory@cctz_extension@time_internal@absl@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@absl@@U?$default_delete@VZoneInfoSource@cctz@time_internal@absl@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@5@AEBV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@absl@@U?$default_delete@VZoneInfoSource@cctz@time_internal@absl@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@5@@ZEA=?default_factory@cctz_extension@time_internal@absl@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@absl@@U?$default_delete@VZoneInfoSource@cctz@time_internal@absl@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@5@AEBV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@absl@@U?$default_delete@VZoneInfoSource@cctz@time_internal@absl@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@5@@ZEA")
+#else
+#error Unsupported MSVC platform
+#endif  // _M_<PLATFORM>
+#else
+// Make it a "strong" definition if we have no other choice.
+ZoneInfoSourceFactory zone_info_source_factory = DefaultFactory;
+#endif
+
+}  // namespace cctz_extension
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/cctz/testdata/README.zoneinfo b/absl/time/internal/cctz/testdata/README.zoneinfo
new file mode 100644
index 0000000..95fb4a9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/README.zoneinfo
@@ -0,0 +1,37 @@
+testdata/zoneinfo contains time-zone data files that may be used with CCTZ.
+Install them in a location referenced by the ${TZDIR} environment variable.
+Symbolic and hard links have been eliminated for portability.
+
+On Linux systems the distribution's versions of these files can probably
+already be found in the default ${TZDIR} location, /usr/share/zoneinfo.
+
+New versions can be generated using the following shell script.
+
+  #!/bin/sh -
+  set -e
+  DESTDIR=$(mktemp -d)
+  trap "rm -fr ${DESTDIR}" 0 2 15
+  (
+    cd ${DESTDIR}
+    git clone https://github.com/eggert/tz.git
+    make --directory=tz \
+        install DESTDIR=${DESTDIR} \
+                DATAFORM=vanguard \
+                TZDIR=/zoneinfo \
+                REDO=posix_only \
+                LOCALTIME=Factory \
+                TZDATA_TEXT= \
+                ZONETABLES=zone1970.tab
+    tar --create --dereference --hard-dereference --file tzfile.tar \
+        --directory=tz tzfile.h
+    tar --create --dereference --hard-dereference --file zoneinfo.tar \
+        --exclude=zoneinfo/posixrules zoneinfo \
+        --directory=tz version
+  )
+  tar --extract --directory src --file ${DESTDIR}/tzfile.tar
+  tar --extract --directory testdata --file ${DESTDIR}/zoneinfo.tar
+  exit 0
+
+To run the CCTZ tests using the testdata/zoneinfo files, execute:
+
+  bazel test --test_env=TZDIR=${PWD}/testdata/zoneinfo ...
diff --git a/absl/time/internal/cctz/testdata/version b/absl/time/internal/cctz/testdata/version
new file mode 100644
index 0000000..db18f83
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/version
@@ -0,0 +1 @@
+2019c
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra
new file mode 100644
index 0000000..697b993
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers
new file mode 100644
index 0000000..ae04342
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau
new file mode 100644
index 0000000..82ea5aa
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre
new file mode 100644
index 0000000..52753c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura
new file mode 100644
index 0000000..52753c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo
new file mode 100644
index 0000000..d3f8196
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca
new file mode 100644
index 0000000..245f4eb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta
new file mode 100644
index 0000000..850c8f0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun b/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun
new file mode 100644
index 0000000..a91f65f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone
new file mode 100644
index 0000000..52753c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare
new file mode 100644
index 0000000..52753c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg
new file mode 100644
index 0000000..b1c425d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba
new file mode 100644
index 0000000..625b1ac
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum
new file mode 100644
index 0000000..8ee8cb9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali
new file mode 100644
index 0000000..52753c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi
new file mode 100644
index 0000000..52753c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka
new file mode 100644
index 0000000..52753c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo
new file mode 100644
index 0000000..52753c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru
new file mode 100644
index 0000000..b1c425d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane
new file mode 100644
index 0000000..b1c425d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia
new file mode 100644
index 0000000..6d68850
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena
new file mode 100644
index 0000000..a968845
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo
new file mode 100644
index 0000000..0c80137
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome
new file mode 100644
index 0000000..59f3759
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli
new file mode 100644
index 0000000..07b393b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis
new file mode 100644
index 0000000..427fa56
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek
new file mode 100644
index 0000000..abecd13
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Adak b/absl/time/internal/cctz/testdata/zoneinfo/America/Adak
new file mode 100644
index 0000000..4323649
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Adak
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage b/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage
new file mode 100644
index 0000000..9bbb2fd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla b/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua b/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina b/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina
new file mode 100644
index 0000000..49381b4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires
new file mode 100644
index 0000000..260f86a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca
new file mode 100644
index 0000000..0ae222a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia
new file mode 100644
index 0000000..0ae222a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba
new file mode 100644
index 0000000..da4c23a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy
new file mode 100644
index 0000000..604b856
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja
new file mode 100644
index 0000000..2218e36
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza
new file mode 100644
index 0000000..f9e677f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos
new file mode 100644
index 0000000..c36587e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta
new file mode 100644
index 0000000..0e797f2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan
new file mode 100644
index 0000000..2698495
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis
new file mode 100644
index 0000000..fe50f62
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman
new file mode 100644
index 0000000..c954000
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia
new file mode 100644
index 0000000..3643628
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba b/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba
new file mode 100644
index 0000000..f7ab6ef
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion b/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion
new file mode 100644
index 0000000..2f3bbda
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan b/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan
new file mode 100644
index 0000000..629ed42
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Atka b/absl/time/internal/cctz/testdata/zoneinfo/America/Atka
new file mode 100644
index 0000000..4323649
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Atka
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia b/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia
new file mode 100644
index 0000000..15808d3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas b/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas
new file mode 100644
index 0000000..896af3f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados b/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados
new file mode 100644
index 0000000..9b90e30
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Belem b/absl/time/internal/cctz/testdata/zoneinfo/America/Belem
new file mode 100644
index 0000000..60b5924
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Belem
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Belize b/absl/time/internal/cctz/testdata/zoneinfo/America/Belize
new file mode 100644
index 0000000..851051a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Belize
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon b/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon
new file mode 100644
index 0000000..f9f13a1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista b/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista
new file mode 100644
index 0000000..978c331
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota b/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota
new file mode 100644
index 0000000..b2647d7a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Boise b/absl/time/internal/cctz/testdata/zoneinfo/America/Boise
new file mode 100644
index 0000000..f8d54e2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Boise
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires b/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires
new file mode 100644
index 0000000..260f86a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay b/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay
new file mode 100644
index 0000000..f8db4b6
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande b/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande
new file mode 100644
index 0000000..8120624
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun b/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun
new file mode 100644
index 0000000..f907f0a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas b/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas
new file mode 100644
index 0000000..eedf725
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca b/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca
new file mode 100644
index 0000000..0ae222a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne b/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne
new file mode 100644
index 0000000..e5bc06f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman b/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman
new file mode 100644
index 0000000..9964b9a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago b/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago
new file mode 100644
index 0000000..a5b1617
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua b/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua
new file mode 100644
index 0000000..8ed5f93
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour b/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour
new file mode 100644
index 0000000..629ed42
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba b/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba
new file mode 100644
index 0000000..da4c23a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica b/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica
new file mode 100644
index 0000000..37cb85e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Creston b/absl/time/internal/cctz/testdata/zoneinfo/America/Creston
new file mode 100644
index 0000000..ca64857
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Creston
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba b/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba
new file mode 100644
index 0000000..9bea3d4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao b/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao
new file mode 100644
index 0000000..f7ab6ef
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn b/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn
new file mode 100644
index 0000000..9549adc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson b/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson
new file mode 100644
index 0000000..db9cead
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek b/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek
new file mode 100644
index 0000000..db9e339
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Denver b/absl/time/internal/cctz/testdata/zoneinfo/America/Denver
new file mode 100644
index 0000000..5fbe26b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Denver
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit b/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit
new file mode 100644
index 0000000..e104faa
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica b/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton b/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton
new file mode 100644
index 0000000..cd78a6f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe b/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe
new file mode 100644
index 0000000..39d6dae
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador b/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador
new file mode 100644
index 0000000..e2f2230
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada b/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada
new file mode 100644
index 0000000..ada6bf7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson b/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson
new file mode 100644
index 0000000..5a0b7f1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne b/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne
new file mode 100644
index 0000000..09511cc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza b/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza
new file mode 100644
index 0000000..be57dc2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay b/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay
new file mode 100644
index 0000000..48412a4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab b/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab
new file mode 100644
index 0000000..0160308
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay b/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay
new file mode 100644
index 0000000..a3f2990
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk b/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk
new file mode 100644
index 0000000..b9bb063
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada b/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe b/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala b/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala
new file mode 100644
index 0000000..407138c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil b/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil
new file mode 100644
index 0000000..0559a7a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana b/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana
new file mode 100644
index 0000000..d5dab14
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax b/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax
new file mode 100644
index 0000000..756099a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Havana b/absl/time/internal/cctz/testdata/zoneinfo/America/Havana
new file mode 100644
index 0000000..b69ac45
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Havana
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo b/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo
new file mode 100644
index 0000000..791a9fa
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis
new file mode 100644
index 0000000..09511cc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox
new file mode 100644
index 0000000..fcd408d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo
new file mode 100644
index 0000000..1abf75e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg
new file mode 100644
index 0000000..0133548
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City
new file mode 100644
index 0000000..7bbb653
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay
new file mode 100644
index 0000000..d236b7c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes
new file mode 100644
index 0000000..c818929
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac
new file mode 100644
index 0000000..630935c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis b/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis
new file mode 100644
index 0000000..09511cc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik b/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik
new file mode 100644
index 0000000..87bb355
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit b/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit
new file mode 100644
index 0000000..c8138bd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica b/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica
new file mode 100644
index 0000000..2a9b7fd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy b/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy
new file mode 100644
index 0000000..604b856
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau b/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau
new file mode 100644
index 0000000..451f349
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville b/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville
new file mode 100644
index 0000000..177836e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello b/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello
new file mode 100644
index 0000000..438e3ea
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN b/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN
new file mode 100644
index 0000000..fcd408d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk b/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk
new file mode 100644
index 0000000..f7ab6ef
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz b/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz
new file mode 100644
index 0000000..a101372
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Lima b/absl/time/internal/cctz/testdata/zoneinfo/America/Lima
new file mode 100644
index 0000000..3c6529b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Lima
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles b/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles
new file mode 100644
index 0000000..9dad4f4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville b/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville
new file mode 100644
index 0000000..177836e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes b/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes
new file mode 100644
index 0000000..f7ab6ef
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio b/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio
new file mode 100644
index 0000000..bc8b951
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Managua b/absl/time/internal/cctz/testdata/zoneinfo/America/Managua
new file mode 100644
index 0000000..e0242bf
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Managua
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus b/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus
new file mode 100644
index 0000000..63d58f8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot b/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique b/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique
new file mode 100644
index 0000000..8df43dc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros b/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros
new file mode 100644
index 0000000..047968d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan b/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan
new file mode 100644
index 0000000..e4a7857
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza b/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza
new file mode 100644
index 0000000..f9e677f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee b/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee
new file mode 100644
index 0000000..3146138
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Merida b/absl/time/internal/cctz/testdata/zoneinfo/America/Merida
new file mode 100644
index 0000000..ea852da
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Merida
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla b/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla
new file mode 100644
index 0000000..1e94be3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City b/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City
new file mode 100644
index 0000000..e7fb6f2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon b/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon
new file mode 100644
index 0000000..b924b71
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton b/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton
new file mode 100644
index 0000000..9df8d0f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey b/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey
new file mode 100644
index 0000000..a8928c8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo b/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo
new file mode 100644
index 0000000..2f357bc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal b/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal
new file mode 100644
index 0000000..6752c5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat b/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau b/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau
new file mode 100644
index 0000000..33cc6c6
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/New_York b/absl/time/internal/cctz/testdata/zoneinfo/America/New_York
new file mode 100644
index 0000000..2f75480
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/New_York
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon b/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon
new file mode 100644
index 0000000..f6a856e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Nome b/absl/time/internal/cctz/testdata/zoneinfo/America/Nome
new file mode 100644
index 0000000..10998df
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Nome
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha b/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha
new file mode 100644
index 0000000..f140726
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah b/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah
new file mode 100644
index 0000000..246345d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center b/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center
new file mode 100644
index 0000000..1fa0703
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem b/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem
new file mode 100644
index 0000000..123f2ae
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga b/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga
new file mode 100644
index 0000000..fc4a03e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Panama b/absl/time/internal/cctz/testdata/zoneinfo/America/Panama
new file mode 100644
index 0000000..9964b9a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Panama
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung b/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung
new file mode 100644
index 0000000..3e4e0db
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo b/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo
new file mode 100644
index 0000000..bc8a6ed
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix b/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix
new file mode 100644
index 0000000..ac6bb0c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince b/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince
new file mode 100644
index 0000000..287f143
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain b/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre b/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre
new file mode 100644
index 0000000..a374cb4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho b/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho
new file mode 100644
index 0000000..2e873a5
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico b/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico
new file mode 100644
index 0000000..a662a57
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas b/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas
new file mode 100644
index 0000000..a5a8af5
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River b/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River
new file mode 100644
index 0000000..ea66099
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet b/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet
new file mode 100644
index 0000000..3a70587
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Recife b/absl/time/internal/cctz/testdata/zoneinfo/America/Recife
new file mode 100644
index 0000000..d7abb16
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Recife
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Regina b/absl/time/internal/cctz/testdata/zoneinfo/America/Regina
new file mode 100644
index 0000000..20c9c84
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Regina
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute b/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute
new file mode 100644
index 0000000..0a73b75
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco b/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco
new file mode 100644
index 0000000..a374cb4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario b/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario
new file mode 100644
index 0000000..da4c23a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel b/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel
new file mode 100644
index 0000000..ada6bf7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem b/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem
new file mode 100644
index 0000000..c28f360
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago b/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago
new file mode 100644
index 0000000..816a042
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo b/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo
new file mode 100644
index 0000000..4fe36fd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo b/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo
new file mode 100644
index 0000000..13ff083
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund b/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund
new file mode 100644
index 0000000..e20e9e1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock b/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock
new file mode 100644
index 0000000..5fbe26b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka b/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka
new file mode 100644
index 0000000..31f7061
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns
new file mode 100644
index 0000000..65a5b0c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current b/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current
new file mode 100644
index 0000000..8e9ef25
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa b/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa
new file mode 100644
index 0000000..2adacb2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Thule b/absl/time/internal/cctz/testdata/zoneinfo/America/Thule
new file mode 100644
index 0000000..6f802f1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Thule
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay b/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay
new file mode 100644
index 0000000..e504c9a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana b/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana
new file mode 100644
index 0000000..ada6bf7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto b/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto
new file mode 100644
index 0000000..6752c5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola b/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver b/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver
new file mode 100644
index 0000000..bb60cbc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin b/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin
new file mode 100644
index 0000000..697cf5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse b/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse
new file mode 100644
index 0000000..fb3cd71
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg b/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg
new file mode 100644
index 0000000..ac40299
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat b/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat
new file mode 100644
index 0000000..da209f9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife b/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife
new file mode 100644
index 0000000..e6afa39
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey
new file mode 100644
index 0000000..f100f47
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis
new file mode 100644
index 0000000..916f2c2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville
new file mode 100644
index 0000000..a71b39c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie
new file mode 100644
index 0000000..616afd9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson
new file mode 100644
index 0000000..b32e7fd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo
new file mode 100644
index 0000000..6575fdc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer
new file mode 100644
index 0000000..3dd85f8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera
new file mode 100644
index 0000000..8b2430a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole
new file mode 100644
index 0000000..6575fdc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa
new file mode 100644
index 0000000..254af7d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll
new file mode 100644
index 0000000..5e565da
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok
new file mode 100644
index 0000000..7283053
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen b/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen
new file mode 100644
index 0000000..15a34c3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden
new file mode 100644
index 0000000..2aea25f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty
new file mode 100644
index 0000000..a4b0077
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman
new file mode 100644
index 0000000..c9e8707
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr
new file mode 100644
index 0000000..6ed8b7c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau
new file mode 100644
index 0000000..e2d0f91
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe
new file mode 100644
index 0000000..06f0a13
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat
new file mode 100644
index 0000000..73891af
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad
new file mode 100644
index 0000000..73891af
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau
new file mode 100644
index 0000000..8b5153e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad
new file mode 100644
index 0000000..f7162ed
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain
new file mode 100644
index 0000000..63188b2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku
new file mode 100644
index 0000000..a0de74b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok
new file mode 100644
index 0000000..c292ac5
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul
new file mode 100644
index 0000000..759592a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut
new file mode 100644
index 0000000..fb266ed
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek
new file mode 100644
index 0000000..f6e20dd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei
new file mode 100644
index 0000000..3dab0ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta
new file mode 100644
index 0000000..0014046
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita
new file mode 100644
index 0000000..c4149c0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan
new file mode 100644
index 0000000..e48daa8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing
new file mode 100644
index 0000000..3c0bef2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking
new file mode 100644
index 0000000..3c0bef2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo
new file mode 100644
index 0000000..62c64d8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca
new file mode 100644
index 0000000..b11c928
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus
new file mode 100644
index 0000000..d9104a7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka
new file mode 100644
index 0000000..b11c928
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili
new file mode 100644
index 0000000..30943bb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai
new file mode 100644
index 0000000..fc0a589
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe
new file mode 100644
index 0000000..82d85b8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta
new file mode 100644
index 0000000..653b146
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza
new file mode 100644
index 0000000..592b632
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin
new file mode 100644
index 0000000..3c0bef2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron
new file mode 100644
index 0000000..ae82f9b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh
new file mode 100644
index 0000000..e2934e3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong
new file mode 100644
index 0000000..23d0375
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd
new file mode 100644
index 0000000..4cb800a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk
new file mode 100644
index 0000000..4dcbbb7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul
new file mode 100644
index 0000000..508446b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta
new file mode 100644
index 0000000..5baa3a8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura
new file mode 100644
index 0000000..3002c82
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem
new file mode 100644
index 0000000..440ef06
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul
new file mode 100644
index 0000000..d19b9bd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka
new file mode 100644
index 0000000..3e80b4e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi
new file mode 100644
index 0000000..ba65c0e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar
new file mode 100644
index 0000000..faa14d9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu
new file mode 100644
index 0000000..a5d5107
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu
new file mode 100644
index 0000000..a5d5107
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga
new file mode 100644
index 0000000..72bea64
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata
new file mode 100644
index 0000000..0014046
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk
new file mode 100644
index 0000000..30c6f16
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur
new file mode 100644
index 0000000..612b01e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching
new file mode 100644
index 0000000..c86750c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait
new file mode 100644
index 0000000..2aea25f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao
new file mode 100644
index 0000000..cac6506
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau
new file mode 100644
index 0000000..cac6506
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan
new file mode 100644
index 0000000..b4fcac1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar
new file mode 100644
index 0000000..556ba86
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila
new file mode 100644
index 0000000..f4f4b04
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat
new file mode 100644
index 0000000..fc0a589
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia
new file mode 100644
index 0000000..f7f10ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk
new file mode 100644
index 0000000..d983276
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk
new file mode 100644
index 0000000..e0ee5fc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk
new file mode 100644
index 0000000..b29b769
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral
new file mode 100644
index 0000000..ad1f9ca
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh
new file mode 100644
index 0000000..c292ac5
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak
new file mode 100644
index 0000000..12ce24c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang
new file mode 100644
index 0000000..7ad7e0b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar
new file mode 100644
index 0000000..63188b2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay
new file mode 100644
index 0000000..73b9d96
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda
new file mode 100644
index 0000000..c2fe4c1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon
new file mode 100644
index 0000000..dd77395
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh
new file mode 100644
index 0000000..2aea25f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon
new file mode 100644
index 0000000..e2934e3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin
new file mode 100644
index 0000000..485459c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand
new file mode 100644
index 0000000..030d47c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul
new file mode 100644
index 0000000..96199e7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai
new file mode 100644
index 0000000..3c0bef2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore
new file mode 100644
index 0000000..2364b21
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk
new file mode 100644
index 0000000..261a983
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei
new file mode 100644
index 0000000..24c4344
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent
new file mode 100644
index 0000000..32a9d7d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi
new file mode 100644
index 0000000..b608d79
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran
new file mode 100644
index 0000000..8cec5ad
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv
new file mode 100644
index 0000000..440ef06
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu
new file mode 100644
index 0000000..fe409c7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu
new file mode 100644
index 0000000..fe409c7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo
new file mode 100644
index 0000000..26f4d34
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk
new file mode 100644
index 0000000..670e2ad
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang
new file mode 100644
index 0000000..556ba86
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar
new file mode 100644
index 0000000..2e20cc3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator
new file mode 100644
index 0000000..2e20cc3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi
new file mode 100644
index 0000000..faa14d9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera
new file mode 100644
index 0000000..9e4a78f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane
new file mode 100644
index 0000000..c292ac5
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok
new file mode 100644
index 0000000..8ab253c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk
new file mode 100644
index 0000000..c815e99
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon
new file mode 100644
index 0000000..dd77395
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg
new file mode 100644
index 0000000..6958d7e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan
new file mode 100644
index 0000000..250bfe0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores
new file mode 100644
index 0000000..56593db
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda
new file mode 100644
index 0000000..419c660
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary
new file mode 100644
index 0000000..f319215
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde
new file mode 100644
index 0000000..e2a49d2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe
new file mode 100644
index 0000000..4dab7ef
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe
new file mode 100644
index 0000000..4dab7ef
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen
new file mode 100644
index 0000000..15a34c3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira
new file mode 100644
index 0000000..5213761
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik
new file mode 100644
index 0000000..10e0fc8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia
new file mode 100644
index 0000000..4466608
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena
new file mode 100644
index 0000000..28b32ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley
new file mode 100644
index 0000000..88077f1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT b/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT
new file mode 100644
index 0000000..7636592
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide
new file mode 100644
index 0000000..0b1252a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane
new file mode 100644
index 0000000..3021bdb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill
new file mode 100644
index 0000000..1ac3fc8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra
new file mode 100644
index 0000000..7636592
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie
new file mode 100644
index 0000000..f65a990
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin
new file mode 100644
index 0000000..1cf5029
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla
new file mode 100644
index 0000000..98ae557
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart
new file mode 100644
index 0000000..02b07ca
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI b/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI
new file mode 100644
index 0000000..9e04a80
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman
new file mode 100644
index 0000000..eab0fb9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe
new file mode 100644
index 0000000..9e04a80
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne
new file mode 100644
index 0000000..ba45733
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW b/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW
new file mode 100644
index 0000000..7636592
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/North b/absl/time/internal/cctz/testdata/zoneinfo/Australia/North
new file mode 100644
index 0000000..1cf5029
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/North
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth
new file mode 100644
index 0000000..a876b9e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland
new file mode 100644
index 0000000..3021bdb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/South b/absl/time/internal/cctz/testdata/zoneinfo/Australia/South
new file mode 100644
index 0000000..0b1252a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/South
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney
new file mode 100644
index 0000000..7636592
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania
new file mode 100644
index 0000000..02b07ca
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria
new file mode 100644
index 0000000..ba45733
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/West b/absl/time/internal/cctz/testdata/zoneinfo/Australia/West
new file mode 100644
index 0000000..a876b9e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/West
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna
new file mode 100644
index 0000000..1ac3fc8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre b/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre
new file mode 100644
index 0000000..a374cb4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha b/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha
new file mode 100644
index 0000000..f140726
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East b/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East
new file mode 100644
index 0000000..13ff083
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West b/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West
new file mode 100644
index 0000000..63d58f8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/CET b/absl/time/internal/cctz/testdata/zoneinfo/CET
new file mode 100644
index 0000000..122e934
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/CET
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT b/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT
new file mode 100644
index 0000000..ca67929
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic
new file mode 100644
index 0000000..756099a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central
new file mode 100644
index 0000000..ac40299
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern
new file mode 100644
index 0000000..6752c5b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain
new file mode 100644
index 0000000..cd78a6f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland
new file mode 100644
index 0000000..65a5b0c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific
new file mode 100644
index 0000000..bb60cbc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan
new file mode 100644
index 0000000..20c9c84
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon
new file mode 100644
index 0000000..fb3cd71
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental b/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental
new file mode 100644
index 0000000..816a042
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland b/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland
new file mode 100644
index 0000000..cae3744
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Cuba b/absl/time/internal/cctz/testdata/zoneinfo/Cuba
new file mode 100644
index 0000000..b69ac45
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Cuba
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/EET b/absl/time/internal/cctz/testdata/zoneinfo/EET
new file mode 100644
index 0000000..cbdb71d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/EET
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/EST b/absl/time/internal/cctz/testdata/zoneinfo/EST
new file mode 100644
index 0000000..21ebc00
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/EST
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT b/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT
new file mode 100644
index 0000000..9bce500
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Egypt b/absl/time/internal/cctz/testdata/zoneinfo/Egypt
new file mode 100644
index 0000000..d3f8196
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Egypt
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Eire b/absl/time/internal/cctz/testdata/zoneinfo/Eire
new file mode 100644
index 0000000..1d99490
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Eire
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1
new file mode 100644
index 0000000..4dab6f9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10
new file mode 100644
index 0000000..c749290
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11
new file mode 100644
index 0000000..d969982
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12
new file mode 100644
index 0000000..cdeec90
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2
new file mode 100644
index 0000000..fbd2a94
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3
new file mode 100644
index 0000000..ee246ef
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4
new file mode 100644
index 0000000..5a25ff2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5
new file mode 100644
index 0000000..c0b745f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6
new file mode 100644
index 0000000..06e777d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7
new file mode 100644
index 0000000..4e0b53a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8
new file mode 100644
index 0000000..714b0c5
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9
new file mode 100644
index 0000000..78b9daa
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1
new file mode 100644
index 0000000..a838beb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10
new file mode 100644
index 0000000..68ff77d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11
new file mode 100644
index 0000000..66af5a4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12
new file mode 100644
index 0000000..17ba505
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13
new file mode 100644
index 0000000..5f3706c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14
new file mode 100644
index 0000000..7e9f9c4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2
new file mode 100644
index 0000000..fcef6d9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3
new file mode 100644
index 0000000..27973bc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4
new file mode 100644
index 0000000..1efd841
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5
new file mode 100644
index 0000000..1f76184
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6
new file mode 100644
index 0000000..952681e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7
new file mode 100644
index 0000000..cefc912
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8
new file mode 100644
index 0000000..afb093d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9
new file mode 100644
index 0000000..9265fb7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0 b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich b/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT b/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT
new file mode 100644
index 0000000..91558be
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC b/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC
new file mode 100644
index 0000000..91558be
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal b/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal
new file mode 100644
index 0000000..91558be
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu b/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu
new file mode 100644
index 0000000..91558be
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam
new file mode 100644
index 0000000..c3ff07b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra
new file mode 100644
index 0000000..5962550
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan
new file mode 100644
index 0000000..73a4d01
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens
new file mode 100644
index 0000000..9f3a067
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast
new file mode 100644
index 0000000..ac02a81
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade
new file mode 100644
index 0000000..27de456
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin
new file mode 100644
index 0000000..7f6d958
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava
new file mode 100644
index 0000000..ce8f433
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels
new file mode 100644
index 0000000..40d7124
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest
new file mode 100644
index 0000000..4303b90
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest
new file mode 100644
index 0000000..6b94a4f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen
new file mode 100644
index 0000000..ad6cf59
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau
new file mode 100644
index 0000000..5ee23fe
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen
new file mode 100644
index 0000000..776be6e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin
new file mode 100644
index 0000000..1d99490
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar
new file mode 100644
index 0000000..117aadb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey
new file mode 100644
index 0000000..ac02a81
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki
new file mode 100644
index 0000000..b4f8f9c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man
new file mode 100644
index 0000000..ac02a81
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul
new file mode 100644
index 0000000..508446b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey
new file mode 100644
index 0000000..ac02a81
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad
new file mode 100644
index 0000000..cc99bea
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev
new file mode 100644
index 0000000..9337c9e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov
new file mode 100644
index 0000000..a3b5320
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon
new file mode 100644
index 0000000..355817b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana
new file mode 100644
index 0000000..27de456
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/London b/absl/time/internal/cctz/testdata/zoneinfo/Europe/London
new file mode 100644
index 0000000..ac02a81
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/London
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg
new file mode 100644
index 0000000..c4ca733
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid
new file mode 100644
index 0000000..16f6420
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta
new file mode 100644
index 0000000..bf2452d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn
new file mode 100644
index 0000000..b4f8f9c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk
new file mode 100644
index 0000000..453306c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco
new file mode 100644
index 0000000..686ae88
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow
new file mode 100644
index 0000000..ddb3f4e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia
new file mode 100644
index 0000000..f7f10ab
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo
new file mode 100644
index 0000000..15a34c3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris
new file mode 100644
index 0000000..ca85435
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica
new file mode 100644
index 0000000..27de456
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague
new file mode 100644
index 0000000..ce8f433
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga
new file mode 100644
index 0000000..8db477d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome
new file mode 100644
index 0000000..ac4c163
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara
new file mode 100644
index 0000000..97d5dd9
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino b/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino
new file mode 100644
index 0000000..ac4c163
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo
new file mode 100644
index 0000000..27de456
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov
new file mode 100644
index 0000000..8fd5f6d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol
new file mode 100644
index 0000000..432e831
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje
new file mode 100644
index 0000000..27de456
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia
new file mode 100644
index 0000000..0e4d879
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm
new file mode 100644
index 0000000..f3e0c7f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn
new file mode 100644
index 0000000..b5acca3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane
new file mode 100644
index 0000000..0b86017
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol
new file mode 100644
index 0000000..5ee23fe
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk
new file mode 100644
index 0000000..7b61bdc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod
new file mode 100644
index 0000000..66ae8d6
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz
new file mode 100644
index 0000000..ad6cf59
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican
new file mode 100644
index 0000000..ac4c163
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna
new file mode 100644
index 0000000..3582bb1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius
new file mode 100644
index 0000000..7abd63f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd
new file mode 100644
index 0000000..d1cfac0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw
new file mode 100644
index 0000000..e33cf67
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb
new file mode 100644
index 0000000..27de456
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye
new file mode 100644
index 0000000..e42edfc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich
new file mode 100644
index 0000000..ad6cf59
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Factory b/absl/time/internal/cctz/testdata/zoneinfo/Factory
new file mode 100644
index 0000000..60aa2a0
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Factory
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/GB b/absl/time/internal/cctz/testdata/zoneinfo/GB
new file mode 100644
index 0000000..ac02a81
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/GB
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire b/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire
new file mode 100644
index 0000000..ac02a81
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/GMT b/absl/time/internal/cctz/testdata/zoneinfo/GMT
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/GMT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/GMT+0 b/absl/time/internal/cctz/testdata/zoneinfo/GMT+0
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/GMT+0
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/GMT-0 b/absl/time/internal/cctz/testdata/zoneinfo/GMT-0
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/GMT-0
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/GMT0 b/absl/time/internal/cctz/testdata/zoneinfo/GMT0
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/GMT0
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Greenwich b/absl/time/internal/cctz/testdata/zoneinfo/Greenwich
new file mode 100644
index 0000000..c634746
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Greenwich
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/HST b/absl/time/internal/cctz/testdata/zoneinfo/HST
new file mode 100644
index 0000000..cccd45e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/HST
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Hongkong b/absl/time/internal/cctz/testdata/zoneinfo/Hongkong
new file mode 100644
index 0000000..23d0375
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Hongkong
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Iceland b/absl/time/internal/cctz/testdata/zoneinfo/Iceland
new file mode 100644
index 0000000..10e0fc8
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Iceland
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos
new file mode 100644
index 0000000..93d6dda
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas
new file mode 100644
index 0000000..d18c381
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos
new file mode 100644
index 0000000..f8116e7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen
new file mode 100644
index 0000000..cde4cf7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe
new file mode 100644
index 0000000..cba7dfe
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives
new file mode 100644
index 0000000..7c839cf
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius
new file mode 100644
index 0000000..17f2616
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte
new file mode 100644
index 0000000..9a2918f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion
new file mode 100644
index 0000000..dfe0831
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Iran b/absl/time/internal/cctz/testdata/zoneinfo/Iran
new file mode 100644
index 0000000..8cec5ad
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Iran
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Israel b/absl/time/internal/cctz/testdata/zoneinfo/Israel
new file mode 100644
index 0000000..440ef06
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Israel
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Jamaica b/absl/time/internal/cctz/testdata/zoneinfo/Jamaica
new file mode 100644
index 0000000..2a9b7fd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Jamaica
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Japan b/absl/time/internal/cctz/testdata/zoneinfo/Japan
new file mode 100644
index 0000000..26f4d34
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Japan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein b/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein
new file mode 100644
index 0000000..1a7975f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Libya b/absl/time/internal/cctz/testdata/zoneinfo/Libya
new file mode 100644
index 0000000..07b393b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Libya
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/MET b/absl/time/internal/cctz/testdata/zoneinfo/MET
new file mode 100644
index 0000000..4a826bb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/MET
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/MST b/absl/time/internal/cctz/testdata/zoneinfo/MST
new file mode 100644
index 0000000..c93a58e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/MST
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT b/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT
new file mode 100644
index 0000000..4506a6e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte b/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte
new file mode 100644
index 0000000..ada6bf7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur b/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur
new file mode 100644
index 0000000..e4a7857
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General b/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General
new file mode 100644
index 0000000..e7fb6f2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/NZ b/absl/time/internal/cctz/testdata/zoneinfo/NZ
new file mode 100644
index 0000000..6575fdc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/NZ
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT b/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT
new file mode 100644
index 0000000..c004109
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Navajo b/absl/time/internal/cctz/testdata/zoneinfo/Navajo
new file mode 100644
index 0000000..5fbe26b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Navajo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/PRC b/absl/time/internal/cctz/testdata/zoneinfo/PRC
new file mode 100644
index 0000000..3c0bef2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/PRC
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT b/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT
new file mode 100644
index 0000000..99d246b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia
new file mode 100644
index 0000000..dab1f3f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland
new file mode 100644
index 0000000..6575fdc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville
new file mode 100644
index 0000000..2892d26
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham
new file mode 100644
index 0000000..c004109
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk
new file mode 100644
index 0000000..07c84b7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter
new file mode 100644
index 0000000..cae3744
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate
new file mode 100644
index 0000000..6015017
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury
new file mode 100644
index 0000000..f0b8252
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo
new file mode 100644
index 0000000..e40307f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji
new file mode 100644
index 0000000..d39bf53
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti
new file mode 100644
index 0000000..ea72863
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos
new file mode 100644
index 0000000..31f0921
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier
new file mode 100644
index 0000000..e1fc3da
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal
new file mode 100644
index 0000000..7e9d10a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam
new file mode 100644
index 0000000..66490d2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu
new file mode 100644
index 0000000..c7cd060
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston
new file mode 100644
index 0000000..c7cd060
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati
new file mode 100644
index 0000000..7cae0cb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae
new file mode 100644
index 0000000..a584aae
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein
new file mode 100644
index 0000000..1a7975f
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro
new file mode 100644
index 0000000..9ef8374
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas
new file mode 100644
index 0000000..74d6792
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway
new file mode 100644
index 0000000..cb56709
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru
new file mode 100644
index 0000000..acec042
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue
new file mode 100644
index 0000000..684b010
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk
new file mode 100644
index 0000000..53c1aad
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea
new file mode 100644
index 0000000..931a1a3
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago
new file mode 100644
index 0000000..cb56709
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau
new file mode 100644
index 0000000..146b351
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn
new file mode 100644
index 0000000..ef91b06
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei
new file mode 100644
index 0000000..c298ddd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape
new file mode 100644
index 0000000..c298ddd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby
new file mode 100644
index 0000000..920ad27
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga
new file mode 100644
index 0000000..da6b0fa
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan
new file mode 100644
index 0000000..66490d2
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa
new file mode 100644
index 0000000..cb56709
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti
new file mode 100644
index 0000000..442b8eb
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa
new file mode 100644
index 0000000..3db6c75
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu
new file mode 100644
index 0000000..5553c60
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk
new file mode 100644
index 0000000..07c84b7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake
new file mode 100644
index 0000000..c9e3106
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis
new file mode 100644
index 0000000..b35344b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap
new file mode 100644
index 0000000..07c84b7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Poland b/absl/time/internal/cctz/testdata/zoneinfo/Poland
new file mode 100644
index 0000000..e33cf67
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Poland
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Portugal b/absl/time/internal/cctz/testdata/zoneinfo/Portugal
new file mode 100644
index 0000000..355817b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Portugal
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/ROC b/absl/time/internal/cctz/testdata/zoneinfo/ROC
new file mode 100644
index 0000000..24c4344
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/ROC
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/ROK b/absl/time/internal/cctz/testdata/zoneinfo/ROK
new file mode 100644
index 0000000..96199e7
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/ROK
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Singapore b/absl/time/internal/cctz/testdata/zoneinfo/Singapore
new file mode 100644
index 0000000..2364b21
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Singapore
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Turkey b/absl/time/internal/cctz/testdata/zoneinfo/Turkey
new file mode 100644
index 0000000..508446b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Turkey
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/UCT b/absl/time/internal/cctz/testdata/zoneinfo/UCT
new file mode 100644
index 0000000..91558be
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/UCT
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska b/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska
new file mode 100644
index 0000000..9bbb2fd
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian b/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian
new file mode 100644
index 0000000..4323649
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona b/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona
new file mode 100644
index 0000000..ac6bb0c
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Central b/absl/time/internal/cctz/testdata/zoneinfo/US/Central
new file mode 100644
index 0000000..a5b1617
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Central
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana b/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana
new file mode 100644
index 0000000..09511cc
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern b/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern
new file mode 100644
index 0000000..2f75480
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii b/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii
new file mode 100644
index 0000000..c7cd060
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke b/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke
new file mode 100644
index 0000000..fcd408d
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan b/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan
new file mode 100644
index 0000000..e104faa
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain b/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain
new file mode 100644
index 0000000..5fbe26b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific b/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific
new file mode 100644
index 0000000..9dad4f4
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa b/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa
new file mode 100644
index 0000000..cb56709
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/UTC b/absl/time/internal/cctz/testdata/zoneinfo/UTC
new file mode 100644
index 0000000..91558be
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/UTC
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Universal b/absl/time/internal/cctz/testdata/zoneinfo/Universal
new file mode 100644
index 0000000..91558be
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Universal
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/W-SU b/absl/time/internal/cctz/testdata/zoneinfo/W-SU
new file mode 100644
index 0000000..ddb3f4e
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/W-SU
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/WET b/absl/time/internal/cctz/testdata/zoneinfo/WET
new file mode 100644
index 0000000..c27390b
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/WET
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/Zulu b/absl/time/internal/cctz/testdata/zoneinfo/Zulu
new file mode 100644
index 0000000..91558be
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/Zulu
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab b/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab
new file mode 100644
index 0000000..a4ff61a
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab
@@ -0,0 +1,274 @@
+# ISO 3166 alpha-2 country codes
+#
+# This file is in the public domain, so clarified as of
+# 2009-05-17 by Arthur David Olson.
+#
+# From Paul Eggert (2015-05-02):
+# This file contains a table of two-letter country codes.  Columns are
+# separated by a single tab.  Lines beginning with '#' are comments.
+# All text uses UTF-8 encoding.  The columns of the table are as follows:
+#
+# 1.  ISO 3166-1 alpha-2 country code, current as of
+#     ISO 3166-1 N976 (2018-11-06).  See: Updates on ISO 3166-1
+#     https://isotc.iso.org/livelink/livelink/Open/16944257
+# 2.  The usual English name for the coded region,
+#     chosen so that alphabetic sorting of subsets produces helpful lists.
+#     This is not the same as the English name in the ISO 3166 tables.
+#
+# The table is sorted by country code.
+#
+# This table is intended as an aid for users, to help them select time
+# zone data appropriate for their practical needs.  It is not intended
+# to take or endorse any position on legal or territorial claims.
+#
+#country-
+#code	name of country, territory, area, or subdivision
+AD	Andorra
+AE	United Arab Emirates
+AF	Afghanistan
+AG	Antigua & Barbuda
+AI	Anguilla
+AL	Albania
+AM	Armenia
+AO	Angola
+AQ	Antarctica
+AR	Argentina
+AS	Samoa (American)
+AT	Austria
+AU	Australia
+AW	Aruba
+AX	Åland Islands
+AZ	Azerbaijan
+BA	Bosnia & Herzegovina
+BB	Barbados
+BD	Bangladesh
+BE	Belgium
+BF	Burkina Faso
+BG	Bulgaria
+BH	Bahrain
+BI	Burundi
+BJ	Benin
+BL	St Barthelemy
+BM	Bermuda
+BN	Brunei
+BO	Bolivia
+BQ	Caribbean NL
+BR	Brazil
+BS	Bahamas
+BT	Bhutan
+BV	Bouvet Island
+BW	Botswana
+BY	Belarus
+BZ	Belize
+CA	Canada
+CC	Cocos (Keeling) Islands
+CD	Congo (Dem. Rep.)
+CF	Central African Rep.
+CG	Congo (Rep.)
+CH	Switzerland
+CI	Côte d'Ivoire
+CK	Cook Islands
+CL	Chile
+CM	Cameroon
+CN	China
+CO	Colombia
+CR	Costa Rica
+CU	Cuba
+CV	Cape Verde
+CW	Curaçao
+CX	Christmas Island
+CY	Cyprus
+CZ	Czech Republic
+DE	Germany
+DJ	Djibouti
+DK	Denmark
+DM	Dominica
+DO	Dominican Republic
+DZ	Algeria
+EC	Ecuador
+EE	Estonia
+EG	Egypt
+EH	Western Sahara
+ER	Eritrea
+ES	Spain
+ET	Ethiopia
+FI	Finland
+FJ	Fiji
+FK	Falkland Islands
+FM	Micronesia
+FO	Faroe Islands
+FR	France
+GA	Gabon
+GB	Britain (UK)
+GD	Grenada
+GE	Georgia
+GF	French Guiana
+GG	Guernsey
+GH	Ghana
+GI	Gibraltar
+GL	Greenland
+GM	Gambia
+GN	Guinea
+GP	Guadeloupe
+GQ	Equatorial Guinea
+GR	Greece
+GS	South Georgia & the South Sandwich Islands
+GT	Guatemala
+GU	Guam
+GW	Guinea-Bissau
+GY	Guyana
+HK	Hong Kong
+HM	Heard Island & McDonald Islands
+HN	Honduras
+HR	Croatia
+HT	Haiti
+HU	Hungary
+ID	Indonesia
+IE	Ireland
+IL	Israel
+IM	Isle of Man
+IN	India
+IO	British Indian Ocean Territory
+IQ	Iraq
+IR	Iran
+IS	Iceland
+IT	Italy
+JE	Jersey
+JM	Jamaica
+JO	Jordan
+JP	Japan
+KE	Kenya
+KG	Kyrgyzstan
+KH	Cambodia
+KI	Kiribati
+KM	Comoros
+KN	St Kitts & Nevis
+KP	Korea (North)
+KR	Korea (South)
+KW	Kuwait
+KY	Cayman Islands
+KZ	Kazakhstan
+LA	Laos
+LB	Lebanon
+LC	St Lucia
+LI	Liechtenstein
+LK	Sri Lanka
+LR	Liberia
+LS	Lesotho
+LT	Lithuania
+LU	Luxembourg
+LV	Latvia
+LY	Libya
+MA	Morocco
+MC	Monaco
+MD	Moldova
+ME	Montenegro
+MF	St Martin (French)
+MG	Madagascar
+MH	Marshall Islands
+MK	North Macedonia
+ML	Mali
+MM	Myanmar (Burma)
+MN	Mongolia
+MO	Macau
+MP	Northern Mariana Islands
+MQ	Martinique
+MR	Mauritania
+MS	Montserrat
+MT	Malta
+MU	Mauritius
+MV	Maldives
+MW	Malawi
+MX	Mexico
+MY	Malaysia
+MZ	Mozambique
+NA	Namibia
+NC	New Caledonia
+NE	Niger
+NF	Norfolk Island
+NG	Nigeria
+NI	Nicaragua
+NL	Netherlands
+NO	Norway
+NP	Nepal
+NR	Nauru
+NU	Niue
+NZ	New Zealand
+OM	Oman
+PA	Panama
+PE	Peru
+PF	French Polynesia
+PG	Papua New Guinea
+PH	Philippines
+PK	Pakistan
+PL	Poland
+PM	St Pierre & Miquelon
+PN	Pitcairn
+PR	Puerto Rico
+PS	Palestine
+PT	Portugal
+PW	Palau
+PY	Paraguay
+QA	Qatar
+RE	Réunion
+RO	Romania
+RS	Serbia
+RU	Russia
+RW	Rwanda
+SA	Saudi Arabia
+SB	Solomon Islands
+SC	Seychelles
+SD	Sudan
+SE	Sweden
+SG	Singapore
+SH	St Helena
+SI	Slovenia
+SJ	Svalbard & Jan Mayen
+SK	Slovakia
+SL	Sierra Leone
+SM	San Marino
+SN	Senegal
+SO	Somalia
+SR	Suriname
+SS	South Sudan
+ST	Sao Tome & Principe
+SV	El Salvador
+SX	St Maarten (Dutch)
+SY	Syria
+SZ	Eswatini (Swaziland)
+TC	Turks & Caicos Is
+TD	Chad
+TF	French Southern & Antarctic Lands
+TG	Togo
+TH	Thailand
+TJ	Tajikistan
+TK	Tokelau
+TL	East Timor
+TM	Turkmenistan
+TN	Tunisia
+TO	Tonga
+TR	Turkey
+TT	Trinidad & Tobago
+TV	Tuvalu
+TW	Taiwan
+TZ	Tanzania
+UA	Ukraine
+UG	Uganda
+UM	US minor outlying islands
+US	United States
+UY	Uruguay
+UZ	Uzbekistan
+VA	Vatican City
+VC	St Vincent
+VE	Venezuela
+VG	Virgin Islands (UK)
+VI	Virgin Islands (US)
+VN	Vietnam
+VU	Vanuatu
+WF	Wallis & Futuna
+WS	Samoa (western)
+YE	Yemen
+YT	Mayotte
+ZA	South Africa
+ZM	Zambia
+ZW	Zimbabwe
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/localtime b/absl/time/internal/cctz/testdata/zoneinfo/localtime
new file mode 100644
index 0000000..afeeb88
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/localtime
Binary files differ
diff --git a/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab b/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab
new file mode 100644
index 0000000..822ffa1
--- /dev/null
+++ b/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab
@@ -0,0 +1,384 @@
+# tzdb timezone descriptions
+#
+# This file is in the public domain.
+#
+# From Paul Eggert (2018-06-27):
+# This file contains a table where each row stands for a timezone where
+# civil timestamps have agreed since 1970.  Columns are separated by
+# a single tab.  Lines beginning with '#' are comments.  All text uses
+# UTF-8 encoding.  The columns of the table are as follows:
+#
+# 1.  The countries that overlap the timezone, as a comma-separated list
+#     of ISO 3166 2-character country codes.  See the file 'iso3166.tab'.
+# 2.  Latitude and longitude of the timezone's principal location
+#     in ISO 6709 sign-degrees-minutes-seconds format,
+#     either ±DDMM±DDDMM or ±DDMMSS±DDDMMSS,
+#     first latitude (+ is north), then longitude (+ is east).
+# 3.  Timezone name used in value of TZ environment variable.
+#     Please see the theory.html file for how these names are chosen.
+#     If multiple timezones overlap a country, each has a row in the
+#     table, with each column 1 containing the country code.
+# 4.  Comments; present if and only if a country has multiple timezones.
+#
+# If a timezone covers multiple countries, the most-populous city is used,
+# and that country is listed first in column 1; any other countries
+# are listed alphabetically by country code.  The table is sorted
+# first by country code, then (if possible) by an order within the
+# country that (1) makes some geographical sense, and (2) puts the
+# most populous timezones first, where that does not contradict (1).
+#
+# This table is intended as an aid for users, to help them select timezones
+# appropriate for their practical needs.  It is not intended to take or
+# endorse any position on legal or territorial claims.
+#
+#country-
+#codes	coordinates	TZ	comments
+AD	+4230+00131	Europe/Andorra
+AE,OM	+2518+05518	Asia/Dubai
+AF	+3431+06912	Asia/Kabul
+AL	+4120+01950	Europe/Tirane
+AM	+4011+04430	Asia/Yerevan
+AQ	-6617+11031	Antarctica/Casey	Casey
+AQ	-6835+07758	Antarctica/Davis	Davis
+AQ	-6640+14001	Antarctica/DumontDUrville	Dumont-d'Urville
+AQ	-6736+06253	Antarctica/Mawson	Mawson
+AQ	-6448-06406	Antarctica/Palmer	Palmer
+AQ	-6734-06808	Antarctica/Rothera	Rothera
+AQ	-690022+0393524	Antarctica/Syowa	Syowa
+AQ	-720041+0023206	Antarctica/Troll	Troll
+AQ	-7824+10654	Antarctica/Vostok	Vostok
+AR	-3436-05827	America/Argentina/Buenos_Aires	Buenos Aires (BA, CF)
+AR	-3124-06411	America/Argentina/Cordoba	Argentina (most areas: CB, CC, CN, ER, FM, MN, SE, SF)
+AR	-2447-06525	America/Argentina/Salta	Salta (SA, LP, NQ, RN)
+AR	-2411-06518	America/Argentina/Jujuy	Jujuy (JY)
+AR	-2649-06513	America/Argentina/Tucuman	Tucumán (TM)
+AR	-2828-06547	America/Argentina/Catamarca	Catamarca (CT); Chubut (CH)
+AR	-2926-06651	America/Argentina/La_Rioja	La Rioja (LR)
+AR	-3132-06831	America/Argentina/San_Juan	San Juan (SJ)
+AR	-3253-06849	America/Argentina/Mendoza	Mendoza (MZ)
+AR	-3319-06621	America/Argentina/San_Luis	San Luis (SL)
+AR	-5138-06913	America/Argentina/Rio_Gallegos	Santa Cruz (SC)
+AR	-5448-06818	America/Argentina/Ushuaia	Tierra del Fuego (TF)
+AS,UM	-1416-17042	Pacific/Pago_Pago	Samoa, Midway
+AT	+4813+01620	Europe/Vienna
+AU	-3133+15905	Australia/Lord_Howe	Lord Howe Island
+AU	-5430+15857	Antarctica/Macquarie	Macquarie Island
+AU	-4253+14719	Australia/Hobart	Tasmania (most areas)
+AU	-3956+14352	Australia/Currie	Tasmania (King Island)
+AU	-3749+14458	Australia/Melbourne	Victoria
+AU	-3352+15113	Australia/Sydney	New South Wales (most areas)
+AU	-3157+14127	Australia/Broken_Hill	New South Wales (Yancowinna)
+AU	-2728+15302	Australia/Brisbane	Queensland (most areas)
+AU	-2016+14900	Australia/Lindeman	Queensland (Whitsunday Islands)
+AU	-3455+13835	Australia/Adelaide	South Australia
+AU	-1228+13050	Australia/Darwin	Northern Territory
+AU	-3157+11551	Australia/Perth	Western Australia (most areas)
+AU	-3143+12852	Australia/Eucla	Western Australia (Eucla)
+AZ	+4023+04951	Asia/Baku
+BB	+1306-05937	America/Barbados
+BD	+2343+09025	Asia/Dhaka
+BE	+5050+00420	Europe/Brussels
+BG	+4241+02319	Europe/Sofia
+BM	+3217-06446	Atlantic/Bermuda
+BN	+0456+11455	Asia/Brunei
+BO	-1630-06809	America/La_Paz
+BR	-0351-03225	America/Noronha	Atlantic islands
+BR	-0127-04829	America/Belem	Pará (east); Amapá
+BR	-0343-03830	America/Fortaleza	Brazil (northeast: MA, PI, CE, RN, PB)
+BR	-0803-03454	America/Recife	Pernambuco
+BR	-0712-04812	America/Araguaina	Tocantins
+BR	-0940-03543	America/Maceio	Alagoas, Sergipe
+BR	-1259-03831	America/Bahia	Bahia
+BR	-2332-04637	America/Sao_Paulo	Brazil (southeast: GO, DF, MG, ES, RJ, SP, PR, SC, RS)
+BR	-2027-05437	America/Campo_Grande	Mato Grosso do Sul
+BR	-1535-05605	America/Cuiaba	Mato Grosso
+BR	-0226-05452	America/Santarem	Pará (west)
+BR	-0846-06354	America/Porto_Velho	Rondônia
+BR	+0249-06040	America/Boa_Vista	Roraima
+BR	-0308-06001	America/Manaus	Amazonas (east)
+BR	-0640-06952	America/Eirunepe	Amazonas (west)
+BR	-0958-06748	America/Rio_Branco	Acre
+BS	+2505-07721	America/Nassau
+BT	+2728+08939	Asia/Thimphu
+BY	+5354+02734	Europe/Minsk
+BZ	+1730-08812	America/Belize
+CA	+4734-05243	America/St_Johns	Newfoundland; Labrador (southeast)
+CA	+4439-06336	America/Halifax	Atlantic - NS (most areas); PE
+CA	+4612-05957	America/Glace_Bay	Atlantic - NS (Cape Breton)
+CA	+4606-06447	America/Moncton	Atlantic - New Brunswick
+CA	+5320-06025	America/Goose_Bay	Atlantic - Labrador (most areas)
+CA	+5125-05707	America/Blanc-Sablon	AST - QC (Lower North Shore)
+CA	+4339-07923	America/Toronto	Eastern - ON, QC (most areas)
+CA	+4901-08816	America/Nipigon	Eastern - ON, QC (no DST 1967-73)
+CA	+4823-08915	America/Thunder_Bay	Eastern - ON (Thunder Bay)
+CA	+6344-06828	America/Iqaluit	Eastern - NU (most east areas)
+CA	+6608-06544	America/Pangnirtung	Eastern - NU (Pangnirtung)
+CA	+484531-0913718	America/Atikokan	EST - ON (Atikokan); NU (Coral H)
+CA	+4953-09709	America/Winnipeg	Central - ON (west); Manitoba
+CA	+4843-09434	America/Rainy_River	Central - ON (Rainy R, Ft Frances)
+CA	+744144-0944945	America/Resolute	Central - NU (Resolute)
+CA	+624900-0920459	America/Rankin_Inlet	Central - NU (central)
+CA	+5024-10439	America/Regina	CST - SK (most areas)
+CA	+5017-10750	America/Swift_Current	CST - SK (midwest)
+CA	+5333-11328	America/Edmonton	Mountain - AB; BC (E); SK (W)
+CA	+690650-1050310	America/Cambridge_Bay	Mountain - NU (west)
+CA	+6227-11421	America/Yellowknife	Mountain - NT (central)
+CA	+682059-1334300	America/Inuvik	Mountain - NT (west)
+CA	+4906-11631	America/Creston	MST - BC (Creston)
+CA	+5946-12014	America/Dawson_Creek	MST - BC (Dawson Cr, Ft St John)
+CA	+5848-12242	America/Fort_Nelson	MST - BC (Ft Nelson)
+CA	+4916-12307	America/Vancouver	Pacific - BC (most areas)
+CA	+6043-13503	America/Whitehorse	Pacific - Yukon (south)
+CA	+6404-13925	America/Dawson	Pacific - Yukon (north)
+CC	-1210+09655	Indian/Cocos
+CH,DE,LI	+4723+00832	Europe/Zurich	Swiss time
+CI,BF,GM,GN,ML,MR,SH,SL,SN,TG	+0519-00402	Africa/Abidjan
+CK	-2114-15946	Pacific/Rarotonga
+CL	-3327-07040	America/Santiago	Chile (most areas)
+CL	-5309-07055	America/Punta_Arenas	Region of Magallanes
+CL	-2709-10926	Pacific/Easter	Easter Island
+CN	+3114+12128	Asia/Shanghai	Beijing Time
+CN	+4348+08735	Asia/Urumqi	Xinjiang Time
+CO	+0436-07405	America/Bogota
+CR	+0956-08405	America/Costa_Rica
+CU	+2308-08222	America/Havana
+CV	+1455-02331	Atlantic/Cape_Verde
+CW,AW,BQ,SX	+1211-06900	America/Curacao
+CX	-1025+10543	Indian/Christmas
+CY	+3510+03322	Asia/Nicosia	Cyprus (most areas)
+CY	+3507+03357	Asia/Famagusta	Northern Cyprus
+CZ,SK	+5005+01426	Europe/Prague
+DE	+5230+01322	Europe/Berlin	Germany (most areas)
+DK	+5540+01235	Europe/Copenhagen
+DO	+1828-06954	America/Santo_Domingo
+DZ	+3647+00303	Africa/Algiers
+EC	-0210-07950	America/Guayaquil	Ecuador (mainland)
+EC	-0054-08936	Pacific/Galapagos	Galápagos Islands
+EE	+5925+02445	Europe/Tallinn
+EG	+3003+03115	Africa/Cairo
+EH	+2709-01312	Africa/El_Aaiun
+ES	+4024-00341	Europe/Madrid	Spain (mainland)
+ES	+3553-00519	Africa/Ceuta	Ceuta, Melilla
+ES	+2806-01524	Atlantic/Canary	Canary Islands
+FI,AX	+6010+02458	Europe/Helsinki
+FJ	-1808+17825	Pacific/Fiji
+FK	-5142-05751	Atlantic/Stanley
+FM	+0725+15147	Pacific/Chuuk	Chuuk/Truk, Yap
+FM	+0658+15813	Pacific/Pohnpei	Pohnpei/Ponape
+FM	+0519+16259	Pacific/Kosrae	Kosrae
+FO	+6201-00646	Atlantic/Faroe
+FR	+4852+00220	Europe/Paris
+GB,GG,IM,JE	+513030-0000731	Europe/London
+GE	+4143+04449	Asia/Tbilisi
+GF	+0456-05220	America/Cayenne
+GH	+0533-00013	Africa/Accra
+GI	+3608-00521	Europe/Gibraltar
+GL	+6411-05144	America/Godthab	Greenland (most areas)
+GL	+7646-01840	America/Danmarkshavn	National Park (east coast)
+GL	+7029-02158	America/Scoresbysund	Scoresbysund/Ittoqqortoormiit
+GL	+7634-06847	America/Thule	Thule/Pituffik
+GR	+3758+02343	Europe/Athens
+GS	-5416-03632	Atlantic/South_Georgia
+GT	+1438-09031	America/Guatemala
+GU,MP	+1328+14445	Pacific/Guam
+GW	+1151-01535	Africa/Bissau
+GY	+0648-05810	America/Guyana
+HK	+2217+11409	Asia/Hong_Kong
+HN	+1406-08713	America/Tegucigalpa
+HT	+1832-07220	America/Port-au-Prince
+HU	+4730+01905	Europe/Budapest
+ID	-0610+10648	Asia/Jakarta	Java, Sumatra
+ID	-0002+10920	Asia/Pontianak	Borneo (west, central)
+ID	-0507+11924	Asia/Makassar	Borneo (east, south); Sulawesi/Celebes, Bali, Nusa Tengarra; Timor (west)
+ID	-0232+14042	Asia/Jayapura	New Guinea (West Papua / Irian Jaya); Malukus/Moluccas
+IE	+5320-00615	Europe/Dublin
+IL	+314650+0351326	Asia/Jerusalem
+IN	+2232+08822	Asia/Kolkata
+IO	-0720+07225	Indian/Chagos
+IQ	+3321+04425	Asia/Baghdad
+IR	+3540+05126	Asia/Tehran
+IS	+6409-02151	Atlantic/Reykjavik
+IT,SM,VA	+4154+01229	Europe/Rome
+JM	+175805-0764736	America/Jamaica
+JO	+3157+03556	Asia/Amman
+JP	+353916+1394441	Asia/Tokyo
+KE,DJ,ER,ET,KM,MG,SO,TZ,UG,YT	-0117+03649	Africa/Nairobi
+KG	+4254+07436	Asia/Bishkek
+KI	+0125+17300	Pacific/Tarawa	Gilbert Islands
+KI	-0308-17105	Pacific/Enderbury	Phoenix Islands
+KI	+0152-15720	Pacific/Kiritimati	Line Islands
+KP	+3901+12545	Asia/Pyongyang
+KR	+3733+12658	Asia/Seoul
+KZ	+4315+07657	Asia/Almaty	Kazakhstan (most areas)
+KZ	+4448+06528	Asia/Qyzylorda	Qyzylorda/Kyzylorda/Kzyl-Orda
+KZ	+5312+06337	Asia/Qostanay	Qostanay/Kostanay/Kustanay
+KZ	+5017+05710	Asia/Aqtobe	Aqtöbe/Aktobe
+KZ	+4431+05016	Asia/Aqtau	Mangghystaū/Mankistau
+KZ	+4707+05156	Asia/Atyrau	Atyraū/Atirau/Gur'yev
+KZ	+5113+05121	Asia/Oral	West Kazakhstan
+LB	+3353+03530	Asia/Beirut
+LK	+0656+07951	Asia/Colombo
+LR	+0618-01047	Africa/Monrovia
+LT	+5441+02519	Europe/Vilnius
+LU	+4936+00609	Europe/Luxembourg
+LV	+5657+02406	Europe/Riga
+LY	+3254+01311	Africa/Tripoli
+MA	+3339-00735	Africa/Casablanca
+MC	+4342+00723	Europe/Monaco
+MD	+4700+02850	Europe/Chisinau
+MH	+0709+17112	Pacific/Majuro	Marshall Islands (most areas)
+MH	+0905+16720	Pacific/Kwajalein	Kwajalein
+MM	+1647+09610	Asia/Yangon
+MN	+4755+10653	Asia/Ulaanbaatar	Mongolia (most areas)
+MN	+4801+09139	Asia/Hovd	Bayan-Ölgii, Govi-Altai, Hovd, Uvs, Zavkhan
+MN	+4804+11430	Asia/Choibalsan	Dornod, Sükhbaatar
+MO	+221150+1133230	Asia/Macau
+MQ	+1436-06105	America/Martinique
+MT	+3554+01431	Europe/Malta
+MU	-2010+05730	Indian/Mauritius
+MV	+0410+07330	Indian/Maldives
+MX	+1924-09909	America/Mexico_City	Central Time
+MX	+2105-08646	America/Cancun	Eastern Standard Time - Quintana Roo
+MX	+2058-08937	America/Merida	Central Time - Campeche, Yucatán
+MX	+2540-10019	America/Monterrey	Central Time - Durango; Coahuila, Nuevo León, Tamaulipas (most areas)
+MX	+2550-09730	America/Matamoros	Central Time US - Coahuila, Nuevo León, Tamaulipas (US border)
+MX	+2313-10625	America/Mazatlan	Mountain Time - Baja California Sur, Nayarit, Sinaloa
+MX	+2838-10605	America/Chihuahua	Mountain Time - Chihuahua (most areas)
+MX	+2934-10425	America/Ojinaga	Mountain Time US - Chihuahua (US border)
+MX	+2904-11058	America/Hermosillo	Mountain Standard Time - Sonora
+MX	+3232-11701	America/Tijuana	Pacific Time US - Baja California
+MX	+2048-10515	America/Bahia_Banderas	Central Time - Bahía de Banderas
+MY	+0310+10142	Asia/Kuala_Lumpur	Malaysia (peninsula)
+MY	+0133+11020	Asia/Kuching	Sabah, Sarawak
+MZ,BI,BW,CD,MW,RW,ZM,ZW	-2558+03235	Africa/Maputo	Central Africa Time
+NA	-2234+01706	Africa/Windhoek
+NC	-2216+16627	Pacific/Noumea
+NF	-2903+16758	Pacific/Norfolk
+NG,AO,BJ,CD,CF,CG,CM,GA,GQ,NE	+0627+00324	Africa/Lagos	West Africa Time
+NI	+1209-08617	America/Managua
+NL	+5222+00454	Europe/Amsterdam
+NO,SJ	+5955+01045	Europe/Oslo
+NP	+2743+08519	Asia/Kathmandu
+NR	-0031+16655	Pacific/Nauru
+NU	-1901-16955	Pacific/Niue
+NZ,AQ	-3652+17446	Pacific/Auckland	New Zealand time
+NZ	-4357-17633	Pacific/Chatham	Chatham Islands
+PA,KY	+0858-07932	America/Panama
+PE	-1203-07703	America/Lima
+PF	-1732-14934	Pacific/Tahiti	Society Islands
+PF	-0900-13930	Pacific/Marquesas	Marquesas Islands
+PF	-2308-13457	Pacific/Gambier	Gambier Islands
+PG	-0930+14710	Pacific/Port_Moresby	Papua New Guinea (most areas)
+PG	-0613+15534	Pacific/Bougainville	Bougainville
+PH	+1435+12100	Asia/Manila
+PK	+2452+06703	Asia/Karachi
+PL	+5215+02100	Europe/Warsaw
+PM	+4703-05620	America/Miquelon
+PN	-2504-13005	Pacific/Pitcairn
+PR	+182806-0660622	America/Puerto_Rico
+PS	+3130+03428	Asia/Gaza	Gaza Strip
+PS	+313200+0350542	Asia/Hebron	West Bank
+PT	+3843-00908	Europe/Lisbon	Portugal (mainland)
+PT	+3238-01654	Atlantic/Madeira	Madeira Islands
+PT	+3744-02540	Atlantic/Azores	Azores
+PW	+0720+13429	Pacific/Palau
+PY	-2516-05740	America/Asuncion
+QA,BH	+2517+05132	Asia/Qatar
+RE,TF	-2052+05528	Indian/Reunion	Réunion, Crozet, Scattered Islands
+RO	+4426+02606	Europe/Bucharest
+RS,BA,HR,ME,MK,SI	+4450+02030	Europe/Belgrade
+RU	+5443+02030	Europe/Kaliningrad	MSK-01 - Kaliningrad
+RU	+554521+0373704	Europe/Moscow	MSK+00 - Moscow area
+# Mention RU and UA alphabetically.  See "territorial claims" above.
+RU,UA	+4457+03406	Europe/Simferopol	MSK+00 - Crimea
+RU	+5836+04939	Europe/Kirov	MSK+00 - Kirov
+RU	+4621+04803	Europe/Astrakhan	MSK+01 - Astrakhan
+RU	+4844+04425	Europe/Volgograd	MSK+01 - Volgograd
+RU	+5134+04602	Europe/Saratov	MSK+01 - Saratov
+RU	+5420+04824	Europe/Ulyanovsk	MSK+01 - Ulyanovsk
+RU	+5312+05009	Europe/Samara	MSK+01 - Samara, Udmurtia
+RU	+5651+06036	Asia/Yekaterinburg	MSK+02 - Urals
+RU	+5500+07324	Asia/Omsk	MSK+03 - Omsk
+RU	+5502+08255	Asia/Novosibirsk	MSK+04 - Novosibirsk
+RU	+5322+08345	Asia/Barnaul	MSK+04 - Altai
+RU	+5630+08458	Asia/Tomsk	MSK+04 - Tomsk
+RU	+5345+08707	Asia/Novokuznetsk	MSK+04 - Kemerovo
+RU	+5601+09250	Asia/Krasnoyarsk	MSK+04 - Krasnoyarsk area
+RU	+5216+10420	Asia/Irkutsk	MSK+05 - Irkutsk, Buryatia
+RU	+5203+11328	Asia/Chita	MSK+06 - Zabaykalsky
+RU	+6200+12940	Asia/Yakutsk	MSK+06 - Lena River
+RU	+623923+1353314	Asia/Khandyga	MSK+06 - Tomponsky, Ust-Maysky
+RU	+4310+13156	Asia/Vladivostok	MSK+07 - Amur River
+RU	+643337+1431336	Asia/Ust-Nera	MSK+07 - Oymyakonsky
+RU	+5934+15048	Asia/Magadan	MSK+08 - Magadan
+RU	+4658+14242	Asia/Sakhalin	MSK+08 - Sakhalin Island
+RU	+6728+15343	Asia/Srednekolymsk	MSK+08 - Sakha (E); North Kuril Is
+RU	+5301+15839	Asia/Kamchatka	MSK+09 - Kamchatka
+RU	+6445+17729	Asia/Anadyr	MSK+09 - Bering Sea
+SA,KW,YE	+2438+04643	Asia/Riyadh
+SB	-0932+16012	Pacific/Guadalcanal
+SC	-0440+05528	Indian/Mahe
+SD	+1536+03232	Africa/Khartoum
+SE	+5920+01803	Europe/Stockholm
+SG	+0117+10351	Asia/Singapore
+SR	+0550-05510	America/Paramaribo
+SS	+0451+03137	Africa/Juba
+ST	+0020+00644	Africa/Sao_Tome
+SV	+1342-08912	America/El_Salvador
+SY	+3330+03618	Asia/Damascus
+TC	+2128-07108	America/Grand_Turk
+TD	+1207+01503	Africa/Ndjamena
+TF	-492110+0701303	Indian/Kerguelen	Kerguelen, St Paul Island, Amsterdam Island
+TH,KH,LA,VN	+1345+10031	Asia/Bangkok	Indochina (most areas)
+TJ	+3835+06848	Asia/Dushanbe
+TK	-0922-17114	Pacific/Fakaofo
+TL	-0833+12535	Asia/Dili
+TM	+3757+05823	Asia/Ashgabat
+TN	+3648+01011	Africa/Tunis
+TO	-2110-17510	Pacific/Tongatapu
+TR	+4101+02858	Europe/Istanbul
+TT,AG,AI,BL,DM,GD,GP,KN,LC,MF,MS,VC,VG,VI	+1039-06131	America/Port_of_Spain
+TV	-0831+17913	Pacific/Funafuti
+TW	+2503+12130	Asia/Taipei
+UA	+5026+03031	Europe/Kiev	Ukraine (most areas)
+UA	+4837+02218	Europe/Uzhgorod	Ruthenia
+UA	+4750+03510	Europe/Zaporozhye	Zaporozh'ye/Zaporizhia; Lugansk/Luhansk (east)
+UM	+1917+16637	Pacific/Wake	Wake Island
+US	+404251-0740023	America/New_York	Eastern (most areas)
+US	+421953-0830245	America/Detroit	Eastern - MI (most areas)
+US	+381515-0854534	America/Kentucky/Louisville	Eastern - KY (Louisville area)
+US	+364947-0845057	America/Kentucky/Monticello	Eastern - KY (Wayne)
+US	+394606-0860929	America/Indiana/Indianapolis	Eastern - IN (most areas)
+US	+384038-0873143	America/Indiana/Vincennes	Eastern - IN (Da, Du, K, Mn)
+US	+410305-0863611	America/Indiana/Winamac	Eastern - IN (Pulaski)
+US	+382232-0862041	America/Indiana/Marengo	Eastern - IN (Crawford)
+US	+382931-0871643	America/Indiana/Petersburg	Eastern - IN (Pike)
+US	+384452-0850402	America/Indiana/Vevay	Eastern - IN (Switzerland)
+US	+415100-0873900	America/Chicago	Central (most areas)
+US	+375711-0864541	America/Indiana/Tell_City	Central - IN (Perry)
+US	+411745-0863730	America/Indiana/Knox	Central - IN (Starke)
+US	+450628-0873651	America/Menominee	Central - MI (Wisconsin border)
+US	+470659-1011757	America/North_Dakota/Center	Central - ND (Oliver)
+US	+465042-1012439	America/North_Dakota/New_Salem	Central - ND (Morton rural)
+US	+471551-1014640	America/North_Dakota/Beulah	Central - ND (Mercer)
+US	+394421-1045903	America/Denver	Mountain (most areas)
+US	+433649-1161209	America/Boise	Mountain - ID (south); OR (east)
+US	+332654-1120424	America/Phoenix	MST - Arizona (except Navajo)
+US	+340308-1181434	America/Los_Angeles	Pacific
+US	+611305-1495401	America/Anchorage	Alaska (most areas)
+US	+581807-1342511	America/Juneau	Alaska - Juneau area
+US	+571035-1351807	America/Sitka	Alaska - Sitka area
+US	+550737-1313435	America/Metlakatla	Alaska - Annette Island
+US	+593249-1394338	America/Yakutat	Alaska - Yakutat
+US	+643004-1652423	America/Nome	Alaska (west)
+US	+515248-1763929	America/Adak	Aleutian Islands
+US,UM	+211825-1575130	Pacific/Honolulu	Hawaii
+UY	-345433-0561245	America/Montevideo
+UZ	+3940+06648	Asia/Samarkand	Uzbekistan (west)
+UZ	+4120+06918	Asia/Tashkent	Uzbekistan (east)
+VE	+1030-06656	America/Caracas
+VN	+1045+10640	Asia/Ho_Chi_Minh	Vietnam (south)
+VU	-1740+16825	Pacific/Efate
+WF	-1318-17610	Pacific/Wallis
+WS	-1350-17144	Pacific/Apia
+ZA,LS,SZ	-2615+02800	Africa/Johannesburg
diff --git a/absl/time/internal/get_current_time_chrono.inc b/absl/time/internal/get_current_time_chrono.inc
new file mode 100644
index 0000000..5180230
--- /dev/null
+++ b/absl/time/internal/get_current_time_chrono.inc
@@ -0,0 +1,29 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <chrono>
+#include <cstdint>
+
+namespace absl {
+namespace time_internal {
+
+static int64_t GetCurrentTimeNanosFromSystem() {
+  return std::chrono::duration_cast<std::chrono::nanoseconds>(
+             std::chrono::system_clock::now() -
+             std::chrono::system_clock::from_time_t(0))
+      .count();
+}
+
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/get_current_time_posix.inc b/absl/time/internal/get_current_time_posix.inc
new file mode 100644
index 0000000..65474ca
--- /dev/null
+++ b/absl/time/internal/get_current_time_posix.inc
@@ -0,0 +1,22 @@
+#include "absl/time/clock.h"
+
+#include <sys/time.h>
+#include <ctime>
+#include <cstdint>
+
+#include "absl/base/internal/raw_logging.h"
+
+namespace absl {
+namespace time_internal {
+
+static int64_t GetCurrentTimeNanosFromSystem() {
+  const int64_t kNanosPerSecond = 1000 * 1000 * 1000;
+  struct timespec ts;
+  ABSL_RAW_CHECK(clock_gettime(CLOCK_REALTIME, &ts) == 0,
+                 "Failed to read real-time clock.");
+  return (int64_t{ts.tv_sec} * kNanosPerSecond +
+          int64_t{ts.tv_nsec});
+}
+
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/test_util.cc b/absl/time/internal/test_util.cc
new file mode 100644
index 0000000..59166a7
--- /dev/null
+++ b/absl/time/internal/test_util.cc
@@ -0,0 +1,123 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/internal/test_util.h"
+
+#include <algorithm>
+#include <cstddef>
+#include <cstring>
+
+#include "absl/base/internal/raw_logging.h"
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+
+namespace cctz = absl::time_internal::cctz;
+
+namespace absl {
+namespace time_internal {
+
+TimeZone LoadTimeZone(const std::string& name) {
+  TimeZone tz;
+  ABSL_RAW_CHECK(LoadTimeZone(name, &tz), name.c_str());
+  return tz;
+}
+
+}  // namespace time_internal
+}  // namespace absl
+
+namespace absl {
+namespace time_internal {
+namespace cctz_extension {
+namespace {
+
+// Embed the zoneinfo data for time zones used during tests and benchmarks.
+// The data was generated using "xxd -i zoneinfo-file".  There is no need
+// to update the data as long as the tests do not depend on recent changes
+// (and the past rules remain the same).
+#include "absl/time/internal/zoneinfo.inc"
+
+const struct ZoneInfo {
+  const char* name;
+  const char* data;
+  std::size_t length;
+} kZoneInfo[] = {
+    // The three real time zones used by :time_test and :time_benchmark.
+    {"America/Los_Angeles",  //
+     reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+    {"America/New_York",  //
+     reinterpret_cast<char*>(America_New_York), America_New_York_len},
+    {"Australia/Sydney",  //
+     reinterpret_cast<char*>(Australia_Sydney), Australia_Sydney_len},
+
+    // Other zones named in tests but which should fail to load.
+    {"Invalid/TimeZone", nullptr, 0},
+    {"", nullptr, 0},
+
+    // Also allow for loading the local time zone under TZ=US/Pacific.
+    {"US/Pacific",  //
+     reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+
+    // Allows use of the local time zone from a system-specific location.
+#ifdef _MSC_VER
+    {"localtime",  //
+     reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+#else
+    {"/etc/localtime",  //
+     reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+#endif
+};
+
+class TestZoneInfoSource : public cctz::ZoneInfoSource {
+ public:
+  TestZoneInfoSource(const char* data, std::size_t size)
+      : data_(data), end_(data + size) {}
+
+  std::size_t Read(void* ptr, std::size_t size) override {
+    const std::size_t len = std::min<std::size_t>(size, end_ - data_);
+    memcpy(ptr, data_, len);
+    data_ += len;
+    return len;
+  }
+
+  int Skip(std::size_t offset) override {
+    data_ += std::min<std::size_t>(offset, end_ - data_);
+    return 0;
+  }
+
+ private:
+  const char* data_;
+  const char* const end_;
+};
+
+std::unique_ptr<cctz::ZoneInfoSource> TestFactory(
+    const std::string& name,
+    const std::function<std::unique_ptr<cctz::ZoneInfoSource>(
+        const std::string& name)>& /*fallback_factory*/) {
+  for (const ZoneInfo& zoneinfo : kZoneInfo) {
+    if (name == zoneinfo.name) {
+      if (zoneinfo.data == nullptr) return nullptr;
+      return std::unique_ptr<cctz::ZoneInfoSource>(
+          new TestZoneInfoSource(zoneinfo.data, zoneinfo.length));
+    }
+  }
+  ABSL_RAW_LOG(FATAL, "Unexpected time zone \"%s\" in test", name.c_str());
+  return nullptr;
+}
+
+}  // namespace
+
+ZoneInfoSourceFactory zone_info_source_factory = TestFactory;
+
+}  // namespace cctz_extension
+}  // namespace time_internal
+}  // namespace absl
diff --git a/absl/time/internal/test_util.h b/absl/time/internal/test_util.h
new file mode 100644
index 0000000..d7319ea
--- /dev/null
+++ b/absl/time/internal/test_util.h
@@ -0,0 +1,31 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_TEST_UTIL_H_
+#define ABSL_TIME_INTERNAL_TEST_UTIL_H_
+
+#include <string>
+
+#include "absl/time/time.h"
+
+namespace absl {
+namespace time_internal {
+
+// Loads the named timezone, but dies on any failure.
+absl::TimeZone LoadTimeZone(const std::string& name);
+
+}  // namespace time_internal
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_TEST_UTIL_H_
diff --git a/absl/time/internal/zoneinfo.inc b/absl/time/internal/zoneinfo.inc
new file mode 100644
index 0000000..bfed829
--- /dev/null
+++ b/absl/time/internal/zoneinfo.inc
@@ -0,0 +1,729 @@
+unsigned char America_Los_Angeles[] = {
+  0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0x80, 0x00, 0x00, 0x00,
+  0x9e, 0xa6, 0x48, 0xa0, 0x9f, 0xbb, 0x15, 0x90, 0xa0, 0x86, 0x2a, 0xa0,
+  0xa1, 0x9a, 0xf7, 0x90, 0xcb, 0x89, 0x1a, 0xa0, 0xd2, 0x23, 0xf4, 0x70,
+  0xd2, 0x61, 0x26, 0x10, 0xd6, 0xfe, 0x74, 0x5c, 0xd8, 0x80, 0xad, 0x90,
+  0xda, 0xfe, 0xc3, 0x90, 0xdb, 0xc0, 0x90, 0x10, 0xdc, 0xde, 0xa5, 0x90,
+  0xdd, 0xa9, 0xac, 0x90, 0xde, 0xbe, 0x87, 0x90, 0xdf, 0x89, 0x8e, 0x90,
+  0xe0, 0x9e, 0x69, 0x90, 0xe1, 0x69, 0x70, 0x90, 0xe2, 0x7e, 0x4b, 0x90,
+  0xe3, 0x49, 0x52, 0x90, 0xe4, 0x5e, 0x2d, 0x90, 0xe5, 0x29, 0x34, 0x90,
+  0xe6, 0x47, 0x4a, 0x10, 0xe7, 0x12, 0x51, 0x10, 0xe8, 0x27, 0x2c, 0x10,
+  0xe8, 0xf2, 0x33, 0x10, 0xea, 0x07, 0x0e, 0x10, 0xea, 0xd2, 0x15, 0x10,
+  0xeb, 0xe6, 0xf0, 0x10, 0xec, 0xb1, 0xf7, 0x10, 0xed, 0xc6, 0xd2, 0x10,
+  0xee, 0x91, 0xd9, 0x10, 0xef, 0xaf, 0xee, 0x90, 0xf0, 0x71, 0xbb, 0x10,
+  0xf1, 0x8f, 0xd0, 0x90, 0xf2, 0x7f, 0xc1, 0x90, 0xf3, 0x6f, 0xb2, 0x90,
+  0xf4, 0x5f, 0xa3, 0x90, 0xf5, 0x4f, 0x94, 0x90, 0xf6, 0x3f, 0x85, 0x90,
+  0xf7, 0x2f, 0x76, 0x90, 0xf8, 0x28, 0xa2, 0x10, 0xf9, 0x0f, 0x58, 0x90,
+  0xfa, 0x08, 0x84, 0x10, 0xfa, 0xf8, 0x83, 0x20, 0xfb, 0xe8, 0x66, 0x10,
+  0xfc, 0xd8, 0x65, 0x20, 0xfd, 0xc8, 0x48, 0x10, 0xfe, 0xb8, 0x47, 0x20,
+  0xff, 0xa8, 0x2a, 0x10, 0x00, 0x98, 0x29, 0x20, 0x01, 0x88, 0x0c, 0x10,
+  0x02, 0x78, 0x0b, 0x20, 0x03, 0x71, 0x28, 0x90, 0x04, 0x61, 0x27, 0xa0,
+  0x05, 0x51, 0x0a, 0x90, 0x06, 0x41, 0x09, 0xa0, 0x07, 0x30, 0xec, 0x90,
+  0x07, 0x8d, 0x43, 0xa0, 0x09, 0x10, 0xce, 0x90, 0x09, 0xad, 0xbf, 0x20,
+  0x0a, 0xf0, 0xb0, 0x90, 0x0b, 0xe0, 0xaf, 0xa0, 0x0c, 0xd9, 0xcd, 0x10,
+  0x0d, 0xc0, 0x91, 0xa0, 0x0e, 0xb9, 0xaf, 0x10, 0x0f, 0xa9, 0xae, 0x20,
+  0x10, 0x99, 0x91, 0x10, 0x11, 0x89, 0x90, 0x20, 0x12, 0x79, 0x73, 0x10,
+  0x13, 0x69, 0x72, 0x20, 0x14, 0x59, 0x55, 0x10, 0x15, 0x49, 0x54, 0x20,
+  0x16, 0x39, 0x37, 0x10, 0x17, 0x29, 0x36, 0x20, 0x18, 0x22, 0x53, 0x90,
+  0x19, 0x09, 0x18, 0x20, 0x1a, 0x02, 0x35, 0x90, 0x1a, 0xf2, 0x34, 0xa0,
+  0x1b, 0xe2, 0x17, 0x90, 0x1c, 0xd2, 0x16, 0xa0, 0x1d, 0xc1, 0xf9, 0x90,
+  0x1e, 0xb1, 0xf8, 0xa0, 0x1f, 0xa1, 0xdb, 0x90, 0x20, 0x76, 0x2b, 0x20,
+  0x21, 0x81, 0xbd, 0x90, 0x22, 0x56, 0x0d, 0x20, 0x23, 0x6a, 0xda, 0x10,
+  0x24, 0x35, 0xef, 0x20, 0x25, 0x4a, 0xbc, 0x10, 0x26, 0x15, 0xd1, 0x20,
+  0x27, 0x2a, 0x9e, 0x10, 0x27, 0xfe, 0xed, 0xa0, 0x29, 0x0a, 0x80, 0x10,
+  0x29, 0xde, 0xcf, 0xa0, 0x2a, 0xea, 0x62, 0x10, 0x2b, 0xbe, 0xb1, 0xa0,
+  0x2c, 0xd3, 0x7e, 0x90, 0x2d, 0x9e, 0x93, 0xa0, 0x2e, 0xb3, 0x60, 0x90,
+  0x2f, 0x7e, 0x75, 0xa0, 0x30, 0x93, 0x42, 0x90, 0x31, 0x67, 0x92, 0x20,
+  0x32, 0x73, 0x24, 0x90, 0x33, 0x47, 0x74, 0x20, 0x34, 0x53, 0x06, 0x90,
+  0x35, 0x27, 0x56, 0x20, 0x36, 0x32, 0xe8, 0x90, 0x37, 0x07, 0x38, 0x20,
+  0x38, 0x1c, 0x05, 0x10, 0x38, 0xe7, 0x1a, 0x20, 0x39, 0xfb, 0xe7, 0x10,
+  0x3a, 0xc6, 0xfc, 0x20, 0x3b, 0xdb, 0xc9, 0x10, 0x3c, 0xb0, 0x18, 0xa0,
+  0x3d, 0xbb, 0xab, 0x10, 0x3e, 0x8f, 0xfa, 0xa0, 0x3f, 0x9b, 0x8d, 0x10,
+  0x40, 0x6f, 0xdc, 0xa0, 0x41, 0x84, 0xa9, 0x90, 0x42, 0x4f, 0xbe, 0xa0,
+  0x43, 0x64, 0x8b, 0x90, 0x44, 0x2f, 0xa0, 0xa0, 0x45, 0x44, 0x6d, 0x90,
+  0x45, 0xf3, 0xd3, 0x20, 0x47, 0x2d, 0x8a, 0x10, 0x47, 0xd3, 0xb5, 0x20,
+  0x49, 0x0d, 0x6c, 0x10, 0x49, 0xb3, 0x97, 0x20, 0x4a, 0xed, 0x4e, 0x10,
+  0x4b, 0x9c, 0xb3, 0xa0, 0x4c, 0xd6, 0x6a, 0x90, 0x4d, 0x7c, 0x95, 0xa0,
+  0x4e, 0xb6, 0x4c, 0x90, 0x4f, 0x5c, 0x77, 0xa0, 0x50, 0x96, 0x2e, 0x90,
+  0x51, 0x3c, 0x59, 0xa0, 0x52, 0x76, 0x10, 0x90, 0x53, 0x1c, 0x3b, 0xa0,
+  0x54, 0x55, 0xf2, 0x90, 0x54, 0xfc, 0x1d, 0xa0, 0x56, 0x35, 0xd4, 0x90,
+  0x56, 0xe5, 0x3a, 0x20, 0x58, 0x1e, 0xf1, 0x10, 0x58, 0xc5, 0x1c, 0x20,
+  0x59, 0xfe, 0xd3, 0x10, 0x5a, 0xa4, 0xfe, 0x20, 0x5b, 0xde, 0xb5, 0x10,
+  0x5c, 0x84, 0xe0, 0x20, 0x5d, 0xbe, 0x97, 0x10, 0x5e, 0x64, 0xc2, 0x20,
+  0x5f, 0x9e, 0x79, 0x10, 0x60, 0x4d, 0xde, 0xa0, 0x61, 0x87, 0x95, 0x90,
+  0x62, 0x2d, 0xc0, 0xa0, 0x63, 0x67, 0x77, 0x90, 0x64, 0x0d, 0xa2, 0xa0,
+  0x65, 0x47, 0x59, 0x90, 0x65, 0xed, 0x84, 0xa0, 0x67, 0x27, 0x3b, 0x90,
+  0x67, 0xcd, 0x66, 0xa0, 0x69, 0x07, 0x1d, 0x90, 0x69, 0xad, 0x48, 0xa0,
+  0x6a, 0xe6, 0xff, 0x90, 0x6b, 0x96, 0x65, 0x20, 0x6c, 0xd0, 0x1c, 0x10,
+  0x6d, 0x76, 0x47, 0x20, 0x6e, 0xaf, 0xfe, 0x10, 0x6f, 0x56, 0x29, 0x20,
+  0x70, 0x8f, 0xe0, 0x10, 0x71, 0x36, 0x0b, 0x20, 0x72, 0x6f, 0xc2, 0x10,
+  0x73, 0x15, 0xed, 0x20, 0x74, 0x4f, 0xa4, 0x10, 0x74, 0xff, 0x09, 0xa0,
+  0x76, 0x38, 0xc0, 0x90, 0x76, 0xde, 0xeb, 0xa0, 0x78, 0x18, 0xa2, 0x90,
+  0x78, 0xbe, 0xcd, 0xa0, 0x79, 0xf8, 0x84, 0x90, 0x7a, 0x9e, 0xaf, 0xa0,
+  0x7b, 0xd8, 0x66, 0x90, 0x7c, 0x7e, 0x91, 0xa0, 0x7d, 0xb8, 0x48, 0x90,
+  0x7e, 0x5e, 0x73, 0xa0, 0x7f, 0x98, 0x2a, 0x90, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0xff, 0xff, 0x91, 0x26, 0x00, 0x00, 0xff, 0xff, 0x9d, 0x90,
+  0x01, 0x04, 0xff, 0xff, 0x8f, 0x80, 0x00, 0x08, 0xff, 0xff, 0x9d, 0x90,
+  0x01, 0x0c, 0xff, 0xff, 0x9d, 0x90, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00,
+  0x50, 0x44, 0x54, 0x00, 0x50, 0x53, 0x54, 0x00, 0x50, 0x57, 0x54, 0x00,
+  0x50, 0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x01, 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x05, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0xbb, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0xf8, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0x5e, 0x04,
+  0x1a, 0xc0, 0xff, 0xff, 0xff, 0xff, 0x9e, 0xa6, 0x48, 0xa0, 0xff, 0xff,
+  0xff, 0xff, 0x9f, 0xbb, 0x15, 0x90, 0xff, 0xff, 0xff, 0xff, 0xa0, 0x86,
+  0x2a, 0xa0, 0xff, 0xff, 0xff, 0xff, 0xa1, 0x9a, 0xf7, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xcb, 0x89, 0x1a, 0xa0, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x23,
+  0xf4, 0x70, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x61, 0x26, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xd6, 0xfe, 0x74, 0x5c, 0xff, 0xff, 0xff, 0xff, 0xd8, 0x80,
+  0xad, 0x90, 0xff, 0xff, 0xff, 0xff, 0xda, 0xfe, 0xc3, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xdb, 0xc0, 0x90, 0x10, 0xff, 0xff, 0xff, 0xff, 0xdc, 0xde,
+  0xa5, 0x90, 0xff, 0xff, 0xff, 0xff, 0xdd, 0xa9, 0xac, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xde, 0xbe, 0x87, 0x90, 0xff, 0xff, 0xff, 0xff, 0xdf, 0x89,
+  0x8e, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe0, 0x9e, 0x69, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xe1, 0x69, 0x70, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe2, 0x7e,
+  0x4b, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe3, 0x49, 0x52, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xe4, 0x5e, 0x2d, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe5, 0x29,
+  0x34, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe6, 0x47, 0x4a, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xe7, 0x12, 0x51, 0x10, 0xff, 0xff, 0xff, 0xff, 0xe8, 0x27,
+  0x2c, 0x10, 0xff, 0xff, 0xff, 0xff, 0xe8, 0xf2, 0x33, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xea, 0x07, 0x0e, 0x10, 0xff, 0xff, 0xff, 0xff, 0xea, 0xd2,
+  0x15, 0x10, 0xff, 0xff, 0xff, 0xff, 0xeb, 0xe6, 0xf0, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xec, 0xb1, 0xf7, 0x10, 0xff, 0xff, 0xff, 0xff, 0xed, 0xc6,
+  0xd2, 0x10, 0xff, 0xff, 0xff, 0xff, 0xee, 0x91, 0xd9, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xef, 0xaf, 0xee, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf0, 0x71,
+  0xbb, 0x10, 0xff, 0xff, 0xff, 0xff, 0xf1, 0x8f, 0xd0, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xf2, 0x7f, 0xc1, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf3, 0x6f,
+  0xb2, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf4, 0x5f, 0xa3, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xf5, 0x4f, 0x94, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x3f,
+  0x85, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x2f, 0x76, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xf8, 0x28, 0xa2, 0x10, 0xff, 0xff, 0xff, 0xff, 0xf9, 0x0f,
+  0x58, 0x90, 0xff, 0xff, 0xff, 0xff, 0xfa, 0x08, 0x84, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xfa, 0xf8, 0x83, 0x20, 0xff, 0xff, 0xff, 0xff, 0xfb, 0xe8,
+  0x66, 0x10, 0xff, 0xff, 0xff, 0xff, 0xfc, 0xd8, 0x65, 0x20, 0xff, 0xff,
+  0xff, 0xff, 0xfd, 0xc8, 0x48, 0x10, 0xff, 0xff, 0xff, 0xff, 0xfe, 0xb8,
+  0x47, 0x20, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa8, 0x2a, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x98, 0x29, 0x20, 0x00, 0x00, 0x00, 0x00, 0x01, 0x88,
+  0x0c, 0x10, 0x00, 0x00, 0x00, 0x00, 0x02, 0x78, 0x0b, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x03, 0x71, 0x28, 0x90, 0x00, 0x00, 0x00, 0x00, 0x04, 0x61,
+  0x27, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x05, 0x51, 0x0a, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x06, 0x41, 0x09, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x07, 0x30,
+  0xec, 0x90, 0x00, 0x00, 0x00, 0x00, 0x07, 0x8d, 0x43, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x09, 0x10, 0xce, 0x90, 0x00, 0x00, 0x00, 0x00, 0x09, 0xad,
+  0xbf, 0x20, 0x00, 0x00, 0x00, 0x00, 0x0a, 0xf0, 0xb0, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x0b, 0xe0, 0xaf, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x0c, 0xd9,
+  0xcd, 0x10, 0x00, 0x00, 0x00, 0x00, 0x0d, 0xc0, 0x91, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x0e, 0xb9, 0xaf, 0x10, 0x00, 0x00, 0x00, 0x00, 0x0f, 0xa9,
+  0xae, 0x20, 0x00, 0x00, 0x00, 0x00, 0x10, 0x99, 0x91, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x11, 0x89, 0x90, 0x20, 0x00, 0x00, 0x00, 0x00, 0x12, 0x79,
+  0x73, 0x10, 0x00, 0x00, 0x00, 0x00, 0x13, 0x69, 0x72, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x14, 0x59, 0x55, 0x10, 0x00, 0x00, 0x00, 0x00, 0x15, 0x49,
+  0x54, 0x20, 0x00, 0x00, 0x00, 0x00, 0x16, 0x39, 0x37, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x17, 0x29, 0x36, 0x20, 0x00, 0x00, 0x00, 0x00, 0x18, 0x22,
+  0x53, 0x90, 0x00, 0x00, 0x00, 0x00, 0x19, 0x09, 0x18, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x1a, 0x02, 0x35, 0x90, 0x00, 0x00, 0x00, 0x00, 0x1a, 0xf2,
+  0x34, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x1b, 0xe2, 0x17, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x1c, 0xd2, 0x16, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x1d, 0xc1,
+  0xf9, 0x90, 0x00, 0x00, 0x00, 0x00, 0x1e, 0xb1, 0xf8, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x1f, 0xa1, 0xdb, 0x90, 0x00, 0x00, 0x00, 0x00, 0x20, 0x76,
+  0x2b, 0x20, 0x00, 0x00, 0x00, 0x00, 0x21, 0x81, 0xbd, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x22, 0x56, 0x0d, 0x20, 0x00, 0x00, 0x00, 0x00, 0x23, 0x6a,
+  0xda, 0x10, 0x00, 0x00, 0x00, 0x00, 0x24, 0x35, 0xef, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x25, 0x4a, 0xbc, 0x10, 0x00, 0x00, 0x00, 0x00, 0x26, 0x15,
+  0xd1, 0x20, 0x00, 0x00, 0x00, 0x00, 0x27, 0x2a, 0x9e, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x27, 0xfe, 0xed, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x29, 0x0a,
+  0x80, 0x10, 0x00, 0x00, 0x00, 0x00, 0x29, 0xde, 0xcf, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x2a, 0xea, 0x62, 0x10, 0x00, 0x00, 0x00, 0x00, 0x2b, 0xbe,
+  0xb1, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x2c, 0xd3, 0x7e, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x2d, 0x9e, 0x93, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x2e, 0xb3,
+  0x60, 0x90, 0x00, 0x00, 0x00, 0x00, 0x2f, 0x7e, 0x75, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x30, 0x93, 0x42, 0x90, 0x00, 0x00, 0x00, 0x00, 0x31, 0x67,
+  0x92, 0x20, 0x00, 0x00, 0x00, 0x00, 0x32, 0x73, 0x24, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x33, 0x47, 0x74, 0x20, 0x00, 0x00, 0x00, 0x00, 0x34, 0x53,
+  0x06, 0x90, 0x00, 0x00, 0x00, 0x00, 0x35, 0x27, 0x56, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x36, 0x32, 0xe8, 0x90, 0x00, 0x00, 0x00, 0x00, 0x37, 0x07,
+  0x38, 0x20, 0x00, 0x00, 0x00, 0x00, 0x38, 0x1c, 0x05, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x38, 0xe7, 0x1a, 0x20, 0x00, 0x00, 0x00, 0x00, 0x39, 0xfb,
+  0xe7, 0x10, 0x00, 0x00, 0x00, 0x00, 0x3a, 0xc6, 0xfc, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x3b, 0xdb, 0xc9, 0x10, 0x00, 0x00, 0x00, 0x00, 0x3c, 0xb0,
+  0x18, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x3d, 0xbb, 0xab, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x3e, 0x8f, 0xfa, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x9b,
+  0x8d, 0x10, 0x00, 0x00, 0x00, 0x00, 0x40, 0x6f, 0xdc, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x41, 0x84, 0xa9, 0x90, 0x00, 0x00, 0x00, 0x00, 0x42, 0x4f,
+  0xbe, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x43, 0x64, 0x8b, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x44, 0x2f, 0xa0, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x45, 0x44,
+  0x6d, 0x90, 0x00, 0x00, 0x00, 0x00, 0x45, 0xf3, 0xd3, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x47, 0x2d, 0x8a, 0x10, 0x00, 0x00, 0x00, 0x00, 0x47, 0xd3,
+  0xb5, 0x20, 0x00, 0x00, 0x00, 0x00, 0x49, 0x0d, 0x6c, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x49, 0xb3, 0x97, 0x20, 0x00, 0x00, 0x00, 0x00, 0x4a, 0xed,
+  0x4e, 0x10, 0x00, 0x00, 0x00, 0x00, 0x4b, 0x9c, 0xb3, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x4c, 0xd6, 0x6a, 0x90, 0x00, 0x00, 0x00, 0x00, 0x4d, 0x7c,
+  0x95, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x4e, 0xb6, 0x4c, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x4f, 0x5c, 0x77, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x50, 0x96,
+  0x2e, 0x90, 0x00, 0x00, 0x00, 0x00, 0x51, 0x3c, 0x59, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x52, 0x76, 0x10, 0x90, 0x00, 0x00, 0x00, 0x00, 0x53, 0x1c,
+  0x3b, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x54, 0x55, 0xf2, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x54, 0xfc, 0x1d, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x56, 0x35,
+  0xd4, 0x90, 0x00, 0x00, 0x00, 0x00, 0x56, 0xe5, 0x3a, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x58, 0x1e, 0xf1, 0x10, 0x00, 0x00, 0x00, 0x00, 0x58, 0xc5,
+  0x1c, 0x20, 0x00, 0x00, 0x00, 0x00, 0x59, 0xfe, 0xd3, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x5a, 0xa4, 0xfe, 0x20, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xde,
+  0xb5, 0x10, 0x00, 0x00, 0x00, 0x00, 0x5c, 0x84, 0xe0, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x5d, 0xbe, 0x97, 0x10, 0x00, 0x00, 0x00, 0x00, 0x5e, 0x64,
+  0xc2, 0x20, 0x00, 0x00, 0x00, 0x00, 0x5f, 0x9e, 0x79, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x60, 0x4d, 0xde, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x61, 0x87,
+  0x95, 0x90, 0x00, 0x00, 0x00, 0x00, 0x62, 0x2d, 0xc0, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x63, 0x67, 0x77, 0x90, 0x00, 0x00, 0x00, 0x00, 0x64, 0x0d,
+  0xa2, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x65, 0x47, 0x59, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x65, 0xed, 0x84, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x67, 0x27,
+  0x3b, 0x90, 0x00, 0x00, 0x00, 0x00, 0x67, 0xcd, 0x66, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x69, 0x07, 0x1d, 0x90, 0x00, 0x00, 0x00, 0x00, 0x69, 0xad,
+  0x48, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x6a, 0xe6, 0xff, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x6b, 0x96, 0x65, 0x20, 0x00, 0x00, 0x00, 0x00, 0x6c, 0xd0,
+  0x1c, 0x10, 0x00, 0x00, 0x00, 0x00, 0x6d, 0x76, 0x47, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x6e, 0xaf, 0xfe, 0x10, 0x00, 0x00, 0x00, 0x00, 0x6f, 0x56,
+  0x29, 0x20, 0x00, 0x00, 0x00, 0x00, 0x70, 0x8f, 0xe0, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x71, 0x36, 0x0b, 0x20, 0x00, 0x00, 0x00, 0x00, 0x72, 0x6f,
+  0xc2, 0x10, 0x00, 0x00, 0x00, 0x00, 0x73, 0x15, 0xed, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x74, 0x4f, 0xa4, 0x10, 0x00, 0x00, 0x00, 0x00, 0x74, 0xff,
+  0x09, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x76, 0x38, 0xc0, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x76, 0xde, 0xeb, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x78, 0x18,
+  0xa2, 0x90, 0x00, 0x00, 0x00, 0x00, 0x78, 0xbe, 0xcd, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x79, 0xf8, 0x84, 0x90, 0x00, 0x00, 0x00, 0x00, 0x7a, 0x9e,
+  0xaf, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x7b, 0xd8, 0x66, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x7c, 0x7e, 0x91, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x7d, 0xb8,
+  0x48, 0x90, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x5e, 0x73, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x7f, 0x98, 0x2a, 0x90, 0x00, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0xff, 0xff, 0x91, 0x26, 0x00, 0x00, 0xff, 0xff, 0x9d, 0x90, 0x01,
+  0x04, 0xff, 0xff, 0x8f, 0x80, 0x00, 0x08, 0xff, 0xff, 0x9d, 0x90, 0x01,
+  0x0c, 0xff, 0xff, 0x9d, 0x90, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00, 0x50,
+  0x44, 0x54, 0x00, 0x50, 0x53, 0x54, 0x00, 0x50, 0x57, 0x54, 0x00, 0x50,
+  0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00,
+  0x01, 0x0a, 0x50, 0x53, 0x54, 0x38, 0x50, 0x44, 0x54, 0x2c, 0x4d, 0x33,
+  0x2e, 0x32, 0x2e, 0x30, 0x2c, 0x4d, 0x31, 0x31, 0x2e, 0x31, 0x2e, 0x30,
+  0x0a
+};
+unsigned int America_Los_Angeles_len = 2845;
+unsigned char America_New_York[] = {
+  0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xec,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0x80, 0x00, 0x00, 0x00,
+  0x9e, 0xa6, 0x1e, 0x70, 0x9f, 0xba, 0xeb, 0x60, 0xa0, 0x86, 0x00, 0x70,
+  0xa1, 0x9a, 0xcd, 0x60, 0xa2, 0x65, 0xe2, 0x70, 0xa3, 0x83, 0xe9, 0xe0,
+  0xa4, 0x6a, 0xae, 0x70, 0xa5, 0x35, 0xa7, 0x60, 0xa6, 0x53, 0xca, 0xf0,
+  0xa7, 0x15, 0x89, 0x60, 0xa8, 0x33, 0xac, 0xf0, 0xa8, 0xfe, 0xa5, 0xe0,
+  0xaa, 0x13, 0x8e, 0xf0, 0xaa, 0xde, 0x87, 0xe0, 0xab, 0xf3, 0x70, 0xf0,
+  0xac, 0xbe, 0x69, 0xe0, 0xad, 0xd3, 0x52, 0xf0, 0xae, 0x9e, 0x4b, 0xe0,
+  0xaf, 0xb3, 0x34, 0xf0, 0xb0, 0x7e, 0x2d, 0xe0, 0xb1, 0x9c, 0x51, 0x70,
+  0xb2, 0x67, 0x4a, 0x60, 0xb3, 0x7c, 0x33, 0x70, 0xb4, 0x47, 0x2c, 0x60,
+  0xb5, 0x5c, 0x15, 0x70, 0xb6, 0x27, 0x0e, 0x60, 0xb7, 0x3b, 0xf7, 0x70,
+  0xb8, 0x06, 0xf0, 0x60, 0xb9, 0x1b, 0xd9, 0x70, 0xb9, 0xe6, 0xd2, 0x60,
+  0xbb, 0x04, 0xf5, 0xf0, 0xbb, 0xc6, 0xb4, 0x60, 0xbc, 0xe4, 0xd7, 0xf0,
+  0xbd, 0xaf, 0xd0, 0xe0, 0xbe, 0xc4, 0xb9, 0xf0, 0xbf, 0x8f, 0xb2, 0xe0,
+  0xc0, 0xa4, 0x9b, 0xf0, 0xc1, 0x6f, 0x94, 0xe0, 0xc2, 0x84, 0x7d, 0xf0,
+  0xc3, 0x4f, 0x76, 0xe0, 0xc4, 0x64, 0x5f, 0xf0, 0xc5, 0x2f, 0x58, 0xe0,
+  0xc6, 0x4d, 0x7c, 0x70, 0xc7, 0x0f, 0x3a, 0xe0, 0xc8, 0x2d, 0x5e, 0x70,
+  0xc8, 0xf8, 0x57, 0x60, 0xca, 0x0d, 0x40, 0x70, 0xca, 0xd8, 0x39, 0x60,
+  0xcb, 0x88, 0xf0, 0x70, 0xd2, 0x23, 0xf4, 0x70, 0xd2, 0x60, 0xfb, 0xe0,
+  0xd3, 0x75, 0xe4, 0xf0, 0xd4, 0x40, 0xdd, 0xe0, 0xd5, 0x55, 0xc6, 0xf0,
+  0xd6, 0x20, 0xbf, 0xe0, 0xd7, 0x35, 0xa8, 0xf0, 0xd8, 0x00, 0xa1, 0xe0,
+  0xd9, 0x15, 0x8a, 0xf0, 0xd9, 0xe0, 0x83, 0xe0, 0xda, 0xfe, 0xa7, 0x70,
+  0xdb, 0xc0, 0x65, 0xe0, 0xdc, 0xde, 0x89, 0x70, 0xdd, 0xa9, 0x82, 0x60,
+  0xde, 0xbe, 0x6b, 0x70, 0xdf, 0x89, 0x64, 0x60, 0xe0, 0x9e, 0x4d, 0x70,
+  0xe1, 0x69, 0x46, 0x60, 0xe2, 0x7e, 0x2f, 0x70, 0xe3, 0x49, 0x28, 0x60,
+  0xe4, 0x5e, 0x11, 0x70, 0xe5, 0x57, 0x2e, 0xe0, 0xe6, 0x47, 0x2d, 0xf0,
+  0xe7, 0x37, 0x10, 0xe0, 0xe8, 0x27, 0x0f, 0xf0, 0xe9, 0x16, 0xf2, 0xe0,
+  0xea, 0x06, 0xf1, 0xf0, 0xea, 0xf6, 0xd4, 0xe0, 0xeb, 0xe6, 0xd3, 0xf0,
+  0xec, 0xd6, 0xb6, 0xe0, 0xed, 0xc6, 0xb5, 0xf0, 0xee, 0xbf, 0xd3, 0x60,
+  0xef, 0xaf, 0xd2, 0x70, 0xf0, 0x9f, 0xb5, 0x60, 0xf1, 0x8f, 0xb4, 0x70,
+  0xf2, 0x7f, 0x97, 0x60, 0xf3, 0x6f, 0x96, 0x70, 0xf4, 0x5f, 0x79, 0x60,
+  0xf5, 0x4f, 0x78, 0x70, 0xf6, 0x3f, 0x5b, 0x60, 0xf7, 0x2f, 0x5a, 0x70,
+  0xf8, 0x28, 0x77, 0xe0, 0xf9, 0x0f, 0x3c, 0x70, 0xfa, 0x08, 0x59, 0xe0,
+  0xfa, 0xf8, 0x58, 0xf0, 0xfb, 0xe8, 0x3b, 0xe0, 0xfc, 0xd8, 0x3a, 0xf0,
+  0xfd, 0xc8, 0x1d, 0xe0, 0xfe, 0xb8, 0x1c, 0xf0, 0xff, 0xa7, 0xff, 0xe0,
+  0x00, 0x97, 0xfe, 0xf0, 0x01, 0x87, 0xe1, 0xe0, 0x02, 0x77, 0xe0, 0xf0,
+  0x03, 0x70, 0xfe, 0x60, 0x04, 0x60, 0xfd, 0x70, 0x05, 0x50, 0xe0, 0x60,
+  0x06, 0x40, 0xdf, 0x70, 0x07, 0x30, 0xc2, 0x60, 0x07, 0x8d, 0x19, 0x70,
+  0x09, 0x10, 0xa4, 0x60, 0x09, 0xad, 0x94, 0xf0, 0x0a, 0xf0, 0x86, 0x60,
+  0x0b, 0xe0, 0x85, 0x70, 0x0c, 0xd9, 0xa2, 0xe0, 0x0d, 0xc0, 0x67, 0x70,
+  0x0e, 0xb9, 0x84, 0xe0, 0x0f, 0xa9, 0x83, 0xf0, 0x10, 0x99, 0x66, 0xe0,
+  0x11, 0x89, 0x65, 0xf0, 0x12, 0x79, 0x48, 0xe0, 0x13, 0x69, 0x47, 0xf0,
+  0x14, 0x59, 0x2a, 0xe0, 0x15, 0x49, 0x29, 0xf0, 0x16, 0x39, 0x0c, 0xe0,
+  0x17, 0x29, 0x0b, 0xf0, 0x18, 0x22, 0x29, 0x60, 0x19, 0x08, 0xed, 0xf0,
+  0x1a, 0x02, 0x0b, 0x60, 0x1a, 0xf2, 0x0a, 0x70, 0x1b, 0xe1, 0xed, 0x60,
+  0x1c, 0xd1, 0xec, 0x70, 0x1d, 0xc1, 0xcf, 0x60, 0x1e, 0xb1, 0xce, 0x70,
+  0x1f, 0xa1, 0xb1, 0x60, 0x20, 0x76, 0x00, 0xf0, 0x21, 0x81, 0x93, 0x60,
+  0x22, 0x55, 0xe2, 0xf0, 0x23, 0x6a, 0xaf, 0xe0, 0x24, 0x35, 0xc4, 0xf0,
+  0x25, 0x4a, 0x91, 0xe0, 0x26, 0x15, 0xa6, 0xf0, 0x27, 0x2a, 0x73, 0xe0,
+  0x27, 0xfe, 0xc3, 0x70, 0x29, 0x0a, 0x55, 0xe0, 0x29, 0xde, 0xa5, 0x70,
+  0x2a, 0xea, 0x37, 0xe0, 0x2b, 0xbe, 0x87, 0x70, 0x2c, 0xd3, 0x54, 0x60,
+  0x2d, 0x9e, 0x69, 0x70, 0x2e, 0xb3, 0x36, 0x60, 0x2f, 0x7e, 0x4b, 0x70,
+  0x30, 0x93, 0x18, 0x60, 0x31, 0x67, 0x67, 0xf0, 0x32, 0x72, 0xfa, 0x60,
+  0x33, 0x47, 0x49, 0xf0, 0x34, 0x52, 0xdc, 0x60, 0x35, 0x27, 0x2b, 0xf0,
+  0x36, 0x32, 0xbe, 0x60, 0x37, 0x07, 0x0d, 0xf0, 0x38, 0x1b, 0xda, 0xe0,
+  0x38, 0xe6, 0xef, 0xf0, 0x39, 0xfb, 0xbc, 0xe0, 0x3a, 0xc6, 0xd1, 0xf0,
+  0x3b, 0xdb, 0x9e, 0xe0, 0x3c, 0xaf, 0xee, 0x70, 0x3d, 0xbb, 0x80, 0xe0,
+  0x3e, 0x8f, 0xd0, 0x70, 0x3f, 0x9b, 0x62, 0xe0, 0x40, 0x6f, 0xb2, 0x70,
+  0x41, 0x84, 0x7f, 0x60, 0x42, 0x4f, 0x94, 0x70, 0x43, 0x64, 0x61, 0x60,
+  0x44, 0x2f, 0x76, 0x70, 0x45, 0x44, 0x43, 0x60, 0x45, 0xf3, 0xa8, 0xf0,
+  0x47, 0x2d, 0x5f, 0xe0, 0x47, 0xd3, 0x8a, 0xf0, 0x49, 0x0d, 0x41, 0xe0,
+  0x49, 0xb3, 0x6c, 0xf0, 0x4a, 0xed, 0x23, 0xe0, 0x4b, 0x9c, 0x89, 0x70,
+  0x4c, 0xd6, 0x40, 0x60, 0x4d, 0x7c, 0x6b, 0x70, 0x4e, 0xb6, 0x22, 0x60,
+  0x4f, 0x5c, 0x4d, 0x70, 0x50, 0x96, 0x04, 0x60, 0x51, 0x3c, 0x2f, 0x70,
+  0x52, 0x75, 0xe6, 0x60, 0x53, 0x1c, 0x11, 0x70, 0x54, 0x55, 0xc8, 0x60,
+  0x54, 0xfb, 0xf3, 0x70, 0x56, 0x35, 0xaa, 0x60, 0x56, 0xe5, 0x0f, 0xf0,
+  0x58, 0x1e, 0xc6, 0xe0, 0x58, 0xc4, 0xf1, 0xf0, 0x59, 0xfe, 0xa8, 0xe0,
+  0x5a, 0xa4, 0xd3, 0xf0, 0x5b, 0xde, 0x8a, 0xe0, 0x5c, 0x84, 0xb5, 0xf0,
+  0x5d, 0xbe, 0x6c, 0xe0, 0x5e, 0x64, 0x97, 0xf0, 0x5f, 0x9e, 0x4e, 0xe0,
+  0x60, 0x4d, 0xb4, 0x70, 0x61, 0x87, 0x6b, 0x60, 0x62, 0x2d, 0x96, 0x70,
+  0x63, 0x67, 0x4d, 0x60, 0x64, 0x0d, 0x78, 0x70, 0x65, 0x47, 0x2f, 0x60,
+  0x65, 0xed, 0x5a, 0x70, 0x67, 0x27, 0x11, 0x60, 0x67, 0xcd, 0x3c, 0x70,
+  0x69, 0x06, 0xf3, 0x60, 0x69, 0xad, 0x1e, 0x70, 0x6a, 0xe6, 0xd5, 0x60,
+  0x6b, 0x96, 0x3a, 0xf0, 0x6c, 0xcf, 0xf1, 0xe0, 0x6d, 0x76, 0x1c, 0xf0,
+  0x6e, 0xaf, 0xd3, 0xe0, 0x6f, 0x55, 0xfe, 0xf0, 0x70, 0x8f, 0xb5, 0xe0,
+  0x71, 0x35, 0xe0, 0xf0, 0x72, 0x6f, 0x97, 0xe0, 0x73, 0x15, 0xc2, 0xf0,
+  0x74, 0x4f, 0x79, 0xe0, 0x74, 0xfe, 0xdf, 0x70, 0x76, 0x38, 0x96, 0x60,
+  0x76, 0xde, 0xc1, 0x70, 0x78, 0x18, 0x78, 0x60, 0x78, 0xbe, 0xa3, 0x70,
+  0x79, 0xf8, 0x5a, 0x60, 0x7a, 0x9e, 0x85, 0x70, 0x7b, 0xd8, 0x3c, 0x60,
+  0x7c, 0x7e, 0x67, 0x70, 0x7d, 0xb8, 0x1e, 0x60, 0x7e, 0x5e, 0x49, 0x70,
+  0x7f, 0x98, 0x00, 0x60, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0xff, 0xff, 0xba, 0x9e, 0x00, 0x00, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x04,
+  0xff, 0xff, 0xb9, 0xb0, 0x00, 0x08, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x0c,
+  0xff, 0xff, 0xc7, 0xc0, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00, 0x45, 0x44,
+  0x54, 0x00, 0x45, 0x53, 0x54, 0x00, 0x45, 0x57, 0x54, 0x00, 0x45, 0x50,
+  0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xed,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0xf8, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0x5e, 0x03, 0xf0, 0x90,
+  0xff, 0xff, 0xff, 0xff, 0x9e, 0xa6, 0x1e, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0x9f, 0xba, 0xeb, 0x60, 0xff, 0xff, 0xff, 0xff, 0xa0, 0x86, 0x00, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xa1, 0x9a, 0xcd, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xa2, 0x65, 0xe2, 0x70, 0xff, 0xff, 0xff, 0xff, 0xa3, 0x83, 0xe9, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xa4, 0x6a, 0xae, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xa5, 0x35, 0xa7, 0x60, 0xff, 0xff, 0xff, 0xff, 0xa6, 0x53, 0xca, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xa7, 0x15, 0x89, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xa8, 0x33, 0xac, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xa8, 0xfe, 0xa5, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xaa, 0x13, 0x8e, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xaa, 0xde, 0x87, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xab, 0xf3, 0x70, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xac, 0xbe, 0x69, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xad, 0xd3, 0x52, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xae, 0x9e, 0x4b, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xaf, 0xb3, 0x34, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xb0, 0x7e, 0x2d, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xb1, 0x9c, 0x51, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xb2, 0x67, 0x4a, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xb3, 0x7c, 0x33, 0x70, 0xff, 0xff, 0xff, 0xff, 0xb4, 0x47, 0x2c, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xb5, 0x5c, 0x15, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xb6, 0x27, 0x0e, 0x60, 0xff, 0xff, 0xff, 0xff, 0xb7, 0x3b, 0xf7, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xb8, 0x06, 0xf0, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xb9, 0x1b, 0xd9, 0x70, 0xff, 0xff, 0xff, 0xff, 0xb9, 0xe6, 0xd2, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xbb, 0x04, 0xf5, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xbb, 0xc6, 0xb4, 0x60, 0xff, 0xff, 0xff, 0xff, 0xbc, 0xe4, 0xd7, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xbd, 0xaf, 0xd0, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xbe, 0xc4, 0xb9, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xbf, 0x8f, 0xb2, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xc0, 0xa4, 0x9b, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xc1, 0x6f, 0x94, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xc2, 0x84, 0x7d, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xc3, 0x4f, 0x76, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xc4, 0x64, 0x5f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xc5, 0x2f, 0x58, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xc6, 0x4d, 0x7c, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xc7, 0x0f, 0x3a, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xc8, 0x2d, 0x5e, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xc8, 0xf8, 0x57, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xca, 0x0d, 0x40, 0x70, 0xff, 0xff, 0xff, 0xff, 0xca, 0xd8, 0x39, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xcb, 0x88, 0xf0, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xd2, 0x23, 0xf4, 0x70, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x60, 0xfb, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xd3, 0x75, 0xe4, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xd4, 0x40, 0xdd, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xd5, 0x55, 0xc6, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xd6, 0x20, 0xbf, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xd7, 0x35, 0xa8, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xd8, 0x00, 0xa1, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xd9, 0x15, 0x8a, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xd9, 0xe0, 0x83, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xda, 0xfe, 0xa7, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xdb, 0xc0, 0x65, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xdc, 0xde, 0x89, 0x70, 0xff, 0xff, 0xff, 0xff, 0xdd, 0xa9, 0x82, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xde, 0xbe, 0x6b, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xdf, 0x89, 0x64, 0x60, 0xff, 0xff, 0xff, 0xff, 0xe0, 0x9e, 0x4d, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xe1, 0x69, 0x46, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xe2, 0x7e, 0x2f, 0x70, 0xff, 0xff, 0xff, 0xff, 0xe3, 0x49, 0x28, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xe4, 0x5e, 0x11, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xe5, 0x57, 0x2e, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xe6, 0x47, 0x2d, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xe7, 0x37, 0x10, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xe8, 0x27, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xe9, 0x16, 0xf2, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xea, 0x06, 0xf1, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xea, 0xf6, 0xd4, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xeb, 0xe6, 0xd3, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xec, 0xd6, 0xb6, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xed, 0xc6, 0xb5, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xee, 0xbf, 0xd3, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xef, 0xaf, 0xd2, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xf0, 0x9f, 0xb5, 0x60, 0xff, 0xff, 0xff, 0xff, 0xf1, 0x8f, 0xb4, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xf2, 0x7f, 0x97, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xf3, 0x6f, 0x96, 0x70, 0xff, 0xff, 0xff, 0xff, 0xf4, 0x5f, 0x79, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xf5, 0x4f, 0x78, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xf6, 0x3f, 0x5b, 0x60, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x2f, 0x5a, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xf8, 0x28, 0x77, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xf9, 0x0f, 0x3c, 0x70, 0xff, 0xff, 0xff, 0xff, 0xfa, 0x08, 0x59, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xfa, 0xf8, 0x58, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xfb, 0xe8, 0x3b, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xfc, 0xd8, 0x3a, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xfd, 0xc8, 0x1d, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xfe, 0xb8, 0x1c, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa7, 0xff, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x97, 0xfe, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x01, 0x87, 0xe1, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x02, 0x77, 0xe0, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x03, 0x70, 0xfe, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x04, 0x60, 0xfd, 0x70, 0x00, 0x00, 0x00, 0x00, 0x05, 0x50, 0xe0, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x06, 0x40, 0xdf, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x07, 0x30, 0xc2, 0x60, 0x00, 0x00, 0x00, 0x00, 0x07, 0x8d, 0x19, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x09, 0x10, 0xa4, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x09, 0xad, 0x94, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x0a, 0xf0, 0x86, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x0b, 0xe0, 0x85, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x0c, 0xd9, 0xa2, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x0d, 0xc0, 0x67, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x0e, 0xb9, 0x84, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x0f, 0xa9, 0x83, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x10, 0x99, 0x66, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x11, 0x89, 0x65, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x12, 0x79, 0x48, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x13, 0x69, 0x47, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x14, 0x59, 0x2a, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x15, 0x49, 0x29, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x16, 0x39, 0x0c, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x17, 0x29, 0x0b, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x18, 0x22, 0x29, 0x60, 0x00, 0x00, 0x00, 0x00, 0x19, 0x08, 0xed, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x1a, 0x02, 0x0b, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x1a, 0xf2, 0x0a, 0x70, 0x00, 0x00, 0x00, 0x00, 0x1b, 0xe1, 0xed, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x1c, 0xd1, 0xec, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x1d, 0xc1, 0xcf, 0x60, 0x00, 0x00, 0x00, 0x00, 0x1e, 0xb1, 0xce, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x1f, 0xa1, 0xb1, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x20, 0x76, 0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x21, 0x81, 0x93, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x22, 0x55, 0xe2, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x23, 0x6a, 0xaf, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x24, 0x35, 0xc4, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x25, 0x4a, 0x91, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x26, 0x15, 0xa6, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x27, 0x2a, 0x73, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x27, 0xfe, 0xc3, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x29, 0x0a, 0x55, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x29, 0xde, 0xa5, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x2a, 0xea, 0x37, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x2b, 0xbe, 0x87, 0x70, 0x00, 0x00, 0x00, 0x00, 0x2c, 0xd3, 0x54, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x2d, 0x9e, 0x69, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x2e, 0xb3, 0x36, 0x60, 0x00, 0x00, 0x00, 0x00, 0x2f, 0x7e, 0x4b, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x30, 0x93, 0x18, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x31, 0x67, 0x67, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x32, 0x72, 0xfa, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x33, 0x47, 0x49, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x34, 0x52, 0xdc, 0x60, 0x00, 0x00, 0x00, 0x00, 0x35, 0x27, 0x2b, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x36, 0x32, 0xbe, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x37, 0x07, 0x0d, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x1b, 0xda, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x38, 0xe6, 0xef, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x39, 0xfb, 0xbc, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x3a, 0xc6, 0xd1, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x3b, 0xdb, 0x9e, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x3c, 0xaf, 0xee, 0x70, 0x00, 0x00, 0x00, 0x00, 0x3d, 0xbb, 0x80, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x3e, 0x8f, 0xd0, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x3f, 0x9b, 0x62, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x40, 0x6f, 0xb2, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x41, 0x84, 0x7f, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x42, 0x4f, 0x94, 0x70, 0x00, 0x00, 0x00, 0x00, 0x43, 0x64, 0x61, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x44, 0x2f, 0x76, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x45, 0x44, 0x43, 0x60, 0x00, 0x00, 0x00, 0x00, 0x45, 0xf3, 0xa8, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x47, 0x2d, 0x5f, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x47, 0xd3, 0x8a, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x49, 0x0d, 0x41, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x49, 0xb3, 0x6c, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x4a, 0xed, 0x23, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x4b, 0x9c, 0x89, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x4c, 0xd6, 0x40, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x4d, 0x7c, 0x6b, 0x70, 0x00, 0x00, 0x00, 0x00, 0x4e, 0xb6, 0x22, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x4f, 0x5c, 0x4d, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x50, 0x96, 0x04, 0x60, 0x00, 0x00, 0x00, 0x00, 0x51, 0x3c, 0x2f, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x52, 0x75, 0xe6, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x53, 0x1c, 0x11, 0x70, 0x00, 0x00, 0x00, 0x00, 0x54, 0x55, 0xc8, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x54, 0xfb, 0xf3, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x56, 0x35, 0xaa, 0x60, 0x00, 0x00, 0x00, 0x00, 0x56, 0xe5, 0x0f, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x58, 0x1e, 0xc6, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x58, 0xc4, 0xf1, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x59, 0xfe, 0xa8, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x5a, 0xa4, 0xd3, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x5b, 0xde, 0x8a, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x5c, 0x84, 0xb5, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x5d, 0xbe, 0x6c, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x5e, 0x64, 0x97, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x5f, 0x9e, 0x4e, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x60, 0x4d, 0xb4, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x61, 0x87, 0x6b, 0x60, 0x00, 0x00, 0x00, 0x00, 0x62, 0x2d, 0x96, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x63, 0x67, 0x4d, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x64, 0x0d, 0x78, 0x70, 0x00, 0x00, 0x00, 0x00, 0x65, 0x47, 0x2f, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x65, 0xed, 0x5a, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x67, 0x27, 0x11, 0x60, 0x00, 0x00, 0x00, 0x00, 0x67, 0xcd, 0x3c, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x69, 0x06, 0xf3, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x69, 0xad, 0x1e, 0x70, 0x00, 0x00, 0x00, 0x00, 0x6a, 0xe6, 0xd5, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x6b, 0x96, 0x3a, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x6c, 0xcf, 0xf1, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x6d, 0x76, 0x1c, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x6e, 0xaf, 0xd3, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x6f, 0x55, 0xfe, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x70, 0x8f, 0xb5, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x71, 0x35, 0xe0, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x72, 0x6f, 0x97, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x73, 0x15, 0xc2, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x74, 0x4f, 0x79, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x74, 0xfe, 0xdf, 0x70, 0x00, 0x00, 0x00, 0x00, 0x76, 0x38, 0x96, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x76, 0xde, 0xc1, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x78, 0x18, 0x78, 0x60, 0x00, 0x00, 0x00, 0x00, 0x78, 0xbe, 0xa3, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x79, 0xf8, 0x5a, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x7a, 0x9e, 0x85, 0x70, 0x00, 0x00, 0x00, 0x00, 0x7b, 0xd8, 0x3c, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x7c, 0x7e, 0x67, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x7d, 0xb8, 0x1e, 0x60, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x5e, 0x49, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x7f, 0x98, 0x00, 0x60, 0x00, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0xff, 0xff, 0xba, 0x9e, 0x00, 0x00, 0xff,
+  0xff, 0xc7, 0xc0, 0x01, 0x04, 0xff, 0xff, 0xb9, 0xb0, 0x00, 0x08, 0xff,
+  0xff, 0xc7, 0xc0, 0x01, 0x0c, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x10, 0x4c,
+  0x4d, 0x54, 0x00, 0x45, 0x44, 0x54, 0x00, 0x45, 0x53, 0x54, 0x00, 0x45,
+  0x57, 0x54, 0x00, 0x45, 0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x00, 0x00, 0x00, 0x00, 0x01, 0x0a, 0x45, 0x53, 0x54, 0x35, 0x45, 0x44,
+  0x54, 0x2c, 0x4d, 0x33, 0x2e, 0x32, 0x2e, 0x30, 0x2c, 0x4d, 0x31, 0x31,
+  0x2e, 0x31, 0x2e, 0x30, 0x0a
+};
+unsigned int America_New_York_len = 3545;
+unsigned char Australia_Sydney[] = {
+  0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8e,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x0e, 0x80, 0x00, 0x00, 0x00,
+  0x9c, 0x4e, 0xa6, 0x9c, 0x9c, 0xbc, 0x20, 0xf0, 0xcb, 0x54, 0xb3, 0x00,
+  0xcb, 0xc7, 0x57, 0x70, 0xcc, 0xb7, 0x56, 0x80, 0xcd, 0xa7, 0x39, 0x70,
+  0xce, 0xa0, 0x73, 0x00, 0xcf, 0x87, 0x1b, 0x70, 0x03, 0x70, 0x39, 0x80,
+  0x04, 0x0d, 0x1c, 0x00, 0x05, 0x50, 0x1b, 0x80, 0x05, 0xf6, 0x38, 0x80,
+  0x07, 0x2f, 0xfd, 0x80, 0x07, 0xd6, 0x1a, 0x80, 0x09, 0x0f, 0xdf, 0x80,
+  0x09, 0xb5, 0xfc, 0x80, 0x0a, 0xef, 0xc1, 0x80, 0x0b, 0x9f, 0x19, 0x00,
+  0x0c, 0xd8, 0xde, 0x00, 0x0d, 0x7e, 0xfb, 0x00, 0x0e, 0xb8, 0xc0, 0x00,
+  0x0f, 0x5e, 0xdd, 0x00, 0x10, 0x98, 0xa2, 0x00, 0x11, 0x3e, 0xbf, 0x00,
+  0x12, 0x78, 0x84, 0x00, 0x13, 0x1e, 0xa1, 0x00, 0x14, 0x58, 0x66, 0x00,
+  0x14, 0xfe, 0x83, 0x00, 0x16, 0x38, 0x48, 0x00, 0x17, 0x0c, 0x89, 0x80,
+  0x18, 0x21, 0x64, 0x80, 0x18, 0xc7, 0x81, 0x80, 0x1a, 0x01, 0x46, 0x80,
+  0x1a, 0xa7, 0x63, 0x80, 0x1b, 0xe1, 0x28, 0x80, 0x1c, 0x87, 0x45, 0x80,
+  0x1d, 0xc1, 0x0a, 0x80, 0x1e, 0x79, 0x9c, 0x80, 0x1f, 0x97, 0xb2, 0x00,
+  0x20, 0x59, 0x7e, 0x80, 0x21, 0x80, 0xce, 0x80, 0x22, 0x42, 0x9b, 0x00,
+  0x23, 0x69, 0xeb, 0x00, 0x24, 0x22, 0x7d, 0x00, 0x25, 0x49, 0xcd, 0x00,
+  0x25, 0xef, 0xea, 0x00, 0x27, 0x29, 0xaf, 0x00, 0x27, 0xcf, 0xcc, 0x00,
+  0x29, 0x09, 0x91, 0x00, 0x29, 0xaf, 0xae, 0x00, 0x2a, 0xe9, 0x73, 0x00,
+  0x2b, 0x98, 0xca, 0x80, 0x2c, 0xd2, 0x8f, 0x80, 0x2d, 0x78, 0xac, 0x80,
+  0x2e, 0xb2, 0x71, 0x80, 0x2f, 0x58, 0x8e, 0x80, 0x30, 0x92, 0x53, 0x80,
+  0x31, 0x5d, 0x5a, 0x80, 0x32, 0x72, 0x35, 0x80, 0x33, 0x3d, 0x3c, 0x80,
+  0x34, 0x52, 0x17, 0x80, 0x35, 0x1d, 0x1e, 0x80, 0x36, 0x31, 0xf9, 0x80,
+  0x36, 0xfd, 0x00, 0x80, 0x38, 0x1b, 0x16, 0x00, 0x38, 0xdc, 0xe2, 0x80,
+  0x39, 0xa7, 0xe9, 0x80, 0x3a, 0xbc, 0xc4, 0x80, 0x3b, 0xda, 0xda, 0x00,
+  0x3c, 0xa5, 0xe1, 0x00, 0x3d, 0xba, 0xbc, 0x00, 0x3e, 0x85, 0xc3, 0x00,
+  0x3f, 0x9a, 0x9e, 0x00, 0x40, 0x65, 0xa5, 0x00, 0x41, 0x83, 0xba, 0x80,
+  0x42, 0x45, 0x87, 0x00, 0x43, 0x63, 0x9c, 0x80, 0x44, 0x2e, 0xa3, 0x80,
+  0x45, 0x43, 0x7e, 0x80, 0x46, 0x05, 0x4b, 0x00, 0x47, 0x23, 0x60, 0x80,
+  0x47, 0xf7, 0xa2, 0x00, 0x48, 0xe7, 0x93, 0x00, 0x49, 0xd7, 0x84, 0x00,
+  0x4a, 0xc7, 0x75, 0x00, 0x4b, 0xb7, 0x66, 0x00, 0x4c, 0xa7, 0x57, 0x00,
+  0x4d, 0x97, 0x48, 0x00, 0x4e, 0x87, 0x39, 0x00, 0x4f, 0x77, 0x2a, 0x00,
+  0x50, 0x70, 0x55, 0x80, 0x51, 0x60, 0x46, 0x80, 0x52, 0x50, 0x37, 0x80,
+  0x53, 0x40, 0x28, 0x80, 0x54, 0x30, 0x19, 0x80, 0x55, 0x20, 0x0a, 0x80,
+  0x56, 0x0f, 0xfb, 0x80, 0x56, 0xff, 0xec, 0x80, 0x57, 0xef, 0xdd, 0x80,
+  0x58, 0xdf, 0xce, 0x80, 0x59, 0xcf, 0xbf, 0x80, 0x5a, 0xbf, 0xb0, 0x80,
+  0x5b, 0xb8, 0xdc, 0x00, 0x5c, 0xa8, 0xcd, 0x00, 0x5d, 0x98, 0xbe, 0x00,
+  0x5e, 0x88, 0xaf, 0x00, 0x5f, 0x78, 0xa0, 0x00, 0x60, 0x68, 0x91, 0x00,
+  0x61, 0x58, 0x82, 0x00, 0x62, 0x48, 0x73, 0x00, 0x63, 0x38, 0x64, 0x00,
+  0x64, 0x28, 0x55, 0x00, 0x65, 0x18, 0x46, 0x00, 0x66, 0x11, 0x71, 0x80,
+  0x67, 0x01, 0x62, 0x80, 0x67, 0xf1, 0x53, 0x80, 0x68, 0xe1, 0x44, 0x80,
+  0x69, 0xd1, 0x35, 0x80, 0x6a, 0xc1, 0x26, 0x80, 0x6b, 0xb1, 0x17, 0x80,
+  0x6c, 0xa1, 0x08, 0x80, 0x6d, 0x90, 0xf9, 0x80, 0x6e, 0x80, 0xea, 0x80,
+  0x6f, 0x70, 0xdb, 0x80, 0x70, 0x6a, 0x07, 0x00, 0x71, 0x59, 0xf8, 0x00,
+  0x72, 0x49, 0xe9, 0x00, 0x73, 0x39, 0xda, 0x00, 0x74, 0x29, 0xcb, 0x00,
+  0x75, 0x19, 0xbc, 0x00, 0x76, 0x09, 0xad, 0x00, 0x76, 0xf9, 0x9e, 0x00,
+  0x77, 0xe9, 0x8f, 0x00, 0x78, 0xd9, 0x80, 0x00, 0x79, 0xc9, 0x71, 0x00,
+  0x7a, 0xb9, 0x62, 0x00, 0x7b, 0xb2, 0x8d, 0x80, 0x7c, 0xa2, 0x7e, 0x80,
+  0x7d, 0x92, 0x6f, 0x80, 0x7e, 0x82, 0x60, 0x80, 0x7f, 0x72, 0x51, 0x80,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x00, 0x00,
+  0x8d, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x9a, 0xb0, 0x01, 0x04, 0x00, 0x00,
+  0x8c, 0xa0, 0x00, 0x09, 0x00, 0x00, 0x9a, 0xb0, 0x01, 0x04, 0x00, 0x00,
+  0x8c, 0xa0, 0x00, 0x09, 0x4c, 0x4d, 0x54, 0x00, 0x41, 0x45, 0x44, 0x54,
+  0x00, 0x41, 0x45, 0x53, 0x54, 0x00, 0x00, 0x00, 0x00, 0x01, 0x01, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8f, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x0e,
+  0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff,
+  0x73, 0x16, 0x7f, 0x3c, 0xff, 0xff, 0xff, 0xff, 0x9c, 0x4e, 0xa6, 0x9c,
+  0xff, 0xff, 0xff, 0xff, 0x9c, 0xbc, 0x20, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xcb, 0x54, 0xb3, 0x00, 0xff, 0xff, 0xff, 0xff, 0xcb, 0xc7, 0x57, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xcc, 0xb7, 0x56, 0x80, 0xff, 0xff, 0xff, 0xff,
+  0xcd, 0xa7, 0x39, 0x70, 0xff, 0xff, 0xff, 0xff, 0xce, 0xa0, 0x73, 0x00,
+  0xff, 0xff, 0xff, 0xff, 0xcf, 0x87, 0x1b, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x03, 0x70, 0x39, 0x80, 0x00, 0x00, 0x00, 0x00, 0x04, 0x0d, 0x1c, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x05, 0x50, 0x1b, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x05, 0xf6, 0x38, 0x80, 0x00, 0x00, 0x00, 0x00, 0x07, 0x2f, 0xfd, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x07, 0xd6, 0x1a, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x09, 0x0f, 0xdf, 0x80, 0x00, 0x00, 0x00, 0x00, 0x09, 0xb5, 0xfc, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x0a, 0xef, 0xc1, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x0b, 0x9f, 0x19, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0xd8, 0xde, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x0d, 0x7e, 0xfb, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x0e, 0xb8, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x5e, 0xdd, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x10, 0x98, 0xa2, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x11, 0x3e, 0xbf, 0x00, 0x00, 0x00, 0x00, 0x00, 0x12, 0x78, 0x84, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x13, 0x1e, 0xa1, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x14, 0x58, 0x66, 0x00, 0x00, 0x00, 0x00, 0x00, 0x14, 0xfe, 0x83, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x16, 0x38, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x17, 0x0c, 0x89, 0x80, 0x00, 0x00, 0x00, 0x00, 0x18, 0x21, 0x64, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x18, 0xc7, 0x81, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x1a, 0x01, 0x46, 0x80, 0x00, 0x00, 0x00, 0x00, 0x1a, 0xa7, 0x63, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x1b, 0xe1, 0x28, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x1c, 0x87, 0x45, 0x80, 0x00, 0x00, 0x00, 0x00, 0x1d, 0xc1, 0x0a, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x1e, 0x79, 0x9c, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x1f, 0x97, 0xb2, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x59, 0x7e, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x21, 0x80, 0xce, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x22, 0x42, 0x9b, 0x00, 0x00, 0x00, 0x00, 0x00, 0x23, 0x69, 0xeb, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x24, 0x22, 0x7d, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x25, 0x49, 0xcd, 0x00, 0x00, 0x00, 0x00, 0x00, 0x25, 0xef, 0xea, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x27, 0x29, 0xaf, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x27, 0xcf, 0xcc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x29, 0x09, 0x91, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x29, 0xaf, 0xae, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x2a, 0xe9, 0x73, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2b, 0x98, 0xca, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x2c, 0xd2, 0x8f, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x2d, 0x78, 0xac, 0x80, 0x00, 0x00, 0x00, 0x00, 0x2e, 0xb2, 0x71, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x2f, 0x58, 0x8e, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x30, 0x92, 0x53, 0x80, 0x00, 0x00, 0x00, 0x00, 0x31, 0x5d, 0x5a, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x32, 0x72, 0x35, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x33, 0x3d, 0x3c, 0x80, 0x00, 0x00, 0x00, 0x00, 0x34, 0x52, 0x17, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x35, 0x1d, 0x1e, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x36, 0x31, 0xf9, 0x80, 0x00, 0x00, 0x00, 0x00, 0x36, 0xfd, 0x00, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x38, 0x1b, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x38, 0xdc, 0xe2, 0x80, 0x00, 0x00, 0x00, 0x00, 0x39, 0xa7, 0xe9, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x3a, 0xbc, 0xc4, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x3b, 0xda, 0xda, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c, 0xa5, 0xe1, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x3d, 0xba, 0xbc, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x3e, 0x85, 0xc3, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x9a, 0x9e, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x40, 0x65, 0xa5, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x41, 0x83, 0xba, 0x80, 0x00, 0x00, 0x00, 0x00, 0x42, 0x45, 0x87, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x43, 0x63, 0x9c, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x44, 0x2e, 0xa3, 0x80, 0x00, 0x00, 0x00, 0x00, 0x45, 0x43, 0x7e, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x46, 0x05, 0x4b, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x47, 0x23, 0x60, 0x80, 0x00, 0x00, 0x00, 0x00, 0x47, 0xf7, 0xa2, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x48, 0xe7, 0x93, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x49, 0xd7, 0x84, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4a, 0xc7, 0x75, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x4b, 0xb7, 0x66, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x4c, 0xa7, 0x57, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4d, 0x97, 0x48, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x4e, 0x87, 0x39, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x4f, 0x77, 0x2a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0x70, 0x55, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x51, 0x60, 0x46, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x52, 0x50, 0x37, 0x80, 0x00, 0x00, 0x00, 0x00, 0x53, 0x40, 0x28, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x54, 0x30, 0x19, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x55, 0x20, 0x0a, 0x80, 0x00, 0x00, 0x00, 0x00, 0x56, 0x0f, 0xfb, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x56, 0xff, 0xec, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x57, 0xef, 0xdd, 0x80, 0x00, 0x00, 0x00, 0x00, 0x58, 0xdf, 0xce, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x59, 0xcf, 0xbf, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x5a, 0xbf, 0xb0, 0x80, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xb8, 0xdc, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x5c, 0xa8, 0xcd, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x5d, 0x98, 0xbe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x5e, 0x88, 0xaf, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x5f, 0x78, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x60, 0x68, 0x91, 0x00, 0x00, 0x00, 0x00, 0x00, 0x61, 0x58, 0x82, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x62, 0x48, 0x73, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x63, 0x38, 0x64, 0x00, 0x00, 0x00, 0x00, 0x00, 0x64, 0x28, 0x55, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x65, 0x18, 0x46, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x66, 0x11, 0x71, 0x80, 0x00, 0x00, 0x00, 0x00, 0x67, 0x01, 0x62, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x67, 0xf1, 0x53, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x68, 0xe1, 0x44, 0x80, 0x00, 0x00, 0x00, 0x00, 0x69, 0xd1, 0x35, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x6a, 0xc1, 0x26, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x6b, 0xb1, 0x17, 0x80, 0x00, 0x00, 0x00, 0x00, 0x6c, 0xa1, 0x08, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x6d, 0x90, 0xf9, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x6e, 0x80, 0xea, 0x80, 0x00, 0x00, 0x00, 0x00, 0x6f, 0x70, 0xdb, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x70, 0x6a, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x71, 0x59, 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x72, 0x49, 0xe9, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x73, 0x39, 0xda, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x74, 0x29, 0xcb, 0x00, 0x00, 0x00, 0x00, 0x00, 0x75, 0x19, 0xbc, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x76, 0x09, 0xad, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x76, 0xf9, 0x9e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x77, 0xe9, 0x8f, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x78, 0xd9, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x79, 0xc9, 0x71, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7a, 0xb9, 0x62, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x7b, 0xb2, 0x8d, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x7c, 0xa2, 0x7e, 0x80, 0x00, 0x00, 0x00, 0x00, 0x7d, 0x92, 0x6f, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x7e, 0x82, 0x60, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x7f, 0x72, 0x51, 0x80, 0x00, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x00, 0x00, 0x8d, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x9a,
+  0xb0, 0x01, 0x04, 0x00, 0x00, 0x8c, 0xa0, 0x00, 0x09, 0x00, 0x00, 0x9a,
+  0xb0, 0x01, 0x04, 0x00, 0x00, 0x8c, 0xa0, 0x00, 0x09, 0x4c, 0x4d, 0x54,
+  0x00, 0x41, 0x45, 0x44, 0x54, 0x00, 0x41, 0x45, 0x53, 0x54, 0x00, 0x00,
+  0x00, 0x00, 0x01, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a, 0x41, 0x45,
+  0x53, 0x54, 0x2d, 0x31, 0x30, 0x41, 0x45, 0x44, 0x54, 0x2c, 0x4d, 0x31,
+  0x30, 0x2e, 0x31, 0x2e, 0x30, 0x2c, 0x4d, 0x34, 0x2e, 0x31, 0x2e, 0x30,
+  0x2f, 0x33, 0x0a
+};
+unsigned int Australia_Sydney_len = 2223;