Removed Common
Change-Id: I01ea8f07220375c2ad9bc0092281d4f27c642303
diff --git a/aos/logging/implementations.cc b/aos/logging/implementations.cc
new file mode 100644
index 0000000..337aa8f
--- /dev/null
+++ b/aos/logging/implementations.cc
@@ -0,0 +1,437 @@
+#include "aos/logging/implementations.h"
+
+#include <stdarg.h>
+#include <inttypes.h>
+
+#include <algorithm>
+#include <chrono>
+
+#include "aos/die.h"
+#include "aos/logging/printf_formats.h"
+#include "aos/queue_types.h"
+#include "aos/time/time.h"
+#include "aos/linux_code/ipc_lib/queue.h"
+#include "aos/once.h"
+
+namespace aos {
+namespace logging {
+namespace {
+
+namespace chrono = ::std::chrono;
+
+// The root LogImplementation. It only logs to stderr/stdout.
+// Some of the things specified in the LogImplementation documentation doesn't
+// apply here (mostly the parts about being able to use LOG) because this is the
+// root one.
+class RootLogImplementation : public SimpleLogImplementation {
+ public:
+ void have_other_implementation() { only_implementation_ = false; }
+
+ private:
+ void set_next(LogImplementation *) override {
+ LOG(FATAL, "can't have a next logger from here\n");
+ }
+
+ __attribute__((format(GOOD_PRINTF_FORMAT_TYPE, 3, 0)))
+ void DoLog(log_level level, const char *format, va_list ap) override {
+ LogMessage message;
+ internal::FillInMessage(level, format, ap, &message);
+ internal::PrintMessage(stderr, message);
+ if (!only_implementation_) {
+ fputs("root logger got used, see stderr for message\n", stdout);
+ }
+ }
+
+ bool only_implementation_ = true;
+};
+
+RootLogImplementation *root_implementation = nullptr;
+
+void SetGlobalImplementation(LogImplementation *implementation) {
+ if (root_implementation == nullptr) {
+ fputs("Somebody didn't call logging::Init()!\n", stderr);
+ abort();
+ }
+
+ internal::Context *context = internal::Context::Get();
+
+ context->implementation = implementation;
+ internal::global_top_implementation.store(implementation);
+}
+
+void NewContext() {
+ internal::Context::Delete();
+}
+
+void *DoInit() {
+ SetGlobalImplementation(root_implementation = new RootLogImplementation());
+
+ if (pthread_atfork(NULL /*prepare*/, NULL /*parent*/,
+ NewContext /*child*/) != 0) {
+ LOG(FATAL, "pthread_atfork(NULL, NULL, %p) failed\n",
+ NewContext);
+ }
+
+ return NULL;
+}
+
+} // namespace
+namespace internal {
+namespace {
+
+void FillInMessageBase(log_level level, LogMessage *message) {
+ Context *context = Context::Get();
+
+ message->level = level;
+ message->source = context->source;
+ memcpy(message->name, context->name, context->name_size);
+ message->name_length = context->name_size;
+
+ monotonic_clock::time_point monotonic_now = monotonic_clock::now();
+ message->seconds =
+ chrono::duration_cast<chrono::seconds>(monotonic_now.time_since_epoch())
+ .count();
+ message->nseconds =
+ chrono::duration_cast<chrono::nanoseconds>(
+ monotonic_now.time_since_epoch() - chrono::seconds(message->seconds))
+ .count();
+
+ message->sequence = context->sequence++;
+}
+
+} // namespace
+
+void FillInMessageStructure(log_level level,
+ const ::std::string &message_string, size_t size,
+ const MessageType *type,
+ const ::std::function<size_t(char *)> &serialize,
+ LogMessage *message) {
+ type_cache::AddShm(type->id);
+ message->structure.type_id = type->id;
+
+ FillInMessageBase(level, message);
+
+ if (message_string.size() + size > sizeof(message->structure.serialized)) {
+ LOG(FATAL, "serialized struct %s (size %zd) and message %s too big\n",
+ type->name.c_str(), size, message_string.c_str());
+ }
+ message->structure.string_length = message_string.size();
+ memcpy(message->structure.serialized, message_string.data(),
+ message->structure.string_length);
+
+ message->message_length = serialize(
+ &message->structure.serialized[message->structure.string_length]);
+ message->type = LogMessage::Type::kStruct;
+}
+
+void FillInMessageMatrix(log_level level,
+ const ::std::string &message_string, uint32_t type_id,
+ int rows, int cols, const void *data,
+ LogMessage *message) {
+ CHECK(MessageType::IsPrimitive(type_id));
+ message->matrix.type = type_id;
+
+ const auto element_size = MessageType::Sizeof(type_id);
+
+ FillInMessageBase(level, message);
+
+ message->message_length = rows * cols * element_size;
+ if (message_string.size() + message->message_length >
+ sizeof(message->matrix.data)) {
+ LOG(FATAL, "%dx%d matrix of type %" PRIu32
+ " (size %u) and message %s is too big\n",
+ rows, cols, type_id, element_size, message_string.c_str());
+ }
+ message->matrix.string_length = message_string.size();
+ memcpy(message->matrix.data, message_string.data(),
+ message->matrix.string_length);
+
+ message->matrix.rows = rows;
+ message->matrix.cols = cols;
+ SerializeMatrix(type_id, &message->matrix.data[message->matrix.string_length],
+ data, rows, cols);
+ message->type = LogMessage::Type::kMatrix;
+}
+
+void FillInMessage(log_level level, const char *format, va_list ap,
+ LogMessage *message) {
+ FillInMessageBase(level, message);
+
+ message->message_length =
+ ExecuteFormat(message->message, sizeof(message->message), format, ap);
+ message->type = LogMessage::Type::kString;
+}
+
+void PrintMessage(FILE *output, const LogMessage &message) {
+#define BASE_ARGS \
+ AOS_LOGGING_BASE_ARGS( \
+ message.name_length, message.name, static_cast<int32_t>(message.source), \
+ message.sequence, message.level, message.seconds, message.nseconds)
+ switch (message.type) {
+ case LogMessage::Type::kString:
+ fprintf(output, AOS_LOGGING_BASE_FORMAT "%.*s", BASE_ARGS,
+ static_cast<int>(message.message_length), message.message);
+ break;
+ case LogMessage::Type::kStruct: {
+ char buffer[4096];
+ size_t output_length = sizeof(buffer);
+ size_t input_length = message.message_length;
+ if (!PrintMessage(
+ buffer, &output_length,
+ message.structure.serialized + message.structure.string_length,
+ &input_length, type_cache::Get(message.structure.type_id))) {
+ LOG(FATAL,
+ "printing message (%.*s) of type %s into %zu-byte buffer failed\n",
+ static_cast<int>(message.message_length), message.message,
+ type_cache::Get(message.structure.type_id).name.c_str(),
+ sizeof(buffer));
+ }
+ if (input_length > 0) {
+ LOG(WARNING, "%zu extra bytes on message of type %s\n", input_length,
+ type_cache::Get(message.structure.type_id).name.c_str());
+ }
+ fprintf(output, AOS_LOGGING_BASE_FORMAT "%.*s: %.*s\n", BASE_ARGS,
+ static_cast<int>(message.structure.string_length),
+ message.structure.serialized,
+ static_cast<int>(sizeof(buffer) - output_length), buffer);
+ } break;
+ case LogMessage::Type::kMatrix: {
+ char buffer[1024];
+ size_t output_length = sizeof(buffer);
+ if (message.message_length !=
+ static_cast<size_t>(message.matrix.rows * message.matrix.cols *
+ MessageType::Sizeof(message.matrix.type))) {
+ LOG(FATAL, "expected %d bytes of matrix data but have %zu\n",
+ message.matrix.rows * message.matrix.cols *
+ MessageType::Sizeof(message.matrix.type),
+ message.message_length);
+ }
+ if (!PrintMatrix(buffer, &output_length,
+ message.matrix.data + message.matrix.string_length,
+ message.matrix.type, message.matrix.rows,
+ message.matrix.cols)) {
+ LOG(FATAL, "printing %dx%d matrix of type %" PRIu32 " failed\n",
+ message.matrix.rows, message.matrix.cols, message.matrix.type);
+ }
+ fprintf(output, AOS_LOGGING_BASE_FORMAT "%.*s: %.*s\n", BASE_ARGS,
+ static_cast<int>(message.matrix.string_length),
+ message.matrix.data,
+ static_cast<int>(sizeof(buffer) - output_length), buffer);
+ } break;
+ }
+#undef BASE_ARGS
+}
+
+} // namespace internal
+
+void SimpleLogImplementation::LogStruct(
+ log_level level, const ::std::string &message, size_t size,
+ const MessageType *type, const ::std::function<size_t(char *)> &serialize) {
+ char serialized[1024];
+ if (size > sizeof(serialized)) {
+ LOG(FATAL, "structure of type %s too big to serialize\n",
+ type->name.c_str());
+ }
+ size_t used = serialize(serialized);
+ char printed[1024];
+ size_t printed_bytes = sizeof(printed);
+ if (!PrintMessage(printed, &printed_bytes, serialized, &used, *type)) {
+ LOG(FATAL, "PrintMessage(%p, %p(=%zd), %p, %p(=%zd), %p(name=%s)) failed\n",
+ printed, &printed_bytes, printed_bytes, serialized, &used, used, type,
+ type->name.c_str());
+ }
+ DoLogVariadic(level, "%.*s: %.*s\n", static_cast<int>(message.size()),
+ message.data(),
+ static_cast<int>(sizeof(printed) - printed_bytes), printed);
+}
+
+void SimpleLogImplementation::LogMatrix(
+ log_level level, const ::std::string &message, uint32_t type_id,
+ int rows, int cols, const void *data) {
+ char serialized[1024];
+ if (static_cast<size_t>(rows * cols * MessageType::Sizeof(type_id)) >
+ sizeof(serialized)) {
+ LOG(FATAL, "matrix of size %u too big to serialize\n",
+ rows * cols * MessageType::Sizeof(type_id));
+ }
+ SerializeMatrix(type_id, serialized, data, rows, cols);
+ char printed[1024];
+ size_t printed_bytes = sizeof(printed);
+ if (!PrintMatrix(printed, &printed_bytes, serialized, type_id, rows, cols)) {
+ LOG(FATAL, "PrintMatrix(%p, %p(=%zd), %p, %" PRIu32 ", %d, %d) failed\n",
+ printed, &printed_bytes, printed_bytes, serialized, type_id, rows,
+ cols);
+ }
+ DoLogVariadic(level, "%.*s: %.*s\n", static_cast<int>(message.size()),
+ message.data(),
+ static_cast<int>(sizeof(printed) - printed_bytes), printed);
+}
+
+void HandleMessageLogImplementation::DoLog(log_level level, const char *format,
+ va_list ap) {
+ LogMessage message;
+ internal::FillInMessage(level, format, ap, &message);
+ HandleMessage(message);
+}
+
+void HandleMessageLogImplementation::LogStruct(
+ log_level level, const ::std::string &message_string, size_t size,
+ const MessageType *type, const ::std::function<size_t(char *)> &serialize) {
+ LogMessage message;
+ internal::FillInMessageStructure(level, message_string, size, type, serialize,
+ &message);
+ HandleMessage(message);
+}
+
+void HandleMessageLogImplementation::LogMatrix(
+ log_level level, const ::std::string &message_string, uint32_t type_id,
+ int rows, int cols, const void *data) {
+ LogMessage message;
+ internal::FillInMessageMatrix(level, message_string, type_id, rows, cols,
+ data, &message);
+ HandleMessage(message);
+}
+
+StreamLogImplementation::StreamLogImplementation(FILE *stream)
+ : stream_(stream) {}
+
+void StreamLogImplementation::HandleMessage(const LogMessage &message) {
+ internal::PrintMessage(stream_, message);
+}
+
+void AddImplementation(LogImplementation *implementation) {
+ internal::Context *context = internal::Context::Get();
+
+ if (implementation->next() != NULL) {
+ LOG(FATAL, "%p already has a next implementation, but it's not"
+ " being used yet\n", implementation);
+ }
+
+ LogImplementation *old = context->implementation;
+ if (old != NULL) {
+ implementation->set_next(old);
+ }
+ SetGlobalImplementation(implementation);
+ root_implementation->have_other_implementation();
+}
+
+void Init() {
+ static Once<void> once(DoInit);
+ once.Get();
+}
+
+void Load() {
+ internal::Context::Get();
+}
+
+void Cleanup() {
+ internal::Context::Delete();
+}
+
+namespace {
+
+RawQueue *queue = NULL;
+
+int dropped_messages = 0;
+monotonic_clock::time_point dropped_start, backoff_start;
+// Wait this long after dropping a message before even trying to write any more.
+constexpr chrono::milliseconds kDropBackoff = chrono::milliseconds(100);
+
+LogMessage *GetMessageOrDie() {
+ LogMessage *message = static_cast<LogMessage *>(queue->GetMessage());
+ if (message == NULL) {
+ LOG(FATAL, "%p->GetMessage() failed\n", queue);
+ } else {
+ return message;
+ }
+}
+
+void Write(LogMessage *msg) {
+ if (__builtin_expect(dropped_messages > 0, false)) {
+ monotonic_clock::time_point message_time(
+ chrono::seconds(msg->seconds) + chrono::nanoseconds(msg->nseconds));
+ if (message_time - backoff_start < kDropBackoff) {
+ ++dropped_messages;
+ queue->FreeMessage(msg);
+ return;
+ }
+
+ LogMessage *dropped_message = GetMessageOrDie();
+ chrono::seconds dropped_start_sec = chrono::duration_cast<chrono::seconds>(
+ dropped_start.time_since_epoch());
+ chrono::nanoseconds dropped_start_nsec =
+ chrono::duration_cast<chrono::nanoseconds>(
+ dropped_start.time_since_epoch() - dropped_start_sec);
+ internal::FillInMessageVarargs(
+ ERROR, dropped_message,
+ "%d logs starting at %" PRId32 ".%" PRId32 " dropped\n",
+ dropped_messages, static_cast<int32_t>(dropped_start_sec.count()),
+ static_cast<int32_t>(dropped_start_nsec.count()));
+ if (queue->WriteMessage(dropped_message, RawQueue::kNonBlock)) {
+ dropped_messages = 0;
+ } else {
+ // Don't even bother trying to write this message because it's not likely
+ // to work and it would be confusing to have one log in the middle of a
+ // string of failures get through.
+ ++dropped_messages;
+ backoff_start = message_time;
+ queue->FreeMessage(msg);
+ return;
+ }
+ }
+ if (!queue->WriteMessage(msg, RawQueue::kNonBlock)) {
+ if (dropped_messages == 0) {
+ monotonic_clock::time_point message_time(
+ chrono::seconds(msg->seconds) + chrono::nanoseconds(msg->nseconds));
+ dropped_start = backoff_start = message_time;
+ }
+ ++dropped_messages;
+ }
+}
+
+class LinuxQueueLogImplementation : public LogImplementation {
+ __attribute__((format(GOOD_PRINTF_FORMAT_TYPE, 3, 0)))
+ void DoLog(log_level level, const char *format, va_list ap) override {
+ LogMessage *message = GetMessageOrDie();
+ internal::FillInMessage(level, format, ap, message);
+ Write(message);
+ }
+
+ void LogStruct(log_level level, const ::std::string &message_string,
+ size_t size, const MessageType *type,
+ const ::std::function<size_t(char *)> &serialize) override {
+ LogMessage *message = GetMessageOrDie();
+ internal::FillInMessageStructure(level, message_string, size, type,
+ serialize, message);
+ Write(message);
+ }
+
+ void LogMatrix(log_level level, const ::std::string &message_string,
+ uint32_t type_id, int rows, int cols,
+ const void *data) override {
+ LogMessage *message = GetMessageOrDie();
+ internal::FillInMessageMatrix(level, message_string, type_id, rows, cols,
+ data, message);
+ Write(message);
+ }
+};
+
+} // namespace
+
+RawQueue *GetLoggingQueue() {
+ return RawQueue::Fetch("LoggingQueue", sizeof(LogMessage), 1323, 40000);
+}
+
+void RegisterQueueImplementation() {
+ Init();
+
+ queue = GetLoggingQueue();
+ if (queue == NULL) {
+ Die("logging: couldn't fetch queue\n");
+ }
+
+ AddImplementation(new LinuxQueueLogImplementation());
+}
+
+} // namespace logging
+} // namespace aos